DE2216804A1 - Verfahren zur Herstellung von 2 Nitro-4,6 dichlor 5 methylphenol - Google Patents
Verfahren zur Herstellung von 2 Nitro-4,6 dichlor 5 methylphenolInfo
- Publication number
- DE2216804A1 DE2216804A1 DE19722216804 DE2216804A DE2216804A1 DE 2216804 A1 DE2216804 A1 DE 2216804A1 DE 19722216804 DE19722216804 DE 19722216804 DE 2216804 A DE2216804 A DE 2216804A DE 2216804 A1 DE2216804 A1 DE 2216804A1
- Authority
- DE
- Germany
- Prior art keywords
- methylphenol
- dichloro
- chloro
- sulfo
- nitro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 52
- VMBRJHMTAZXHES-UHFFFAOYSA-N 2,4-dichloro-3-methyl-6-nitrophenol Chemical compound CC1=C(Cl)C=C([N+]([O-])=O)C(O)=C1Cl VMBRJHMTAZXHES-UHFFFAOYSA-N 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 9
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Inorganic materials O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 21
- 239000002904 solvent Substances 0.000 claims description 18
- ZOQYQHLEDJOHOK-UHFFFAOYSA-N 6-amino-2,4-dichloro-3-methylphenol;hydron;chloride Chemical compound Cl.CC1=C(Cl)C=C(N)C(O)=C1Cl ZOQYQHLEDJOHOK-UHFFFAOYSA-N 0.000 claims description 12
- 238000005660 chlorination reaction Methods 0.000 claims description 12
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 10
- 150000008282 halocarbons Chemical class 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 9
- 230000015572 biosynthetic process Effects 0.000 claims description 9
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 8
- 239000007789 gas Substances 0.000 claims description 8
- OFKATMOSWWAWCZ-UHFFFAOYSA-N 3,5-dichloro-2-hydroxy-4-methylbenzenesulfonic acid Chemical compound CC1=C(Cl)C=C(S(O)(=O)=O)C(O)=C1Cl OFKATMOSWWAWCZ-UHFFFAOYSA-N 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- -1 2-nitro-4,6-dichloromethylphenol Chemical compound 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical group O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 229910017604 nitric acid Inorganic materials 0.000 claims description 6
- QZEPLRHZZAKWCP-UHFFFAOYSA-N 5-chloro-2-hydroxy-4-methylbenzenesulfonic acid Chemical compound CC1=CC(O)=C(S(O)(=O)=O)C=C1Cl QZEPLRHZZAKWCP-UHFFFAOYSA-N 0.000 claims description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 4
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 4
- QDOGSLSGLUTSQL-UHFFFAOYSA-N 6-amino-2,4-dichloro-3-methylphenol Chemical compound CC1=C(Cl)C=C(N)C(O)=C1Cl QDOGSLSGLUTSQL-UHFFFAOYSA-N 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims 3
- 230000000802 nitrating effect Effects 0.000 claims 3
- 125000001931 aliphatic group Chemical group 0.000 claims 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 claims 1
- 238000010531 catalytic reduction reaction Methods 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 238000006277 sulfonation reaction Methods 0.000 description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 5
- 238000006396 nitration reaction Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 4
- 230000021736 acetylation Effects 0.000 description 4
- 238000006640 acetylation reaction Methods 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000012320 chlorinating reagent Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ZXUJWPHOPHHZLR-UHFFFAOYSA-N 1,1,1-trichloro-2-fluoroethane Chemical compound FCC(Cl)(Cl)Cl ZXUJWPHOPHHZLR-UHFFFAOYSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 1
- KBQBTMPFZDYDCE-UHFFFAOYSA-N 2,3-dichloro-5-methylphenol hydrochloride Chemical compound Cl.ClC=1C(=C(C=C(C1)C)O)Cl KBQBTMPFZDYDCE-UHFFFAOYSA-N 0.000 description 1
- QDGJHZNOQSIFAT-UHFFFAOYSA-N 2-amino-4-chloro-5-methylphenol Chemical compound CC1=CC(O)=C(N)C=C1Cl QDGJHZNOQSIFAT-UHFFFAOYSA-N 0.000 description 1
- OPHKGEDQTWIJEX-UHFFFAOYSA-N 2-methylphenol;hydrochloride Chemical compound Cl.CC1=CC=CC=C1O OPHKGEDQTWIJEX-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- JBMGJOKJUYGIJH-UHFFFAOYSA-N 4-chloro-5-methyl-2-nitrophenol Chemical compound CC1=CC(O)=C([N+]([O-])=O)C=C1Cl JBMGJOKJUYGIJH-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 235000010724 Wisteria floribunda Nutrition 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229940061610 sulfonated phenol Drugs 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/10—Preparation of nitro compounds by substitution of functional groups by nitro groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP46021617A JPS5039654B1 (cg-RX-API-DMAC7.html) | 1971-04-07 | 1971-04-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2216804A1 true DE2216804A1 (de) | 1972-10-12 |
Family
ID=12059995
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722216804 Pending DE2216804A1 (de) | 1971-04-07 | 1972-04-07 | Verfahren zur Herstellung von 2 Nitro-4,6 dichlor 5 methylphenol |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3903178A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5039654B1 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2216804A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1361714A (cg-RX-API-DMAC7.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0142086A2 (de) | 1983-11-08 | 1985-05-22 | Agfa-Gevaert AG | Farbfotografisches Aufzeichnungsmaterial zur Herstellung farbiger Aufsichtsbilder |
| EP0175151A1 (de) * | 1984-08-29 | 1986-03-26 | Bayer Ag | 2,4-Dichlor-3-alkyl-6-nitrophenole sowie ein Verfahren zu deren Herstellung |
| WO1991002717A1 (de) * | 1989-08-18 | 1991-03-07 | Hoechst Aktiengesellschaft | Verfahren zur herstellung von 5-chlor-2-hydroxy-4-alkylbenzolsulfonsäuren |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2501899C2 (de) * | 1975-01-18 | 1977-02-17 | Bayer Ag | Verfahren zur herstellung von 2- nitro-4,6-dichlor-5-methylphenol |
| DE3731527A1 (de) * | 1987-09-18 | 1989-03-30 | Bayer Ag | Neue 2-methyl-4-fluor-phenole und deren herstellung |
| US5012015A (en) * | 1988-03-09 | 1991-04-30 | Daiei Chemical Co., Ltd. | Process for producing 2,4-dichloro-3-alkyl-6-nitrophenol |
| DE3816839A1 (de) * | 1988-05-18 | 1989-11-30 | Wella Ag | Verfahren zur herstellung von 4-chlor-2-methyl-5-nitro-phenol |
| DE69110377T2 (de) * | 1990-08-28 | 1995-10-26 | Taoka Chemical Co Ltd | Verfahren zur Herstellung von 2,4-Dichlor-3-alkyl-6-nitrophenol. |
| EP0561298B1 (de) * | 1992-03-18 | 1995-08-02 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von 2-Nitro-3,6-dichlorphenol |
| US5371291A (en) * | 1993-10-15 | 1994-12-06 | The Dow Chemical Company | Synthesis of 4,6-diaminoresorcinol |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2176010A (en) * | 1935-12-30 | 1939-10-10 | Dow Chemical Co | Alkylated halo-phenols |
| US2325753A (en) * | 1941-01-02 | 1943-08-03 | American Cyanamid Co | Method of making dinitro cresol |
| US2693487A (en) * | 1948-01-30 | 1954-11-02 | Monsanto Chemicals | Monosulfonation of benzene |
| US2523707A (en) * | 1948-06-21 | 1950-09-26 | California Research Corp | Production of hydroxytoluenes |
| US2629745A (en) * | 1951-04-23 | 1953-02-24 | Allied Chem & Dye Corp | Process for preparing 2-chloro-4-nitrophenol |
| US3108927A (en) * | 1958-09-02 | 1963-10-29 | Diamond Alkali Co | Phenolic pesticide |
-
1971
- 1971-04-07 JP JP46021617A patent/JPS5039654B1/ja active Pending
-
1972
- 1972-04-05 US US241376A patent/US3903178A/en not_active Expired - Lifetime
- 1972-04-06 GB GB1603072A patent/GB1361714A/en not_active Expired
- 1972-04-07 DE DE19722216804 patent/DE2216804A1/de active Pending
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0142086A2 (de) | 1983-11-08 | 1985-05-22 | Agfa-Gevaert AG | Farbfotografisches Aufzeichnungsmaterial zur Herstellung farbiger Aufsichtsbilder |
| EP0175151A1 (de) * | 1984-08-29 | 1986-03-26 | Bayer Ag | 2,4-Dichlor-3-alkyl-6-nitrophenole sowie ein Verfahren zu deren Herstellung |
| US4670608A (en) * | 1984-08-29 | 1987-06-02 | Bayer Aktiengesellschaft | Preparation of 2,4-dichloro-3-alkyl-6-nitrophenols |
| WO1991002717A1 (de) * | 1989-08-18 | 1991-03-07 | Hoechst Aktiengesellschaft | Verfahren zur herstellung von 5-chlor-2-hydroxy-4-alkylbenzolsulfonsäuren |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5039654B1 (cg-RX-API-DMAC7.html) | 1975-12-18 |
| US3903178A (en) | 1975-09-02 |
| GB1361714A (en) | 1974-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2855764C2 (cg-RX-API-DMAC7.html) | ||
| DE2162859A1 (de) | Verfahren zur Herstellung von beta, beta-Bis-(3,5-dibrom-4-hydroxyphenyl> propan | |
| DE2216804A1 (de) | Verfahren zur Herstellung von 2 Nitro-4,6 dichlor 5 methylphenol | |
| DE2501899C2 (de) | Verfahren zur herstellung von 2- nitro-4,6-dichlor-5-methylphenol | |
| EP0175151B1 (de) | 2,4-Dichlor-3-alkyl-6-nitrophenole sowie ein Verfahren zu deren Herstellung | |
| DE2363458C3 (de) | Aminobenzaldehydverbindungen und ein Verfahren zu ihrer Herstellung | |
| EP0142788B1 (de) | Verfahren zur Herstellung von reinen 3-Acetylaminoanilinen | |
| DE2416722C3 (de) | Verfahren zur Herstellung von 2-Nitrohalogenophenolen | |
| DE2426994A1 (de) | Verfahren zur herstellung von phenolderivaten | |
| DE2648644C3 (de) | Verfahren zur Herstellung von 4-Phenoxy-phenolen | |
| DE3523204A1 (de) | Verfahren zur herstellung von 4,4'-dinitrodibenzylen | |
| DE2648054C3 (de) | Verfahren zur Herstellung von Dichlornitroanilinen | |
| DE3300821A1 (de) | Verfahren zur herstellung von 3,3'- oder 3,4'-diaminobenzophenon | |
| DE2318106C3 (de) | Verfahren zur Herstellung von Dichlorbenzoesäuren | |
| DE3445644A1 (de) | Neue diaminoalkyldiphenylether, ein verfahren zu ihrer herstellung sowie deren verwendung | |
| DE1933525A1 (de) | Verfahren zur Herstellung von chlor- und/oder cyansubstituierten Hydroxybenzonitrilen oder deren Alkali- oder Erdalkalisalzen | |
| DE2416260A1 (de) | Verfahren zur herstellung von phenolderivaten | |
| CH620412A5 (cg-RX-API-DMAC7.html) | ||
| DE3506845A1 (de) | Verfahren zur herstellung von 4,4'-dihydroxidiphenylether | |
| AT239243B (de) | Verfahren zur Herstellung von 2, 3-Dicyan-1, 4-dithia-anthrahydrochinon und -anthrachinon | |
| DE2721133C2 (de) | Verfahren zur Herstellung von Halogenbenzoesäureverbindungen | |
| DE3519864A1 (de) | Verfahren zur herstellung von o- und p-nitrobenzaldehyd | |
| DE1593871C3 (de) | Verfahren zur Herstellung von Nitroaminodiaryläthern | |
| EP0014835B1 (de) | Bis-(brom- und chlor-substituiertes propenyl)-äther, Verfahren zu seiner Herstellung und seine Verwendung bei der Herstellung von Trichloracrolein | |
| AT216511B (de) | Verfahren zur Herstellung von 1,2,4-Benzothiadiazin-1,1-dioxydverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |