DE2131944B2 - Verfahren zur herstellung von 6-desoxy-6-desmethyl-6-methylen-5-hydroxytetracyclin und/oder 6-desoxy-5-hydroxytetracyclin - Google Patents
Verfahren zur herstellung von 6-desoxy-6-desmethyl-6-methylen-5-hydroxytetracyclin und/oder 6-desoxy-5-hydroxytetracyclinInfo
- Publication number
- DE2131944B2 DE2131944B2 DE19712131944 DE2131944A DE2131944B2 DE 2131944 B2 DE2131944 B2 DE 2131944B2 DE 19712131944 DE19712131944 DE 19712131944 DE 2131944 A DE2131944 A DE 2131944A DE 2131944 B2 DE2131944 B2 DE 2131944B2
- Authority
- DE
- Germany
- Prior art keywords
- deoxy
- desmethyl
- hydroxytetracycline
- methylene
- hydrazine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 20
- 238000002360 preparation method Methods 0.000 title claims description 5
- PTNZGHXUZDHMIQ-UHFFFAOYSA-N 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide;hydrochloride Chemical compound Cl.C1=CC=C2C(C)C(C(O)C3C(C(O)=C(C(N)=O)C(=O)C3N(C)C)(O)C3=O)C3=C(O)C2=C1O PTNZGHXUZDHMIQ-UHFFFAOYSA-N 0.000 title 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 35
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 22
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 21
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 16
- 229910052763 palladium Inorganic materials 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 230000015572 biosynthetic process Effects 0.000 claims description 9
- 239000007858 starting material Substances 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 238000005695 dehalogenation reaction Methods 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 8
- XIYOPDCBBDCGOE-IWVLMIASSA-N (4s,4ar,5s,5ar,12ar)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide Chemical compound C=C1C2=CC=CC(O)=C2C(O)=C2[C@@H]1[C@H](O)[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]1(O)C2=O XIYOPDCBBDCGOE-IWVLMIASSA-N 0.000 claims description 5
- 239000004098 Tetracycline Substances 0.000 claims description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 5
- 229940042016 methacycline Drugs 0.000 claims description 5
- 229910052697 platinum Inorganic materials 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 235000019364 tetracycline Nutrition 0.000 claims description 4
- 102000016736 Cyclin Human genes 0.000 claims description 3
- 108050006400 Cyclin Proteins 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- 239000002609 medium Substances 0.000 claims description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 3
- 239000000047 product Substances 0.000 claims description 3
- 229960002180 tetracycline Drugs 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 239000003242 anti bacterial agent Substances 0.000 claims description 2
- 229940088710 antibiotic agent Drugs 0.000 claims description 2
- 230000006378 damage Effects 0.000 claims description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 2
- -1 methylene tetracyclines Chemical class 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 229940040944 tetracyclines Drugs 0.000 claims description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims 6
- 230000003197 catalytic effect Effects 0.000 claims 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims 2
- 239000007795 chemical reaction product Substances 0.000 claims 2
- 238000005984 hydrogenation reaction Methods 0.000 claims 2
- IWVCMVBTMGNXQD-PXOLEDIWSA-N oxytetracycline Chemical compound C1=CC=C2[C@](O)(C)[C@H]3[C@H](O)[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-PXOLEDIWSA-N 0.000 claims 2
- 235000009518 sodium iodide Nutrition 0.000 claims 2
- 229910052717 sulfur Inorganic materials 0.000 claims 2
- 239000011593 sulfur Substances 0.000 claims 2
- 229930101283 tetracycline Natural products 0.000 claims 2
- 150000003522 tetracyclines Chemical class 0.000 claims 2
- 229910052725 zinc Inorganic materials 0.000 claims 2
- 239000011701 zinc Substances 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000004100 Oxytetracycline Substances 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims 1
- 238000006887 Ullmann reaction Methods 0.000 claims 1
- 239000012736 aqueous medium Substances 0.000 claims 1
- 239000006227 byproduct Substances 0.000 claims 1
- GRWZHXKQBITJKP-UHFFFAOYSA-N dithionous acid Chemical compound OS(=O)S(O)=O GRWZHXKQBITJKP-UHFFFAOYSA-N 0.000 claims 1
- 230000000694 effects Effects 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 229960000625 oxytetracycline Drugs 0.000 claims 1
- 235000019366 oxytetracycline Nutrition 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 239000011780 sodium chloride Substances 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims 1
- IWVCMVBTMGNXQD-UHFFFAOYSA-N terramycin dehydrate Natural products C1=CC=C2C(O)(C)C3C(O)C4C(N(C)C)C(O)=C(C(N)=O)C(=O)C4(O)C(O)=C3C(=O)C2=C1O IWVCMVBTMGNXQD-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 5
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 5
- MOODSJOROWROTO-UHFFFAOYSA-N salicylsulfuric acid Chemical compound OC(=O)C1=CC=CC=C1OS(O)(=O)=O MOODSJOROWROTO-UHFFFAOYSA-N 0.000 description 5
- 229940071103 sulfosalicylate Drugs 0.000 description 5
- YCPXWRQRBFJBPZ-UHFFFAOYSA-N 5-sulfosalicylic acid Chemical compound OC(=O)C1=CC(S(O)(=O)=O)=CC=C1O YCPXWRQRBFJBPZ-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000007857 degradation product Substances 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229960003722 doxycycline Drugs 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- SGKRLCUYIXIAHR-AKNGSSGZSA-N (4s,4ar,5s,5ar,6r,12ar)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide Chemical compound C1=CC=C2[C@H](C)[C@@H]([C@H](O)[C@@H]3[C@](C(O)=C(C(N)=O)C(=O)[C@H]3N(C)C)(O)C3=O)C3=C(O)C2=C1O SGKRLCUYIXIAHR-AKNGSSGZSA-N 0.000 description 1
- IHGRARUXKULRDG-CVHRZJFOSA-N (4s,4ar,5s,5ar,6r,12ar)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide;2-hydroxy-5-sulfobenzoic acid Chemical compound OC(=O)C1=CC(S(O)(=O)=O)=CC=C1O.C1=CC=C2[C@H](C)[C@@H]([C@H](O)[C@@H]3[C@](C(O)=C(C(N)=O)C(=O)[C@H]3N(C)C)(O)C3=O)C3=C(O)C2=C1O IHGRARUXKULRDG-CVHRZJFOSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- GRWKNBPOGBTZMN-UHFFFAOYSA-N 2-benzyl-3-phenylpropane-1,2-diamine Chemical compound C=1C=CC=CC=1CC(N)(CN)CC1=CC=CC=C1 GRWKNBPOGBTZMN-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- LVXXWIVBBWEGQH-UHFFFAOYSA-N 2-sulfooxybenzoic acid hydrochloride Chemical compound S(=O)(=O)(O)OC=1C(C(=O)O)=CC=CC1.Cl LVXXWIVBBWEGQH-UHFFFAOYSA-N 0.000 description 1
- FUSNOPLQVRUIIM-UHFFFAOYSA-N 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-n-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide Chemical compound O=C1NC(C)(C)CN1C(N=C1N)=NC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 FUSNOPLQVRUIIM-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- VNXNGRQGPLLWCJ-UHFFFAOYSA-N calcium;n,n'-dibenzylethane-1,2-diamine Chemical compound [Ca].C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 VNXNGRQGPLLWCJ-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- XMEVHPAGJVLHIG-FMZCEJRJSA-N chembl454950 Chemical compound [Cl-].C1=CC=C2[C@](O)(C)[C@H]3C[C@H]4[C@H]([NH+](C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O XMEVHPAGJVLHIG-FMZCEJRJSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012493 hydrazine sulfate Substances 0.000 description 1
- 229910000377 hydrazine sulfate Inorganic materials 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical compound C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229960004368 oxytetracycline hydrochloride Drugs 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000004816 paper chromatography Methods 0.000 description 1
- JTJMJGYZQZDUJJ-UHFFFAOYSA-N phencyclidine Chemical compound C1CCCCN1C1(C=2C=CC=CC=2)CCCCC1 JTJMJGYZQZDUJJ-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 229960004989 tetracycline hydrochloride Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- MWKJTNBSKNUMFN-UHFFFAOYSA-N trifluoromethyltrimethylsilane Chemical compound C[Si](C)(C)C(F)(F)F MWKJTNBSKNUMFN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PT5410870 | 1970-07-03 | ||
| PT5410670 | 1970-07-03 | ||
| PT5410770 | 1970-07-03 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2131944A1 DE2131944A1 (de) | 1972-01-20 |
| DE2131944B2 true DE2131944B2 (de) | 1973-05-10 |
Family
ID=27354088
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712131944 Ceased DE2131944B2 (de) | 1970-07-03 | 1971-06-26 | Verfahren zur herstellung von 6-desoxy-6-desmethyl-6-methylen-5-hydroxytetracyclin und/oder 6-desoxy-5-hydroxytetracyclin |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3849491A (enrdf_load_stackoverflow) |
| CA (1) | CA942743A (enrdf_load_stackoverflow) |
| CH (1) | CH582132A5 (enrdf_load_stackoverflow) |
| DE (1) | DE2131944B2 (enrdf_load_stackoverflow) |
| FR (1) | FR2108191B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1360006A (enrdf_load_stackoverflow) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK153393C (da) * | 1970-07-03 | 1988-11-28 | Ivan Villax | Fremgangsmaade til fremstilling af metacyklin ved dehalogenering af et syreadditionssalt af 11a-klor-6-desoxy-6-demetyl-6-metylen-5-hydroxytetracyklin |
| GB1459861A (en) * | 1973-06-21 | 1976-12-31 | Pfizer | Process for 11a-dehalogenation of 11a-halotetracyclines |
| YU41093B (en) * | 1978-04-12 | 1986-12-31 | Pliva Pharm & Chem Works | Process for preparing 6-deoxy-5hydroxy-tetracycline |
| US4500458A (en) * | 1982-01-19 | 1985-02-19 | Plurichemie Anstalt | Process for the preparation of α-6-deoxytetracyclines |
| PT76061A (en) * | 1982-12-30 | 1983-01-01 | Stable homogeneous hydrogenation rhodium catalyst - useful in high yield prodn. of doxycycline by stereospecific hydrogenation | |
| USRE32535E (en) * | 1982-01-19 | 1987-10-27 | Plurichemie Anstalt | Process for the preparation of α-6-deoxytetracyclines |
| DK386784A (da) * | 1983-08-17 | 1985-02-18 | Hovione Int Ltd | Fremgangsmaade til fremstilling af alfa-6-desoxy-tetracykliner |
| HU188367B (en) * | 1983-09-02 | 1986-04-28 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt,Hu | Process for preparing 6-demethy-6-deoxy-6-methylene-5-exytetracycline and 11a-chloro-derivative thereof |
| US7191496B2 (en) * | 2005-02-17 | 2007-03-20 | Preformed Line Products Company | Formed wire dead-end appliance for high temperature linear bodies |
| CN113929592A (zh) * | 2021-12-20 | 2022-01-14 | 山东国邦药业有限公司 | 一种强力霉素中间体的制备方法 |
-
1971
- 1971-06-25 CA CA116,690A patent/CA942743A/en not_active Expired
- 1971-06-26 DE DE19712131944 patent/DE2131944B2/de not_active Ceased
- 1971-06-28 GB GB3012071A patent/GB1360006A/en not_active Expired
- 1971-06-30 CH CH961371A patent/CH582132A5/xx not_active IP Right Cessation
- 1971-07-02 FR FR717124328A patent/FR2108191B1/fr not_active Expired
- 1971-07-02 US US00159458A patent/US3849491A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB1360006A (en) | 1974-07-17 |
| CH582132A5 (enrdf_load_stackoverflow) | 1976-11-30 |
| US3849491A (en) | 1974-11-19 |
| CA942743A (en) | 1974-02-26 |
| FR2108191A1 (enrdf_load_stackoverflow) | 1972-05-19 |
| DE2131944A1 (de) | 1972-01-20 |
| FR2108191B1 (enrdf_load_stackoverflow) | 1973-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1545760C3 (de) | Vincaleukoblastinderivate | |
| DE2154032C3 (de) | Verfahren zur Demethylierung des Dimethylaminorestes in Erythromycin-Antibiotika | |
| CH444853A (de) | Verfahren zur Herstellung neuer Tetracyclinverbindungen | |
| DE2040998B2 (de) | 5-Halogensalicylsäurederivate und Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende coccidiostatische und antibakterielle Mittel | |
| DE2131944B2 (de) | Verfahren zur herstellung von 6-desoxy-6-desmethyl-6-methylen-5-hydroxytetracyclin und/oder 6-desoxy-5-hydroxytetracyclin | |
| DE2309582B2 (de) | Verfahren zur Gewinnung von reinem 7-Dimethylamino-6-desmethyl-6-desoxytetracyclinhydrochlorid aus seinen wäßrigen Rohlösungen und dabei gebildete Komplexverbindung mit Calciumchlorid | |
| DE1445506C3 (de) | Verfahren zur Gewinnung von reinem a-Aminobenzylpenicillin | |
| DE69212002T2 (de) | Verfahren und zwischenprodukte für die reinigung von oxytetracycline | |
| DE2027699B2 (de) | Verfahren zur Herstellung von N-Desalkyl-lincomycin und dessen Analogen | |
| DE2131945B2 (de) | Verfahren zum abtrennen von alpha6-desoxy-5-hydroxy-tetracyclin hoher reinheit aus einem reaktionsgemisch | |
| DE1570002A1 (de) | Verfahren zur Herstellung von Piperazinderivaten | |
| DE1670163A1 (de) | Cephaloglycinderivate und Verfahren zu ihrer Herstellung | |
| DE932670C (de) | Verfahren zur Herstellung von Tetracyclin und seinen Salzen | |
| DE2414084A1 (de) | Dinitroanilinderivate | |
| DE1470013A1 (de) | Verfahren zur Herstellung von Tetracyclin-Derivaten | |
| AT205170B (de) | Verfahren zur Herstellung von in Wasser schwerlöslichen Salzen der Tetracycline | |
| DE2136622A1 (enrdf_load_stackoverflow) | ||
| DE1768971C (de) | 11 a-H alogen-e-desoxy-e-desmethyl-emethylentetracycline und ihre Säureadditionssalze | |
| DE2164840A1 (de) | Verfahren zum Herstellen eines 6-Methylentetracyclins | |
| DE555241C (de) | Verfahren zur Herstellung von aminosubstituierten Guajacolarsinsaeuren und deren Reduktionsprodukten | |
| DE911135C (de) | Verfahren zur Herstellung von Pteridinen | |
| DE911262C (de) | Verfahren zur Herstellung neuer substituierter Pteridine | |
| AT216145B (de) | Verfahren zur Herstellung von neuen therapeutisch wertvollen Verbindungen | |
| DE1004172B (de) | Verfahren zur Herstellung von kristallisierbaren Komplexverbindungen von 2, 6-trans,trans-Pentaenaldehyden mit Vitamin-A-aldehydaufbau | |
| DE2117443A1 (en) | 6-methylene-tetracyclines prepn - via the 11a-halo-6,12-hemiacetal |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8263 | Opposition against grant of a patent | ||
| 8235 | Patent refused | ||
| 8235 | Patent refused |