DE2127901A1 - - Google Patents
Info
- Publication number
- DE2127901A1 DE2127901A1 DE19712127901 DE2127901A DE2127901A1 DE 2127901 A1 DE2127901 A1 DE 2127901A1 DE 19712127901 DE19712127901 DE 19712127901 DE 2127901 A DE2127901 A DE 2127901A DE 2127901 A1 DE2127901 A1 DE 2127901A1
- Authority
- DE
- Germany
- Prior art keywords
- metal carboxylate
- salt
- halogenopyridine
- metal
- hydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 claims description 30
- 229910052751 metal Inorganic materials 0.000 claims description 25
- 239000002184 metal Substances 0.000 claims description 25
- 150000007942 carboxylates Chemical class 0.000 claims description 24
- 150000003839 salts Chemical class 0.000 claims description 22
- -1 fluoro- Chemical class 0.000 claims description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- 239000007858 starting material Substances 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 150000005748 halopyridines Chemical class 0.000 claims description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- IKZSQJOVXGDGAH-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-fluoropyridine Chemical group FC1=NC(Cl)=C(Cl)C(Cl)=C1Cl IKZSQJOVXGDGAH-UHFFFAOYSA-N 0.000 claims description 2
- UXUZMYHSICIOQT-UHFFFAOYSA-N 3-chloro-2,4,5,6-tetrafluoropyridine Chemical group FC1=NC(F)=C(Cl)C(F)=C1F UXUZMYHSICIOQT-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- HDYRYUINDGQKMC-UHFFFAOYSA-M acetyloxyaluminum;dihydrate Chemical group O.O.CC(=O)O[Al] HDYRYUINDGQKMC-UHFFFAOYSA-M 0.000 claims 1
- 229940009827 aluminum acetate Drugs 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 7
- PKSORSNCSXBXOT-UHFFFAOYSA-N 3,5-dichloro-2,4,6-trifluoropyridine Chemical compound FC1=NC(F)=C(Cl)C(F)=C1Cl PKSORSNCSXBXOT-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 150000002222 fluorine compounds Chemical class 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- MJAWMRVEIWPJRW-UHFFFAOYSA-N haloxydine Chemical compound FC=1NC(F)=C(Cl)C(=O)C=1Cl MJAWMRVEIWPJRW-UHFFFAOYSA-N 0.000 description 3
- 235000011056 potassium acetate Nutrition 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- MTAODLNXWYIKSO-UHFFFAOYSA-N 2-fluoropyridine Chemical compound FC1=CC=CC=N1 MTAODLNXWYIKSO-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- DNDPLEAVNVOOQZ-UHFFFAOYSA-N 2,3,4,5,6-pentachloropyridine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=C1Cl DNDPLEAVNVOOQZ-UHFFFAOYSA-N 0.000 description 1
- XTGOWLIKIQLYRG-UHFFFAOYSA-N 2,3,4,5,6-pentafluoropyridine Chemical compound FC1=NC(F)=C(F)C(F)=C1F XTGOWLIKIQLYRG-UHFFFAOYSA-N 0.000 description 1
- VBEHFOMFHUQAOW-UHFFFAOYSA-N 2-chloro-1h-pyridin-4-one Chemical class OC1=CC=NC(Cl)=C1 VBEHFOMFHUQAOW-UHFFFAOYSA-N 0.000 description 1
- FNRMMDCDHWCQTH-UHFFFAOYSA-N 2-chloropyridine;3-chloropyridine;4-chloropyridine Chemical compound ClC1=CC=NC=C1.ClC1=CC=CN=C1.ClC1=CC=CC=N1 FNRMMDCDHWCQTH-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005910 alkyl carbonate group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 150000005753 chloropyridines Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000005754 fluoropyridines Chemical class 0.000 description 1
- NHGVZTMBVDFPHJ-UHFFFAOYSA-N formyl fluoride Chemical compound FC=O NHGVZTMBVDFPHJ-UHFFFAOYSA-N 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3158370 | 1970-06-30 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2127901A1 true DE2127901A1 (enExample) | 1972-02-17 |
| DE2127901B2 DE2127901B2 (de) | 1974-08-22 |
| DE2127901C3 DE2127901C3 (de) | 1975-04-24 |
Family
ID=10325293
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2127901A Expired DE2127901C3 (de) | 1970-06-30 | 1971-06-04 | Verfahren zur Herstellung von 4-Hydroxy-halogenpyridlnen oder deren Alkalimetallsalzen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3808220A (enExample) |
| AU (1) | AU3002571A (enExample) |
| BE (1) | BE769015A (enExample) |
| CA (1) | CA926401A (enExample) |
| DE (1) | DE2127901C3 (enExample) |
| FR (1) | FR2098104A5 (enExample) |
| GB (1) | GB1303679A (enExample) |
| IL (1) | IL36932A (enExample) |
| NL (1) | NL7108786A (enExample) |
| ZA (1) | ZA713303B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9704795D0 (en) * | 1997-03-07 | 1997-04-23 | Zeneca Ltd | Chemical process |
| GB9819235D0 (en) * | 1998-09-03 | 1998-10-28 | Zeneca Ltd | Chemical process |
-
1970
- 1970-06-30 GB GB3158370A patent/GB1303679A/en not_active Expired
-
1971
- 1971-05-17 US US00144288A patent/US3808220A/en not_active Expired - Lifetime
- 1971-05-21 CA CA113689A patent/CA926401A/en not_active Expired
- 1971-05-21 ZA ZA713303A patent/ZA713303B/xx unknown
- 1971-05-26 IL IL36932A patent/IL36932A/xx unknown
- 1971-06-04 DE DE2127901A patent/DE2127901C3/de not_active Expired
- 1971-06-15 AU AU30025/71A patent/AU3002571A/en not_active Expired
- 1971-06-24 BE BE769015A patent/BE769015A/xx unknown
- 1971-06-25 NL NL7108786A patent/NL7108786A/xx unknown
- 1971-06-29 FR FR7123807A patent/FR2098104A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2127901B2 (de) | 1974-08-22 |
| FR2098104A5 (enExample) | 1972-03-03 |
| IL36932A0 (en) | 1971-07-28 |
| IL36932A (en) | 1974-07-31 |
| BE769015A (fr) | 1971-12-24 |
| GB1303679A (enExample) | 1973-01-17 |
| ZA713303B (en) | 1972-01-26 |
| NL7108786A (enExample) | 1972-01-03 |
| CA926401A (en) | 1973-05-15 |
| DE2127901C3 (de) | 1975-04-24 |
| AU3002571A (en) | 1972-12-21 |
| US3808220A (en) | 1974-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2326784B2 (de) | Verfahren zur Herstellung von Chinoxalin, insbesondere aus nicht gereinigten Rohstoffen | |
| DE2056433C3 (de) | Verfahren zur Herstellung von Amiden stickstoffhaltiger aromatischer heterocyclischer Basen | |
| DE1012914B (de) | Verfahren zur Herstellung von Benzthiazolyl-2-sulfen-morpholid | |
| DE2127901A1 (enExample) | ||
| DE2627223C2 (enExample) | ||
| DE3150005A1 (de) | Verfahren zur herstellung von chinolinsaeure | |
| EP0034257B1 (de) | Verfahren zur Herstellung von 1.4-Diamino-2.3-dicyano-anthrachinon | |
| EP0551632A2 (de) | Verfahren zur Herstellung von Halogenanthranilsäuren | |
| DE3226490A1 (de) | Katalytische dampfphasenhydrolyse von benzalchlorid oder dessen halogen- oder trifluormethylverbindungen zur herstellung von benzaldehyd oder entsprechend substituierten verbindungen | |
| DE1618986C3 (de) | Verfahren zur Herstellung von chlorierten aromatischen Nitrilen | |
| DE3887376T2 (de) | 2-Methyl-4-amino-5-aminomethylpyrimidinkarbonat, Verfahren zu dessen Herstellung und diese brauchende Methode zur Reinigung von 2-Methyl-4-amino-5-aminomethylpyrimidin. | |
| DE69501029T2 (de) | Verfahren zur herstellung von cyanopyridin | |
| DE3839329A1 (de) | Verfahren zur reduktiven enthalogenierung von aromaten | |
| EP0315138B1 (de) | Verfahren zur Herstellung von 6-Chorisatosäureanhydrid | |
| DE2346021A1 (de) | Verfahren zur herstellung von ,5hexandion | |
| DE2724190C2 (de) | Verfahren zur Umwandlung von Thallium(I)-Verbindungen in Thallium(III)- Verbindungen | |
| AT225684B (de) | Verfahren zur Herstellung von Gemischen aus α, α, γ- und α, γ, γ-Trimethyladipinsäure | |
| DE2415748A1 (de) | Verfahren zur herstellung von polyhalogenierten nicotinsaeuren | |
| DE1545570C3 (de) | Verfahren zur Herstellung von Dichlorpyrazinen | |
| DE2313548C3 (de) | N-N'-Dichlor-terephthalsäurediamid sowie ein Verfahren zur Herstellung von N,N'-Dichlor-terephthalsäurediamid und von N, N '-Dichlor-isophthalsäurediamid | |
| DE2510139C3 (de) | Verfahren zur Herstellung von Monochlorbenzoesäuren | |
| DE888701C (de) | Verfahren zur Herstellung von Pentachlorphenol | |
| AT229301B (de) | Verfahren zur Chlorierung von o-Kresol | |
| AT201590B (de) | Verfahren zur Herstellung heterocyclischer Sulfamide | |
| DE1243196B (de) | Verfahren zur Herstellung kernchlorierter Pyridine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |