DE2204495A1 - Stabilisierte Polyamidzusammensetzungen - Google Patents
Stabilisierte PolyamidzusammensetzungenInfo
- Publication number
- DE2204495A1 DE2204495A1 DE19722204495 DE2204495A DE2204495A1 DE 2204495 A1 DE2204495 A1 DE 2204495A1 DE 19722204495 DE19722204495 DE 19722204495 DE 2204495 A DE2204495 A DE 2204495A DE 2204495 A1 DE2204495 A1 DE 2204495A1
- Authority
- DE
- Germany
- Prior art keywords
- tert
- copper
- metal
- butyl
- sterically hindered
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004952 Polyamide Substances 0.000 title claims description 37
- 229920002647 polyamide Polymers 0.000 title claims description 37
- 239000000203 mixture Substances 0.000 title claims description 25
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Inorganic materials [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 claims description 31
- -1 metal halide potassium iodide Chemical class 0.000 claims description 23
- 229910052751 metal Inorganic materials 0.000 claims description 14
- 239000002184 metal Substances 0.000 claims description 14
- 239000010949 copper Substances 0.000 claims description 13
- 229910052802 copper Inorganic materials 0.000 claims description 10
- 229910001507 metal halide Inorganic materials 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical compound [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 claims description 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 7
- 150000005309 metal halides Chemical class 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 150000002989 phenols Chemical class 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 4
- 150000004694 iodide salts Chemical class 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- 239000011591 potassium Substances 0.000 claims description 4
- KWSLGOVYXMQPPX-UHFFFAOYSA-N 5-[3-(trifluoromethyl)phenyl]-2h-tetrazole Chemical group FC(F)(F)C1=CC=CC(C2=NNN=N2)=C1 KWSLGOVYXMQPPX-UHFFFAOYSA-N 0.000 claims description 3
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910001379 sodium hypophosphite Inorganic materials 0.000 claims description 3
- 238000006864 oxidative decomposition reaction Methods 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 238000005979 thermal decomposition reaction Methods 0.000 claims description 2
- CIMUUFUVEIMCEI-UHFFFAOYSA-J [Cu+2].[Cu+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O Chemical compound [Cu+2].[Cu+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O CIMUUFUVEIMCEI-UHFFFAOYSA-J 0.000 claims 2
- 239000003513 alkali Substances 0.000 claims 2
- 229910001617 alkaline earth metal chloride Inorganic materials 0.000 claims 2
- 230000000737 periodic effect Effects 0.000 claims 2
- 150000003839 salts Chemical class 0.000 claims 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 150000001649 bromium compounds Chemical class 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims 1
- 229910001380 potassium hypophosphite Inorganic materials 0.000 claims 1
- CRGPNLUFHHUKCM-UHFFFAOYSA-M potassium phosphinate Chemical compound [K+].[O-]P=O CRGPNLUFHHUKCM-UHFFFAOYSA-M 0.000 claims 1
- 230000006641 stabilisation Effects 0.000 claims 1
- 238000011105 stabilization Methods 0.000 claims 1
- 150000001879 copper Chemical class 0.000 description 9
- 230000014759 maintenance of location Effects 0.000 description 9
- 239000008188 pellet Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 238000006068 polycondensation reaction Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 239000003381 stabilizer Substances 0.000 description 6
- 239000004677 Nylon Substances 0.000 description 5
- 229920002302 Nylon 6,6 Polymers 0.000 description 5
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 5
- 229920001778 nylon Polymers 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 239000002530 phenolic antioxidant Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000003842 bromide salts Chemical class 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical class O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- WPMYUUITDBHVQZ-UHFFFAOYSA-N 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid Chemical compound CC(C)(C)C1=CC(CCC(O)=O)=CC(C(C)(C)C)=C1O WPMYUUITDBHVQZ-UHFFFAOYSA-N 0.000 description 1
- UFFRSDWQMJYQNE-UHFFFAOYSA-N 6-azaniumylhexylazanium;hexanedioate Chemical compound [NH3+]CCCCCC[NH3+].[O-]C(=O)CCCCC([O-])=O UFFRSDWQMJYQNE-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 208000029422 Hypernatremia Diseases 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 244000089486 Phragmites australis subsp australis Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000004957 Zytel Substances 0.000 description 1
- 229920006102 Zytel® Polymers 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 238000011938 amidation process Methods 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- AHQQRBMURHPYNK-UHFFFAOYSA-L calcium chloride iodide Chemical compound [I-].[Cl-].[Ca+2] AHQQRBMURHPYNK-UHFFFAOYSA-L 0.000 description 1
- 229910001382 calcium hypophosphite Inorganic materials 0.000 description 1
- 229940064002 calcium hypophosphite Drugs 0.000 description 1
- 229910001640 calcium iodide Inorganic materials 0.000 description 1
- 229940046413 calcium iodide Drugs 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- VNZQQAVATKSIBR-UHFFFAOYSA-L copper;octanoate Chemical compound [Cu+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O VNZQQAVATKSIBR-UHFFFAOYSA-L 0.000 description 1
- GEBVYLHOCNKBAH-UHFFFAOYSA-N copper;propan-2-one Chemical compound [Cu].CC(C)=O GEBVYLHOCNKBAH-UHFFFAOYSA-N 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 208000020442 loss of weight Diseases 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 150000002697 manganese compounds Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 208000027765 speech disease Diseases 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- CNALVHVMBXLLIY-IUCAKERBSA-N tert-butyl n-[(3s,5s)-5-methylpiperidin-3-yl]carbamate Chemical compound C[C@@H]1CNC[C@@H](NC(=O)OC(C)(C)C)C1 CNALVHVMBXLLIY-IUCAKERBSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 208000016261 weight loss Diseases 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K13/00—Use of mixtures of ingredients not covered by one single of the preceding main groups, each of these compounds being essential
- C08K13/02—Organic and inorganic ingredients
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11167271A | 1971-02-01 | 1971-02-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2204495A1 true DE2204495A1 (de) | 1972-08-17 |
Family
ID=22339832
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722204495 Pending DE2204495A1 (de) | 1971-02-01 | 1972-01-31 | Stabilisierte Polyamidzusammensetzungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3691131A (OSRAM) |
| CA (1) | CA982729A (OSRAM) |
| DE (1) | DE2204495A1 (OSRAM) |
| FR (1) | FR2124338B1 (OSRAM) |
| GB (1) | GB1368776A (OSRAM) |
| IT (1) | IT947163B (OSRAM) |
| NL (1) | NL7201249A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013075982A1 (de) * | 2011-11-25 | 2013-05-30 | Basf Se | Blasformbare polyamidformmassen |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4043972A (en) * | 1975-10-06 | 1977-08-23 | Phillips Fibers Corporation | Stabilizing polyamide antistatic compositions |
| US4101550A (en) * | 1976-05-03 | 1978-07-18 | Ciba-Geigy Corporation | Bis-piperazides of trisubstituted hydroxyphenylalkanoic acids |
| US4508867A (en) * | 1983-11-07 | 1985-04-02 | Polysar Limited | Polymer compositions comprising polyamides, carboxylated (meth)acrylonitrile-butadiene rubber, and nonpolymeric additives |
| US5216054A (en) * | 1989-02-10 | 1993-06-01 | Tonen Sekiyukagaku Kabushiki Kaisha | Polymer composition |
| JPH04351670A (ja) * | 1991-05-29 | 1992-12-07 | Sumitomo Chem Co Ltd | 耐候性樹脂組成物 |
| DE4305166A1 (de) * | 1993-02-19 | 1994-08-25 | Bayer Ag | Thermostabile kupferhaltige Polyamidformmassen |
| DE19519820A1 (de) * | 1995-05-31 | 1996-12-05 | Bayer Ag | Thermostabile, witterungsbeständige Polyamidformmassen |
| JPH10130497A (ja) * | 1996-11-01 | 1998-05-19 | Mitsubishi Gas Chem Co Inc | ポリアミド樹脂組成物 |
| SG68701A1 (en) * | 1997-12-05 | 1999-11-16 | Ciba Sc Holding Ag | Stabilisation of polyamide polyester and polyacetal |
| US6197855B1 (en) * | 1998-09-29 | 2001-03-06 | Solutia Inc. | Nucleation of Polyamides in the presence of hypophosphite |
| MXPA04008820A (es) * | 2002-03-15 | 2004-11-26 | Bayer Chemicals Ag | Combinaciones estabilizantes para sistemas polimeros. |
| US20120279605A1 (en) * | 2011-05-04 | 2012-11-08 | E.I. Du Pont De Nemours And Company | Polyamide compositions for the inner layer of a multi-layer tubular article and articles incorporating same |
| CN103508923B (zh) * | 2012-06-27 | 2016-06-29 | 中国石油化工股份有限公司 | 一种受阻酚类抗氧剂的制备方法 |
| HK1232245A1 (zh) | 2014-05-30 | 2018-01-05 | 奥升德高性能材料公司 | 低磷低色度的聚酰胺 |
| CN109749080B (zh) | 2018-12-26 | 2020-06-09 | 浙江新和成特种材料有限公司 | 半芳香族聚酰胺树脂及其制备方法 |
| GB2584307A (en) | 2019-05-30 | 2020-12-02 | Si Group Switzerland Chaa Gmbh | Antidegradant blend |
| GB2584305B (en) | 2019-05-30 | 2022-07-13 | Si Group Switzerland Chaa Gmbh | Antidegradant blend |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2510777A (en) * | 1946-12-30 | 1950-06-06 | Du Pont | Polyamide treated with a hypophosphorous acid compound |
| US2640044A (en) * | 1951-05-24 | 1953-05-26 | Du Pont | Heat stabilization of polyamides |
| US2705227A (en) * | 1954-03-15 | 1955-03-29 | Du Pont | Heat stabilization of polyamides |
| GB932066A (en) * | 1960-11-25 | 1963-07-24 | Ici Ltd | Polyamides |
| US3398115A (en) * | 1961-12-22 | 1968-08-20 | Argus Chem | Polyolefins stabilized with mixtures comprising an organic phosphorus acid, phosphite triester and thiodipropionate |
| US3274151A (en) * | 1962-11-21 | 1966-09-20 | Schweizerische Viscose | Polyamides containing a combination of (1) a phenol, (2) a phosphorus acid salt or ester, (3) a manganese salt, and (4) a dicarboxylic acid as stabilizers |
| CH475298A (de) * | 1964-07-17 | 1969-07-15 | Schweizerische Viscose | Verfahren zur Stabilisierung von Polyamiden |
| US3285855A (en) * | 1965-03-11 | 1966-11-15 | Geigy Chem Corp | Stabilization of organic material with esters containing an alkylhydroxy-phenyl group |
| GB1163086A (en) * | 1966-03-07 | 1969-09-04 | Ici Ltd | Polyamides. |
| US3584047A (en) * | 1967-12-29 | 1971-06-08 | Geigy Chem Corp | Alkylhydroxyphenyl polyamides |
-
1971
- 1971-02-01 US US111672A patent/US3691131A/en not_active Expired - Lifetime
-
1972
- 1972-01-31 CA CA133,496A patent/CA982729A/en not_active Expired
- 1972-01-31 DE DE19722204495 patent/DE2204495A1/de active Pending
- 1972-01-31 IT IT20033/72A patent/IT947163B/it active
- 1972-01-31 NL NL7201249A patent/NL7201249A/xx unknown
- 1972-01-31 GB GB453072A patent/GB1368776A/en not_active Expired
- 1972-02-01 FR FR727203272A patent/FR2124338B1/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013075982A1 (de) * | 2011-11-25 | 2013-05-30 | Basf Se | Blasformbare polyamidformmassen |
| US10655013B2 (en) | 2011-11-25 | 2020-05-19 | Basf Se | Blow-moldable polyamide compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| IT947163B (it) | 1973-05-21 |
| US3691131A (en) | 1972-09-12 |
| FR2124338B1 (OSRAM) | 1974-06-28 |
| CA982729A (en) | 1976-01-27 |
| NL7201249A (OSRAM) | 1972-08-03 |
| FR2124338A1 (OSRAM) | 1972-09-22 |
| GB1368776A (en) | 1974-10-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2204495A1 (de) | Stabilisierte Polyamidzusammensetzungen | |
| DE69728484T2 (de) | Polyamidzusammensetzungen mit verbesserter thermischer Stabilität | |
| DE69400136T2 (de) | Polyamide mit verbessertem farbverhalten und verbesserter verarbeitbarkeit und verfahren zu ihrer herstellung | |
| DE2158014A1 (de) | Stabilisierte Polyamidzusammen Setzungen | |
| DE1237309B (de) | Verfahren zur Herstellung waermestabilisierter Polyamide | |
| DE1595603A1 (de) | Stabilisierte Polyamide | |
| DE2341895B2 (de) | Polymermischungen auf basis von polyamiden, phosphorverbindungen und alkalimetallverbindungen mit verringerter gelbildung | |
| DE19519820A1 (de) | Thermostabile, witterungsbeständige Polyamidformmassen | |
| DE1257425B (de) | Verfahren zum Waermestabilisieren von Polyamiden | |
| CH626904A5 (OSRAM) | ||
| EP0621304A1 (de) | Flammgeschützte thermoplastische Formmassen auf der Basis von Polyamiden | |
| US3806488A (en) | Stabilized flame resistant polyamides | |
| DE2519583A1 (de) | Thermoplastische polybutylenterephthalat-formmassen | |
| DE3026503A1 (de) | Stabilisatorloesung, ihre verwendung zur stabilisierung von thermoplastischen polycarbonaten sowie stabilisierte thermoplastische polycarbonate | |
| DE1669989B2 (de) | Stabilisierte Massen auf der Basis von halogenenthaltenden Polymerisaten und Organozinnverbindungen | |
| DE1745012A1 (de) | Polyamidmasse und Verfahren zu deren Herstellung | |
| DE1568884A1 (de) | Stabilisatoren fuer Polymerisate | |
| DE68908831T2 (de) | Mischungen auf der Basis von flammwidrigen Polyamiden. | |
| DE60304568T2 (de) | Verbindungen zur reduzierung des acetaldehydgehalts von polyethylenterephthalat , ihre verwendung und daraus erhaltene produkte | |
| DE2309435A1 (de) | Verfahren zum stabilisieren von polyamiden | |
| DE1222674B (de) | Verfahren zur Herstellung von Polyamiden | |
| DE2237849A1 (de) | Aminsalze von 3,5-dialkyl-4-hydroxyphenylcarbonsaeuren und damit stabilisierte polyamidzusammensetzungen | |
| EP0463512B1 (de) | Stabilisatorkombinationen und ihre Verwendung zur Herstellung von stabilisierten, schlagzähmodifizierten Polyamiden | |
| US3242134A (en) | Polycarbonates stabilized with a manganese salt in combination with hypophosphorous acid | |
| DE1694160A1 (de) | Verfahren zur Herstellung stabilisierter Polyamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |