DE2136704A1 - Abbaufähige thermoplastische Kunststoffmasse - Google Patents
Abbaufähige thermoplastische KunststoffmasseInfo
- Publication number
- DE2136704A1 DE2136704A1 DE19712136704 DE2136704A DE2136704A1 DE 2136704 A1 DE2136704 A1 DE 2136704A1 DE 19712136704 DE19712136704 DE 19712136704 DE 2136704 A DE2136704 A DE 2136704A DE 2136704 A1 DE2136704 A1 DE 2136704A1
- Authority
- DE
- Germany
- Prior art keywords
- complex
- polymer
- plastic compound
- metal
- compound according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 26
- 229920001169 thermoplastic Polymers 0.000 title claims description 19
- 229920000642 polymer Polymers 0.000 claims description 65
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 43
- 229910052751 metal Inorganic materials 0.000 claims description 41
- 239000002184 metal Substances 0.000 claims description 41
- -1 heterocyclic radical Chemical class 0.000 claims description 29
- 125000003118 aryl group Chemical group 0.000 claims description 26
- 229920003023 plastic Polymers 0.000 claims description 24
- 239000004033 plastic Substances 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 239000003963 antioxidant agent Substances 0.000 claims description 18
- 229910052742 iron Inorganic materials 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 12
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 11
- 230000003078 antioxidant effect Effects 0.000 claims description 11
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical group C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 239000004416 thermosoftening plastic Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 150000003254 radicals Chemical class 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 229920002554 vinyl polymer Polymers 0.000 claims description 8
- 239000010949 copper Substances 0.000 claims description 7
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 150000004982 aromatic amines Chemical class 0.000 claims description 5
- 239000011651 chromium Substances 0.000 claims description 5
- 229910017052 cobalt Inorganic materials 0.000 claims description 5
- 239000010941 cobalt Substances 0.000 claims description 5
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229910052759 nickel Inorganic materials 0.000 claims description 5
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 5
- 229910052684 Cerium Inorganic materials 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- SZRLKIKBPASKQH-UHFFFAOYSA-M dibutyldithiocarbamate Chemical group CCCCN(C([S-])=S)CCCC SZRLKIKBPASKQH-UHFFFAOYSA-M 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 239000004611 light stabiliser Substances 0.000 claims description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 239000011975 tartaric acid Substances 0.000 claims description 3
- 235000002906 tartaric acid Nutrition 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- JAEZSIYNWDWMMN-UHFFFAOYSA-N 1,1,3-trimethylthiourea Chemical compound CNC(=S)N(C)C JAEZSIYNWDWMMN-UHFFFAOYSA-N 0.000 claims description 2
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 claims description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 2
- 241001233037 catfish Species 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- BOXSVZNGTQTENJ-UHFFFAOYSA-L zinc dibutyldithiocarbamate Chemical compound [Zn+2].CCCCN(C([S-])=S)CCCC.CCCCN(C([S-])=S)CCCC BOXSVZNGTQTENJ-UHFFFAOYSA-L 0.000 claims description 2
- 235000006708 antioxidants Nutrition 0.000 claims 4
- OENHQHLEOONYIE-UKMVMLAPSA-N beta-Carotene Chemical compound CC=1CCCC(C)(C)C=1/C=C/C(/C)=C/C=C/C(/C)=C/C=C/C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C OENHQHLEOONYIE-UKMVMLAPSA-N 0.000 claims 2
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 claims 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 1
- 239000002253 acid Substances 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- TUPZEYHYWIEDIH-WAIFQNFQSA-N beta-carotene Natural products CC(=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C=CC=C(/C)C=CC2=CCCCC2(C)C TUPZEYHYWIEDIH-WAIFQNFQSA-N 0.000 claims 1
- 235000013734 beta-carotene Nutrition 0.000 claims 1
- 239000011648 beta-carotene Substances 0.000 claims 1
- 229960002747 betacarotene Drugs 0.000 claims 1
- 230000003247 decreasing effect Effects 0.000 claims 1
- 229920006238 degradable plastic Polymers 0.000 claims 1
- BXYFLGJRMCIGLW-UHFFFAOYSA-N hydroxy-propan-2-yloxy-propan-2-ylsulfanyl-sulfanylidene-$l^{5}-phosphane Chemical compound CC(C)OP(O)(=S)SC(C)C BXYFLGJRMCIGLW-UHFFFAOYSA-N 0.000 claims 1
- 229920006163 vinyl copolymer Polymers 0.000 claims 1
- 239000010408 film Substances 0.000 description 23
- 239000000654 additive Substances 0.000 description 22
- 239000008139 complexing agent Substances 0.000 description 22
- 238000012545 processing Methods 0.000 description 18
- 230000015556 catabolic process Effects 0.000 description 17
- 238000006731 degradation reaction Methods 0.000 description 14
- 230000000996 additive effect Effects 0.000 description 13
- 238000007792 addition Methods 0.000 description 12
- 230000008859 change Effects 0.000 description 12
- 239000004743 Polypropylene Substances 0.000 description 9
- 125000004429 atom Chemical group 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 229920001155 polypropylene Polymers 0.000 description 9
- 239000004698 Polyethylene Substances 0.000 description 8
- 125000003342 alkenyl group Chemical group 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000155 melt Substances 0.000 description 8
- 229910021645 metal ion Inorganic materials 0.000 description 8
- 229920000573 polyethylene Polymers 0.000 description 8
- 239000011701 zinc Substances 0.000 description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- 239000011888 foil Substances 0.000 description 7
- 238000000227 grinding Methods 0.000 description 7
- 150000002989 phenols Chemical class 0.000 description 7
- 229910052725 zinc Inorganic materials 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 5
- 239000000975 dye Substances 0.000 description 5
- 235000013824 polyphenols Nutrition 0.000 description 5
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 4
- 239000004793 Polystyrene Substances 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 239000011572 manganese Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 150000008442 polyphenolic compounds Chemical class 0.000 description 4
- 229920002223 polystyrene Polymers 0.000 description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 4
- 229920000915 polyvinyl chloride Polymers 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- JXSRRBVHLUJJFC-UHFFFAOYSA-N 7-amino-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile Chemical compound N1=CC(C#N)=C(N)N2N=C(SC)N=C21 JXSRRBVHLUJJFC-UHFFFAOYSA-N 0.000 description 3
- 229930185605 Bisphenol Natural products 0.000 description 3
- 238000004566 IR spectroscopy Methods 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- 150000004696 coordination complex Chemical class 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- FRVCGRDGKAINSV-UHFFFAOYSA-L iron(2+);octadecanoate Chemical compound [Fe+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O FRVCGRDGKAINSV-UHFFFAOYSA-L 0.000 description 3
- 229920001684 low density polyethylene Polymers 0.000 description 3
- 239000004702 low-density polyethylene Substances 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 239000005022 packaging material Substances 0.000 description 3
- 229910052709 silver Inorganic materials 0.000 description 3
- 239000004332 silver Substances 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 3
- 150000003573 thiols Chemical class 0.000 description 3
- 229910052724 xenon Inorganic materials 0.000 description 3
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 3
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- PRWJPWSKLXYEPD-UHFFFAOYSA-N 4-[4,4-bis(5-tert-butyl-4-hydroxy-2-methylphenyl)butan-2-yl]-2-tert-butyl-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(C)CC(C=1C(=CC(O)=C(C=1)C(C)(C)C)C)C1=CC(C(C)(C)C)=C(O)C=C1C PRWJPWSKLXYEPD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 2
- 230000009918 complex formation Effects 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 2
- 229920001903 high density polyethylene Polymers 0.000 description 2
- BZZORYDPNKSSOZ-UHFFFAOYSA-L iron(2+);dicarbamodithioate Chemical class [Fe+2].NC([S-])=S.NC([S-])=S BZZORYDPNKSSOZ-UHFFFAOYSA-L 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- ODLMAHJVESYWTB-UHFFFAOYSA-N propylbenzene Chemical compound CCCC1=CC=CC=C1 ODLMAHJVESYWTB-UHFFFAOYSA-N 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- YHCGGLXPGFJNCO-UHFFFAOYSA-N 2-(2H-benzotriazol-4-yl)phenol Chemical compound OC1=CC=CC=C1C1=CC=CC2=C1N=NN2 YHCGGLXPGFJNCO-UHFFFAOYSA-N 0.000 description 1
- RYPKRALMXUUNKS-UHFFFAOYSA-N 2-Hexene Natural products CCCC=CC RYPKRALMXUUNKS-UHFFFAOYSA-N 0.000 description 1
- PHXLONCQBNATSL-UHFFFAOYSA-N 2-[[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methyl]-4-methyl-6-(1-methylcyclohexyl)phenol Chemical compound OC=1C(C2(C)CCCCC2)=CC(C)=CC=1CC(C=1O)=CC(C)=CC=1C1(C)CCCCC1 PHXLONCQBNATSL-UHFFFAOYSA-N 0.000 description 1
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical class C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 1
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 1
- ODJQKYXPKWQWNK-UHFFFAOYSA-N 3,3'-Thiobispropanoic acid Chemical compound OC(=O)CCSCCC(O)=O ODJQKYXPKWQWNK-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- BDDLHHRCDSJVKV-UHFFFAOYSA-N 7028-40-2 Chemical compound CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O BDDLHHRCDSJVKV-UHFFFAOYSA-N 0.000 description 1
- 239000004604 Blowing Agent Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 150000000703 Cerium Chemical class 0.000 description 1
- GHKOFFNLGXMVNJ-UHFFFAOYSA-N Didodecyl thiobispropanoate Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCC GHKOFFNLGXMVNJ-UHFFFAOYSA-N 0.000 description 1
- 239000003508 Dilauryl thiodipropionate Substances 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical group OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241001417501 Lobotidae Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000003064 anti-oxidating effect Effects 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 238000006701 autoxidation reaction Methods 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- MLSVGAXOQBMEGH-UHFFFAOYSA-N benzo[c][1,5]benzodioxocine-6,12-dione Chemical compound O=C1OC2=CC=CC=C2C(=O)OC2=CC=CC=C12 MLSVGAXOQBMEGH-UHFFFAOYSA-N 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical class [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical class NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 239000013039 cover film Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 229940116901 diethyldithiocarbamate Drugs 0.000 description 1
- 235000019304 dilauryl thiodipropionate Nutrition 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 150000004659 dithiocarbamates Chemical class 0.000 description 1
- NAGJZTKCGNOGPW-UHFFFAOYSA-N dithiophosphoric acid Chemical class OP(O)(S)=S NAGJZTKCGNOGPW-UHFFFAOYSA-N 0.000 description 1
- HKIGPMUNBXIAHY-UHFFFAOYSA-N ethyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate;sulfuric acid;hydrochloride Chemical compound Cl.OS(O)(=O)=O.CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1.C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1CCC(C#N)(C=1C=CC=CC=1)C1=CC=CC=C1 HKIGPMUNBXIAHY-UHFFFAOYSA-N 0.000 description 1
- 125000003916 ethylene diamine group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 239000005357 flat glass Substances 0.000 description 1
- 229960000304 folic acid Drugs 0.000 description 1
- 235000019152 folic acid Nutrition 0.000 description 1
- 239000011724 folic acid Substances 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229920005669 high impact polystyrene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 239000004797 high-impact polystyrene Substances 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000004698 iron complex Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229940080256 lonox Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 239000010813 municipal solid waste Substances 0.000 description 1
- WTAJDDHWXARSLK-UHFFFAOYSA-L n,n-diethylcarbamodithioate;iron(2+) Chemical compound [Fe+2].CCN(CC)C([S-])=S.CCN(CC)C([S-])=S WTAJDDHWXARSLK-UHFFFAOYSA-L 0.000 description 1
- 239000012785 packaging film Substances 0.000 description 1
- 229920006280 packaging film Polymers 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000001782 photodegradation Methods 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Chemical group CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000013074 reference sample Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000002798 spectrophotometry method Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 235000019303 thiodipropionic acid Nutrition 0.000 description 1
- 125000005323 thioketone group Chemical group 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0091—Complexes with metal-heteroatom-bonds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S260/00—Chemistry of carbon compounds
- Y10S260/43—Promoting degradability of polymers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1282671*[A GB1356107A (en) | 1970-07-22 | 1970-07-22 | Polymer compositions |
| GB1282671 | 1971-05-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2136704A1 true DE2136704A1 (de) | 1972-01-27 |
Family
ID=26249298
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712136704 Pending DE2136704A1 (de) | 1970-07-22 | 1971-07-22 | Abbaufähige thermoplastische Kunststoffmasse |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4121025A (enExample) |
| JP (1) | JPS5142137B1 (enExample) |
| BE (1) | BE770202A (enExample) |
| CA (1) | CA990498A (enExample) |
| DE (1) | DE2136704A1 (enExample) |
| FR (1) | FR2099518B1 (enExample) |
| GB (1) | GB1356107A (enExample) |
| NL (1) | NL7110135A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3992487A (en) * | 1973-10-31 | 1976-11-16 | Bayer Aktiengesellschaft | Degradable plastics compositions containing a transition metal complexed with a 1,3-dicarbonyl group containing polymer |
| EP0181473A1 (en) * | 1984-10-31 | 1986-05-21 | Fiocchi Munizioni Spa | Components for cartridge for hunting, shooting purposes and the like of photodegradable synthetic plastic material |
| WO1992018826A1 (en) * | 1991-04-22 | 1992-10-29 | The Kent Cartridge Manufacturing Company Limited | Shot-gun cartridge case |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3941759A (en) | 1972-03-01 | 1976-03-02 | Owens-Illinois, Inc. | Degradable plastics containing dual-function additive system |
| US4048410A (en) * | 1972-03-17 | 1977-09-13 | Owens-Illinois, Inc. | Environmentally degradable polymer compositions |
| US4495311A (en) * | 1972-07-06 | 1985-01-22 | Princeton Polymer Laboratories, Inc. | Degradable hydrocarbon polymers |
| US3830764A (en) * | 1972-07-06 | 1974-08-20 | Princeton Polymer Lab | Degradable hydrocarbon polymers |
| GB1458817A (en) * | 1973-07-09 | 1976-12-15 | Charbonnages Ste Chimique | Photodegradable olefin polymer compositions |
| FR2307840A1 (fr) * | 1975-04-17 | 1976-11-12 | Charbonnages Ste Chimique | Compositions polymeres degradables a la lumiere |
| US4519161A (en) * | 1977-09-21 | 1985-05-28 | Dan Gilead | Agricultural process using controllably degradable polymer composition film |
| IL52974A0 (en) * | 1977-09-21 | 1977-11-30 | Plastopil Hazorea | Agricultural process film products for carrying out the process and controllably degradable polymer compositions for making said film products |
| US4192757A (en) * | 1978-04-21 | 1980-03-11 | Exxon Research & Engineering Company | Alkyl phenol solutions of organo molybdenum complexes as friction reducing antiwear additives |
| US4201683A (en) * | 1978-04-21 | 1980-05-06 | Exxon Research & Engineering Co. | Alkanol solutions of organo molybdenum complexes as friction reducing antiwear additives |
| GB8415305D0 (en) * | 1984-06-15 | 1984-07-18 | Robinson Bros Ltd | Stabilising polymers and films |
| US4759955A (en) * | 1985-05-20 | 1988-07-26 | The Boeing Company | Protective, decorative and restorative coating composition and method |
| DE3670855D1 (de) * | 1985-08-28 | 1990-06-07 | Akzo Nv | Photosensibilisierende zusammensetzungen und diese enthaltende unter lichteinwirkung abbaubare polymerzusammensetzung. |
| KR910003404B1 (ko) * | 1985-12-31 | 1991-05-30 | 더 다우 케미칼 캄파니 | 광분해제, 광분해성 에틸렌 중합체 조성물 및 이로부터 제조된 제품 |
| GB2187193B (en) * | 1986-02-27 | 1989-11-08 | Gerald Scott | Controllably and swiftly degradable polymer compositions and films and other products made therefrom |
| US5096941A (en) * | 1990-08-23 | 1992-03-17 | The Dow Chemical Company | Environmentally degradable polyethylene composition |
| US5274019A (en) * | 1990-10-25 | 1993-12-28 | Robinson Brothers Limited | Photodegradable compositions |
| TW210995B (enExample) * | 1991-09-19 | 1993-08-11 | Asahi Chemical Ind | |
| US5518730A (en) | 1992-06-03 | 1996-05-21 | Fuisz Technologies Ltd. | Biodegradable controlled release flash flow melt-spun delivery system |
| WO1996017007A1 (en) * | 1994-12-02 | 1996-06-06 | Cape Cod Research, Inc. | Zinc oxide photoactive material |
| US5916947A (en) * | 1994-12-02 | 1999-06-29 | Cape Cod Research, Inc. | Zinc oxide photoactive antifoulant material |
| US5827904A (en) * | 1996-09-27 | 1998-10-27 | Hahn; David | Medical implant composition |
| US6057015A (en) * | 1997-09-02 | 2000-05-02 | Burlington Bio-Medical And Scientific Corporation | Containers and methods for waste recycling |
| TW546348B (en) * | 1997-12-24 | 2003-08-11 | Sumitomo Dow Ltd | Transparent resin compositions with near infrared absorption characteristics |
| US6277907B1 (en) | 1998-11-09 | 2001-08-21 | Uniroyal Chemical Company, Inc. | Thermoplastic resins stabilized by blends of sterically hindered phenols, secondary amines, and thioethers |
| US6790888B2 (en) | 2001-05-16 | 2004-09-14 | Crompton Corporation | Thermoplastic resins in contact with metals or metal salts stabilized by blends of dithiocarbamates and metal deactivators |
| US20040259974A1 (en) * | 2003-06-18 | 2004-12-23 | Gerald Scott | Biodegradable polymer compositions with controlled lifetimes |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2765292A (en) * | 1953-04-15 | 1956-10-02 | Union Carbide & Carbon Corp | Stabilization of synthetic rubber-modified polystyrenes with hydroquinone monoethersand dithiocarbamic acid salts |
| US2789962A (en) * | 1953-04-15 | 1957-04-23 | Union Carbide & Carbon Corp | Stabilization of synthetic rubber-modified polystyrenes with aryl secondary amines and dithiocarbamic acid salts |
| IT580901A (enExample) * | 1957-01-29 | |||
| DE1244399B (de) * | 1959-09-28 | 1967-07-13 | Du Pont | Normalerweise feste, pigmentierte Formmassen aus Polyolefinen |
| NL259977A (enExample) * | 1960-06-07 | |||
| GB1047482A (enExample) * | 1963-01-23 | 1900-01-01 | ||
| US3349018A (en) * | 1963-10-28 | 1967-10-24 | Union Carbide Corp | Controllable degradation of alpha-olefin polymers using irradiation |
| NL127902C (enExample) * | 1964-02-21 | |||
| GB1128793A (en) * | 1964-11-16 | 1968-10-02 | Eastman Kodak Co | Articles |
| US3454510A (en) * | 1966-03-03 | 1969-07-08 | Eastman Kodak Co | Polyolefin compositions and degradable films made therefrom |
| GB1231021A (enExample) * | 1967-04-18 | 1971-05-05 | ||
| US3563849A (en) * | 1968-06-14 | 1971-02-16 | Goodyear Tire & Rubber | Isocyanate modified polyester reinforcing elements and rubber structures made therefrom |
| US3825627A (en) * | 1971-07-06 | 1974-07-23 | Dow Chemical Co | Ethylene polymer composition having enhanced photodegradability |
-
1970
- 1970-07-22 GB GB1282671*[A patent/GB1356107A/en not_active Expired
-
1971
- 1971-07-19 BE BE770202A patent/BE770202A/xx unknown
- 1971-07-20 US US05/164,462 patent/US4121025A/en not_active Expired - Lifetime
- 1971-07-20 CA CA118,658A patent/CA990498A/en not_active Expired
- 1971-07-21 FR FR717126715A patent/FR2099518B1/fr not_active Expired
- 1971-07-22 NL NL7110135A patent/NL7110135A/xx not_active Application Discontinuation
- 1971-07-22 JP JP46054285A patent/JPS5142137B1/ja active Pending
- 1971-07-22 DE DE19712136704 patent/DE2136704A1/de active Pending
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3992487A (en) * | 1973-10-31 | 1976-11-16 | Bayer Aktiengesellschaft | Degradable plastics compositions containing a transition metal complexed with a 1,3-dicarbonyl group containing polymer |
| EP0181473A1 (en) * | 1984-10-31 | 1986-05-21 | Fiocchi Munizioni Spa | Components for cartridge for hunting, shooting purposes and the like of photodegradable synthetic plastic material |
| WO1992018826A1 (en) * | 1991-04-22 | 1992-10-29 | The Kent Cartridge Manufacturing Company Limited | Shot-gun cartridge case |
| GB2270366A (en) * | 1991-04-22 | 1994-03-09 | Kent Cartridge Mfg | Shot-gun cartridge case |
| GB2270366B (en) * | 1991-04-22 | 1995-01-11 | Kent Cartridge Mfg | Shot-gun cartridge case |
| US5549048A (en) * | 1991-04-22 | 1996-08-27 | The Kent Cartridge Manufacturing Company Limited | Biodegradable shot-gun cartridge case |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2099518A1 (enExample) | 1972-03-17 |
| CA990498A (en) | 1976-06-08 |
| US4121025A (en) | 1978-10-17 |
| BE770202A (fr) | 1972-01-19 |
| JPS5142137B1 (enExample) | 1976-11-13 |
| NL7110135A (enExample) | 1972-01-25 |
| GB1356107A (en) | 1974-06-12 |
| FR2099518B1 (enExample) | 1973-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2136704A1 (de) | Abbaufähige thermoplastische Kunststoffmasse | |
| DE3019632C2 (de) | Verwendung eines Hydrotalcits bestimmter Zusammensetzung zur Inhibierung des thermischen oder Ultraviolett-Abbaus von thermoplastischen Harzen | |
| DE1953143C3 (de) | Tris-hydroxybenzyl-isocyanurate und deren Verwendung zum Stabilisieren von Polymeren | |
| DE2839867C2 (de) | Geregelt abbaubare, ein film- oder faserbildendes Vinylpolymeres enthaltende Zubereitung | |
| DE1130163B (de) | Verfahren zum Vernetzen von amorphem Polypropylen oder amorphen Mischpolymeren aus AEthylen und Propylen | |
| DE1282019B (de) | Hitze- und UV-Schutzmittel fuer organische Stoffe | |
| DE2629202B2 (de) | Stabilisatorkombination für Vinylhalogenid-Polymerisate | |
| DE1138943B (de) | Verfahren zur Herstellung chlorierter kautschukartiger Mischpolymerisate von Isoolefinen mit Multiolefinen | |
| DE2261778C3 (de) | Abbaubare Polyolefinfolien | |
| DE1769646A1 (de) | Stabilisierung von synthetischen Polymeren | |
| DE2545292B2 (de) | Azaadamantanverbindungen als Stabilisatoren für organische Polymerisatzusammensetzungen | |
| EP0277593B1 (de) | Photoabbaubare Polymer-Formmassen | |
| DE2214810C3 (de) | Verfahren zur Mastizierung von natürlichen und/oder synthetischen Kautschuken und Mastiziermittel | |
| EP0002539A2 (de) | Selbstverlöschende, expandierbare Styrolpolymerisate und deren Verwendung zur Herstellung von Schaumstoffen | |
| DE1569597A1 (de) | Licht- und Waermestabilisierung von Hart-Polyvinylchlorid | |
| EP0477748B1 (de) | Formmassen auf Basis Polyethylen mit einer mittleren Molmasse von mindestens 10 hoch 6 g/mol | |
| Hutson et al. | The effect of processing on the light stability of stabilized and unstabilized polyethylene | |
| DE2118298A1 (de) | Verwendung von Piperidonazinen zum Stabilisieren von organischem Material | |
| DE4119097C2 (de) | In organischen Lösungsmitteln löslicher chlorierter Kautschuk und Verfahren zu seiner Herstellung | |
| DE2007942A1 (de) | UV-Absorberkombination für Polypropylen-Polyvinylpyridin | |
| DE2017044C3 (de) | Nickel-Amid-Komplexe von 2,2'Thiobis-(p-t-octylphenol) und ein Verfahren zu ihrer Herstellung | |
| DE1469810B2 (de) | Thermoplastische massen | |
| DE3025139C2 (de) | Flammwidrige thermoplastische Harzmasse | |
| DE1793192C3 (de) | Verfahren zur Herstellung von Bisphenol-Oligomeren und ihre Verwendung als Antioxidantien zur Stabilisierung von Polymeren bzw. Polymergemischen | |
| DE3587983T2 (de) | Verfahren zum Pflanzenschutz durch stabilisierte Polymerfilme. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| OHW | Rejection |