DE2205145A1 - Thiazolinazetidinone - Google Patents
ThiazolinazetidinoneInfo
- Publication number
- DE2205145A1 DE2205145A1 DE19722205145 DE2205145A DE2205145A1 DE 2205145 A1 DE2205145 A1 DE 2205145A1 DE 19722205145 DE19722205145 DE 19722205145 DE 2205145 A DE2205145 A DE 2205145A DE 2205145 A1 DE2205145 A1 DE 2205145A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- formula
- thiazolinazetidinone
- mercapto
- specified
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 carbomethoxy group Chemical group 0.000 claims description 25
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- JEHCHYAKAXDFKV-UHFFFAOYSA-J lead tetraacetate Chemical compound CC(=O)O[Pb](OC(C)=O)(OC(C)=O)OC(C)=O JEHCHYAKAXDFKV-UHFFFAOYSA-J 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000011203 carbon fibre reinforced carbon Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 3
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 31
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 229930182555 Penicillin Natural products 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 229940049954 penicillin Drugs 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 229930186147 Cephalosporin Natural products 0.000 description 5
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 229940124587 cephalosporin Drugs 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 150000002960 penicillins Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 3
- 150000001780 cephalosporins Chemical class 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 230000008707 rearrangement Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- FCZNNHHXCFARDY-WQRUCBPWSA-N (2s,5r,6r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2=O)(C)C)C(O)=O)C(=O)CC1=CC=CC=C1 FCZNNHHXCFARDY-WQRUCBPWSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical class O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 125000005518 carboxamido group Chemical group 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical group [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 244000186140 Asperula odorata Species 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 235000008526 Galium odoratum Nutrition 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11239071A | 1971-02-03 | 1971-02-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2205145A1 true DE2205145A1 (de) | 1972-10-12 |
Family
ID=22343635
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722205145 Pending DE2205145A1 (de) | 1971-02-03 | 1972-02-03 | Thiazolinazetidinone |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3681380A (OSRAM) |
| AT (1) | AT312599B (OSRAM) |
| AU (1) | AU3817272A (OSRAM) |
| BE (1) | BE778322A (OSRAM) |
| CA (1) | CA986116A (OSRAM) |
| CH (1) | CH536857A (OSRAM) |
| CS (1) | CS178102B2 (OSRAM) |
| DE (1) | DE2205145A1 (OSRAM) |
| ES (1) | ES399424A1 (OSRAM) |
| FR (1) | FR2124439A1 (OSRAM) |
| GB (1) | GB1374487A (OSRAM) |
| HU (1) | HU164226B (OSRAM) |
| IE (1) | IE35990B1 (OSRAM) |
| IL (1) | IL38613A (OSRAM) |
| NL (1) | NL7201445A (OSRAM) |
| PL (1) | PL85159B1 (OSRAM) |
| SU (1) | SU508208A3 (OSRAM) |
| YU (1) | YU21872A (OSRAM) |
| ZA (1) | ZA72349B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1368231A (en) * | 1970-07-31 | 1974-09-25 | Glaxo Lab Ltd | Thio-substituted azetidinones and thiazolino azetidinones |
| GB1368232A (en) * | 1970-07-31 | 1974-09-25 | Glaxo Lab Ltd | Azetidino-thiazolidine compounds |
| GB1368236A (en) * | 1970-11-03 | 1974-09-25 | Glaxo Lab Ltd | Azetidinone derivatives and their preparation |
| US3880872A (en) * | 1971-09-21 | 1975-04-29 | Lilly Co Eli | Process for preparing thiazoline azetidinones |
| JPS5749555B2 (OSRAM) * | 1973-04-04 | 1982-10-22 | ||
| US4282149A (en) * | 1977-03-21 | 1981-08-04 | Massachusetts Institute Of Technology | Carbon and oxygen analogs of penicillin |
| US4392923A (en) * | 1982-08-09 | 1983-07-12 | Otsuka Kagaku Yakuhin Kabushiki Kaisha | Process for preparing thiazolinozetidinone derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS157621B2 (en) * | 1965-09-10 | 1974-09-16 | Robert B Woodward | Method of 7-amino-3-desacetyloxymethyl-3-formylisocephaelospora acid's derivatives making |
| US3422103A (en) * | 1967-08-11 | 1969-01-14 | Glaxo Lab Ltd | 7(aminophenylacetamido)cephalosporanic acids |
-
1971
- 1971-02-03 US US112390A patent/US3681380A/en not_active Expired - Lifetime
-
1972
- 1972-01-18 IE IE71/72A patent/IE35990B1/xx unknown
- 1972-01-18 ZA ZA720349A patent/ZA72349B/xx unknown
- 1972-01-20 BE BE778322A patent/BE778322A/xx unknown
- 1972-01-21 AU AU38172/72A patent/AU3817272A/en not_active Expired
- 1972-01-23 IL IL38613A patent/IL38613A/en unknown
- 1972-01-24 CA CA133,019A patent/CA986116A/en not_active Expired
- 1972-01-26 GB GB371072A patent/GB1374487A/en not_active Expired
- 1972-01-31 YU YU00218/72A patent/YU21872A/xx unknown
- 1972-02-02 CS CS659A patent/CS178102B2/cs unknown
- 1972-02-02 PL PL1972153241A patent/PL85159B1/pl unknown
- 1972-02-02 HU HUEI405A patent/HU164226B/hu unknown
- 1972-02-02 AT AT82472A patent/AT312599B/de not_active IP Right Cessation
- 1972-02-02 ES ES399424A patent/ES399424A1/es not_active Expired
- 1972-02-03 DE DE19722205145 patent/DE2205145A1/de active Pending
- 1972-02-03 FR FR7203629A patent/FR2124439A1/fr not_active Withdrawn
- 1972-02-03 SU SU1744415A patent/SU508208A3/ru active
- 1972-02-03 CH CH157672A patent/CH536857A/fr not_active IP Right Cessation
- 1972-02-03 NL NL7201445A patent/NL7201445A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SU508208A3 (ru) | 1976-03-25 |
| AT312599B (de) | 1974-01-10 |
| BE778322A (fr) | 1972-07-20 |
| US3681380A (en) | 1972-08-01 |
| IE35990B1 (en) | 1976-07-21 |
| IE35990L (en) | 1972-08-03 |
| GB1374487A (en) | 1974-11-20 |
| CS178102B2 (OSRAM) | 1977-08-31 |
| CH536857A (fr) | 1973-05-15 |
| HU164226B (OSRAM) | 1974-01-28 |
| IL38613A0 (en) | 1972-03-28 |
| ES399424A1 (es) | 1974-10-16 |
| NL7201445A (OSRAM) | 1972-08-07 |
| FR2124439A1 (OSRAM) | 1972-09-22 |
| AU3817272A (en) | 1973-07-26 |
| IL38613A (en) | 1976-02-29 |
| ZA72349B (en) | 1973-09-26 |
| PL85159B1 (OSRAM) | 1976-04-30 |
| YU21872A (en) | 1980-03-15 |
| CA986116A (en) | 1976-03-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2258278A1 (de) | Verfahren zur herstellung substituierter cephalosporine | |
| DE2735832C3 (de) | Verfahren zur Herstellung von Schwefelanalogen der 6 β-Aminopenicillansäure und deren Derivaten | |
| DE2205145A1 (de) | Thiazolinazetidinone | |
| DE2754743A1 (de) | Thiooximcephalosporin- und -penicillin- derivate, verfahren zu ihrer herstellung und ihre verwendung als arzneistoffe | |
| DE2205144B2 (de) | Azetidino [3,2-d] zu thiazole und Verfahren zu ihrer Herstellung | |
| DE2534926C2 (de) | Verfahren zur Herstellung von Estern der 7-Oxo- und 7β-Hydroxy-cephalosporansäure und deren 3-substituierten Derivaten | |
| DE2029099C3 (de) | Verfahren zur Herstellung von Acetidino [3,2-d] thiazolen | |
| DE2412598C2 (de) | Verfahren zur Herstellung von 7-Alkoxycephalosporinen bzw. 6-Alkoxypenicillinen | |
| EP0722946A1 (de) | Verfahren zur Herstellung von 3-Formyl-Cephem-Derivaten | |
| DE1232577B (de) | Verfahren zur Herstellung von delta 4,9-3-Oxo-11beta-hydroperoxy-19-nor-steroiden | |
| DE2145354C3 (de) | Thioester und Verfahren zu ihrer Herstellung | |
| EP0361467A2 (de) | Enolether des Elaiophylins, Verfahren zu deren Herstellung, diese enthaltenden Mittel und ihre Verwendung | |
| DE1695212B2 (de) | Verfahren zur Herstellung von Iodininderivaten | |
| DE2938065A1 (de) | Verfahren zur herstellung von cephalosporinverbindungen | |
| DE2319873C2 (de) | 16-O-Alkylderivate von Gitoxigenin-digitoxosiden, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE1937015A1 (de) | Cephalospronsulfoxide | |
| DE2110140C3 (OSRAM) | ||
| DE3012667A1 (de) | Verfahren zur herstellung von derivaten von 6- beta -amidinopenicillansaeure | |
| DE2707404C3 (de) | Verfahren zur Herstellung von 5,6-Dehydropenicillinen | |
| DE1937016C3 (de) | Verfahren zur Herstellung von Cephalosporjnsulfoxiden | |
| DE2143331C3 (OSRAM) | ||
| AT350200B (de) | Verfahren zur herstellung von neuen steroid- spirolactonen | |
| DE3018847A1 (de) | 6- alpha - und 6- beta -substituierte penicillansaeurederivate und verfahren zu ihrer herstellung | |
| DE938729C (de) | Verfahren zur Herstellung von 4-Halogen-21-acyloxy-17-oxypregnan-3, 11, 20-trionen | |
| DE2138323A1 (de) | Chemische Verbindungen |