DE2103326A1 - Verfahren zur Herstellung von ge formten Kautschukprodukten - Google Patents
Verfahren zur Herstellung von ge formten KautschukproduktenInfo
- Publication number
- DE2103326A1 DE2103326A1 DE19712103326 DE2103326A DE2103326A1 DE 2103326 A1 DE2103326 A1 DE 2103326A1 DE 19712103326 DE19712103326 DE 19712103326 DE 2103326 A DE2103326 A DE 2103326A DE 2103326 A1 DE2103326 A1 DE 2103326A1
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- aromatic
- hydrocarbon
- aluminum
- preformed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 34
- 230000008569 process Effects 0.000 title claims description 10
- 229920001971 elastomer Polymers 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- 239000003054 catalyst Substances 0.000 claims description 63
- 238000006116 polymerization reaction Methods 0.000 claims description 36
- -1 unsaturated alicyclic hydrocarbon Chemical class 0.000 claims description 34
- 239000003921 oil Substances 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 25
- 229930195733 hydrocarbon Natural products 0.000 claims description 23
- 125000003118 aryl group Chemical group 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 239000000945 filler Substances 0.000 claims description 15
- 150000002430 hydrocarbons Chemical class 0.000 claims description 15
- 150000001334 alicyclic compounds Chemical class 0.000 claims description 14
- 239000000178 monomer Substances 0.000 claims description 12
- 239000012744 reinforcing agent Substances 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 11
- 125000004122 cyclic group Chemical group 0.000 claims description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- 239000001301 oxygen Substances 0.000 claims description 11
- 229910052721 tungsten Inorganic materials 0.000 claims description 11
- 239000010937 tungsten Substances 0.000 claims description 11
- 239000003963 antioxidant agent Substances 0.000 claims description 10
- 239000003431 cross linking reagent Substances 0.000 claims description 9
- 239000011203 carbon fibre reinforced carbon Chemical group 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 7
- 230000003078 antioxidant effect Effects 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 239000000049 pigment Substances 0.000 claims description 7
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 6
- 239000011707 mineral Substances 0.000 claims description 6
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 5
- 229910001882 dioxygen Inorganic materials 0.000 claims description 5
- 230000005484 gravity Effects 0.000 claims description 5
- 239000010690 paraffinic oil Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000005248 alkyl aryloxy group Chemical group 0.000 claims description 4
- 150000004982 aromatic amines Chemical class 0.000 claims description 4
- 239000010692 aromatic oil Substances 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 230000009471 action Effects 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 150000002989 phenols Chemical class 0.000 claims description 3
- 150000003573 thiols Chemical class 0.000 claims description 3
- 229910052723 transition metal Inorganic materials 0.000 claims description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 229920000297 Rayon Polymers 0.000 claims 1
- 239000000243 solution Substances 0.000 description 32
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 21
- 239000000047 product Substances 0.000 description 14
- 239000000463 material Substances 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 12
- 239000004913 cyclooctene Substances 0.000 description 11
- KAKZBPTYRLMSJV-UHFFFAOYSA-N butadiene group Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- URYYVOIYTNXXBN-UPHRSURJSA-N cyclooctene Chemical compound C1CCC\C=C/CC1 URYYVOIYTNXXBN-UPHRSURJSA-N 0.000 description 10
- 229910052782 aluminium Inorganic materials 0.000 description 9
- 235000006708 antioxidants Nutrition 0.000 description 9
- 239000000539 dimer Substances 0.000 description 8
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 7
- 125000003710 aryl alkyl group Chemical group 0.000 description 7
- 239000006229 carbon black Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- MMMNTDFSPSQXJP-UHFFFAOYSA-N orphenadrine citrate Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C=1C=CC=C(C)C=1C(OCCN(C)C)C1=CC=CC=C1 MMMNTDFSPSQXJP-UHFFFAOYSA-N 0.000 description 7
- 238000007151 ring opening polymerisation reaction Methods 0.000 description 7
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 125000002723 alicyclic group Chemical group 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 239000012299 nitrogen atmosphere Substances 0.000 description 6
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 5
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 5
- 229920005603 alternating copolymer Polymers 0.000 description 5
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 5
- 238000000465 moulding Methods 0.000 description 5
- 150000003254 radicals Chemical group 0.000 description 5
- 239000004606 Fillers/Extenders Substances 0.000 description 4
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 229920001897 terpolymer Polymers 0.000 description 4
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 4
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical class SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000006237 Intermediate SAF Substances 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000005234 alkyl aluminium group Chemical group 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- VYXHVRARDIDEHS-UHFFFAOYSA-N 1,5-cyclooctadiene Chemical compound C1CC=CCCC=C1 VYXHVRARDIDEHS-UHFFFAOYSA-N 0.000 description 2
- 239000004912 1,5-cyclooctadiene Substances 0.000 description 2
- ZRKMQKLGEQPLNS-UHFFFAOYSA-N 1-Pentanethiol Chemical compound CCCCCS ZRKMQKLGEQPLNS-UHFFFAOYSA-N 0.000 description 2
- BVUXDWXKPROUDO-UHFFFAOYSA-N 2,6-di-tert-butyl-4-ethylphenol Chemical compound CCC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 BVUXDWXKPROUDO-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 150000001602 bicycloalkyls Chemical group 0.000 description 2
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- UDJQAOMQLIIJIE-UHFFFAOYSA-L dichlorotungsten Chemical compound Cl[W]Cl UDJQAOMQLIIJIE-UHFFFAOYSA-L 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000007670 refining Methods 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- RVEZZJVBDQCTEF-UHFFFAOYSA-N sulfenic acid Chemical class SO RVEZZJVBDQCTEF-UHFFFAOYSA-N 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- KPGXUAIFQMJJFB-UHFFFAOYSA-H tungsten hexachloride Chemical compound Cl[W](Cl)(Cl)(Cl)(Cl)Cl KPGXUAIFQMJJFB-UHFFFAOYSA-H 0.000 description 2
- NXHILIPIEUBEPD-UHFFFAOYSA-H tungsten hexafluoride Chemical compound F[W](F)(F)(F)(F)F NXHILIPIEUBEPD-UHFFFAOYSA-H 0.000 description 2
- PFTAWBLQPZVEMU-DZGCQCFKSA-N (+)-catechin Chemical compound C1([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC=C(O)C(O)=C1 PFTAWBLQPZVEMU-DZGCQCFKSA-N 0.000 description 1
- MZJCFRKLOXHQIL-ZPUQHVIOSA-N (1E,3E)-cyclodeca-1,3-diene Chemical compound C/1=C\C=C\CCCCCC\1 MZJCFRKLOXHQIL-ZPUQHVIOSA-N 0.000 description 1
- SXIFNAOBIAIYJO-SXVCMZJPSA-N (1E,3E,7E)-cyclododeca-1,3,7-triene Chemical compound C/1=C\CCCC\C=C\C=C\CC\1 SXIFNAOBIAIYJO-SXVCMZJPSA-N 0.000 description 1
- CDCDYENGTKUCSR-UAOXYDSYSA-N (1z,4z,7z)-cyclonona-1,4,7-triene Chemical compound C\1\C=C/C\C=C/C\C=C/1 CDCDYENGTKUCSR-UAOXYDSYSA-N 0.000 description 1
- GWCMUONZBWHLRN-REXUQAFDSA-N (1z,6z)-cyclodeca-1,6-diene Chemical compound C1C\C=C/CCC\C=C/C1 GWCMUONZBWHLRN-REXUQAFDSA-N 0.000 description 1
- CMAOLVNGLTWICC-UHFFFAOYSA-N 2-fluoro-5-methylbenzonitrile Chemical compound CC1=CC=C(F)C(C#N)=C1 CMAOLVNGLTWICC-UHFFFAOYSA-N 0.000 description 1
- NMVXHZSPDTXJSJ-UHFFFAOYSA-L 2-methylpropylaluminum(2+);dichloride Chemical compound CC(C)C[Al](Cl)Cl NMVXHZSPDTXJSJ-UHFFFAOYSA-L 0.000 description 1
- YEUZDWLVCVNEAO-UHFFFAOYSA-N 3-phenylcyclooctene Chemical compound C1CCCCC=CC1C1=CC=CC=C1 YEUZDWLVCVNEAO-UHFFFAOYSA-N 0.000 description 1
- WLHCBQAPPJAULW-UHFFFAOYSA-N 4-methylbenzenethiol Chemical compound CC1=CC=C(S)C=C1 WLHCBQAPPJAULW-UHFFFAOYSA-N 0.000 description 1
- 241000282461 Canis lupus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- YOUIDGQAIILFBW-UHFFFAOYSA-J Tungsten(IV) chloride Inorganic materials Cl[W](Cl)(Cl)Cl YOUIDGQAIILFBW-UHFFFAOYSA-J 0.000 description 1
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminum chloride Substances Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 238000000498 ball milling Methods 0.000 description 1
- PJGHZHNSMUMSHJ-UHFFFAOYSA-L benzylaluminum(2+);dibromide Chemical compound [Br-].[Br-].[Al+2]CC1=CC=CC=C1 PJGHZHNSMUMSHJ-UHFFFAOYSA-L 0.000 description 1
- VIQRCOQXIHFJND-UHFFFAOYSA-N bicyclo[2.2.2]oct-2-ene Chemical compound C1CC2CCC1C=C2 VIQRCOQXIHFJND-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- ADRVNXBAWSRFAJ-UHFFFAOYSA-N catechin Natural products OC1Cc2cc(O)cc(O)c2OC1c3ccc(O)c(O)c3 ADRVNXBAWSRFAJ-UHFFFAOYSA-N 0.000 description 1
- 235000005487 catechin Nutrition 0.000 description 1
- 238000009750 centrifugal casting Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- YFTINYFNBHAGRZ-UHFFFAOYSA-L chloro(fluoro)tungsten Chemical compound F[W]Cl YFTINYFNBHAGRZ-UHFFFAOYSA-L 0.000 description 1
- 229950001002 cianidanol Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- CFBGXYDUODCMNS-UHFFFAOYSA-N cyclobutene Chemical compound C1CC=C1 CFBGXYDUODCMNS-UHFFFAOYSA-N 0.000 description 1
- ZLLMHFVWHQSIIV-UHFFFAOYSA-N cyclododeca-1,7-diene Chemical compound C1CCC=CCCCCC=CC1 ZLLMHFVWHQSIIV-UHFFFAOYSA-N 0.000 description 1
- HYPABJGVBDSCIT-UHFFFAOYSA-N cyclododecene Chemical class C1CCCCCC=CCCCC1 HYPABJGVBDSCIT-UHFFFAOYSA-N 0.000 description 1
- UBQOICRQWAEPCA-UHFFFAOYSA-M dibenzyl(bromo)alumane Chemical compound [Br-].C=1C=CC=CC=1C[Al+]CC1=CC=CC=C1 UBQOICRQWAEPCA-UHFFFAOYSA-M 0.000 description 1
- CKHRABBVHUWTBC-UHFFFAOYSA-L dibromo(phenyl)alumane Chemical compound [Br-].[Br-].[Al+2]C1=CC=CC=C1 CKHRABBVHUWTBC-UHFFFAOYSA-L 0.000 description 1
- LSALTGRCOGBBFR-UHFFFAOYSA-L dibromotungsten Chemical compound Br[W]Br LSALTGRCOGBBFR-UHFFFAOYSA-L 0.000 description 1
- RFUDQCRVCDXBGK-UHFFFAOYSA-L dichloro(propyl)alumane Chemical compound [Cl-].[Cl-].CCC[Al+2] RFUDQCRVCDXBGK-UHFFFAOYSA-L 0.000 description 1
- HJXBDPDUCXORKZ-UHFFFAOYSA-N diethylalumane Chemical compound CC[AlH]CC HJXBDPDUCXORKZ-UHFFFAOYSA-N 0.000 description 1
- JJSGABFIILQOEY-UHFFFAOYSA-M diethylalumanylium;bromide Chemical compound CC[Al](Br)CC JJSGABFIILQOEY-UHFFFAOYSA-M 0.000 description 1
- HRXSKIOIHQEGAI-UHFFFAOYSA-M diethylalumanylium;fluoride Chemical compound CC[Al](F)CC HRXSKIOIHQEGAI-UHFFFAOYSA-M 0.000 description 1
- PPQUYYAZSOKTQD-UHFFFAOYSA-M diethylalumanylium;iodide Chemical compound CC[Al](I)CC PPQUYYAZSOKTQD-UHFFFAOYSA-M 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- SVPHCLUPIVHYBV-UHFFFAOYSA-L diiodo(phenyl)alumane Chemical compound [I-].[I-].[Al+2]C1=CC=CC=C1 SVPHCLUPIVHYBV-UHFFFAOYSA-L 0.000 description 1
- HIVRDDZUKVNKAO-UHFFFAOYSA-N diphenylalumane Chemical compound C1(=CC=CC=C1)[AlH]C1=CC=CC=C1 HIVRDDZUKVNKAO-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- JFICPAADTOQAMU-UHFFFAOYSA-L ethylaluminum(2+);dibromide Chemical compound CC[Al](Br)Br JFICPAADTOQAMU-UHFFFAOYSA-L 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- OQVJXQJWYQNWTI-UHFFFAOYSA-H hexabromotungsten Chemical compound Br[W](Br)(Br)(Br)(Br)Br OQVJXQJWYQNWTI-UHFFFAOYSA-H 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- 229960004337 hydroquinone Drugs 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000012764 mineral filler Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- SJYNFBVQFBRSIB-UHFFFAOYSA-N norbornadiene Chemical compound C1=CC2C=CC1C2 SJYNFBVQFBRSIB-UHFFFAOYSA-N 0.000 description 1
- 239000008041 oiling agent Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- GEJUFTHBORQCNQ-UHFFFAOYSA-N phenylalumane Chemical compound [AlH2]c1ccccc1 GEJUFTHBORQCNQ-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920003245 polyoctenamer Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- BGRYSGVIVVUJHH-UHFFFAOYSA-N prop-2-ynyl propanoate Chemical compound CCC(=O)OCC#C BGRYSGVIVVUJHH-UHFFFAOYSA-N 0.000 description 1
- ZJLMKPKYJBQJNH-UHFFFAOYSA-N propane-1,3-dithiol Chemical compound SCCCS ZJLMKPKYJBQJNH-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 229940079877 pyrogallol Drugs 0.000 description 1
- 229960001755 resorcinol Drugs 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- MMCXETIAXNXKPE-UHFFFAOYSA-J tetraiodotungsten Chemical compound I[W](I)(I)I MMCXETIAXNXKPE-UHFFFAOYSA-J 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- MCWWHQMTJNSXPX-UHFFFAOYSA-N tribenzylalumane Chemical compound C=1C=CC=CC=1C[Al](CC=1C=CC=CC=1)CC1=CC=CC=C1 MCWWHQMTJNSXPX-UHFFFAOYSA-N 0.000 description 1
- SQBBHCOIQXKPHL-UHFFFAOYSA-N tributylalumane Chemical compound CCCC[Al](CCCC)CCCC SQBBHCOIQXKPHL-UHFFFAOYSA-N 0.000 description 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 1
- ORYGRKHDLWYTKX-UHFFFAOYSA-N trihexylalumane Chemical compound CCCCCC[Al](CCCCCC)CCCCCC ORYGRKHDLWYTKX-UHFFFAOYSA-N 0.000 description 1
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 1
- LFXVBWRMVZPLFK-UHFFFAOYSA-N trioctylalumane Chemical compound CCCCCCCC[Al](CCCCCCCC)CCCCCCCC LFXVBWRMVZPLFK-UHFFFAOYSA-N 0.000 description 1
- JQPMDTQDAXRDGS-UHFFFAOYSA-N triphenylalumane Chemical compound C1=CC=CC=C1[Al](C=1C=CC=CC=1)C1=CC=CC=C1 JQPMDTQDAXRDGS-UHFFFAOYSA-N 0.000 description 1
- CNWZYDSEVLFSMS-UHFFFAOYSA-N tripropylalumane Chemical compound CCC[Al](CCC)CCC CNWZYDSEVLFSMS-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G61/00—Macromolecular compounds obtained by reactions forming a carbon-to-carbon link in the main chain of the macromolecule
- C08G61/02—Macromolecular compounds containing only carbon atoms in the main chain of the macromolecule, e.g. polyxylylenes
- C08G61/04—Macromolecular compounds containing only carbon atoms in the main chain of the macromolecule, e.g. polyxylylenes only aliphatic carbon atoms
- C08G61/06—Macromolecular compounds containing only carbon atoms in the main chain of the macromolecule, e.g. polyxylylenes only aliphatic carbon atoms prepared by ring-opening of carbocyclic compounds
- C08G61/08—Macromolecular compounds containing only carbon atoms in the main chain of the macromolecule, e.g. polyxylylenes only aliphatic carbon atoms prepared by ring-opening of carbocyclic compounds of carbocyclic compounds containing one or more carbon-to-carbon double bonds in the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polyoxymethylene Polymers And Polymers With Carbon-To-Carbon Bonds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US905670A | 1970-02-05 | 1970-02-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2103326A1 true DE2103326A1 (de) | 1971-08-12 |
Family
ID=21735331
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712103326 Withdrawn DE2103326A1 (de) | 1970-02-05 | 1971-01-25 | Verfahren zur Herstellung von ge formten Kautschukprodukten |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3652487A (enExample) |
| JP (1) | JPS5511690B1 (enExample) |
| BE (1) | BE762133A (enExample) |
| DE (1) | DE2103326A1 (enExample) |
| FR (1) | FR2080433A5 (enExample) |
| GB (1) | GB1302311A (enExample) |
| NL (1) | NL165765C (enExample) |
| ZA (1) | ZA71124B (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0048439A1 (en) * | 1980-09-18 | 1982-03-31 | The B.F. GOODRICH Company | Norbornene polymers containing bound antioxidant |
| EP0094626A1 (en) * | 1982-05-14 | 1983-11-23 | Hercules Incorporated | Plasticized polydicyclopentadiene and a method for making the same |
| EP0141008A1 (en) * | 1983-08-26 | 1985-05-15 | Hercules Incorporated | Process for making a cellular thermoset poly(dicyclopentadiene) |
| EP0205833A1 (en) * | 1985-05-07 | 1986-12-30 | Hercules Incorporated | Phosphazene flame retardants for reaction injection molded poly(dicyclopentadiene) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4400340A (en) * | 1982-01-25 | 1983-08-23 | Hercules Incorporated | Method for making a dicyclopentadiene thermoset polymer |
| US4126576A (en) * | 1974-12-06 | 1978-11-21 | Toho Titanium Company, Limited | Process for preparation of catalytic components for polymerization of α-olefins |
| US4038471A (en) * | 1976-10-29 | 1977-07-26 | The Goodyear Tire & Rubber Company | Method for preparing high-cis polyalkenamers |
| DE3372102D1 (en) * | 1982-01-25 | 1987-07-23 | Hercules Inc | A dicyclopentadiene thermoset polymer and a catalyst and a method for making it |
| JP2001511194A (ja) * | 1997-01-08 | 2001-08-07 | ハーキュリーズ・インコーポレーテッド | 炭化水素樹脂の製造用触媒としてのフッ化固体酸 |
-
1970
- 1970-02-05 US US9056A patent/US3652487A/en not_active Expired - Lifetime
-
1971
- 1971-01-08 GB GB97171A patent/GB1302311A/en not_active Expired
- 1971-01-11 ZA ZA710124A patent/ZA71124B/xx unknown
- 1971-01-22 FR FR7102232A patent/FR2080433A5/fr not_active Expired
- 1971-01-25 DE DE19712103326 patent/DE2103326A1/de not_active Withdrawn
- 1971-01-27 BE BE762133A patent/BE762133A/xx unknown
- 1971-02-05 JP JP465771A patent/JPS5511690B1/ja active Pending
- 1971-02-05 NL NL7101586.A patent/NL165765C/xx not_active IP Right Cessation
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0048439A1 (en) * | 1980-09-18 | 1982-03-31 | The B.F. GOODRICH Company | Norbornene polymers containing bound antioxidant |
| EP0094626A1 (en) * | 1982-05-14 | 1983-11-23 | Hercules Incorporated | Plasticized polydicyclopentadiene and a method for making the same |
| EP0141008A1 (en) * | 1983-08-26 | 1985-05-15 | Hercules Incorporated | Process for making a cellular thermoset poly(dicyclopentadiene) |
| EP0205833A1 (en) * | 1985-05-07 | 1986-12-30 | Hercules Incorporated | Phosphazene flame retardants for reaction injection molded poly(dicyclopentadiene) |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5511690B1 (enExample) | 1980-03-27 |
| FR2080433A5 (enExample) | 1971-11-12 |
| GB1302311A (enExample) | 1973-01-10 |
| NL7101586A (enExample) | 1971-08-09 |
| NL165765B (nl) | 1980-12-15 |
| US3652487A (en) | 1972-03-28 |
| NL165765C (nl) | 1981-05-15 |
| BE762133A (fr) | 1971-07-01 |
| ZA71124B (en) | 1971-10-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0707017A1 (de) | Verfahren zur Herstellung von mittels Nd-Katalysatoren polymerisierten Dienkautschuken mit niedrigem cold-flow und geringem Eigengeruch | |
| DE1469998A1 (de) | Verfahren zur Haertung von Polymeren mit neuartigen organischen Peroxyden | |
| EP0054144B1 (de) | Verfahren zur kontinuierlichen Herstellung von mit Kautschuk modifizierten Polymerisaten von Vinylaromaten | |
| DE2131354B2 (de) | Verfahren zur Verbesserung der Rohfestigkeit von Kautschukmischungen | |
| DE2126225A1 (de) | Als Klebemittel geeignetes, von einem Kohlenwasserstoff abstammendes Harz | |
| DE3033175C2 (de) | Polybutadienkautschukzusammensetzungen | |
| DE1795738C3 (de) | Polypentenamere, deren Doppelbindungen im wesentlichen cis-Konfiguration aufweisen | |
| DE2415066A1 (de) | Neue vulkanisierbare kompositionen, sowie damit vulkanisierte kompositionen | |
| DE2313535C3 (de) | Bei Normaltemperatur flüssige Masse | |
| DE2103326A1 (de) | Verfahren zur Herstellung von ge formten Kautschukprodukten | |
| DE2509577A1 (de) | Verfahren zur durchfuehrung einer cycloolefin-metathese | |
| DE2039394A1 (de) | Verfahren zur Herstellung von Pfropfmischpolymerisaten | |
| DE1945358C3 (de) | Niedermolekulare Polyalkenamere und Verfahren zu deren Herstellung | |
| DE2058198A1 (de) | Verfahren zum Herstellen von Propf-,Block- und vernetzten ungesaettigten Polymeren und Copolymeren vermittels Olefinmethatese | |
| DE1595343A1 (de) | Verfahren zum Herstellen schlagfester Styrolmischpolymerisate | |
| DE1570099B2 (de) | Verfahren zur herstellung von oelgestreckten ungesaettigten elastomeren polymerisaten | |
| DE1263310B (de) | Verfahren zur Cyclisierung von Kautschuk | |
| DE1806987A1 (de) | Vulkanisationsmittel und Verfahren zu deren Herstellung | |
| DE3006001A1 (de) | Verfahren zur herstellung von cyclopentadienmischpolymerisaten, ein solches mischpolymerisat enthaltende kautschukmassen und deren vulkanisationsprodukte | |
| DE2423714B2 (de) | Verfahren zur Herstellung eines flüssigen Chloroprenpolymeren | |
| DE2509578A1 (de) | Verfahren zur durchfuehrung einer cycloolefinmetathese | |
| DE2131355A1 (de) | Verfahren zur herstellung von copolyalkenameren | |
| DE1169675B (de) | Verfahren zur Polymerisation von Isopren oder Butadien | |
| DE2237353A1 (de) | Hochmolekulare copolyalkenamere und verfahren zu ihrer herstellung | |
| DE1795229B2 (de) | Verfahren zur Herstellung eines Polymerengemisches |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |