DE2115985A1 - Verfahren zur Herstellung von alpha Aminosaurenund ihren Derivaten - Google Patents
Verfahren zur Herstellung von alpha Aminosaurenund ihren DerivatenInfo
- Publication number
- DE2115985A1 DE2115985A1 DE19712115985 DE2115985A DE2115985A1 DE 2115985 A1 DE2115985 A1 DE 2115985A1 DE 19712115985 DE19712115985 DE 19712115985 DE 2115985 A DE2115985 A DE 2115985A DE 2115985 A1 DE2115985 A1 DE 2115985A1
- Authority
- DE
- Germany
- Prior art keywords
- millimoles
- acid
- reaction
- gas
- carbon monoxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title claims description 6
- 235000008206 alpha-amino acids Nutrition 0.000 title description 3
- 150000001371 alpha-amino acids Chemical class 0.000 title description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 33
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 33
- 150000001408 amides Chemical class 0.000 claims description 29
- 239000000203 mixture Substances 0.000 claims description 27
- 125000003368 amide group Chemical group 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000000126 substance Substances 0.000 claims description 9
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 5
- 239000007789 gas Substances 0.000 description 51
- 238000006243 chemical reaction Methods 0.000 description 37
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 34
- 239000011541 reaction mixture Substances 0.000 description 34
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 33
- 150000001299 aldehydes Chemical class 0.000 description 23
- 239000002904 solvent Substances 0.000 description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 19
- 239000001257 hydrogen Substances 0.000 description 19
- 229910052739 hydrogen Inorganic materials 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 229940024606 amino acid Drugs 0.000 description 17
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 17
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 15
- 235000004279 alanine Nutrition 0.000 description 15
- 235000001014 amino acid Nutrition 0.000 description 15
- 150000001413 amino acids Chemical class 0.000 description 14
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 description 13
- 238000010438 heat treatment Methods 0.000 description 13
- 238000003756 stirring Methods 0.000 description 11
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 9
- -1 heterocyclic Aldehydes Chemical class 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 5
- 238000000921 elemental analysis Methods 0.000 description 5
- 238000007037 hydroformylation reaction Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 4
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229920001429 chelating resin Polymers 0.000 description 4
- 229930182817 methionine Natural products 0.000 description 4
- 238000004816 paper chromatography Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- XUYPXLNMDZIRQH-LURJTMIESA-N N-acetyl-L-methionine Chemical compound CSCC[C@@H](C(O)=O)NC(C)=O XUYPXLNMDZIRQH-LURJTMIESA-N 0.000 description 3
- 239000003957 anion exchange resin Substances 0.000 description 3
- 238000005810 carbonylation reaction Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 235000013922 glutamic acid Nutrition 0.000 description 3
- 239000004220 glutamic acid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000012009 microbiological test Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 229940099459 n-acetylmethionine Drugs 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000004448 titration Methods 0.000 description 3
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- PMDCZENCAXMSOU-UHFFFAOYSA-N N-ethylacetamide Chemical compound CCNC(C)=O PMDCZENCAXMSOU-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- FWWQKRXKHIRPJY-UHFFFAOYSA-N octadecanal Chemical compound CCCCCCCCCCCCCCCCCC=O FWWQKRXKHIRPJY-UHFFFAOYSA-N 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- AZFBNUMFQXMTRW-YFKPBYRVSA-N (2S)-2-[acetyl(ethyl)amino]propanoic acid Chemical compound C(C)N([C@@H](C)C(=O)O)C(C)=O AZFBNUMFQXMTRW-YFKPBYRVSA-N 0.000 description 1
- WQHXCNGQDLRDMP-INIZCTEOSA-N (2s)-2-(dodecanoylamino)-3-methylbutanoic acid Chemical compound CCCCCCCCCCCC(=O)N[C@@H](C(C)C)C(O)=O WQHXCNGQDLRDMP-INIZCTEOSA-N 0.000 description 1
- UYTOHYBIBPDOKX-ZDUSSCGKSA-N (2s)-2-(dodecanoylamino)propanoic acid Chemical compound CCCCCCCCCCCC(=O)N[C@@H](C)C(O)=O UYTOHYBIBPDOKX-ZDUSSCGKSA-N 0.000 description 1
- NYNZQNWKBKUAII-KBXCAEBGSA-N (3s)-n-[5-[(2r)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-3-hydroxypyrrolidine-1-carboxamide Chemical compound C1[C@@H](O)CCN1C(=O)NC1=C2N=C(N3[C@H](CCC3)C=3C(=CC=C(F)C=3)F)C=CN2N=C1 NYNZQNWKBKUAII-KBXCAEBGSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- YVXIUWSXSPWZNE-UHFFFAOYSA-N 1,4-dioxane;prop-2-enamide Chemical compound NC(=O)C=C.C1COCCO1 YVXIUWSXSPWZNE-UHFFFAOYSA-N 0.000 description 1
- SBNOTUDDIXOFSN-UHFFFAOYSA-N 1h-indole-2-carbaldehyde Chemical compound C1=CC=C2NC(C=O)=CC2=C1 SBNOTUDDIXOFSN-UHFFFAOYSA-N 0.000 description 1
- XKHGLWVOOXPLCK-UHFFFAOYSA-N 2-(1h-indol-2-yl)acetaldehyde Chemical compound C1=CC=C2NC(CC=O)=CC2=C1 XKHGLWVOOXPLCK-UHFFFAOYSA-N 0.000 description 1
- QMHIFCYFYWNSGF-UHFFFAOYSA-N 2-(2,4-dihydroxyphenyl)acetaldehyde Chemical compound OC1=CC=C(CC=O)C(O)=C1 QMHIFCYFYWNSGF-UHFFFAOYSA-N 0.000 description 1
- SRBATDDRZARFDZ-UHFFFAOYSA-N 2-formamidopropanoic acid Chemical compound OC(=O)C(C)NC=O SRBATDDRZARFDZ-UHFFFAOYSA-N 0.000 description 1
- CLUWOWRTHNNBBU-UHFFFAOYSA-N 3-methylthiopropanal Chemical compound CSCCC=O CLUWOWRTHNNBBU-UHFFFAOYSA-N 0.000 description 1
- CGFGIKNLZTZJDE-UHFFFAOYSA-N 4-oxobutanenitrile Chemical compound O=CCCC#N CGFGIKNLZTZJDE-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- UMHJEEQLYBKSAN-UHFFFAOYSA-N Adipaldehyde Chemical compound O=CCCCCC=O UMHJEEQLYBKSAN-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- FORGMRSGVSYZQR-YFKPBYRVSA-N L-leucinamide Chemical compound CC(C)C[C@H](N)C(N)=O FORGMRSGVSYZQR-YFKPBYRVSA-N 0.000 description 1
- KTHDTJVBEPMMGL-VKHMYHEASA-N N-acetyl-L-alanine Chemical compound OC(=O)[C@H](C)NC(C)=O KTHDTJVBEPMMGL-VKHMYHEASA-N 0.000 description 1
- KSMRODHGGIIXDV-YFKPBYRVSA-N N-acetyl-L-glutamine Chemical compound CC(=O)N[C@H](C(O)=O)CCC(N)=O KSMRODHGGIIXDV-YFKPBYRVSA-N 0.000 description 1
- IHYJTAOFMMMOPX-LURJTMIESA-N N-acetyl-L-valine Chemical compound CC(C)[C@@H](C(O)=O)NC(C)=O IHYJTAOFMMMOPX-LURJTMIESA-N 0.000 description 1
- ZSBDPRIWBYHIAF-UHFFFAOYSA-N N-acetyl-acetamide Natural products CC(=O)NC(C)=O ZSBDPRIWBYHIAF-UHFFFAOYSA-N 0.000 description 1
- UAQVHNZEONHPQG-ZETCQYMHSA-N N-benzoyl-L-alanine Chemical compound OC(=O)[C@H](C)NC(=O)C1=CC=CC=C1 UAQVHNZEONHPQG-ZETCQYMHSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- 108010038807 Oligopeptides Proteins 0.000 description 1
- 102000015636 Oligopeptides Human genes 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- YKNINLVRFFXLCF-UHFFFAOYSA-N acetamide;ethyl acetate Chemical compound CC(N)=O.CCOC(C)=O YKNINLVRFFXLCF-UHFFFAOYSA-N 0.000 description 1
- JYVSZCNTYXUUGH-UHFFFAOYSA-N acetic acid;benzamide Chemical compound CC(O)=O.NC(=O)C1=CC=CC=C1 JYVSZCNTYXUUGH-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000003862 amino acid derivatives Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical compound NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- UMTMTUGJFDWLGO-UHFFFAOYSA-N butanal 2-phenylacetaldehyde Chemical compound C1(=CC=CC=C1)CC=O.C(CCC)=O UMTMTUGJFDWLGO-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- NKDDWNXOKDWJAK-UHFFFAOYSA-N dimethoxymethane Chemical compound COCOC NKDDWNXOKDWJAK-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 229960002743 glutamine Drugs 0.000 description 1
- BEBCJVAWIBVWNZ-UHFFFAOYSA-N glycinamide Chemical compound NCC(N)=O BEBCJVAWIBVWNZ-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 229940116335 lauramide Drugs 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 238000012543 microbiological analysis Methods 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- HWJHZLJIIWOTGZ-UHFFFAOYSA-N n-(hydroxymethyl)acetamide Chemical compound CC(=O)NCO HWJHZLJIIWOTGZ-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- SQYNKIJPMDEDEG-UHFFFAOYSA-N paraldehyde Chemical compound CC1OC(C)OC(C)O1 SQYNKIJPMDEDEG-UHFFFAOYSA-N 0.000 description 1
- 229960003868 paraldehyde Drugs 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- JDVPQXZIJDEHAN-UHFFFAOYSA-N succinamic acid Chemical compound NC(=O)CCC(O)=O JDVPQXZIJDEHAN-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K1/00—General methods for the preparation of peptides, i.e. processes for the organic chemical preparation of peptides or proteins of any length
- C07K1/02—General methods for the preparation of peptides, i.e. processes for the organic chemical preparation of peptides or proteins of any length in solution
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Biophysics (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- Analytical Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Medicinal Chemistry (AREA)
- Molecular Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP45028773A JPS4817259B1 (enExample) | 1970-04-04 | 1970-04-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2115985A1 true DE2115985A1 (de) | 1971-10-21 |
Family
ID=12257710
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712115985 Ceased DE2115985A1 (de) | 1970-04-04 | 1971-04-01 | Verfahren zur Herstellung von alpha Aminosaurenund ihren Derivaten |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3766266A (enExample) |
| JP (1) | JPS4817259B1 (enExample) |
| CA (1) | CA959496A (enExample) |
| CH (1) | CH561176A5 (enExample) |
| DE (1) | DE2115985A1 (enExample) |
| FR (1) | FR2089136A5 (enExample) |
| GB (1) | GB1325102A (enExample) |
| IT (1) | IT1001466B (enExample) |
| NL (1) | NL7104282A (enExample) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3242374A1 (de) * | 1981-11-17 | 1983-05-26 | Sagami Chemical Research Center, Tokyo | Verfahren zur herstellung von n-acyl-(alpha)-aminosaeuren |
| EP0197659A1 (en) * | 1985-04-05 | 1986-10-15 | Texaco Development Corporation | Process for synthesizing N-acetylglycine using novel promoters |
| EP0292918A1 (en) * | 1987-05-26 | 1988-11-30 | Nissan Chemical Industries Ltd. | Process for producing phosphinylamino acid derivatives |
| EP0350630A1 (de) * | 1988-07-14 | 1990-01-17 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von N-Acyl-phosphinothricin-P-ester |
| EP0338330B1 (de) * | 1988-04-16 | 1992-06-24 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von N-Acylaminosäuren |
| WO1998004518A1 (de) * | 1996-07-25 | 1998-02-05 | Aventis Research & Technologies Gmbh & Co Kg | Verfahren zur katalytischen herstellung von n-acylglycinderivaten |
| EP1063226A1 (de) * | 1999-06-25 | 2000-12-27 | Degussa-Hüls Aktiengesellschaft | Verfahren zur Herstellung von N-Acylaminosäuren |
| US6320055B1 (en) | 1999-04-28 | 2001-11-20 | Basf Aktiengesellschaft | Process for preparing hydantoins or cyclic anhydrides of an amino acid |
| US7439390B2 (en) | 2004-06-11 | 2008-10-21 | Degussa Ag | Process for preparing amino acids using the amidocarbonylation reaction |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5521737B2 (enExample) * | 1972-12-23 | 1980-06-12 | ||
| US4091024A (en) * | 1976-12-03 | 1978-05-23 | E. R. Squibb & Sons, Inc. | Pyrrolidine and piperidine-2-carboxylic acid derivatives |
| US4198517A (en) * | 1976-12-03 | 1980-04-15 | E. R. Squibb & Sons, Inc. | Histidine derivatives |
| FR2395252A1 (fr) * | 1977-06-21 | 1979-01-19 | Inst Francais Du Petrole | Procede de fabrication de derive n-acyle d'acide amine |
| FR2468402B2 (fr) * | 1978-11-13 | 1983-11-04 | Elf Aquitaine | Microemulsions aqueuses de substances organiques |
| FR2523576A1 (fr) * | 1982-03-17 | 1983-09-23 | Inst Francais Du Petrole | Procede de preparation d'acides n-acyliminodiacetiques |
| US4496756A (en) * | 1983-09-01 | 1985-01-29 | Ethyl Corporation | Process for preparing amino acid esters |
| DE3345411A1 (de) * | 1983-12-15 | 1985-06-27 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur reindarstellung von carbonsaeuren |
| US4547590A (en) * | 1984-07-06 | 1985-10-15 | W. R. Grace & Co. | Carbon monoxide process for the production of alpha amino acids |
| US4918222A (en) * | 1984-07-27 | 1990-04-17 | Texaco Inc. | Process for synthesis of N-acetylglycine |
| EP0170830B1 (en) * | 1984-07-27 | 1989-03-22 | Texaco Development Corporation | A process for amido carbonylation of an aldehyde to n-acetyl alpha-amino acids |
| US5097065A (en) * | 1985-04-05 | 1992-03-17 | Texaco Inc. | Process for synthesis of a novel amino acid from styrene, acetamide and syngas |
| EP0413068A1 (en) * | 1985-10-29 | 1991-02-20 | The Standard Oil Company | Process for making an optically active mixture of an n-acyl-amino acid or ester containing at least two chiral centers |
| FR2591221B1 (fr) * | 1985-12-10 | 1988-02-19 | Rhone Poulenc Sante | Procede de preparation d'a-aminoacides |
| US4720573A (en) * | 1986-07-31 | 1988-01-19 | Texaco Inc. | Process for synthesis of glutamic acid from acrylate, amide and synthesis gas |
| EP0313692B1 (en) * | 1987-10-27 | 1992-03-25 | Texaco Development Corporation | Process for synthesis of glumatic acid from acrylate, amide and synthesis gas |
| US4892687A (en) * | 1986-10-08 | 1990-01-09 | Texaco Inc. | Process for synthesis of amidoacids using a cobalt catalyst and a bidental phosphine ligand |
| US4891442A (en) * | 1987-03-09 | 1990-01-02 | Texaco Inc. | Process for synthesis of β-phenylalanine |
| US4954466A (en) * | 1989-11-30 | 1990-09-04 | Monsanto Company | Recovery of cobalt catalyst values |
| CN1055284C (zh) * | 1994-12-23 | 2000-08-09 | 中国科学院兰州化学物理研究所 | N-酰基α-氨基酸的合成方法 |
| BR9806266A (pt) * | 1997-02-13 | 2000-10-17 | Monsanto Co | "método de preparação de ácidos de amino carboxìlicos" |
| US6130351A (en) * | 1998-08-12 | 2000-10-10 | Monsanto Company | Continuous process for the preparation of N-(phosphonomethyl) iminodiacetic acid |
| DE10039268A1 (de) * | 2000-08-11 | 2002-02-21 | Degussa | Hydrolyse von Acylaminosäuren |
| JP4554266B2 (ja) * | 2004-04-27 | 2010-09-29 | 日本曹達株式会社 | N−アシルアミノ酸の製造方法 |
| GB0413092D0 (en) * | 2004-06-11 | 2004-07-14 | Degussa | Process for preparing amino acids using the amidocarbonylation reaction (1) |
| WO2006010885A1 (en) * | 2004-07-30 | 2006-02-02 | Heriot-Watt University | Palladacyles, their preparation and catalytic processes involving their use as catalyst, especially catalytic carbonylation processes |
| JP2013095732A (ja) * | 2011-11-04 | 2013-05-20 | Sumitomo Chemical Co Ltd | N−アシルアミノ酸の製造方法 |
-
1970
- 1970-04-04 JP JP45028773A patent/JPS4817259B1/ja active Pending
-
1971
- 1971-03-25 US US00128164A patent/US3766266A/en not_active Expired - Lifetime
- 1971-03-31 NL NL7104282A patent/NL7104282A/xx not_active Application Discontinuation
- 1971-04-01 DE DE19712115985 patent/DE2115985A1/de not_active Ceased
- 1971-04-01 CA CA109,412A patent/CA959496A/en not_active Expired
- 1971-04-01 IT IT22617/71A patent/IT1001466B/it active
- 1971-04-02 FR FR7111817A patent/FR2089136A5/fr not_active Expired
- 1971-04-02 CH CH481271A patent/CH561176A5/xx not_active IP Right Cessation
- 1971-04-19 GB GB2556371*A patent/GB1325102A/en not_active Expired
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3242374A1 (de) * | 1981-11-17 | 1983-05-26 | Sagami Chemical Research Center, Tokyo | Verfahren zur herstellung von n-acyl-(alpha)-aminosaeuren |
| EP0197659A1 (en) * | 1985-04-05 | 1986-10-15 | Texaco Development Corporation | Process for synthesizing N-acetylglycine using novel promoters |
| EP0292918A1 (en) * | 1987-05-26 | 1988-11-30 | Nissan Chemical Industries Ltd. | Process for producing phosphinylamino acid derivatives |
| US4906764A (en) * | 1987-05-26 | 1990-03-06 | Nissan Chemical Industries Ltd. | Process for producing phosphinylamino acid derivatives |
| EP0338330B1 (de) * | 1988-04-16 | 1992-06-24 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von N-Acylaminosäuren |
| EP0350630A1 (de) * | 1988-07-14 | 1990-01-17 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von N-Acyl-phosphinothricin-P-ester |
| WO1998004518A1 (de) * | 1996-07-25 | 1998-02-05 | Aventis Research & Technologies Gmbh & Co Kg | Verfahren zur katalytischen herstellung von n-acylglycinderivaten |
| US6320055B1 (en) | 1999-04-28 | 2001-11-20 | Basf Aktiengesellschaft | Process for preparing hydantoins or cyclic anhydrides of an amino acid |
| EP1063226A1 (de) * | 1999-06-25 | 2000-12-27 | Degussa-Hüls Aktiengesellschaft | Verfahren zur Herstellung von N-Acylaminosäuren |
| US7439390B2 (en) | 2004-06-11 | 2008-10-21 | Degussa Ag | Process for preparing amino acids using the amidocarbonylation reaction |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1325102A (en) | 1973-08-01 |
| CA959496A (en) | 1974-12-17 |
| US3766266A (en) | 1973-10-16 |
| JPS4817259B1 (enExample) | 1973-05-28 |
| IT1001466B (it) | 1976-04-20 |
| FR2089136A5 (enExample) | 1972-01-07 |
| CH561176A5 (enExample) | 1975-04-30 |
| NL7104282A (enExample) | 1971-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2115985A1 (de) | Verfahren zur Herstellung von alpha Aminosaurenund ihren Derivaten | |
| DD148052A5 (de) | Verfahren zur herstellung neuer zwischenprodukte von arzneimitteln | |
| DE1568277A1 (de) | Verfahren zur Herstellung von neuen,optisch aktiven Phenylisopylamin-Derivaten | |
| WO2001012583A1 (de) | Verfahren zur herstellung von adrenalin | |
| DE887651C (de) | Verfahren zur Herstellung von Aminoketonen | |
| DD142888A5 (de) | Verfahren zur herstellung von phosphor-kohlenstoff-stickstoff-bindung enthaltenden verbindungen | |
| DE68908121T2 (de) | Verfahren zur Herstellung von 5-Cyanovaleriansäure und ihrer Ester unter Verwendung von zyklischen Co-Lösungsmitteln. | |
| EP0059792B1 (de) | Verfahren zur Stabilisierung wässeriger Lösungen von Acetoacetamiden | |
| AT310724B (de) | Verfahren zur Herstellung von C-Phenylglycinen | |
| DE3218540A1 (de) | Spiro-2-aza-alkan-3-carbonitrile, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2653332C2 (de) | Verfahren zur Gewinnung von reinem L-Cystin | |
| DE2404306C3 (de) | Optisch aktive Pinanderivate | |
| DE2521088A1 (de) | Diterpensaeureanilide und verfahren zu ihrer herstellung | |
| DE2034682A1 (de) | Herstellung von eis 1 Propenylphos phonsaure | |
| DE69514115T2 (de) | Verfahren zur herstellung von levobupivacain und analogue aus l-lysin | |
| CH378868A (de) | Verfahren zur Herstellung des w-Amino-caprylsäureamids | |
| DE2533685A1 (de) | Verfahren zur herstellung von adenin | |
| DE2409195B2 (de) | Verfahren zur herstellung von imidazol-4,5-dicarboxamid | |
| DE3043115A1 (de) | Verfahren und katalysator zum hydrieren von aromatischen dinitrilen | |
| AT359989B (de) | Verfahren zur herstellung von neuen omega- -amino-carbonsaeureamiden und von deren salzen | |
| DE3009604A1 (de) | Verfahren zur herstellung von butyrolactonen | |
| DE60300806T2 (de) | Verfahren zur Herstellung von N-((S)-1-(Ethoxycarbonyl)butyl)-(S)-alanin und Verwendung in der Synthese von Perindopril | |
| AT238180B (de) | Verfahren zur Herstellung neuer Pyrrolidinverbindungen | |
| DE1470020C (de) | alpha Hydrazino beta (5 hydroxy 3 indolyl) propionsäure und Verfahren zu ihrer Herstellung | |
| DE2305256A1 (de) | Verfahren zur herstellung von 3fluor-d-alanin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8131 | Rejection |