DE2208168C3 - Thermoplastische Formmasse auf Polyoxymethylen-Basis und Verfahren zu ihrer Herstellung - Google Patents
Thermoplastische Formmasse auf Polyoxymethylen-Basis und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE2208168C3 DE2208168C3 DE2208168A DE2208168A DE2208168C3 DE 2208168 C3 DE2208168 C3 DE 2208168C3 DE 2208168 A DE2208168 A DE 2208168A DE 2208168 A DE2208168 A DE 2208168A DE 2208168 C3 DE2208168 C3 DE 2208168C3
- Authority
- DE
- Germany
- Prior art keywords
- weight
- percent
- polyoxymethylene
- groups
- pom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920006324 polyoxymethylene Polymers 0.000 title claims description 60
- -1 polyoxymethylene Polymers 0.000 title claims description 34
- 229930040373 Paraformaldehyde Natural products 0.000 title claims description 22
- 150000001875 compounds Chemical class 0.000 title claims description 11
- 238000009757 thermoplastic moulding Methods 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 5
- 238000000034 method Methods 0.000 title description 4
- 229920000642 polymer Polymers 0.000 claims description 43
- 229920000578 graft copolymer Polymers 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 230000015556 catabolic process Effects 0.000 claims description 7
- 238000006731 degradation reaction Methods 0.000 claims description 7
- 125000005704 oxymethylene group Chemical group [H]C([H])([*:2])O[*:1] 0.000 claims description 6
- 239000003381 stabilizer Substances 0.000 claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 5
- 125000005702 oxyalkylene group Chemical group 0.000 claims description 5
- 125000000075 primary alcohol group Chemical group 0.000 claims description 3
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 21
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 21
- 238000000465 moulding Methods 0.000 description 14
- 238000006116 polymerization reaction Methods 0.000 description 11
- 229920001519 homopolymer Polymers 0.000 description 8
- 229920001577 copolymer Polymers 0.000 description 7
- 239000002667 nucleating agent Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 6
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 4
- 150000004292 cyclic ethers Chemical class 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 4
- 229920000058 polyacrylate Polymers 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- 229910015900 BF3 Inorganic materials 0.000 description 3
- 229920002284 Cellulose triacetate Polymers 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000004593 Epoxy Substances 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000003700 epoxy group Chemical group 0.000 description 3
- 239000003822 epoxy resin Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000007373 indentation Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229920003986 novolac Polymers 0.000 description 3
- 230000006911 nucleation Effects 0.000 description 3
- 238000010899 nucleation Methods 0.000 description 3
- 229920000647 polyepoxide Polymers 0.000 description 3
- 229920002689 polyvinyl acetate Polymers 0.000 description 3
- 239000011118 polyvinyl acetate Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- AZCSOJKJFMWYCX-UHFFFAOYSA-N hexasodium;dioxido(dioxo)tungsten;trioxotungsten Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.[O-][W]([O-])(=O)=O.[O-][W]([O-])(=O)=O.[O-][W]([O-])(=O)=O AZCSOJKJFMWYCX-UHFFFAOYSA-N 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- 238000004898 kneading Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000193 polymethacrylate Polymers 0.000 description 2
- 150000003138 primary alcohols Chemical group 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- AUAGGMPIKOZAJZ-UHFFFAOYSA-N 1,3,6-trioxocane Chemical compound C1COCOCCO1 AUAGGMPIKOZAJZ-UHFFFAOYSA-N 0.000 description 1
- CZLMRJZAHXYRIX-UHFFFAOYSA-N 1,3-dioxepane Chemical compound C1CCOCOC1 CZLMRJZAHXYRIX-UHFFFAOYSA-N 0.000 description 1
- BQLZNUMAQHULJO-UHFFFAOYSA-N 1,3-dioxonane Chemical compound C1CCCOCOCC1 BQLZNUMAQHULJO-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- IUDNGVFSUHFMCF-UHFFFAOYSA-N 4-(chloromethyl)-1,3-dioxolane Chemical compound ClCC1COCO1 IUDNGVFSUHFMCF-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000005157 alkyl carboxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- YBGKQGSCGDNZIB-UHFFFAOYSA-N arsenic pentafluoride Chemical compound F[As](F)(F)(F)F YBGKQGSCGDNZIB-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- LBPABMFHQYNGEB-UHFFFAOYSA-N benzene;2h-triazole Chemical class C=1C=NNN=1.C1=CC=CC=C1 LBPABMFHQYNGEB-UHFFFAOYSA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000000686 lactone group Chemical group 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- NAHIZHJHSUSESF-UHFFFAOYSA-N perchloryl acetate Chemical compound CC(=O)OCl(=O)(=O)=O NAHIZHJHSUSESF-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- OBCUTHMOOONNBS-UHFFFAOYSA-N phosphorus pentafluoride Chemical compound FP(F)(F)(F)F OBCUTHMOOONNBS-UHFFFAOYSA-N 0.000 description 1
- 229920002432 poly(vinyl methyl ether) polymer Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 229920001289 polyvinyl ether Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003216 pyrazines Chemical class 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000004557 technical material Substances 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L59/00—Compositions of polyacetals; Compositions of derivatives of polyacetals
- C08L59/02—Polyacetals containing polyoxymethylene sequences only
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L59/00—Compositions of polyacetals; Compositions of derivatives of polyacetals
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyoxymethylene Polymers And Polymers With Carbon-To-Carbon Bonds (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE795792D BE795792A (fr) | 1972-02-22 | Matieres a mouler thermoplastiques a base de poly-oxymethylenes | |
| DE2208168A DE2208168C3 (de) | 1972-02-22 | 1972-02-22 | Thermoplastische Formmasse auf Polyoxymethylen-Basis und Verfahren zu ihrer Herstellung |
| IN303/CAL/73A IN138971B (enExample) | 1972-02-22 | 1973-02-12 | |
| CA164,170A CA999693A (en) | 1972-02-22 | 1973-02-16 | Thermoplastic moulding composition on the basis of polyoxymethylene |
| US332810A US3872182A (en) | 1972-02-22 | 1973-02-16 | Thermoplastic moulding composition on the basis of polyoxymethylene |
| NLAANVRAGE7302216,A NL176786C (nl) | 1972-02-22 | 1973-02-16 | Werkwijze voor het bereiden van een thermoplastisch vormmateriaal, alsmede daaruit vervaardigde, gevormde voortbrengselen. |
| CH238073A CH585775A5 (enExample) | 1972-02-22 | 1973-02-19 | |
| GB830173A GB1406777A (en) | 1972-02-22 | 1973-02-20 | Thermaoplastic moulding composition |
| BR731251A BR7301251D0 (pt) | 1972-02-22 | 1973-02-20 | Composicao termoplastica de moldagem a base de poli(oximetileno), e processo para sua obtencao |
| JP1982173A JPS5717895B2 (enExample) | 1972-02-22 | 1973-02-20 | |
| ZA731169A ZA731169B (en) | 1972-02-22 | 1973-02-20 | Thermoplastic moulding composition on the basis of polyoxymethylene |
| IT20614/73A IT979299B (it) | 1972-02-22 | 1973-02-20 | Massa da stampaggio termoplastica a base poliossimetilenica |
| FR7306130A FR2173126B1 (enExample) | 1972-02-22 | 1973-02-21 | |
| SE7302422A SE388866B (sv) | 1972-02-22 | 1973-02-21 | Termoplastisk pressmassa bestaende av en blandning av polyoximetylen och en ymppolymer och ett forfarande for framstellning derav |
| AT152173A AT322846B (de) | 1972-02-22 | 1973-02-21 | Thermoplastische formmasse auf poly(oxymethylen)-basis |
| AU52396/73A AU471165B2 (en) | 1972-02-22 | 1973-02-21 | Thermoplastic moulding compositions onthe basis of polyoxymethylene |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2208168A DE2208168C3 (de) | 1972-02-22 | 1972-02-22 | Thermoplastische Formmasse auf Polyoxymethylen-Basis und Verfahren zu ihrer Herstellung |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2208168A1 DE2208168A1 (de) | 1973-09-06 |
| DE2208168B2 DE2208168B2 (de) | 1975-03-13 |
| DE2208168C3 true DE2208168C3 (de) | 1981-08-13 |
Family
ID=5836658
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2208168A Expired DE2208168C3 (de) | 1972-02-22 | 1972-02-22 | Thermoplastische Formmasse auf Polyoxymethylen-Basis und Verfahren zu ihrer Herstellung |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3872182A (enExample) |
| JP (1) | JPS5717895B2 (enExample) |
| AT (1) | AT322846B (enExample) |
| AU (1) | AU471165B2 (enExample) |
| BE (1) | BE795792A (enExample) |
| BR (1) | BR7301251D0 (enExample) |
| CA (1) | CA999693A (enExample) |
| CH (1) | CH585775A5 (enExample) |
| DE (1) | DE2208168C3 (enExample) |
| FR (1) | FR2173126B1 (enExample) |
| GB (1) | GB1406777A (enExample) |
| IN (1) | IN138971B (enExample) |
| IT (1) | IT979299B (enExample) |
| NL (1) | NL176786C (enExample) |
| SE (1) | SE388866B (enExample) |
| ZA (1) | ZA731169B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4535127A (en) * | 1983-03-23 | 1985-08-13 | Asahi Kasei Kogyo Kabushiki Kaisha | Polyacetal copolymers and process for production thereof |
| CA2015903A1 (en) * | 1989-05-12 | 1990-11-12 | Andrew B. Auerbach | Grafting of amine functional polymers onto functionalized oxymethylene polymers and the resulting graft polymers thereof |
| US5206308A (en) * | 1989-05-12 | 1993-04-27 | Hoechst Celanese Corporation | Grafting of amine functional polymers onto functionalized oxymethylene polymers and the resulting graft polymers thereof |
| JP3303477B2 (ja) * | 1993-11-16 | 2002-07-22 | 住友化学工業株式会社 | 難燃剤および難燃性熱可塑性樹脂組成物 |
| US5817723A (en) * | 1995-09-07 | 1998-10-06 | E. I. Du Pont De Nemours And Company | Toughened thermoplastic polymer compositions |
| JP2003342442A (ja) * | 2002-05-30 | 2003-12-03 | Polyplastics Co | ポリアセタール樹脂組成物 |
| US20050032950A1 (en) * | 2003-06-28 | 2005-02-10 | Win-Chung Lee | Polyacetal and polyvinylbutyral compositions and blends having enhanced surface properties and articles made therefrom |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3218295A (en) * | 1955-11-30 | 1965-11-16 | Du Pont | Copolymers of formaldehyde with active hydrogen-containing polymers |
| NL109971C (enExample) * | 1959-08-29 | 1900-01-01 | ||
| US3231543A (en) * | 1960-10-14 | 1966-01-25 | Celanese Corp | Process for the formation of shaped trioxane structures and polymerization thereof |
| US3763105A (en) * | 1960-10-14 | 1973-10-02 | Celanese Corp | Shaped structure of trioxane and polyacetaldehyde |
| US3600458A (en) * | 1960-10-14 | 1971-08-17 | Celanese Corp | Shaped structures |
| NL284715A (enExample) * | 1961-10-27 | |||
| BE636370A (enExample) * | 1962-05-04 | |||
| BE647354A (enExample) * | 1963-04-30 | |||
| US3732333A (en) * | 1963-10-02 | 1973-05-08 | Gulf Oil Corp | Formaldehyde block copolymers and processes |
| US3754053A (en) * | 1964-05-15 | 1973-08-21 | Celanese Corp | Polyoxymethylene-oxyalkylene block polymers |
| US3766298A (en) * | 1971-03-01 | 1973-10-16 | Celanese Corp | Process for preparing non tacky coupled oxymethylene copolymers |
| JPS5519942A (en) * | 1978-07-28 | 1980-02-13 | Toshiba Corp | Compressor |
-
0
- BE BE795792D patent/BE795792A/xx not_active IP Right Cessation
-
1972
- 1972-02-22 DE DE2208168A patent/DE2208168C3/de not_active Expired
-
1973
- 1973-02-12 IN IN303/CAL/73A patent/IN138971B/en unknown
- 1973-02-16 US US332810A patent/US3872182A/en not_active Expired - Lifetime
- 1973-02-16 CA CA164,170A patent/CA999693A/en not_active Expired
- 1973-02-16 NL NLAANVRAGE7302216,A patent/NL176786C/xx not_active IP Right Cessation
- 1973-02-19 CH CH238073A patent/CH585775A5/xx not_active IP Right Cessation
- 1973-02-20 ZA ZA731169A patent/ZA731169B/xx unknown
- 1973-02-20 JP JP1982173A patent/JPS5717895B2/ja not_active Expired
- 1973-02-20 GB GB830173A patent/GB1406777A/en not_active Expired
- 1973-02-20 BR BR731251A patent/BR7301251D0/pt unknown
- 1973-02-20 IT IT20614/73A patent/IT979299B/it active
- 1973-02-21 AT AT152173A patent/AT322846B/de not_active IP Right Cessation
- 1973-02-21 SE SE7302422A patent/SE388866B/xx unknown
- 1973-02-21 AU AU52396/73A patent/AU471165B2/en not_active Expired
- 1973-02-21 FR FR7306130A patent/FR2173126B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2208168A1 (de) | 1973-09-06 |
| DE2208168B2 (de) | 1975-03-13 |
| BR7301251D0 (pt) | 1974-02-19 |
| NL176786C (nl) | 1985-06-03 |
| JPS4897955A (enExample) | 1973-12-13 |
| BE795792A (fr) | 1973-08-22 |
| NL7302216A (enExample) | 1973-08-24 |
| ZA731169B (en) | 1973-12-19 |
| IT979299B (it) | 1974-09-30 |
| AU5239673A (en) | 1974-08-22 |
| FR2173126B1 (enExample) | 1976-09-10 |
| SE388866B (sv) | 1976-10-18 |
| IN138971B (enExample) | 1976-04-17 |
| FR2173126A1 (enExample) | 1973-10-05 |
| JPS5717895B2 (enExample) | 1982-04-13 |
| NL176786B (nl) | 1985-01-02 |
| CH585775A5 (enExample) | 1977-03-15 |
| CA999693A (en) | 1976-11-09 |
| AU471165B2 (en) | 1976-04-08 |
| GB1406777A (en) | 1975-09-17 |
| AT322846B (de) | 1975-06-10 |
| US3872182A (en) | 1975-03-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0004973B1 (de) | Thermoplastische Formmassen auf Basis von Polyoxymethylenen | |
| DE10082068C5 (de) | Niedermolekulares Oxymethylen-Polymeres und Zusammensetzung mit einem Gehalt an diesem Polymeren und Verfahren zur Herstellung | |
| DE2540207B1 (de) | Polyoxymethylen-Formmassen(I) | |
| EP1869121B1 (de) | Polyoxymethylen-zusammensetzungen, deren herstellung und verwendung | |
| DE2142091C3 (de) | Thermoplastische Formmasse auf Poly(oxymethylen)-Basis | |
| DE2208168C3 (de) | Thermoplastische Formmasse auf Polyoxymethylen-Basis und Verfahren zu ihrer Herstellung | |
| DE2150038C3 (de) | Thermoplastische Formmassen auf Polyoxymethylenbasis | |
| DE3421864A1 (de) | Thermoplastische formmassen auf der basis von polyoxymethylen und polymeren adipatcarbonatmischestern | |
| DE2620017C3 (de) | Verfahren zur Herstellung von grobkörnigen Oxymethylenpolymeren | |
| EP0000765B1 (de) | Verfahren zur Herstellung von körnigen Oxymethylenpolymeren mit verbesserten mechanischen Eigenschaften | |
| DE2348808B2 (de) | Formmasse auf Poly(oxymethylen)-Basis | |
| DE2233143C3 (de) | Thermoplastische Formmassen auf Poly(oxymethylen)-Basis | |
| DE2166377C3 (de) | Verwendung von verzweigten oder vernetzten Trioxancopolymeren als Nukleierungsmittel | |
| DE2233813A1 (de) | Verfahren zur herstellung von copolymeren des trioxans und daraus hergestellte formmasse | |
| DE2037823C3 (de) | Thermoplastische Formmassen auf Polyoxymethylenbasis | |
| DE2350415C3 (de) | Formmasse auf Poly (oxy methylen)-Basis | |
| DE2509924C3 (de) | Verfahren zur Herstellung von Oxymethylenpolymeren in körniger Form | |
| DE2754600A1 (de) | Verfahren zur herstellung von press- und formmassen auf der basis von polyoxymethylenen | |
| DE2233861A1 (de) | Verfahren zur herstellung von copolymeren des trioxans und daraus hergestellte formmasse | |
| DE2549770C2 (de) | Verfahren zur herstellung von oxymethylenpolymeren in koerniger form | |
| DE2452737A1 (de) | Verfahren zur herstellung von oxymethylenpolymeren in koerniger form | |
| DE2350415B2 (de) | Formmasse auf Poly(oxymethylen)-Basis | |
| DE2504482A1 (de) | Verfahren zur herstellung von oxamethylenpolymeren in koerniger form | |
| DE2508886B2 (de) | Verfahren zur Herstellung von Oxymethylenpolymeren in körniger Form | |
| DE2452736A1 (de) | Verfahren zur herstellung von oxymethylenpolymeren in koerniger form |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |