DE2052719A1 - Verfahren zur Herstellung von neuen 5 Nitrofuryldenvaten - Google Patents
Verfahren zur Herstellung von neuen 5 NitrofuryldenvatenInfo
- Publication number
- DE2052719A1 DE2052719A1 DE19702052719 DE2052719A DE2052719A1 DE 2052719 A1 DE2052719 A1 DE 2052719A1 DE 19702052719 DE19702052719 DE 19702052719 DE 2052719 A DE2052719 A DE 2052719A DE 2052719 A1 DE2052719 A1 DE 2052719A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- compound
- carbon atoms
- meaning given
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- -1 nitrofuryl Chemical group 0.000 title description 27
- 150000001875 compounds Chemical class 0.000 claims description 59
- 238000006243 chemical reaction Methods 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 229910021529 ammonia Inorganic materials 0.000 claims description 10
- 238000002955 isolation Methods 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 150000008065 acid anhydrides Chemical class 0.000 claims description 6
- 230000000845 anti-microbial effect Effects 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 239000013067 intermediate product Substances 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 3
- 239000003377 acid catalyst Substances 0.000 claims description 3
- 239000000654 additive Substances 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000002837 carbocyclic group Chemical group 0.000 claims description 3
- 235000019253 formic acid Nutrition 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 241000269627 Amphiuma means Species 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- 239000000203 mixture Substances 0.000 description 32
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- 238000002844 melting Methods 0.000 description 25
- 230000008018 melting Effects 0.000 description 25
- 239000007787 solid Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 238000010992 reflux Methods 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- TZYQTWHRLVDYPL-UHFFFAOYSA-N 5h-pyrimidin-4-one Chemical compound O=C1CC=NC=N1 TZYQTWHRLVDYPL-UHFFFAOYSA-N 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- 239000004480 active ingredient Substances 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 9
- CWXKGLABGMLZQJ-UHFFFAOYSA-N 5-amino-1-methyl-3-(5-nitrofuran-2-yl)pyrazole-4-carbonitrile Chemical compound N#CC1=C(N)N(C)N=C1C1=CC=C([N+]([O-])=O)O1 CWXKGLABGMLZQJ-UHFFFAOYSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 230000005484 gravity Effects 0.000 description 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 238000004659 sterilization and disinfection Methods 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- JPIPRHICKKLMOR-UHFFFAOYSA-N 5-(furan-2-yl)-4-nitro-1h-pyrazole Chemical class [O-][N+](=O)C1=CNN=C1C1=CC=CO1 JPIPRHICKKLMOR-UHFFFAOYSA-N 0.000 description 2
- XLJGLXWYMMDRQP-UHFFFAOYSA-N 5-[di(butanoyl)amino]-1-methyl-3-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound C(N)(=O)C=1C(=NN(C1N(C(CCC)=O)C(CCC)=O)C)C=1OC(=CC1)[N+](=O)[O-] XLJGLXWYMMDRQP-UHFFFAOYSA-N 0.000 description 2
- PIWSLFACLCTOSC-UHFFFAOYSA-N 5-amino-1-methyl-3-(5-nitrofuran-2-yl)pyrazole-4-carboxamide Chemical compound NC(=O)C1=C(N)N(C)N=C1C1=CC=C([N+]([O-])=O)O1 PIWSLFACLCTOSC-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- 229920000945 Amylopectin Polymers 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000282414 Homo sapiens Species 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- VJDDQSBNUHLBTD-GGWOSOGESA-N [(e)-but-2-enoyl] (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC(=O)\C=C\C VJDDQSBNUHLBTD-GGWOSOGESA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000249 desinfective effect Effects 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 230000036074 healthy skin Effects 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- IVKNUIVDQMARCO-UHFFFAOYSA-N oxazin-4-one Chemical compound O=C1C=CON=C1 IVKNUIVDQMARCO-UHFFFAOYSA-N 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 229920001592 potato starch Polymers 0.000 description 2
- 150000003217 pyrazoles Chemical class 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VJDDQSBNUHLBTD-UHFFFAOYSA-N trans-crotonic acid-anhydride Natural products CC=CC(=O)OC(=O)C=CC VJDDQSBNUHLBTD-UHFFFAOYSA-N 0.000 description 2
- PNVPNXKRAUBJGW-UHFFFAOYSA-N (2-chloroacetyl) 2-chloroacetate Chemical compound ClCC(=O)OC(=O)CCl PNVPNXKRAUBJGW-UHFFFAOYSA-N 0.000 description 1
- JAUFWTSSYRTLLB-UHFFFAOYSA-N (2-phenylacetyl) 2-phenylacetate Chemical compound C=1C=CC=CC=1CC(=O)OC(=O)CC1=CC=CC=C1 JAUFWTSSYRTLLB-UHFFFAOYSA-N 0.000 description 1
- 150000000183 1,3-benzoxazoles Chemical class 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical class C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- UIMXPIFCDOFFNU-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1,2-dihydropyrazolo[3,4-d]pyrimidin-4-one Chemical compound O1C([N+](=O)[O-])=CC=C1C1=NNC2=C1C(=O)NC=N2 UIMXPIFCDOFFNU-UHFFFAOYSA-N 0.000 description 1
- DICJXPWWJZEDCX-UHFFFAOYSA-N 5-(5-nitrofuran-2-yl)-1h-pyrazole Chemical compound O1C([N+](=O)[O-])=CC=C1C1=CC=NN1 DICJXPWWJZEDCX-UHFFFAOYSA-N 0.000 description 1
- GHNLOXXXEAREPT-UHFFFAOYSA-N 5-amino-3-(5-nitrofuran-2-yl)-1-pentylpyrazole-4-carbonitrile Chemical compound NC1=C(C(=NN1CCCCC)C=1OC(=CC1)[N+](=O)[O-])C#N GHNLOXXXEAREPT-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- HIVRGWKUWUWGHC-UHFFFAOYSA-N ClC1=C2C=CC(NC2=CC(=C1)Cl)(O)C Chemical compound ClC1=C2C=CC(NC2=CC(=C1)Cl)(O)C HIVRGWKUWUWGHC-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- DCXXMTOCNZCJGO-UHFFFAOYSA-N Glycerol trioctadecanoate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 241001489106 Laccaria laccata Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000004098 Tetracycline Substances 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000078 anti-malarial effect Effects 0.000 description 1
- 230000002725 anti-mycoplasma Effects 0.000 description 1
- 230000001857 anti-mycotic effect Effects 0.000 description 1
- 230000000842 anti-protozoal effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000002543 antimycotic Substances 0.000 description 1
- 239000003904 antiprotozoal agent Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical class NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 229960005091 chloramphenicol Drugs 0.000 description 1
- WIIZWVCIJKGZOK-RKDXNWHRSA-N chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000002192 coccidiostatic effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- JOHUAELJNSBTGS-UHFFFAOYSA-N cyclohexanecarbonyl cyclohexanecarboxylate Chemical compound C1CCCCC1C(=O)OC(=O)C1CCCCC1 JOHUAELJNSBTGS-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- FGYRQJUIILOLEG-UHFFFAOYSA-N ethyl 5-amino-4-cyano-3-(5-nitrofuran-2-yl)pyrazole-1-carboxylate Chemical compound NC1=C(C(=NN1C(=O)OCC)C=1OC(=CC1)[N+](=O)[O-])C#N FGYRQJUIILOLEG-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003791 organic solvent mixture Substances 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical class C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229960002597 sulfamerazine Drugs 0.000 description 1
- QPPBRPIAZZHUNT-UHFFFAOYSA-N sulfamerazine Chemical compound CC1=CC=NC(NS(=O)(=O)C=2C=CC(N)=CC=2)=N1 QPPBRPIAZZHUNT-UHFFFAOYSA-N 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical class NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 150000004763 sulfides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 239000004758 synthetic textile Substances 0.000 description 1
- 229960002180 tetracycline Drugs 0.000 description 1
- 229930101283 tetracycline Natural products 0.000 description 1
- 235000019364 tetracycline Nutrition 0.000 description 1
- 150000003522 tetracyclines Chemical class 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- KVSKGMLNBAPGKH-UHFFFAOYSA-N tribromosalicylanilide Chemical compound OC1=C(Br)C=C(Br)C=C1C(=O)NC1=CC=C(Br)C=C1 KVSKGMLNBAPGKH-UHFFFAOYSA-N 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 230000000654 trypanocidal effect Effects 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 229940099259 vaseline Drugs 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Earth Drilling (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5266369 | 1969-10-28 | ||
| GB4305670 | 1970-09-09 | ||
| GB4305470 | 1970-09-09 | ||
| GB4305570 | 1970-09-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2052719A1 true DE2052719A1 (de) | 1971-09-16 |
Family
ID=27448964
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702052719 Pending DE2052719A1 (de) | 1969-10-28 | 1970-10-27 | Verfahren zur Herstellung von neuen 5 Nitrofuryldenvaten |
| DE19702064874 Pending DE2064874A1 (de) | 1969-10-28 | 1970-10-27 | Verfahren zur Herstellung von neuen 5-Nitrofurylderivaten. Ausscheidung aus: 2052719 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702064874 Pending DE2064874A1 (de) | 1969-10-28 | 1970-10-27 | Verfahren zur Herstellung von neuen 5-Nitrofurylderivaten. Ausscheidung aus: 2052719 |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US3716555A (enExample) |
| AT (7) | AT299179B (enExample) |
| BE (1) | BE758050A (enExample) |
| BG (1) | BG17005A3 (enExample) |
| CH (5) | CH549599A (enExample) |
| DE (2) | DE2052719A1 (enExample) |
| DK (1) | DK130589B (enExample) |
| FR (1) | FR2070170B1 (enExample) |
| GB (1) | GB1326360A (enExample) |
| HK (1) | HK52076A (enExample) |
| IE (1) | IE34623B1 (enExample) |
| IL (1) | IL35542A (enExample) |
| KE (1) | KE2638A (enExample) |
| NL (1) | NL7015412A (enExample) |
| NO (1) | NO130007B (enExample) |
| RO (1) | RO56795A (enExample) |
| SE (2) | SE383747B (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2005085249A1 (en) * | 2004-02-27 | 2005-09-15 | F. Hoffmann-La Roche Ag | Fused derivatives of pyrazole |
| US7452880B2 (en) | 2004-02-27 | 2008-11-18 | Nidhi Arora | Substituted pyrazolo [3,4-d] pyrimidines and methods of using the same |
| US7495015B2 (en) | 2004-02-27 | 2009-02-24 | Roche Palo Alto Llc | Indazole derivatives and methods for using the same |
| US7563799B2 (en) | 2005-08-25 | 2009-07-21 | Roche Palo Alto Llc | Substituted pyrazolo[3,4-D]pyrimidines as p38 map kinase inhibitors |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3888887A (en) * | 1972-01-14 | 1975-06-10 | American Home Prod | Derivatives of 3-amino-2-halo-2-cyclohexen-1-one |
| US3980794A (en) * | 1974-05-13 | 1976-09-14 | Eli Lilly And Company | Method for promoting growth of poultry with 3-(5-nitro-2-imidazolyl)pyrazoles |
| AR204665A1 (es) * | 1974-05-13 | 1976-02-20 | Lilly Co Eli | Procedimiento para preparar compuestos de 3-(5-nitroimidazol-2-il)pirazolo(3,4d)pirimidina |
| US4044130A (en) * | 1974-07-03 | 1977-08-23 | Ciba-Geigy Corporation | Compositions for the control of microorganisms |
| GB1507957A (en) * | 1975-03-25 | 1978-04-19 | Byk Gulden Lomberg Chem Fab | Nitrofuryl-pyrazole derivatives methods for producing them and medicaments comprising them |
| DE2747531A1 (de) * | 1977-10-22 | 1979-04-26 | Basf Ag | Substituierte 3-aminopyrazole |
| US4282361A (en) * | 1978-03-16 | 1981-08-04 | Massachusetts Institute Of Technology | Synthesis for 7-alkylamino-3-methylpyrazolo [4,3-d]pyrimidines |
| US5656629A (en) * | 1995-03-10 | 1997-08-12 | Sanofi Winthrop, Inc. | 6-substituted pyrazolo (3,4-d)pyrimidin-4-ones and compositions and methods of use thereof |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR4032E (fr) * | 1902-10-22 | 1905-05-03 | Francois Louis Dit Amedee Gira | Appareil pour la commande automatique des registres de tirage des générateurs, pouvant assurer aussi la fumivorité |
| CH398626A (de) * | 1960-05-11 | 1966-03-15 | Ciba Geigy | Verfahren zur Herstellung neuer Pyrazolopyrimidine |
| AT229863B (de) * | 1961-10-11 | 1963-10-25 | Norwich Pharma Co | Verfahren zur Herstellung des neuen 2-(5-Nitro-2-furyl)-imidazo-[1,2-a]-pyridins bzw. -pyrimidins |
| DE1295560B (de) * | 1963-07-24 | 1969-05-22 | Heyden Chem Fab | Verfahren zur Herstellung von substituierten 5-Aminopyrazolen |
| US3335141A (en) * | 1964-08-17 | 1967-08-08 | Norwich Pharma Co | 4-substituted-1-alkyl-6-(5-nitro-2-furyl)-1h-pyrazolo[3, 4-d]pyrimidines |
| FR206F (enExample) * | 1965-07-20 |
-
0
- BE BE758050D patent/BE758050A/xx unknown
-
1969
- 1969-10-28 GB GB5266369A patent/GB1326360A/en not_active Expired
-
1970
- 1970-10-12 CH CH1873872A patent/CH549599A/xx not_active IP Right Cessation
- 1970-10-12 CH CH1496870A patent/CH548412A/xx not_active IP Right Cessation
- 1970-10-12 CH CH1873572A patent/CH572053A5/xx not_active IP Right Cessation
- 1970-10-12 CH CH1873772A patent/CH549598A/xx not_active IP Right Cessation
- 1970-10-12 CH CH1873672A patent/CH549597A/xx not_active IP Right Cessation
- 1970-10-21 SE SE7014182A patent/SE383747B/xx unknown
- 1970-10-21 NL NL7015412A patent/NL7015412A/xx not_active Application Discontinuation
- 1970-10-21 DK DK535970AA patent/DK130589B/da unknown
- 1970-10-21 NO NO03985/70A patent/NO130007B/no unknown
- 1970-10-27 BG BG015927A patent/BG17005A3/xx unknown
- 1970-10-27 IL IL35542A patent/IL35542A/xx unknown
- 1970-10-27 AT AT963670A patent/AT299179B/de active
- 1970-10-27 IE IE1371/70A patent/IE34623B1/xx unknown
- 1970-10-27 AT AT472571A patent/AT304518B/de not_active IP Right Cessation
- 1970-10-27 RO RO64798A patent/RO56795A/ro unknown
- 1970-10-27 FR FR707038696A patent/FR2070170B1/fr not_active Expired
- 1970-10-27 AT AT472671A patent/AT304519B/de not_active IP Right Cessation
- 1970-10-27 DE DE19702052719 patent/DE2052719A1/de active Pending
- 1970-10-27 US US00084512A patent/US3716555A/en not_active Expired - Lifetime
- 1970-10-27 AT AT472471A patent/AT305994B/de not_active IP Right Cessation
- 1970-10-27 AT AT472371A patent/AT303715B/de not_active IP Right Cessation
- 1970-10-27 AT AT472171A patent/AT303714B/de not_active IP Right Cessation
- 1970-10-27 US US00084531A patent/US3755324A/en not_active Expired - Lifetime
- 1970-10-27 DE DE19702064874 patent/DE2064874A1/de active Pending
- 1970-10-27 AT AT472271A patent/AT304517B/de not_active IP Right Cessation
-
1974
- 1974-01-17 SE SE7400605A patent/SE402591B/xx unknown
-
1976
- 1976-05-31 KE KE2638*UA patent/KE2638A/xx unknown
- 1976-08-19 HK HK520/76*UA patent/HK52076A/xx unknown
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2005085249A1 (en) * | 2004-02-27 | 2005-09-15 | F. Hoffmann-La Roche Ag | Fused derivatives of pyrazole |
| US7435731B2 (en) | 2004-02-27 | 2008-10-14 | Roche Palo Alto Llc | Substituted pyrazolo[3,4-d]pyrimadines and methods of using the same |
| US7452880B2 (en) | 2004-02-27 | 2008-11-18 | Nidhi Arora | Substituted pyrazolo [3,4-d] pyrimidines and methods of using the same |
| US7495015B2 (en) | 2004-02-27 | 2009-02-24 | Roche Palo Alto Llc | Indazole derivatives and methods for using the same |
| US7563799B2 (en) | 2005-08-25 | 2009-07-21 | Roche Palo Alto Llc | Substituted pyrazolo[3,4-D]pyrimidines as p38 map kinase inhibitors |
Also Published As
| Publication number | Publication date |
|---|---|
| AT304517B (de) | 1973-01-10 |
| IL35542A0 (en) | 1971-04-28 |
| IE34623B1 (en) | 1975-06-25 |
| AT304519B (de) | 1973-01-10 |
| IE34623L (en) | 1971-04-28 |
| BE758050A (fr) | 1971-04-27 |
| AT304518B (de) | 1973-01-10 |
| US3755324A (en) | 1973-08-28 |
| BG17005A3 (bg) | 1973-04-25 |
| CH548412A (de) | 1974-04-30 |
| CH549598A (de) | 1974-05-31 |
| DK130589C (enExample) | 1975-08-18 |
| AT303715B (de) | 1972-12-11 |
| US3716555A (en) | 1973-02-13 |
| DE2064874A1 (de) | 1972-06-29 |
| NL7015412A (enExample) | 1971-05-03 |
| NO130007B (enExample) | 1974-06-24 |
| SE402591B (sv) | 1978-07-10 |
| GB1326360A (en) | 1973-08-08 |
| KE2638A (en) | 1976-06-11 |
| FR2070170A1 (enExample) | 1971-09-10 |
| SE383747B (sv) | 1976-03-29 |
| AT305994B (de) | 1973-03-26 |
| RO56795A (enExample) | 1974-08-01 |
| CH549597A (de) | 1974-05-31 |
| IL35542A (en) | 1975-04-25 |
| AT299179B (de) | 1972-06-12 |
| DK130589B (da) | 1975-03-10 |
| FR2070170B1 (enExample) | 1974-02-22 |
| CH572053A5 (enExample) | 1976-01-30 |
| AT303714B (de) | 1972-12-11 |
| HK52076A (en) | 1976-08-27 |
| CH549599A (de) | 1974-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3033157A1 (de) | 7-amino-1-cyclopropyl-4-oxo-1,4-dihydro-naphthyridin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel | |
| DE2818676A1 (de) | Substituierte 5,6-dimethylpyrrolo 2,3-d pyrimidine, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE1545912A1 (de) | Verfahren zur Herstellung von Perhydro-1,2,4-thiadiazindioxyden | |
| DE2454632A1 (de) | Neue 5(6)-substituierte benzimidazol- 2-carbamate und ihre herstellung | |
| DE2052719A1 (de) | Verfahren zur Herstellung von neuen 5 Nitrofuryldenvaten | |
| DE2408906A1 (de) | 6-styrylpyrazolo(3,4-d)pyrimidin-4-one und -pyrimidine mit ihren salzen | |
| DE1946315C2 (de) | 4,5-Dihydro-5-oxo-s-triazolo-[1,5-a]-pyrimidin-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| EP0132811A1 (de) | In 1-Stellung substituierte 4-Hydroxymethyl-pyrrolidinone, Verfahren zu ihrer Herstellung, pharmazeutische Zusammensetzungen und Zwischenprodukte | |
| DE2405395A1 (de) | Verfahren zur herstellung von neuen azinen und ihren tautomeren | |
| DD232697A5 (de) | Verfahren zur herstellung von benzimidazolen | |
| DE1926359A1 (de) | oxylkansaeuren | |
| DE3438244C2 (enExample) | ||
| DE2609574C3 (de) | 1 -^-Fluor-S-trifluormethylthiophenyD-piperazin, dessen Salze, Verfahren zu dessen Herstellung und Arzneimittel | |
| DE2105112A1 (de) | Chinoxahn di Noxide und ihre Verwendung in einem pharmazeutischen Gemisch | |
| DE2414084A1 (de) | Dinitroanilinderivate | |
| EP0023593B1 (de) | Dihydronicotinsäurederivate und deren Herstellung sowie Verwendung | |
| CH619237A5 (enExample) | ||
| DE2319281A1 (de) | Diuretisches und antihypertensives mittel | |
| DE2843008C2 (enExample) | ||
| EP0095641A1 (de) | Chinazolinonderivate, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2624856A1 (de) | 2-thiohexahydropyrimidin-4,6-dion-derivate und verfahren zu ihrer herstellung | |
| DE1695220A1 (de) | Verfahren zur Herstellung von Pyrolinverbindungen | |
| DE2218717A1 (de) | Neue Aminopyrazolpyrimidine | |
| AT369649B (de) | Verfahren zur bekaempfung von helminthenbefall bei haus- oder zuchttieren | |
| CH545315A (de) | Verfahren zur Herstellung von neuen 5-Nitrofurylderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |