DE2222275C3 - - Google Patents
Info
- Publication number
- DE2222275C3 DE2222275C3 DE2222275A DE2222275A DE2222275C3 DE 2222275 C3 DE2222275 C3 DE 2222275C3 DE 2222275 A DE2222275 A DE 2222275A DE 2222275 A DE2222275 A DE 2222275A DE 2222275 C3 DE2222275 C3 DE 2222275C3
- Authority
- DE
- Germany
- Prior art keywords
- oxide
- metal
- welding
- fluoride
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052783 alkali metal Inorganic materials 0.000 claims description 91
- 150000001340 alkali metals Chemical class 0.000 claims description 91
- 238000003466 welding Methods 0.000 claims description 70
- 239000000203 mixture Substances 0.000 claims description 53
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 52
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 52
- 229910052751 metal Inorganic materials 0.000 claims description 47
- 239000002184 metal Substances 0.000 claims description 47
- 239000000126 substance Substances 0.000 claims description 41
- 229910052744 lithium Inorganic materials 0.000 claims description 39
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 36
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 32
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 29
- 239000003795 chemical substances by application Substances 0.000 claims description 29
- 229910052782 aluminium Inorganic materials 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 26
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 23
- 239000000377 silicon dioxide Substances 0.000 claims description 23
- 229910000831 Steel Inorganic materials 0.000 claims description 21
- 239000010959 steel Substances 0.000 claims description 21
- 239000003638 chemical reducing agent Substances 0.000 claims description 20
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 19
- 239000002893 slag Substances 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 16
- 239000011734 sodium Substances 0.000 claims description 16
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 14
- 239000003513 alkali Substances 0.000 claims description 14
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 14
- 239000000292 calcium oxide Substances 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 14
- 235000012239 silicon dioxide Nutrition 0.000 claims description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 13
- 229910052749 magnesium Inorganic materials 0.000 claims description 13
- 239000011777 magnesium Substances 0.000 claims description 13
- 229910052710 silicon Inorganic materials 0.000 claims description 13
- 239000010703 silicon Substances 0.000 claims description 13
- 229910052708 sodium Inorganic materials 0.000 claims description 13
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 12
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 12
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 12
- 230000002378 acidificating effect Effects 0.000 claims description 12
- -1 aluminum magnesium Calcium fluoride Barium fluoride Sodium fluoride Chemical compound 0.000 claims description 11
- OYLGJCQECKOTOL-UHFFFAOYSA-L barium fluoride Chemical compound [F-].[F-].[Ba+2] OYLGJCQECKOTOL-UHFFFAOYSA-L 0.000 claims description 11
- 229910001632 barium fluoride Inorganic materials 0.000 claims description 11
- 239000011575 calcium Substances 0.000 claims description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 10
- 229910052791 calcium Inorganic materials 0.000 claims description 10
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 claims description 10
- 229910044991 metal oxide Inorganic materials 0.000 claims description 10
- 150000004706 metal oxides Chemical class 0.000 claims description 10
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 238000009835 boiling Methods 0.000 claims description 9
- 229910001634 calcium fluoride Inorganic materials 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 229910001947 lithium oxide Inorganic materials 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 8
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 7
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 7
- 229910045601 alloy Inorganic materials 0.000 claims description 7
- 239000000956 alloy Substances 0.000 claims description 7
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 claims description 7
- 229910052700 potassium Inorganic materials 0.000 claims description 7
- 239000011591 potassium Substances 0.000 claims description 7
- NDYAVOWOABRNON-UHFFFAOYSA-N [Si](F)(F)(F)F.[K] Chemical compound [Si](F)(F)(F)F.[K] NDYAVOWOABRNON-UHFFFAOYSA-N 0.000 claims description 6
- 238000005275 alloying Methods 0.000 claims description 6
- 239000000470 constituent Substances 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 6
- 239000007789 gas Substances 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 6
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 claims description 6
- FUJCRWPEOMXPAD-UHFFFAOYSA-N lithium oxide Chemical compound [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 claims description 6
- 230000001603 reducing effect Effects 0.000 claims description 6
- 230000009467 reduction Effects 0.000 claims description 6
- 239000010936 titanium Substances 0.000 claims description 6
- 229910052719 titanium Inorganic materials 0.000 claims description 6
- 229910018072 Al 2 O 3 Inorganic materials 0.000 claims description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 5
- 239000001569 carbon dioxide Substances 0.000 claims description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 5
- 239000011521 glass Substances 0.000 claims description 5
- 229910052742 iron Inorganic materials 0.000 claims description 5
- 239000000395 magnesium oxide Substances 0.000 claims description 5
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052759 nickel Inorganic materials 0.000 claims description 5
- 230000001681 protective effect Effects 0.000 claims description 5
- 239000011775 sodium fluoride Substances 0.000 claims description 5
- 235000013024 sodium fluoride Nutrition 0.000 claims description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 238000005253 cladding Methods 0.000 claims description 4
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 claims description 4
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- 229910000480 nickel oxide Inorganic materials 0.000 claims description 4
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 claims description 4
- 229910010413 TiO 2 Inorganic materials 0.000 claims description 3
- 229910001618 alkaline earth metal fluoride Inorganic materials 0.000 claims description 3
- 229910000428 cobalt oxide Inorganic materials 0.000 claims description 3
- 229910000765 intermetallic Inorganic materials 0.000 claims description 3
- 150000004767 nitrides Chemical class 0.000 claims description 3
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical compound [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 claims description 3
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 239000000155 melt Substances 0.000 claims description 2
- 229910001948 sodium oxide Inorganic materials 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 2
- 238000009736 wetting Methods 0.000 claims description 2
- 229910052845 zircon Inorganic materials 0.000 claims description 2
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims description 2
- 229910001512 metal fluoride Inorganic materials 0.000 claims 3
- 238000001816 cooling Methods 0.000 claims 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 claims 1
- 241000212342 Sium Species 0.000 claims 1
- 235000011941 Tilia x europaea Nutrition 0.000 claims 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims 1
- QFGIVKNKFPCKAW-UHFFFAOYSA-N [Mn].[C] Chemical compound [Mn].[C] QFGIVKNKFPCKAW-UHFFFAOYSA-N 0.000 claims 1
- SVFOMDDAWOLOME-UHFFFAOYSA-N [N].[Mg] Chemical compound [N].[Mg] SVFOMDDAWOLOME-UHFFFAOYSA-N 0.000 claims 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims 1
- 229910052787 antimony Inorganic materials 0.000 claims 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims 1
- 229910052785 arsenic Inorganic materials 0.000 claims 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims 1
- RBVYPNHAAJQXIW-UHFFFAOYSA-N azanylidynemanganese Chemical compound [N].[Mn] RBVYPNHAAJQXIW-UHFFFAOYSA-N 0.000 claims 1
- 229910052788 barium Inorganic materials 0.000 claims 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims 1
- 239000011230 binding agent Substances 0.000 claims 1
- 229910052797 bismuth Inorganic materials 0.000 claims 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims 1
- 229910052793 cadmium Inorganic materials 0.000 claims 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims 1
- 229910002091 carbon monoxide Inorganic materials 0.000 claims 1
- 230000001364 causal effect Effects 0.000 claims 1
- 239000011248 coating agent Substances 0.000 claims 1
- 238000000576 coating method Methods 0.000 claims 1
- 238000010891 electric arc Methods 0.000 claims 1
- 239000010433 feldspar Substances 0.000 claims 1
- 239000004571 lime Substances 0.000 claims 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 229910052814 silicon oxide Inorganic materials 0.000 claims 1
- 210000004243 sweat Anatomy 0.000 claims 1
- 229910052726 zirconium Inorganic materials 0.000 claims 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 14
- 239000011572 manganese Substances 0.000 description 12
- 150000001339 alkali metal compounds Chemical class 0.000 description 11
- 235000013980 iron oxide Nutrition 0.000 description 11
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 9
- 238000010521 absorption reaction Methods 0.000 description 9
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 8
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 8
- 229910052748 manganese Inorganic materials 0.000 description 8
- 230000004888 barrier function Effects 0.000 description 7
- 229910000019 calcium carbonate Inorganic materials 0.000 description 7
- 229910004298 SiO 2 Inorganic materials 0.000 description 6
- 229910052808 lithium carbonate Inorganic materials 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 150000002736 metal compounds Chemical class 0.000 description 6
- XUCJHNOBJLKZNU-UHFFFAOYSA-M dilithium;hydroxide Chemical compound [Li+].[Li+].[OH-] XUCJHNOBJLKZNU-UHFFFAOYSA-M 0.000 description 5
- 239000012530 fluid Substances 0.000 description 5
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 4
- 150000002642 lithium compounds Chemical class 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 150000004760 silicates Chemical class 0.000 description 4
- KMNWCNNLFBCDJR-UHFFFAOYSA-N [Si].[K] Chemical compound [Si].[K] KMNWCNNLFBCDJR-UHFFFAOYSA-N 0.000 description 3
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 3
- QHGJSLXSVXVKHZ-UHFFFAOYSA-N dilithium;dioxido(dioxo)manganese Chemical group [Li+].[Li+].[O-][Mn]([O-])(=O)=O QHGJSLXSVXVKHZ-UHFFFAOYSA-N 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 229910001388 sodium aluminate Inorganic materials 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 229910016036 BaF 2 Inorganic materials 0.000 description 2
- 229910018068 Li 2 O Inorganic materials 0.000 description 2
- 229910010586 LiFeO 2 Inorganic materials 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 229910052792 caesium Inorganic materials 0.000 description 2
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000007772 electrode material Substances 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- ABTOQLMXBSRXSM-UHFFFAOYSA-N silicon tetrafluoride Chemical compound F[Si](F)(F)F ABTOQLMXBSRXSM-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 1
- IRPGOXJVTQTAAN-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanal Chemical compound FC(F)(F)C(F)(F)C=O IRPGOXJVTQTAAN-UHFFFAOYSA-N 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminum fluoride Inorganic materials F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 1
- 229910001339 C alloy Inorganic materials 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 229910000733 Li alloy Inorganic materials 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- 241001676573 Minium Species 0.000 description 1
- 229910000914 Mn alloy Inorganic materials 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- VEUACKUBDLVUAC-UHFFFAOYSA-N [Na].[Ca] Chemical compound [Na].[Ca] VEUACKUBDLVUAC-UHFFFAOYSA-N 0.000 description 1
- JCCZVLHHCNQSNM-UHFFFAOYSA-N [Na][Si] Chemical compound [Na][Si] JCCZVLHHCNQSNM-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000012754 barrier agent Substances 0.000 description 1
- 239000010953 base metal Substances 0.000 description 1
- 229910052728 basic metal Inorganic materials 0.000 description 1
- 150000003818 basic metals Chemical class 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- USOPFYZPGZGBEB-UHFFFAOYSA-N calcium lithium Chemical compound [Li].[Ca] USOPFYZPGZGBEB-UHFFFAOYSA-N 0.000 description 1
- AKDOPXIRDUMXGP-UHFFFAOYSA-K calcium lithium trifluoride Chemical compound [Li]F.F[Ca]F AKDOPXIRDUMXGP-UHFFFAOYSA-K 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000005308 flint glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000001989 lithium alloy Substances 0.000 description 1
- YQNQTEBHHUSESQ-UHFFFAOYSA-N lithium aluminate Chemical compound [Li+].[O-][Al]=O YQNQTEBHHUSESQ-UHFFFAOYSA-N 0.000 description 1
- VVNXEADCOVSAER-UHFFFAOYSA-N lithium sodium Chemical compound [Li].[Na] VVNXEADCOVSAER-UHFFFAOYSA-N 0.000 description 1
- 238000010309 melting process Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B23—MACHINE TOOLS; METAL-WORKING NOT OTHERWISE PROVIDED FOR
- B23K—SOLDERING OR UNSOLDERING; WELDING; CLADDING OR PLATING BY SOLDERING OR WELDING; CUTTING BY APPLYING HEAT LOCALLY, e.g. FLAME CUTTING; WORKING BY LASER BEAM
- B23K35/00—Rods, electrodes, materials, or media, for use in soldering, welding, or cutting
- B23K35/22—Rods, electrodes, materials, or media, for use in soldering, welding, or cutting characterised by the composition or nature of the material
- B23K35/36—Selection of non-metallic compositions, e.g. coatings, fluxes; Selection of soldering or welding materials, conjoint with selection of non-metallic compositions, both selections being of interest
- B23K35/3601—Selection of non-metallic compositions, e.g. coatings, fluxes; Selection of soldering or welding materials, conjoint with selection of non-metallic compositions, both selections being of interest with inorganic compounds as principal constituents
- B23K35/3602—Carbonates, basic oxides or hydroxides
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Nonmetallic Welding Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14137671A | 1971-05-07 | 1971-05-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2222275A1 DE2222275A1 (de) | 1972-11-23 |
| DE2222275B2 DE2222275B2 (de) | 1976-01-08 |
| DE2222275C3 true DE2222275C3 (enExample) | 1981-02-26 |
Family
ID=22495425
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2222275A Granted DE2222275B2 (de) | 1971-05-07 | 1972-05-06 | Schweißelektrode zum Lichtbogenschweißen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3767891A (enExample) |
| JP (1) | JPS6225479B1 (enExample) |
| BR (1) | BR7202829D0 (enExample) |
| CA (1) | CA989282A (enExample) |
| DE (1) | DE2222275B2 (enExample) |
| FR (1) | FR2139865B1 (enExample) |
| GB (1) | GB1396892A (enExample) |
| IT (1) | IT958580B (enExample) |
| NL (1) | NL7206154A (enExample) |
| SE (1) | SE407670C (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3911244A (en) * | 1969-09-13 | 1975-10-07 | Ishikawajima Harima Heavy Ind | Electrode composition and welding method for arc welding steel |
| US3742185A (en) * | 1971-05-07 | 1973-06-26 | Lincoln Electric Co | Lithium containing welding electrode |
| NL7317784A (enExample) * | 1972-12-29 | 1974-07-02 | ||
| BE816414A (fr) * | 1974-06-17 | 1974-10-16 | Fil fourre pour le soudage a l'arc electrique d'aciers doux ou faiblement allies. | |
| US4186293A (en) * | 1978-05-08 | 1980-01-29 | The Lincoln Electric Company | Cored type welding electrode |
| JPS5942198A (ja) * | 1982-08-31 | 1984-03-08 | Kobe Steel Ltd | セルフシ−ルドア−ク溶接用フラツクス入りワイヤ |
| US4551610A (en) * | 1983-05-17 | 1985-11-05 | The Lincoln Electric Company | Tubular welding electrode |
| US4571480A (en) * | 1984-02-27 | 1986-02-18 | Kabushiki Kaisha Kobe Seiko Sho | Flux cored wire electrodes for self-shielded arc welding |
| DE3517015A1 (de) * | 1985-05-11 | 1986-11-13 | Fried. Krupp Gmbh, 4300 Essen | Verfahren zum lichtbogenschweissen von stickstofflegierten staehlen |
| JPH0667558B2 (ja) * | 1987-08-18 | 1994-08-31 | 株式会社神戸製鋼所 | フラックス入りワイヤ用リチウム系原料 |
| JPS6487100A (en) * | 1987-09-29 | 1989-03-31 | Kobe Steel Ltd | Flux cored wire for self-shielded arc welding |
| US4833296A (en) * | 1987-12-29 | 1989-05-23 | The Lincoln Electric Company | Consumable welding electrode and method of using same |
| US5147579A (en) * | 1989-07-17 | 1992-09-15 | Tam Ceramics, Inc. | Moisture resistant sodium titanate and potassium titanate |
| US9333580B2 (en) * | 2004-04-29 | 2016-05-10 | Lincoln Global, Inc. | Gas-less process and system for girth welding in high strength applications |
| US7842903B2 (en) * | 2005-10-31 | 2010-11-30 | Lincoln Global, Inc. | Short arc welding system |
| US8759715B2 (en) | 2004-10-06 | 2014-06-24 | Lincoln Global, Inc. | Method of AC welding with cored electrode |
| US8704135B2 (en) * | 2006-01-20 | 2014-04-22 | Lincoln Global, Inc. | Synergistic welding system |
| US20060096966A1 (en) * | 2004-11-08 | 2006-05-11 | Lincoln Global, Inc. | Self-shielded flux cored electrode for fracture critical applications |
| US7812284B2 (en) * | 2005-07-12 | 2010-10-12 | Lincoln Global, Inc. | Barium and lithium ratio for flux cored electrode |
| US20070051702A1 (en) * | 2005-09-08 | 2007-03-08 | Lincoln Global, Inc., A Delaware Corporation | Flux system to reduce copper cracking |
| US8153934B2 (en) * | 2006-09-15 | 2012-04-10 | Lincoln Global, Inc. | Saw flux system for improved as-cast weld metal toughness |
| US9138831B2 (en) * | 2008-06-27 | 2015-09-22 | Lincoln Global, Inc. | Addition of rare earth elements to improve the performance of self shielded electrodes |
| US20100102049A1 (en) * | 2008-10-24 | 2010-04-29 | Keegan James M | Electrodes having lithium aluminum alloy and methods |
| US8450649B2 (en) * | 2008-11-07 | 2013-05-28 | Lincoln Global, Inc. | Addition of lithium aluminate to improve the performance of self shielded electrodes |
| US8330078B2 (en) * | 2009-06-05 | 2012-12-11 | Lincoln Global, Inc. | Electrodes incorporating aluminum coated particles and methods thereof |
| US10898966B2 (en) | 2012-05-24 | 2021-01-26 | Hobart Brothers Llc | Systems and methods for low-manganese welding wire |
| US10906135B2 (en) | 2012-05-24 | 2021-02-02 | Hobart Brothers Llc | Systems and methods for low-manganese welding wire |
| US9527152B2 (en) * | 2012-07-30 | 2016-12-27 | Illinois Tool Works Inc. | Root pass welding solution |
| US10421160B2 (en) | 2013-03-11 | 2019-09-24 | The Esab Group, Inc. | Alloying composition for self-shielded FCAW wires with low diffusible hydrogen and high Charpy V-notch impact toughness |
| US9895774B2 (en) | 2013-05-08 | 2018-02-20 | Hobart Brothers Company | Systems and methods for low-manganese welding alloys |
| US9844838B2 (en) | 2013-05-08 | 2017-12-19 | Hobart Brothers Company | Systems and methods for low-manganese welding alloys |
| KR101658804B1 (ko) | 2014-12-23 | 2016-09-26 | 현대종합금속 주식회사 | 셀프 실드 아크 용접용 플럭스 코어드 와이어 |
| US11285559B2 (en) | 2015-11-30 | 2022-03-29 | Illinois Tool Works Inc. | Welding system and method for shielded welding wires |
| US10722986B2 (en) | 2015-12-11 | 2020-07-28 | Hobart Brothers Llc | Systems and methods for low-manganese welding wire |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2909778A (en) * | 1956-06-29 | 1959-10-20 | Lincoln Electric Co | Method and means for bare electrode welding |
| US3177340A (en) * | 1961-11-24 | 1965-04-06 | Soudure Electr Autogene Sa | Flux-cored electrode and process of welding |
| US3162751A (en) * | 1962-09-24 | 1964-12-22 | Robbins Lawrence | Welding electrode |
| US3461270A (en) * | 1966-01-06 | 1969-08-12 | Lincoln Electric Co | Tubular welding electrode |
| US3466417A (en) * | 1966-06-10 | 1969-09-09 | Murex Welding Processes Ltd | Arc welding electrodes |
| US3531620A (en) * | 1966-07-08 | 1970-09-29 | Kobe Steel Ltd | Arc welding electrode for steel without using gas or the like |
| GB1145560A (en) * | 1966-12-29 | 1969-03-19 | Murex Welding Processes Ltd | Improvements in arc welding electrodes |
| US3539765A (en) * | 1968-06-20 | 1970-11-10 | Mckay Co | Tubular composite arc welding electrode |
| BE754889A (fr) * | 1969-08-15 | 1971-01-18 | Teledyne Inc | Electrode en fer enrobee a faible teneur en hydrogene pour le soudage al'arc et formation d'un depot de soudure en acier non austenitique de qualite amelioree |
| BE757977A (fr) * | 1969-11-24 | 1971-04-01 | Stoody Co | Procede et electrode de soudage a l'arc pour acier inoxydable |
| US3643061A (en) * | 1970-06-08 | 1972-02-15 | Teledyne Inc | Tubular composite self-shielded arc welding electrodes |
-
1971
- 1971-05-07 US US00141376A patent/US3767891A/en not_active Expired - Lifetime
-
1972
- 1972-05-05 NL NL7206154A patent/NL7206154A/xx unknown
- 1972-05-05 GB GB2102372A patent/GB1396892A/en not_active Expired
- 1972-05-05 BR BR2829/72A patent/BR7202829D0/pt unknown
- 1972-05-05 SE SE7205958A patent/SE407670C/xx unknown
- 1972-05-05 CA CA141,390A patent/CA989282A/en not_active Expired
- 1972-05-05 FR FR7216242A patent/FR2139865B1/fr not_active Expired
- 1972-05-06 DE DE2222275A patent/DE2222275B2/de active Granted
- 1972-05-06 IT IT50093/72A patent/IT958580B/it active
- 1972-05-08 JP JP47045297A patent/JPS6225479B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| BR7202829D0 (pt) | 1973-05-03 |
| US3767891A (en) | 1973-10-23 |
| DE2222275A1 (de) | 1972-11-23 |
| IT958580B (it) | 1973-10-30 |
| AU4174072A (en) | 1973-11-08 |
| SE407670B (sv) | 1979-04-09 |
| CA989282A (en) | 1976-05-18 |
| SE407670C (sv) | 1981-08-03 |
| FR2139865B1 (enExample) | 1976-10-29 |
| FR2139865A1 (enExample) | 1973-01-12 |
| DE2222275B2 (de) | 1976-01-08 |
| GB1396892A (en) | 1975-06-11 |
| NL7206154A (enExample) | 1972-11-09 |
| JPS6225479B1 (enExample) | 1987-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2222275C3 (enExample) | ||
| DE2917537C2 (de) | Seelenelektrode | |
| DE1758476C3 (de) | Schweißelektrode zum offenen Lichtbogenschweißen | |
| DE2161098C3 (de) | Seelenelektrode für automatisches oder halbautomatisches Schweißen | |
| DE1608367B1 (de) | Selenelektrode zum automatischen oder halbautomatischen licht bogenschweissen | |
| DE2710330A1 (de) | Schweissflussmittel und verfahren zur rauchverminderung | |
| DE2038524C3 (de) | Kalkbasiscli umhüllte Lichtbogenschweißelektrode | |
| DE2521276B2 (de) | Kernelektrode fuer das lichtbogenschweissen | |
| DE2052204A1 (de) | Bogenschweißverfahren mit Elektrode fur rostfreien Stahl | |
| DE2222348C3 (de) | Schweißelektrode zum Lichtbogenschweißen an Luft | |
| DE1690602B2 (de) | Seelen-Elektrode zum Lichtbogenschweißen unter Kohlendioxid | |
| DE1935307A1 (de) | Schweissflussmittelkomponente | |
| DE1483473B2 (de) | Drahtförmige Seelenelektrode fur die elektrische Lichtbogenschweißung | |
| DE1508354B1 (de) | Schweisspulver | |
| DE1558884C2 (de) | Seelenelektrode zum Lichtbogenschweißen | |
| DE2526259C2 (enExample) | ||
| DE1758005B2 (de) | Schweissmittel fuer das verdeckte lichtbogenschweissen | |
| DE2140227C3 (de) | Fülldrahtelektrode zum UP-SchweiBen von Stahl | |
| DE1508320A1 (de) | Flussmittel zum Schweissen | |
| DE1508319B2 (de) | Schweißmittel | |
| DE1558890C3 (de) | Seelenelektrode zum Lichtbogenschweißen von Stahl ohne Schutzgaszufuhr von außen | |
| AT228589B (de) | Schweiß-Zusammensetzung | |
| DE1483473C3 (de) | Drahtförmige Seelenelektrode für die elektrische Lichtbogenschweißung | |
| DE3027770C2 (de) | Pulverzusammensetzung für Fülldrahtelektroden | |
| AT288814B (de) | Seelenelektrode zum kontinuierlichen Lichtbogenschweißen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |