DE2135140B2 - Alkoxydinitroaniline und ihre Verwendung - Google Patents
Alkoxydinitroaniline und ihre VerwendungInfo
- Publication number
- DE2135140B2 DE2135140B2 DE2135140A DE2135140A DE2135140B2 DE 2135140 B2 DE2135140 B2 DE 2135140B2 DE 2135140 A DE2135140 A DE 2135140A DE 2135140 A DE2135140 A DE 2135140A DE 2135140 B2 DE2135140 B2 DE 2135140B2
- Authority
- DE
- Germany
- Prior art keywords
- dinitro
- methoxy
- oil
- trifluoromethylaniline
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 claims description 17
- 241000196324 Embryophyta Species 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 4
- 230000012010 growth Effects 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 239000003921 oil Substances 0.000 description 29
- 235000019198 oils Nutrition 0.000 description 29
- 239000000047 product Substances 0.000 description 18
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- -1 η-butyl Chemical group 0.000 description 10
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 244000068988 Glycine max Species 0.000 description 8
- 235000010469 Glycine max Nutrition 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 240000000321 Abutilon grandifolium Species 0.000 description 7
- 235000003403 Limnocharis flava Nutrition 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- 239000012141 concentrate Substances 0.000 description 5
- 239000004009 herbicide Substances 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- 230000035784 germination Effects 0.000 description 4
- 230000002363 herbicidal effect Effects 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 244000075850 Avena orientalis Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 244000062793 Sorghum vulgare Species 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 210000003608 fece Anatomy 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 235000019713 millet Nutrition 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- SVYOXGBINYWSDQ-UHFFFAOYSA-N 1,4-dioxane;ethanol Chemical compound CCO.C1COCCO1 SVYOXGBINYWSDQ-UHFFFAOYSA-N 0.000 description 2
- CGNBQYFXGQHUQP-UHFFFAOYSA-N 2,3-dinitroaniline Chemical class NC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O CGNBQYFXGQHUQP-UHFFFAOYSA-N 0.000 description 2
- KTHQZVGFYJIYDM-UHFFFAOYSA-N 3-methoxy-2,6-dinitro-N-pentan-3-yl-4-(trifluoromethyl)aniline Chemical compound CCC(CC)NC1=C(C(=C(C=C1[N+](=O)[O-])C(F)(F)F)OC)[N+](=O)[O-] KTHQZVGFYJIYDM-UHFFFAOYSA-N 0.000 description 2
- 240000001592 Amaranthus caudatus Species 0.000 description 2
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 2
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 2
- 244000055702 Amaranthus viridis Species 0.000 description 2
- 235000004135 Amaranthus viridis Nutrition 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- 235000009344 Chenopodium album Nutrition 0.000 description 2
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 2
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 2
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 2
- 240000003176 Digitaria ciliaris Species 0.000 description 2
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 2
- 235000005476 Digitaria cruciata Nutrition 0.000 description 2
- 235000006830 Digitaria didactyla Nutrition 0.000 description 2
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- 235000014716 Eleusine indica Nutrition 0.000 description 2
- 244000038012 Fimbristylis barbata Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 235000015225 Panicum colonum Nutrition 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- KXHORCXSQZTQQI-UHFFFAOYSA-N n-(fluoromethyl)aniline Chemical compound FCNC1=CC=CC=C1 KXHORCXSQZTQQI-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- ZVKOAWGELPXYAQ-UHFFFAOYSA-N 3-chloro-2,6-dinitro-n-pentan-3-yl-4-(trifluoromethyl)aniline Chemical compound CCC(CC)NC1=C([N+]([O-])=O)C=C(C(F)(F)F)C(Cl)=C1[N+]([O-])=O ZVKOAWGELPXYAQ-UHFFFAOYSA-N 0.000 description 1
- CIJMEKRWBOEOBK-UHFFFAOYSA-N 3-chloro-2,6-dinitro-n-propan-2-yl-4-(trifluoromethyl)aniline Chemical compound CC(C)NC1=C([N+]([O-])=O)C=C(C(F)(F)F)C(Cl)=C1[N+]([O-])=O CIJMEKRWBOEOBK-UHFFFAOYSA-N 0.000 description 1
- FXWLMORKZWOODN-UHFFFAOYSA-N 3-methoxy-4-methyl-2,6-dinitro-n,n-dipropylaniline Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C)C(OC)=C1[N+]([O-])=O FXWLMORKZWOODN-UHFFFAOYSA-N 0.000 description 1
- DCTWCMVWUAMVDG-UHFFFAOYSA-N 4-bromo-N,N-diethyl-3-methoxy-2,6-dinitroaniline Chemical compound CCN(CC)C1=C(C(OC)=C(Br)C=C1[N+]([O-])=O)[N+]([O-])=O DCTWCMVWUAMVDG-UHFFFAOYSA-N 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 240000001549 Ipomoea eriocarpa Species 0.000 description 1
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 241001268782 Paspalum dilatatum Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- RCDQLHUTVHEJSV-UHFFFAOYSA-N n-butan-2-yl-3-methoxy-4-methyl-2,6-dinitroaniline Chemical compound CCC(C)NC1=C([N+]([O-])=O)C=C(C)C(OC)=C1[N+]([O-])=O RCDQLHUTVHEJSV-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N33/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic nitrogen compounds
- A01N33/16—Biocides, pest repellants or attractants, or plant growth regulators containing organic nitrogen compounds containing nitrogen-to-oxygen bonds
- A01N33/18—Nitro compounds
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Dentistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Plant Pathology (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US6142870A | 1970-08-05 | 1970-08-05 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2135140A1 DE2135140A1 (de) | 1972-02-10 |
| DE2135140B2 true DE2135140B2 (de) | 1980-06-19 |
Family
ID=22035710
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2135140A Withdrawn DE2135140B2 (de) | 1970-08-05 | 1971-07-14 | Alkoxydinitroaniline und ihre Verwendung |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3764624A (cg-RX-API-DMAC7.html) |
| AT (1) | AT311315B (cg-RX-API-DMAC7.html) |
| AU (1) | AU459328B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE770936A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7104999D0 (cg-RX-API-DMAC7.html) |
| CA (1) | CA943957A (cg-RX-API-DMAC7.html) |
| CH (1) | CH565739A5 (cg-RX-API-DMAC7.html) |
| DD (1) | DD96136A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2135140B2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES393862A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2101862A5 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1308841A (cg-RX-API-DMAC7.html) |
| IL (1) | IL37406A (cg-RX-API-DMAC7.html) |
| IT (1) | IT941655B (cg-RX-API-DMAC7.html) |
| NL (1) | NL150659B (cg-RX-API-DMAC7.html) |
| OA (1) | OA03772A (cg-RX-API-DMAC7.html) |
| PL (1) | PL83205B1 (cg-RX-API-DMAC7.html) |
| SU (1) | SU370753A3 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA715199B (cg-RX-API-DMAC7.html) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4227913A (en) * | 1971-06-30 | 1980-10-14 | American Cyanamid Company | Inhibiting plant bud growth with substituted 2,6-dinitroanilines |
| US4251264A (en) * | 1971-08-25 | 1981-02-17 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4165231A (en) * | 1971-08-25 | 1979-08-21 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US3920742A (en) * | 1971-08-25 | 1975-11-18 | American Cyanamid Co | N-sec-alkyl-2,6-dinitro-3,4-xylidine herbicides |
| US4066441A (en) * | 1971-08-25 | 1978-01-03 | American Cyanamid Company | Preemergence herbicidal methods and compositions using 2,6-dinitroxylidine compounds |
| US4166908A (en) * | 1971-08-25 | 1979-09-04 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4057419A (en) * | 1972-02-29 | 1977-11-08 | Bayer Aktiengesellschaft | 2,4-Bis-(trifluoromethyl)-6-nitrophenol compounds and herbicidal compositions |
| US4123250A (en) * | 1972-04-19 | 1978-10-31 | American Cyanamid Company | Inhibiting plant bud growth with substituted 2,6-di-nitroanilines |
| US4041172A (en) * | 1972-12-20 | 1977-08-09 | Imperial Chemical Industries Limited | Compositions and methods for combating insect pests or fungal pests of plants |
| US3950377A (en) * | 1972-12-20 | 1976-04-13 | Imperial Chemical Industries Limited | Diphenylamine derivatives |
| US4046758A (en) * | 1974-03-05 | 1977-09-06 | United States Borax & Chemical Corporation | 3-Halo-2,6-dinitro-4-trifluoromethylanilines |
| US4192670A (en) * | 1974-10-15 | 1980-03-11 | Eli Lilly And Company | Acetal derivatives of 4-(substituted amino)-3,5-dinitrobenzaldehydes |
| CA1106390A (en) * | 1974-12-04 | 1981-08-04 | Don L. Hunter | Nitrophenylhydrazine compounds |
| US3958974A (en) * | 1974-12-20 | 1976-05-25 | Velsicol Chemical Corporation | Herbicidal N-aryl substituted azetidinones |
| US3979453A (en) * | 1975-06-23 | 1976-09-07 | Eli Lilly And Company | 3-Cyanamino-2,6-dinitroanilines |
| US4180568A (en) * | 1975-06-23 | 1979-12-25 | Eli Lilly And Company | Control of phytopathogens with certain 2,6-dinitroanilines |
| US4101582A (en) * | 1975-12-22 | 1978-07-18 | American Cyanamid Company | 2,6-Dinitroaniline herbicides |
| US4124639A (en) * | 1975-12-22 | 1978-11-07 | America Cyanamid Company | N-alkoxyalkyl-2,6-dinitroaniline herbicides |
| US4045466A (en) * | 1976-03-19 | 1977-08-30 | Eli Lilly And Company | 3-Cyanoalkylthio- or 3-alkoxycarbonylmethylthio-2,6-di-nitroanilines |
| US4133672A (en) * | 1977-02-07 | 1979-01-09 | United States Borax & Chemical Corporation | (Aminophenyl)morpholines and use thereof |
| US4297127A (en) * | 1977-03-11 | 1981-10-27 | American Cyanamid Company | Herbicidal use of 2,6-dinitroaniline herbicides |
| US4152460A (en) * | 1978-01-30 | 1979-05-01 | Eli Lilly And Company | 3-Chloro-2,6-dinitro-N-(substituted phenyl)-4-(trifluoromethyl)benzenamines |
| US4259347A (en) * | 1978-02-16 | 1981-03-31 | Eli Lilly And Company | Control of phytopathogens using dinitroaniline compounds |
| US4391992A (en) * | 1979-08-24 | 1983-07-05 | American Cyanamid Company | N-Denitration of N,2,6-trinitroanilines with phase transfer catalysts |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU36400A1 (cg-RX-API-DMAC7.html) * | 1957-09-17 | |||
| BE628133A (cg-RX-API-DMAC7.html) * | 1962-02-08 | |||
| US3257190A (en) * | 1962-12-10 | 1966-06-21 | Lilly Co Eli | Method of eliminating weed grasses and broadleaf weeds |
| US3403180A (en) * | 1963-10-07 | 1968-09-24 | Lilly Co Eli | 4-trifluoromethyl-2, 6-dinitroanilines |
| US3518076A (en) * | 1967-05-17 | 1970-06-30 | Lilly Co Eli | Method of fliminating weed species with herbicidal combination |
| US3546295A (en) * | 1968-08-01 | 1970-12-08 | Exxon Research Engineering Co | N-cycloalkyl anilines |
-
1970
- 1970-08-05 US US00061428A patent/US3764624A/en not_active Expired - Lifetime
-
1971
- 1971-06-10 CA CA115,378A patent/CA943957A/en not_active Expired
- 1971-07-14 DE DE2135140A patent/DE2135140B2/de not_active Withdrawn
- 1971-07-20 FR FR7126470A patent/FR2101862A5/fr not_active Expired
- 1971-07-22 GB GB3488971A patent/GB1308841A/en not_active Expired
- 1971-07-26 AT AT646271A patent/AT311315B/de not_active IP Right Cessation
- 1971-07-28 CH CH1114071A patent/CH565739A5/xx not_active IP Right Cessation
- 1971-07-28 IL IL37406A patent/IL37406A/en unknown
- 1971-08-03 PL PL1971149810A patent/PL83205B1/pl unknown
- 1971-08-03 DD DD161898A patent/DD96136A5/xx unknown
- 1971-08-03 ES ES393862A patent/ES393862A1/es not_active Expired
- 1971-08-04 IT IT27180/71A patent/IT941655B/it active
- 1971-08-04 BE BE770936A patent/BE770936A/xx unknown
- 1971-08-04 BR BR4999/71A patent/BR7104999D0/pt unknown
- 1971-08-04 AU AU32014/71A patent/AU459328B2/en not_active Expired
- 1971-08-04 ZA ZA715199A patent/ZA715199B/xx unknown
- 1971-08-05 SU SU1689351A patent/SU370753A3/ru active
- 1971-08-05 OA OA54323A patent/OA03772A/xx unknown
- 1971-08-05 NL NL717110826A patent/NL150659B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR7104999D0 (pt) | 1973-02-15 |
| NL7110826A (cg-RX-API-DMAC7.html) | 1972-02-08 |
| BE770936A (fr) | 1971-12-16 |
| GB1308841A (en) | 1973-03-07 |
| AT311315B (de) | 1973-11-12 |
| DD96136A5 (cg-RX-API-DMAC7.html) | 1973-03-12 |
| IT941655B (it) | 1973-03-10 |
| SU370753A3 (cg-RX-API-DMAC7.html) | 1973-02-15 |
| AU3201471A (en) | 1973-02-08 |
| OA03772A (fr) | 1971-12-24 |
| DE2135140A1 (de) | 1972-02-10 |
| CH565739A5 (cg-RX-API-DMAC7.html) | 1975-08-29 |
| CA943957A (en) | 1974-03-19 |
| PL83205B1 (cg-RX-API-DMAC7.html) | 1975-12-31 |
| ES393862A1 (es) | 1974-07-16 |
| IL37406A0 (en) | 1971-10-20 |
| US3764624A (en) | 1973-10-09 |
| AU459328B2 (en) | 1975-03-20 |
| IL37406A (en) | 1976-02-29 |
| NL150659B (nl) | 1976-09-15 |
| ZA715199B (en) | 1972-04-26 |
| FR2101862A5 (cg-RX-API-DMAC7.html) | 1972-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2135140B2 (de) | Alkoxydinitroaniline und ihre Verwendung | |
| DE814742C (de) | Das Pflanzenwachstum regulierende und phytocide Mittel | |
| DE1542725A1 (de) | Neuartige Unkrautvernichtungsmittel | |
| DE2406475C2 (de) | 5-Acetamido-2,4-dimethyltrifluormethansulfonanilid und dessen landwirtschaftlich geeignete Salze, Verfahren zur Herstellung dieser Verbindungen und diese Verbindungen enthaltende Mittel | |
| DE2609280A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE2002764A1 (de) | Thiadiazolharnstoffderivate | |
| DE1542755A1 (de) | Verfahren zur Herstellung von Unkrautvernichtungsmitteln,diese enthaltende Mittel und deren Anwendung | |
| DE1593755A1 (de) | Neue quaternaere Ammoniumsalze und ihre Verwendung als mikrobizide Wirkstoffe | |
| DE1137259B (de) | Selektive Bekaempfung von Fingerhirse | |
| EP0013660B1 (de) | Aminoalkylester der 2-Nitro-5-(ortho-chlor-para-trifluor-methylphenoxy)-benzoesäure, deren Herstellung, sie als Wirkstoff enthaltende herbizide Mittel und deren Verwendung | |
| CH632997A5 (en) | Plant growth regulator | |
| DD142282A5 (de) | Zusammensetzungen zur bekaempfung von pflanzenkrankheiten | |
| DE2241408C2 (de) | 2,6-Dinitroaniline, Verfahren zu ihrer Herstellung und diese enthaltende herbizide Vorauflaufmittel | |
| DE2013508C3 (de) | 6-Halo-2,4-dinitro-,3-phenylendiamine | |
| DE2136616A1 (de) | 2,4 Dinitro 1,3 phenylendiamine und ihre Verwendung | |
| DE2061133A1 (de) | Pestizide Verbindung,Verfahren zu ihrer Herstellung und Verwendung | |
| DE2136617A1 (de) | Alkoxytrifluormethylanihne und ihre Verwendung | |
| DE971511C (de) | Mittel zur Unkrautbekaempfung | |
| DE2055399C3 (de) | 3-Chlor-oder 3-Brom-2,6-dinitro-4trifluormethylaniline | |
| DE2518542A1 (de) | Biocides mittel | |
| DE2239213A1 (de) | Pyrimidinderivate, deren herstellung und deren verwendung | |
| DE2601447A1 (de) | Cyclohexen-ester | |
| DD236868A5 (de) | Mittel zum protahieren der wirkungsdauer und zur erhoehung der selektivitaet von herbiziden zusammensetzungen | |
| EP0092632B1 (de) | Neue Benzonitrilderivate, Verfahren zu ihrer Herstellung und herbicide Mittel | |
| DE3006160A1 (de) | 2-hydroxybenzamidderivate und deren verwendung als fungizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| BHN | Withdrawal |