DE2129109C3 - Phenylpyridazine, ihre Herstellung und sie enthaltende herbizide Mittel - Google Patents
Phenylpyridazine, ihre Herstellung und sie enthaltende herbizide MittelInfo
- Publication number
- DE2129109C3 DE2129109C3 DE2129109A DE2129109A DE2129109C3 DE 2129109 C3 DE2129109 C3 DE 2129109C3 DE 2129109 A DE2129109 A DE 2129109A DE 2129109 A DE2129109 A DE 2129109A DE 2129109 C3 DE2129109 C3 DE 2129109C3
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- damage
- phenylpyridazines
- manufacture
- compositions containing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XWSSUYOEOWLFEI-UHFFFAOYSA-N 3-phenylpyridazine Chemical class C1=CC=CC=C1C1=CC=CN=N1 XWSSUYOEOWLFEI-UHFFFAOYSA-N 0.000 title claims description 4
- 230000002363 herbicidal effect Effects 0.000 title description 8
- 239000000203 mixture Substances 0.000 title description 7
- 238000004519 manufacturing process Methods 0.000 title 1
- 240000007594 Oryza sativa Species 0.000 claims description 3
- 235000007164 Oryza sativa Nutrition 0.000 claims description 2
- 241000209504 Poaceae Species 0.000 claims description 2
- 235000009566 rice Nutrition 0.000 claims description 2
- 241000196324 Embryophyta Species 0.000 description 10
- 239000007921 spray Substances 0.000 description 10
- 230000006378 damage Effects 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000004009 herbicide Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 241000220259 Raphanus Species 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 230000021736 acetylation Effects 0.000 description 3
- 238000006640 acetylation reaction Methods 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000009528 severe injury Effects 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 240000006503 Lamium purpureum Species 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- 241000746983 Phleum pratense Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 235000021536 Sugar beet Nutrition 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 244000038559 crop plants Species 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- 231100001184 nonphytotoxic Toxicity 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 150000004892 pyridazines Chemical class 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 210000003296 saliva Anatomy 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- IZWPGJFSBABFGL-GMFCBQQYSA-M sodium;2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS([O-])(=O)=O IZWPGJFSBABFGL-GMFCBQQYSA-M 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- QPKJFOGPKCJHME-UHFFFAOYSA-N 2-(6-chloropyridazin-3-yl)oxyacetic acid Chemical compound OC(=O)COC1=CC=C(Cl)N=N1 QPKJFOGPKCJHME-UHFFFAOYSA-N 0.000 description 1
- ZVVWBPYZGKHHSR-UHFFFAOYSA-N 3-ethoxypyridazine Chemical compound CCOC1=CC=CN=N1 ZVVWBPYZGKHHSR-UHFFFAOYSA-N 0.000 description 1
- ASFHDLDAWYTMJS-UHFFFAOYSA-N 3-methoxypyridazine Chemical compound COC1=CC=CN=N1 ASFHDLDAWYTMJS-UHFFFAOYSA-N 0.000 description 1
- LINXZJNHOAOKNW-UHFFFAOYSA-N 4,6-dibromo-3-phenylpyridazine Chemical compound N1=NC(Br)=CC(Br)=C1C1=CC=CC=C1 LINXZJNHOAOKNW-UHFFFAOYSA-N 0.000 description 1
- PPYSGGOWIZSMJL-UHFFFAOYSA-N 4,6-dichloro-3-phenylpyridazine Chemical compound N1=NC(Cl)=CC(Cl)=C1C1=CC=CC=C1 PPYSGGOWIZSMJL-UHFFFAOYSA-N 0.000 description 1
- ZUSHSDOEVHPTCU-UHFFFAOYSA-N 6-chloro-3-phenyl-1h-pyridazin-4-one Chemical compound N1C(Cl)=CC(=O)C(C=2C=CC=CC=2)=N1 ZUSHSDOEVHPTCU-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000602336 Anthemis arvensis Species 0.000 description 1
- 244000294263 Arctium minus Species 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 244000157790 Buglossoides arvense Species 0.000 description 1
- 235000004256 Buglossoides arvense Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 241001042948 Centaurea jacea Species 0.000 description 1
- 240000003538 Chamaemelum nobile Species 0.000 description 1
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 1
- 240000003173 Drymaria cordata Species 0.000 description 1
- 240000003759 Erodium cicutarium Species 0.000 description 1
- 235000009967 Erodium cicutarium Nutrition 0.000 description 1
- 241000933689 Galeopsis ladanum Species 0.000 description 1
- 241000816485 Galeopsis speciosa Species 0.000 description 1
- 241001508646 Galeopsis tetrahit Species 0.000 description 1
- 244000214240 Galinsoga parviflora Species 0.000 description 1
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 244000303225 Lamium amplexicaule Species 0.000 description 1
- 235000009198 Lamium amplexicaule Nutrition 0.000 description 1
- 235000009193 Lamium purpureum Nutrition 0.000 description 1
- 235000012587 Lamium purpureum var. incisum Nutrition 0.000 description 1
- 240000002702 Lapsana communis Species 0.000 description 1
- 235000006761 Lapsana communis Nutrition 0.000 description 1
- 241001071917 Lithospermum Species 0.000 description 1
- 244000100545 Lolium multiflorum Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 241000209094 Oryza Species 0.000 description 1
- 240000004674 Papaver rhoeas Species 0.000 description 1
- 235000008753 Papaver somniferum Nutrition 0.000 description 1
- 241000218180 Papaveraceae Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 244000286177 Raphanus raphanistrum Species 0.000 description 1
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 1
- 240000001970 Raphanus sativus var. sativus Species 0.000 description 1
- 241001166549 Veronica hederifolia Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- 241000990144 Veronica persica Species 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- -1 aliphatic alcohols Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 210000003323 beak Anatomy 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 230000009526 moderate injury Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical class ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- YZHUMGUJCQRKBT-UHFFFAOYSA-M sodium chlorate Chemical compound [Na+].[O-]Cl(=O)=O YZHUMGUJCQRKBT-UHFFFAOYSA-M 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/14—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2129109A DE2129109C3 (de) | 1971-06-11 | 1971-06-11 | Phenylpyridazine, ihre Herstellung und sie enthaltende herbizide Mittel |
| AT517771A AT310765B (de) | 1971-06-11 | 1971-06-16 | Verfahren zur Herstellung von neuen Phenylpyridazinverbindungen |
| NLAANVRAGE7207515,A NL171895C (nl) | 1971-06-11 | 1972-06-02 | Werkwijze voor het bereiden van herbicide-preparaten en daarvoor geschikte pyridazinen met herbicide-activiteit. |
| CA143,689A CA986938A (en) | 1971-06-11 | 1972-06-02 | Phenylpyridazines and the preparation thereof |
| GB2596872A GB1362886A (en) | 1971-06-11 | 1972-06-02 | Phenylpyridazines and the preparation thereof |
| CS386872A CS158727B2 (OSRAM) | 1971-06-11 | 1972-06-05 | |
| ZA723877A ZA723877B (en) | 1971-06-11 | 1972-06-06 | Phenylpyridazines and the preparation thereof |
| FR7220433A FR2141253A5 (OSRAM) | 1971-06-11 | 1972-06-07 | |
| IT6881572A IT960401B (it) | 1971-06-11 | 1972-06-07 | Derivati fenilpiridazinici parti colarmente utili come erbicidi e procedimento per la loro prepara zione |
| RO7271193A RO69106A (ro) | 1971-06-11 | 1972-06-08 | Procedeu de preparare a fenilpiridazinelor |
| CH851072A CH563715A5 (OSRAM) | 1971-06-11 | 1972-06-08 | |
| SU721799224A SU708980A3 (ru) | 1971-06-11 | 1972-06-09 | Гербицидное средство |
| JP47056985A JPS5224567B1 (OSRAM) | 1971-06-11 | 1972-06-09 | |
| HUOE176A HU164810B (OSRAM) | 1971-06-11 | 1972-06-09 | |
| BE784692A BE784692A (fr) | 1971-06-11 | 1972-06-09 | Phenylpyridazines et procede pour leur preparation |
| US00261331A US3790571A (en) | 1971-06-11 | 1972-06-09 | Phenylpyridazines |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2129109A DE2129109C3 (de) | 1971-06-11 | 1971-06-11 | Phenylpyridazine, ihre Herstellung und sie enthaltende herbizide Mittel |
| AT517771A AT310765B (de) | 1971-06-11 | 1971-06-16 | Verfahren zur Herstellung von neuen Phenylpyridazinverbindungen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2129109A1 DE2129109A1 (de) | 1973-01-04 |
| DE2129109B2 DE2129109B2 (de) | 1978-10-12 |
| DE2129109C3 true DE2129109C3 (de) | 1979-06-07 |
Family
ID=25601903
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2129109A Expired DE2129109C3 (de) | 1971-06-11 | 1971-06-11 | Phenylpyridazine, ihre Herstellung und sie enthaltende herbizide Mittel |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3790571A (OSRAM) |
| JP (1) | JPS5224567B1 (OSRAM) |
| AT (1) | AT310765B (OSRAM) |
| BE (1) | BE784692A (OSRAM) |
| CA (1) | CA986938A (OSRAM) |
| CH (1) | CH563715A5 (OSRAM) |
| CS (1) | CS158727B2 (OSRAM) |
| DE (1) | DE2129109C3 (OSRAM) |
| FR (1) | FR2141253A5 (OSRAM) |
| GB (1) | GB1362886A (OSRAM) |
| HU (1) | HU164810B (OSRAM) |
| NL (1) | NL171895C (OSRAM) |
| RO (1) | RO69106A (OSRAM) |
| SU (1) | SU708980A3 (OSRAM) |
| ZA (1) | ZA723877B (OSRAM) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2229744A1 (de) * | 1972-06-19 | 1974-01-10 | Lentia Gmbh | Neue pyridazinverbindungen, ihre herstellung und verwendung |
| DE2229758A1 (de) * | 1972-06-19 | 1974-01-17 | Lentia Gmbh | Neue pyridazinverbindungen, ihre herstellung und verwendung |
| DE2256172A1 (de) * | 1972-11-16 | 1974-05-30 | Lentia Gmbh | Phenylpyridazine, ihre herstellung und verwendung als herbizide |
| DE2331398C3 (de) * | 1973-06-20 | 1979-10-11 | Lentia Gmbh | Ester von S-PhenyM-hydroxy-e-halogenpyridazinverbindungen, ihre Herstellung und sie enthaltende herbizide Mittel |
| AT334133B (de) * | 1974-12-17 | 1976-12-27 | Chemie Linz Ag | Herbizides mittel |
| US4340733A (en) * | 1980-09-02 | 1982-07-20 | Smithkline Corporation | Process for preparing 3-chloro-6-(2-hydroxyphenyl)-pyridazines |
| US4623376A (en) * | 1984-04-16 | 1986-11-18 | American Cyanamid Company | Herbicidal pyridazines and method for controlling undesirable plant species |
| AT397598B (de) * | 1990-04-05 | 1994-05-25 | Agrolinz Agrarchemikalien | Herbizides mittel |
| DE4013734A1 (de) * | 1990-04-28 | 1991-10-31 | Agrolinz Agrarchemikalien Muen | Herbizides mittel |
| GB9603446D0 (en) * | 1996-02-19 | 1996-04-17 | Sandoz Ltd | Organic compounds |
| EP0795269B1 (en) * | 1996-03-13 | 2003-07-30 | Syngenta Participations AG | Herbicidal combinations |
| WO2000000029A1 (en) | 1998-06-26 | 2000-01-06 | Novartis Pharma Ag. | Herbicidal composition |
| WO2001054501A2 (en) | 2000-01-25 | 2001-08-02 | Syngenta Participations Ag | Herbicidal composition |
| DE602005014359D1 (de) * | 2004-06-09 | 2009-06-18 | Sumitomo Chemical Co | Pyridazinverbindung und deren verwendung |
| CN106316962B (zh) * | 2015-07-01 | 2020-03-10 | 中国科学院上海有机化学研究所 | 3-芳基哒嗪酮类化合物、制备方法、农药组合物及用途 |
| CN111820225B (zh) * | 2019-04-22 | 2022-04-05 | 江苏清原农冠杂草防治有限公司 | 包含3-芳基-6-三氟甲基哒嗪醇类化合物的除草组合物及其应用 |
| US12096772B2 (en) * | 2022-02-04 | 2024-09-24 | Syngenta Crop Protection Ag | Herbicidal compositions |
-
1971
- 1971-06-11 DE DE2129109A patent/DE2129109C3/de not_active Expired
- 1971-06-16 AT AT517771A patent/AT310765B/de not_active IP Right Cessation
-
1972
- 1972-06-02 GB GB2596872A patent/GB1362886A/en not_active Expired
- 1972-06-02 NL NLAANVRAGE7207515,A patent/NL171895C/xx not_active IP Right Cessation
- 1972-06-02 CA CA143,689A patent/CA986938A/en not_active Expired
- 1972-06-05 CS CS386872A patent/CS158727B2/cs unknown
- 1972-06-06 ZA ZA723877A patent/ZA723877B/xx unknown
- 1972-06-07 FR FR7220433A patent/FR2141253A5/fr not_active Expired
- 1972-06-08 CH CH851072A patent/CH563715A5/xx not_active IP Right Cessation
- 1972-06-08 RO RO7271193A patent/RO69106A/ro unknown
- 1972-06-09 US US00261331A patent/US3790571A/en not_active Expired - Lifetime
- 1972-06-09 BE BE784692A patent/BE784692A/xx not_active IP Right Cessation
- 1972-06-09 SU SU721799224A patent/SU708980A3/ru active
- 1972-06-09 HU HUOE176A patent/HU164810B/hu unknown
- 1972-06-09 JP JP47056985A patent/JPS5224567B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1362886A (en) | 1974-08-07 |
| NL171895C (nl) | 1983-06-01 |
| NL7207515A (OSRAM) | 1972-12-13 |
| ZA723877B (en) | 1973-03-28 |
| HU164810B (OSRAM) | 1974-04-11 |
| CA986938A (en) | 1976-04-06 |
| CS158727B2 (OSRAM) | 1974-11-25 |
| JPS5224567B1 (OSRAM) | 1977-07-01 |
| DE2129109B2 (de) | 1978-10-12 |
| BE784692A (fr) | 1972-12-11 |
| DE2129109A1 (de) | 1973-01-04 |
| FR2141253A5 (OSRAM) | 1973-01-19 |
| SU708980A3 (ru) | 1980-01-05 |
| RO69106A (ro) | 1982-10-26 |
| US3790571A (en) | 1974-02-05 |
| NL171895B (nl) | 1983-01-03 |
| CH563715A5 (OSRAM) | 1975-07-15 |
| AT310765B (de) | 1973-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2129109C3 (de) | Phenylpyridazine, ihre Herstellung und sie enthaltende herbizide Mittel | |
| DE2546251A1 (de) | Alpha- eckige klammer auf 4-(5- mono-substituiert- oder 3,5-disubstituiert-pyridyl-2-oxy)phenoxy eckige klammer zu alkancarbonsaeuren und ihre derivate | |
| DE1542873C3 (de) | Herbizides Mittel auf Basis von 4-Amino-1,2,4-triazin-5-onen | |
| DE69129711T2 (de) | 3-(Substituierte Phenyl)Pyrazol-Derivate, Verfahren zu deren Herstellung, diese enthaltende herbizide Zusammensetzung und Verfahren zur Bekämpfung von Unkraut unter Verwendung dieser Zusammensetzung | |
| DE1670912B2 (de) | Herbizide Mittel auf Basis von 1,2,4-Triazin-5-onen | |
| DE2331398C3 (de) | Ester von S-PhenyM-hydroxy-e-halogenpyridazinverbindungen, ihre Herstellung und sie enthaltende herbizide Mittel | |
| DE2107757C3 (de) | 4-Amino-1,2,4-triazin-5-one, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE68917617T2 (de) | Triazolverbindungen, Verfahren zu ihrer Herstellung und diese enthaltende herbizide Zusammensetzungen. | |
| DE1542733C3 (de) | 2-Azido-13,5-triazin-verbindungen | |
| EP0053699A1 (de) | 2'-Phenylhydrazino-2-cyanacrylsäureester und diese enthaltende Herbizide | |
| DE2524578C3 (de) | 5-Hydroxylaminomethylen-barbitursäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbicide | |
| DE2256172A1 (de) | Phenylpyridazine, ihre herstellung und verwendung als herbizide | |
| DE2324732C2 (de) | N-Phenyl-N'-1,2,3-thiadiazol-5-yl-thioharnstoff, wuchsregulatorisches Mittel enthaltend diese Verbindung sowie Verfahren zu ihrer Herstellung | |
| EP0007089A1 (de) | Acylanilide mit herbicider und fungicider Wirkung, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE3016304A1 (de) | 3,5-dioxo-1,2,4-triazine und deren salze, verfahren zu ihrer herstellung und verwendung | |
| DE2114018C3 (de) | 3-(2-Tetrahydropyranyl)-l,23,4tetrahydropyrimidin-2,4-dione, Verfahren zu ihrer Herstellung und pesticide Zusammensetzungen | |
| DE3316369C2 (de) | Tetrahydrobenzthiazole und herbizide Mittel, die diese Verbindungen als wirksamen Bestandteil enthalten | |
| AT309883B (de) | Herbizides Mittel | |
| DE2643488A1 (de) | Pyrazolyl-4h-1,2,4-triazole und verfahren zu ihrer herstellung | |
| EP0031086A1 (de) | Halogenierte Imidazol-carbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE3332271A1 (de) | Herbizide mittel enthaltend metribuzin in kombination mit substituierten azolyl-derivaten | |
| AT322273B (de) | Herbizides mittel | |
| DE2430353C2 (de) | 1H-(Pyrido-[3.2-e]-2.1.3-thiadiazin-(4)-on-2.2-dioxide) | |
| DE2229758A1 (de) | Neue pyridazinverbindungen, ihre herstellung und verwendung | |
| DE3139505A1 (de) | 1,2,3,-thiadiazol-5-yl-harnstoff-derivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit wuchsregulatorischer und entblaetternder wirkung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |