DE2101698A1 - Substituierte m-Trifluormethylphenylharnstoffderivate - Google Patents
Substituierte m-TrifluormethylphenylharnstoffderivateInfo
- Publication number
- DE2101698A1 DE2101698A1 DE19712101698 DE2101698A DE2101698A1 DE 2101698 A1 DE2101698 A1 DE 2101698A1 DE 19712101698 DE19712101698 DE 19712101698 DE 2101698 A DE2101698 A DE 2101698A DE 2101698 A1 DE2101698 A1 DE 2101698A1
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- trifluoromethylphenyl
- trifluoromethylphenylurea
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- FQEIBEOBXKJAMZ-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]urea Chemical class NC(=O)NC1=CC=CC(C(F)(F)F)=C1 FQEIBEOBXKJAMZ-UHFFFAOYSA-N 0.000 title claims description 5
- -1 alkyl radical Chemical class 0.000 claims description 7
- 230000002363 herbicidal effect Effects 0.000 claims description 7
- 239000004009 herbicide Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 241000196324 Embryophyta Species 0.000 description 12
- 239000000203 mixture Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 240000006122 Chenopodium album Species 0.000 description 5
- 235000009344 Chenopodium album Nutrition 0.000 description 5
- 244000058871 Echinochloa crus-galli Species 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 235000011999 Panicum crusgalli Nutrition 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- 244000292693 Poa annua Species 0.000 description 4
- 240000006597 Poa trivialis Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 239000004359 castor oil Substances 0.000 description 3
- 235000019438 castor oil Nutrition 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 150000003672 ureas Chemical class 0.000 description 3
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 2
- XPCTZQVDEJYUGT-UHFFFAOYSA-N 3-hydroxy-2-methyl-4-pyrone Chemical compound CC=1OC=CC(=O)C=1O XPCTZQVDEJYUGT-UHFFFAOYSA-N 0.000 description 2
- 235000008427 Brassica arvensis Nutrition 0.000 description 2
- 244000024671 Brassica kaber Species 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- 244000285774 Cyperus esculentus Species 0.000 description 2
- 235000005853 Cyperus esculentus Nutrition 0.000 description 2
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 2
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- OYWRDHBGMCXGFY-UHFFFAOYSA-N 1,2,3-triazinane Chemical compound C1CNNNC1 OYWRDHBGMCXGFY-UHFFFAOYSA-N 0.000 description 1
- MHKGSPHXKAGYDA-UHFFFAOYSA-N 1,3,5-tris[3-(trifluoromethyl)phenyl]triazinane Chemical compound FC(F)(F)C1=CC=CC(C2CN(NN(C2)C=2C=C(C=CC=2)C(F)(F)F)C=2C=C(C=CC=2)C(F)(F)F)=C1 MHKGSPHXKAGYDA-UHFFFAOYSA-N 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- ZIGDMLRLBFCVKM-UHFFFAOYSA-N CC(=O)OCN(C(Cl)=O)C1=CC(=CC=C1)C(F)(F)F Chemical compound CC(=O)OCN(C(Cl)=O)C1=CC(=CC=C1)C(F)(F)F ZIGDMLRLBFCVKM-UHFFFAOYSA-N 0.000 description 1
- 241000207894 Convolvulus arvensis Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- 241000209210 Dactylis Species 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 241001508646 Galeopsis tetrahit Species 0.000 description 1
- 244000100545 Lolium multiflorum Species 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- HYMLWHLQFGRFIY-UHFFFAOYSA-N Maltol Natural products CC1OC=CC(=O)C1=O HYMLWHLQFGRFIY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 244000286177 Raphanus raphanistrum Species 0.000 description 1
- 235000000241 Raphanus raphanistrum Nutrition 0.000 description 1
- 240000000111 Saccharum officinarum Species 0.000 description 1
- 235000007201 Saccharum officinarum Nutrition 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 241000219975 Vicia villosa Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229940043353 maltol Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- XXMGXYAIFSHSLX-UHFFFAOYSA-N n-(methoxymethyl)carbamoyl chloride Chemical compound COCNC(Cl)=O XXMGXYAIFSHSLX-UHFFFAOYSA-N 0.000 description 1
- AAWIEDSRWFRBSM-UHFFFAOYSA-N n-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenoxyacetamide Chemical compound FC(F)(F)C1=CC=C(Cl)C(NC(=O)COC=2C=CC=CC=2)=C1 AAWIEDSRWFRBSM-UHFFFAOYSA-N 0.000 description 1
- KQHZIURIJKFNEL-UHFFFAOYSA-N n-[3-(trifluoromethyl)phenyl]methanimine Chemical compound FC(F)(F)C1=CC=CC(N=C)=C1 KQHZIURIJKFNEL-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712101698 DE2101698A1 (de) | 1971-01-15 | 1971-01-15 | Substituierte m-Trifluormethylphenylharnstoffderivate |
| CH1782171A CH561506A5 (enExample) | 1971-01-15 | 1971-12-07 | |
| CS9065A CS166795B2 (enExample) | 1971-01-15 | 1971-12-29 | |
| NL7118143A NL7118143A (enExample) | 1971-01-15 | 1971-12-30 | |
| IL38504A IL38504A (en) | 1971-01-15 | 1972-01-04 | Substituted(m-trifluoromethyl-phenyl)urea derivatives and their use as herbicides |
| SE00109/72A SE367398B (enExample) | 1971-01-15 | 1972-01-05 | |
| US00215664A US3847971A (en) | 1971-01-15 | 1972-01-05 | Substituted m-trifluoromethylphenylurea derivatives |
| ZA720165A ZA72165B (en) | 1971-01-15 | 1972-01-11 | Substituted m-trifluormethylphenylurea derivatives |
| BR167/72A BR7200167D0 (pt) | 1971-01-15 | 1972-01-12 | Composicoes herbicidas baseadas em novos e valiosos derivados substituidos de m-trifluor metil fenilureta |
| IT47743/72A IT949650B (it) | 1971-01-15 | 1972-01-14 | Derivati della m trifluorometil fenilurea sostituiti |
| SU1737763A SU516331A3 (ru) | 1971-01-15 | 1972-01-14 | Гербицидный состав |
| CA132,496A CA992982A (en) | 1971-01-15 | 1972-01-14 | Substituted m-trifluormethylphenylurea derivatives |
| FR7201258A FR2122248A5 (enExample) | 1971-01-15 | 1972-01-14 | |
| GB178572A GB1367968A (en) | 1971-01-15 | 1972-01-14 | Substituted m-trifluoromethylphenylurea derivatives |
| PL1972152914A PL77353B1 (enExample) | 1971-01-15 | 1972-01-14 | |
| AT31172A AT313633B (de) | 1971-01-15 | 1972-01-14 | Herbizid |
| HUBA2693A HU163829B (enExample) | 1971-01-15 | 1972-01-14 | |
| BE778052A BE778052A (fr) | 1971-01-15 | 1972-01-14 | Derives substitues de la |
| US05/476,149 US3991093A (en) | 1971-01-15 | 1974-06-03 | Substituted m-trifluoromethylphenylurea derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712101698 DE2101698A1 (de) | 1971-01-15 | 1971-01-15 | Substituierte m-Trifluormethylphenylharnstoffderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2101698A1 true DE2101698A1 (de) | 1972-09-07 |
Family
ID=5795929
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712101698 Pending DE2101698A1 (de) | 1971-01-15 | 1971-01-15 | Substituierte m-Trifluormethylphenylharnstoffderivate |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3847971A (enExample) |
| AT (1) | AT313633B (enExample) |
| BE (1) | BE778052A (enExample) |
| BR (1) | BR7200167D0 (enExample) |
| CA (1) | CA992982A (enExample) |
| CH (1) | CH561506A5 (enExample) |
| CS (1) | CS166795B2 (enExample) |
| DE (1) | DE2101698A1 (enExample) |
| FR (1) | FR2122248A5 (enExample) |
| GB (1) | GB1367968A (enExample) |
| HU (1) | HU163829B (enExample) |
| IL (1) | IL38504A (enExample) |
| IT (1) | IT949650B (enExample) |
| NL (1) | NL7118143A (enExample) |
| PL (1) | PL77353B1 (enExample) |
| SE (1) | SE367398B (enExample) |
| SU (1) | SU516331A3 (enExample) |
| ZA (1) | ZA72165B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4046808A (en) * | 1972-08-24 | 1977-09-06 | American Cyanamid Company | (Alkenyloxy)-, (alkynyloxy) and (cyanoalkoxy) alkoxyphenyl ureas and their use as herbicides |
| DE2247310A1 (de) * | 1972-09-27 | 1974-04-04 | Bayer Ag | Tetrasubstituierte harnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| US3978123A (en) * | 1973-07-12 | 1976-08-31 | Chevron Research Company | Herbicidal n-alkylsulfoxymethyl-and-n-alkylsulfonyl-methyl-n-aryl |
| US3916010A (en) * | 1973-08-03 | 1975-10-28 | Chevron Res | 1-Alkanoyloxy-haloethyl urea |
| PH13853A (en) * | 1975-01-13 | 1980-10-22 | Stauffer Chemical Co | Substituted thiomethylurea herbicides |
| US4227915A (en) * | 1978-05-18 | 1980-10-14 | Monsanto Company | N-Substituted oxobenzothiazoline and oxobenzoxazoline derivatives and their use as plant growth regulants |
-
1971
- 1971-01-15 DE DE19712101698 patent/DE2101698A1/de active Pending
- 1971-12-07 CH CH1782171A patent/CH561506A5/xx not_active IP Right Cessation
- 1971-12-29 CS CS9065A patent/CS166795B2/cs unknown
- 1971-12-30 NL NL7118143A patent/NL7118143A/xx unknown
-
1972
- 1972-01-04 IL IL38504A patent/IL38504A/xx unknown
- 1972-01-05 US US00215664A patent/US3847971A/en not_active Expired - Lifetime
- 1972-01-05 SE SE00109/72A patent/SE367398B/xx unknown
- 1972-01-11 ZA ZA720165A patent/ZA72165B/xx unknown
- 1972-01-12 BR BR167/72A patent/BR7200167D0/pt unknown
- 1972-01-14 BE BE778052A patent/BE778052A/xx unknown
- 1972-01-14 GB GB178572A patent/GB1367968A/en not_active Expired
- 1972-01-14 CA CA132,496A patent/CA992982A/en not_active Expired
- 1972-01-14 SU SU1737763A patent/SU516331A3/ru active
- 1972-01-14 IT IT47743/72A patent/IT949650B/it active
- 1972-01-14 PL PL1972152914A patent/PL77353B1/pl unknown
- 1972-01-14 AT AT31172A patent/AT313633B/de not_active IP Right Cessation
- 1972-01-14 FR FR7201258A patent/FR2122248A5/fr not_active Expired
- 1972-01-14 HU HUBA2693A patent/HU163829B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3847971A (en) | 1974-11-12 |
| BR7200167D0 (pt) | 1973-06-26 |
| SE367398B (enExample) | 1974-05-27 |
| IL38504A (en) | 1974-11-29 |
| NL7118143A (enExample) | 1972-07-18 |
| BE778052A (fr) | 1972-07-14 |
| CA992982A (en) | 1976-07-13 |
| CH561506A5 (enExample) | 1975-05-15 |
| AT313633B (de) | 1974-02-25 |
| IL38504A0 (en) | 1972-03-28 |
| SU516331A3 (ru) | 1976-05-30 |
| GB1367968A (en) | 1974-09-25 |
| HU163829B (enExample) | 1973-11-28 |
| FR2122248A5 (enExample) | 1972-08-25 |
| CS166795B2 (enExample) | 1976-03-29 |
| ZA72165B (en) | 1972-10-25 |
| PL77353B1 (enExample) | 1975-04-30 |
| IT949650B (it) | 1973-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2207576A1 (de) | Oxazolidinderivate | |
| DE2005326A1 (de) | Harnstoffderivate | |
| DE2101698A1 (de) | Substituierte m-Trifluormethylphenylharnstoffderivate | |
| DE2140438A1 (de) | Substituierte benzoesaeureamide | |
| EP0037971B1 (de) | Trisubstituierte Cyanguanidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE2219923A1 (de) | Substituierte o- eckige klammer auf aminosulfonyl eckige klammer zu -glykolsaeureamide | |
| DE2110217A1 (de) | Substituierte Phenylharnstoffverbindungen, ihre Herstellung und Verwendung | |
| DE2019536A1 (de) | Oximcarbamate | |
| DE2526868A1 (de) | Neue ungesaettigte halogenacetamide und deren verwendung in herbiziden und pflanzenwachstumsregulierenden mitteln | |
| EP0103252A2 (de) | Aryloxyalkylamine, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| DE2041996A1 (de) | Substituierte Uracile | |
| EP0014999A1 (de) | Optisch aktive Formen des 4-(3-(p-tert.-Butylphenyl)-2-methyl-propyl)-cis-2,6-dimethyl-morpholins und ihre Salze; Fungizide, die diese Verbindungen enthalten, und Verfahren zu ihrer Herstellung | |
| DE1518692A1 (de) | N-(2-Metyl-4-bromphenyl)-N',N'-dimethylformamidin und solches enthaltende Schaedlingsbekaempfungsmittel | |
| DE2140842A1 (de) | 2-chloraethanphosphonsaeurederivate | |
| EP0001271A1 (de) | Heterocyclische Norbornanderivate, Mittel zur Beeinflussung des Pflanzenwachstums die diese Verbindungen enthalten, und Verfahren zur Herstellung dieser Mittel | |
| DE2045907B2 (de) | Biscarbamate und Herbizide, die sie als Wirkstoff enthalten | |
| DE1542835A1 (de) | Herbizide Mittel | |
| DE2115096A1 (de) | Substituierte Chlorcarbonylharnstoffe | |
| DE2536951A1 (de) | Triazapentadiene, verfahren zu ihrer herstellung und ihre verwendung als milbenmittel und insektizide | |
| DE2242785A1 (de) | 1-alkylsulfonyl-2-trifluormethylbenzimidazole, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitenmittel | |
| EP0007066A1 (de) | 4-Alkyl- und 4-Allyl-merkapto-, sulfinyl- und sulfonyl-methyl-2-amino-6-N,N'-dimethylcarbamoyloxy-pyrimidine, Verfahren zu ihrer Herstellung, Mittel welche diese Pyrimidine enthalten und deren Verwendung zur Bekämpfung von Insekten | |
| EP0016731B1 (de) | Meta-Cyanoalkoxy-Phenylharnstoffe mit herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| EP0009555A1 (de) | Herbizide Mittel auf der Basis eines Thiolcarbamats, die Halogenacylamide als Antagonisten enthalten, und ihre Verwendung in einem Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs | |
| DE1493512C (de) | Substituierte Phenyl 2 nitro 4 trifluormethylphenylather und diese enthaltende herbizide Mittel | |
| DE2162238A1 (de) | Neue chemische verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |