DE2105378A1 - Oxadiazolidin-3,5-dione - Google Patents
Oxadiazolidin-3,5-dioneInfo
- Publication number
- DE2105378A1 DE2105378A1 DE19712105378 DE2105378A DE2105378A1 DE 2105378 A1 DE2105378 A1 DE 2105378A1 DE 19712105378 DE19712105378 DE 19712105378 DE 2105378 A DE2105378 A DE 2105378A DE 2105378 A1 DE2105378 A1 DE 2105378A1
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- parts
- oxadiazolidine
- weight
- dione
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000004009 herbicide Substances 0.000 claims description 5
- 230000002363 herbicidal effect Effects 0.000 claims description 4
- XDENVSFWQSKKLZ-UHFFFAOYSA-N 1,2,4-oxadiazolidine-3,5-dione Chemical class O=C1NOC(=O)N1 XDENVSFWQSKKLZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- -1 alkynyl radical Chemical class 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 241000196324 Embryophyta Species 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 235000008427 Brassica arvensis Nutrition 0.000 description 6
- 244000024671 Brassica kaber Species 0.000 description 6
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 6
- 230000006378 damage Effects 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 244000098338 Triticum aestivum Species 0.000 description 5
- 240000008042 Zea mays Species 0.000 description 5
- RBRPAKDHMRWACJ-UHFFFAOYSA-N 2-methylbut-3-en-2-amine Chemical compound CC(C)(N)C=C RBRPAKDHMRWACJ-UHFFFAOYSA-N 0.000 description 4
- 240000004296 Lolium perenne Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 235000007244 Zea mays Nutrition 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 244000303225 Lamium amplexicaule Species 0.000 description 3
- 235000009198 Lamium amplexicaule Nutrition 0.000 description 3
- 240000006597 Poa trivialis Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- JVCDZPRJOFKWPT-UHFFFAOYSA-N [3-(4-methyl-3,5-dioxo-1,2,4-oxadiazolidin-2-yl)phenyl] N,N-dimethylcarbamate Chemical compound CN(C(=O)OC=1C=C(C=CC1)N1OC(N(C1=O)C)=O)C JVCDZPRJOFKWPT-UHFFFAOYSA-N 0.000 description 3
- NDIMBMYQQCDEAS-UHFFFAOYSA-N [3-(4-methyl-3,5-dioxo-1,2,4-oxadiazolidin-2-yl)phenyl] carbonochloridate Chemical compound ClC(=O)OC=1C=C(C=CC1)N1OC(N(C1=O)C)=O NDIMBMYQQCDEAS-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000004359 castor oil Substances 0.000 description 3
- 235000019438 castor oil Nutrition 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 240000006122 Chenopodium album Species 0.000 description 2
- 235000009344 Chenopodium album Nutrition 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- 244000214240 Galinsoga parviflora Species 0.000 description 2
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 241000209048 Poa Species 0.000 description 2
- 244000292693 Poa annua Species 0.000 description 2
- 241001148683 Zostera marina Species 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 210000001699 lower leg Anatomy 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RZLUTARKQTYOJN-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-dione Chemical compound O=C1N(C)C(=O)ON1C1=CC=CC(O)=C1 RZLUTARKQTYOJN-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- RTZZCYNQPHTPPL-UHFFFAOYSA-N 3-nitrophenol Chemical compound OC1=CC=CC([N+]([O-])=O)=C1 RTZZCYNQPHTPPL-UHFFFAOYSA-N 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 101000913968 Ipomoea purpurea Chalcone synthase C Proteins 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 101000907988 Petunia hybrida Chalcone-flavanone isomerase C Proteins 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229960003369 butacaine Drugs 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- RWQSNJNTGSUNOR-UHFFFAOYSA-N methyl n-carbonochloridoyl-n-methylcarbamate Chemical compound COC(=O)N(C)C(Cl)=O RWQSNJNTGSUNOR-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- YDCVQGAUCOROHB-UHFFFAOYSA-N oxadiazolidine-4,5-dione Chemical class O=C1NNOC1=O YDCVQGAUCOROHB-UHFFFAOYSA-N 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 229920003217 poly(methylsilsesquioxane) Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712105378 DE2105378A1 (de) | 1971-02-05 | 1971-02-05 | Oxadiazolidin-3,5-dione |
| CH1781871A CH561507A5 (enExample) | 1971-02-05 | 1971-12-07 | |
| BE778180A BE778180A (fr) | 1971-02-05 | 1972-01-18 | Oxadiazolidine-3,5-diones |
| IL38632A IL38632A (en) | 1971-02-05 | 1972-01-25 | Substituted 2-(m-carbamoyloxyphenyl)-4-methyl-1,2,4-oxadiazolidine-3,5-diones and their use as herbicides |
| US00221064A US3847931A (en) | 1971-02-05 | 1972-01-26 | Oxadiazolidine-3,5-diones |
| NL7201065A NL7201065A (enExample) | 1971-02-05 | 1972-01-26 | |
| ZA720563A ZA72563B (en) | 1971-02-05 | 1972-01-28 | Oxadiazolidine-3,5-diones |
| CS559A CS167340B2 (enExample) | 1971-02-05 | 1972-01-28 | |
| CA133,597A CA971574A (en) | 1971-02-05 | 1972-01-31 | Oxadiazolidine-3,5-diones |
| IT48106/72A IT948412B (it) | 1971-02-05 | 1972-02-02 | Ossadiazolidin 3 5 dioni |
| HUBA2699A HU163831B (enExample) | 1971-02-05 | 1972-02-02 | |
| PL1972153275A PL77409B1 (enExample) | 1971-02-05 | 1972-02-04 | |
| SU1743713A SU543330A3 (ru) | 1971-02-05 | 1972-02-04 | Гербицидна композици |
| GB529772A GB1369160A (en) | 1971-02-05 | 1972-02-04 | Oxadiazolidine-3,5-diones |
| AT92372A AT314265B (de) | 1971-02-05 | 1972-02-04 | Herbizid |
| FR7203761A FR2125079A5 (enExample) | 1971-02-05 | 1972-02-04 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712105378 DE2105378A1 (de) | 1971-02-05 | 1971-02-05 | Oxadiazolidin-3,5-dione |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2105378A1 true DE2105378A1 (de) | 1972-08-24 |
Family
ID=5797868
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712105378 Pending DE2105378A1 (de) | 1971-02-05 | 1971-02-05 | Oxadiazolidin-3,5-dione |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3847931A (enExample) |
| AT (1) | AT314265B (enExample) |
| BE (1) | BE778180A (enExample) |
| CA (1) | CA971574A (enExample) |
| CH (1) | CH561507A5 (enExample) |
| CS (1) | CS167340B2 (enExample) |
| DE (1) | DE2105378A1 (enExample) |
| FR (1) | FR2125079A5 (enExample) |
| GB (1) | GB1369160A (enExample) |
| HU (1) | HU163831B (enExample) |
| IL (1) | IL38632A (enExample) |
| IT (1) | IT948412B (enExample) |
| NL (1) | NL7201065A (enExample) |
| PL (1) | PL77409B1 (enExample) |
| SU (1) | SU543330A3 (enExample) |
| ZA (1) | ZA72563B (enExample) |
-
1971
- 1971-02-05 DE DE19712105378 patent/DE2105378A1/de active Pending
- 1971-12-07 CH CH1781871A patent/CH561507A5/xx not_active IP Right Cessation
-
1972
- 1972-01-18 BE BE778180A patent/BE778180A/xx unknown
- 1972-01-25 IL IL38632A patent/IL38632A/xx unknown
- 1972-01-26 US US00221064A patent/US3847931A/en not_active Expired - Lifetime
- 1972-01-26 NL NL7201065A patent/NL7201065A/xx unknown
- 1972-01-28 CS CS559A patent/CS167340B2/cs unknown
- 1972-01-28 ZA ZA720563A patent/ZA72563B/xx unknown
- 1972-01-31 CA CA133,597A patent/CA971574A/en not_active Expired
- 1972-02-02 HU HUBA2699A patent/HU163831B/hu unknown
- 1972-02-02 IT IT48106/72A patent/IT948412B/it active
- 1972-02-04 FR FR7203761A patent/FR2125079A5/fr not_active Expired
- 1972-02-04 GB GB529772A patent/GB1369160A/en not_active Expired
- 1972-02-04 AT AT92372A patent/AT314265B/de not_active IP Right Cessation
- 1972-02-04 PL PL1972153275A patent/PL77409B1/pl unknown
- 1972-02-04 SU SU1743713A patent/SU543330A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| SU543330A3 (ru) | 1977-01-15 |
| US3847931A (en) | 1974-11-12 |
| IT948412B (it) | 1973-05-30 |
| IL38632A0 (en) | 1972-03-28 |
| HU163831B (enExample) | 1973-11-28 |
| GB1369160A (en) | 1974-10-02 |
| CS167340B2 (enExample) | 1976-04-29 |
| ZA72563B (en) | 1972-11-29 |
| CH561507A5 (enExample) | 1975-05-15 |
| IL38632A (en) | 1974-07-31 |
| AT314265B (de) | 1974-03-25 |
| NL7201065A (enExample) | 1972-08-08 |
| FR2125079A5 (enExample) | 1972-09-22 |
| BE778180A (fr) | 1972-07-18 |
| CA971574A (en) | 1975-07-22 |
| PL77409B1 (enExample) | 1975-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0090309A1 (de) | Dihydrothiophen-carbonester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| DE2915250A1 (de) | Salze von alpha -aminoacetaniliden | |
| EP0116932A1 (de) | Thiophen-carbonester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| EP0074595B1 (de) | Substituierte Phenylsulfonylharnstoff- Derivate, Verfahren und neue Zwischenprodukte zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| EP0071794A1 (de) | 5-Amino-1-phenyl-pyrazol-4-carbonsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| DE2005326A1 (de) | Harnstoffderivate | |
| DE2659404A1 (de) | Neue verbindungen, verfahren zu ihrer herstellung und sie enthaltende herbizide zusammensetzungen | |
| DE3882290T2 (de) | 2-(Substituierte imino)-1,3,4-Dihydrothiadiazole. | |
| DE2219923A1 (de) | Substituierte o- eckige klammer auf aminosulfonyl eckige klammer zu -glykolsaeureamide | |
| EP0053699A1 (de) | 2'-Phenylhydrazino-2-cyanacrylsäureester und diese enthaltende Herbizide | |
| EP0010163B1 (de) | N-Diazolylalkyl-chloracetanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| EP0058868B1 (de) | Substituierte Tetrahydropyrimidinonderivate, Verfahren zu ihrer Herstellung und Herbizide, die diese Derivate als Wirkstoffe enthalten | |
| DE2101698A1 (de) | Substituierte m-Trifluormethylphenylharnstoffderivate | |
| DE3201110A1 (de) | 3-alken(in)yl-mercapto(amino)-4-amino-6-tert.-butyl-1,2,4-triazin-5-one, verfahren zu ihrer herstellung sowie ihrer verwendung als herbizide | |
| DE2105378A1 (de) | Oxadiazolidin-3,5-dione | |
| EP0062254A1 (de) | Substituierte Acetanilide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2041996A1 (de) | Substituierte Uracile | |
| EP0065189B1 (de) | Heterocyclische Dihalogenacetamide, Verfahren zu ihrer Herstellung und herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Dihalogenacetamide als antagonistische Mittel enthalten | |
| EP0001271A1 (de) | Heterocyclische Norbornanderivate, Mittel zur Beeinflussung des Pflanzenwachstums die diese Verbindungen enthalten, und Verfahren zur Herstellung dieser Mittel | |
| EP0107123B1 (de) | Anilinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| EP0084673A1 (de) | Aminothiadiazole, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| DE2405324A1 (de) | 1,2,4-oxdiazolin-5-on-derivate | |
| EP0073443A1 (de) | 2H-1,2,4,6-Thiatriazin-1,1-dioxide, ein Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| DE2045907B2 (de) | Biscarbamate und Herbizide, die sie als Wirkstoff enthalten | |
| DE2553209A1 (de) | Substituierte 2,1,3-benzothiadiazinverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |