DE2051642A1 - Verfahren zur Herstellung von Hydrochinohnen - Google Patents
Verfahren zur Herstellung von HydrochinohnenInfo
- Publication number
- DE2051642A1 DE2051642A1 DE19702051642 DE2051642A DE2051642A1 DE 2051642 A1 DE2051642 A1 DE 2051642A1 DE 19702051642 DE19702051642 DE 19702051642 DE 2051642 A DE2051642 A DE 2051642A DE 2051642 A1 DE2051642 A1 DE 2051642A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- methyl
- ester
- mol
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- 238000004519 manufacturing process Methods 0.000 title description 5
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 title 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical class N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 27
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 26
- 150000002148 esters Chemical class 0.000 claims description 16
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 13
- 235000019253 formic acid Nutrition 0.000 claims description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000001735 carboxylic acids Chemical class 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 150000003248 quinolines Chemical class 0.000 claims description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 235000015250 liver sausages Nutrition 0.000 claims 1
- 150000004702 methyl esters Chemical class 0.000 claims 1
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 239000012043 crude product Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical compound C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- YVBSECQAHGIWNF-UHFFFAOYSA-N N-methyl-1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2N(C)CCCC2=C1 YVBSECQAHGIWNF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 2
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Chemical compound [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- -1 ethyl radicals Chemical class 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- CEKSPMMCISUSTR-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7-octahydroquinoline Chemical compound C1CCC2CCCNC2=C1 CEKSPMMCISUSTR-UHFFFAOYSA-N 0.000 description 1
- DEFNWVPLSCFPIM-UHFFFAOYSA-M 1,2,6-trimethylpyridin-1-ium formate Chemical compound C(=O)[O-].C[N+]1=C(C=CC=C1C)C DEFNWVPLSCFPIM-UHFFFAOYSA-M 0.000 description 1
- PQMWKAXQYMNZOD-UHFFFAOYSA-N 1-methyl-3,4,4a,5-tetrahydro-2h-quinoline Chemical compound C1C=CC=C2N(C)CCCC21 PQMWKAXQYMNZOD-UHFFFAOYSA-N 0.000 description 1
- CHOVRXRQUYRLHZ-UHFFFAOYSA-N 3,4,4a,5-tetrahydro-2h-quinoline-1-carbaldehyde Chemical compound C1C=CC=C2N(C=O)CCCC21 CHOVRXRQUYRLHZ-UHFFFAOYSA-N 0.000 description 1
- 241000410536 Esme Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 150000003797 alkaloid derivatives Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 1
- 150000002497 iodine compounds Chemical class 0.000 description 1
- 229910000462 iron(III) oxide hydroxide Inorganic materials 0.000 description 1
- 150000002537 isoquinolines Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003530 tetrahydroquinolines Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/08—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms with acylated ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/06—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms having only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/04—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Quinoline Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1580169A CH515234A (de) | 1969-10-23 | 1969-10-23 | Verfahren zur Herstellung von N-Acyl-hydropyridinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2051642A1 true DE2051642A1 (de) | 1971-05-06 |
Family
ID=4412073
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702051642 Pending DE2051642A1 (de) | 1969-10-23 | 1970-10-21 | Verfahren zur Herstellung von Hydrochinohnen |
Country Status (15)
| Country | Link |
|---|---|
| AT (1) | AT297705B (enExample) |
| AU (1) | AU2144370A (enExample) |
| BE (1) | BE757755A (enExample) |
| CS (1) | CS154673B2 (enExample) |
| DE (1) | DE2051642A1 (enExample) |
| DK (1) | DK126784B (enExample) |
| ES (1) | ES384797A1 (enExample) |
| FR (1) | FR2066085A5 (enExample) |
| GB (1) | GB1290778A (enExample) |
| IT (1) | IT1016007B (enExample) |
| NL (1) | NL7015377A (enExample) |
| PL (1) | PL70034B1 (enExample) |
| RO (1) | RO56633A (enExample) |
| SU (1) | SU367599A3 (enExample) |
| ZA (1) | ZA707224B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3174932B1 (en) * | 2014-07-30 | 2021-06-09 | Henkel IP & Holding GmbH | Cure accelerators for anaerobic curable compositions |
| CN116283758B (zh) * | 2023-03-30 | 2024-05-24 | 安徽工业大学 | 一种喹啉合成n-甲酰基四氢喹啉的方法及产品 |
-
0
- BE BE757755D patent/BE757755A/xx unknown
-
1970
- 1970-10-16 FR FR7037437A patent/FR2066085A5/fr not_active Expired
- 1970-10-20 SU SU1485204A patent/SU367599A3/ru active
- 1970-10-20 RO RO64744A patent/RO56633A/ro unknown
- 1970-10-21 NL NL7015377A patent/NL7015377A/xx unknown
- 1970-10-21 PL PL1970144008A patent/PL70034B1/xx unknown
- 1970-10-21 IT IT54182/70A patent/IT1016007B/it active
- 1970-10-21 DE DE19702051642 patent/DE2051642A1/de active Pending
- 1970-10-21 CS CS708570A patent/CS154673B2/cs unknown
- 1970-10-21 AT AT947570A patent/AT297705B/de not_active IP Right Cessation
- 1970-10-22 ES ES384797A patent/ES384797A1/es not_active Expired
- 1970-10-22 GB GB1290778D patent/GB1290778A/en not_active Expired
- 1970-10-22 DK DK537670AA patent/DK126784B/da unknown
- 1970-10-23 AU AU21443/70A patent/AU2144370A/en not_active Expired
- 1970-10-23 ZA ZA707224A patent/ZA707224B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1016007B (it) | 1977-05-30 |
| ZA707224B (en) | 1972-06-28 |
| RO56633A (enExample) | 1974-06-01 |
| FR2066085A5 (enExample) | 1971-08-06 |
| AT297705B (de) | 1972-04-10 |
| DK126784B (da) | 1973-08-20 |
| PL70034B1 (enExample) | 1973-12-31 |
| BE757755A (fr) | 1971-04-01 |
| ES384797A1 (es) | 1973-09-01 |
| NL7015377A (enExample) | 1971-04-27 |
| AU2144370A (en) | 1972-04-27 |
| CS154673B2 (enExample) | 1974-04-30 |
| GB1290778A (enExample) | 1972-09-27 |
| SU367599A3 (enExample) | 1973-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2461601C2 (de) | 3-Pyrrolidino-4-phenoxy-5-sulfamoylbenzoesäureester und Verfahren zu ihrer Herstellung | |
| DE1543427C3 (enExample) | ||
| DE2735433A1 (de) | Neue phenylnitromethanverbindungen und verfahren zu ihrer herstellung | |
| DE2051642A1 (de) | Verfahren zur Herstellung von Hydrochinohnen | |
| CH619206A5 (enExample) | ||
| DE1668571C3 (de) | Verfahren zur Herstellung von 2-Methyl-polycycloalkylmethylaminen | |
| DE2406881A1 (de) | Neue carbonsaeure-derivate und verfahren zu deren herstellung | |
| CH637618A5 (de) | Verfahren zur herstellung von anthrachinon. | |
| DE1938219A1 (de) | Verfahren zur Herstellung von 14-Hydroxy-normorphinonderivaten | |
| DE2737481A1 (de) | Verfahren zur herstellung von 2-alkyl- oder 2-cycloalkyl-4-methyl-6-hydroxypyrimidinen | |
| DE2521040C3 (de) | p-Iobutylhydratropasäure-(4-acetamidophenyl)-ester und Verfarhen zu dessen Herstellung | |
| CH447147A (de) | Verfahren zur Herstellung von 5-(3-Hydroxypropyl)-5H-dibenzo(a,d)cycloheptenen | |
| DE2439059C2 (de) | Verfahren zur Herstellung von Decadiensäureesterngemischen | |
| EP0606058A2 (de) | Halogenierte Zimtsäuren und deren Ester, sowie Verfahren zu ihrer Herstellung und halogenierte Aryldiazoniumsalze | |
| DE1620556C (de) | 1 Cyclohexylbarbitursaure derivate | |
| DE2058237C (enExample) | ||
| DE1468817C3 (de) | Verfahren zur Herstellung von Bicycle- [2,2,2] -okt-2-en-l-carbonsäuren und deren Estern | |
| DE2415062C3 (de) | Verfahren zur Herstellung von 2-Nitrobenzaldehyd | |
| DE2139084A1 (de) | Verfahren zur herstellung von 4,4diphenyl-piperidinen | |
| DE1620705C3 (de) | Verfahren zur Herstellung von substituierten 2-Alkoxy-carbonylmethyl-1,4,6,7-tetrahydro-11bH-benzo-(a)chinolizinen | |
| DE2437220B2 (de) | Verfahren zur Herstellung von Anthrachinon | |
| DE1545661A1 (de) | Verfahren zur Herstellung von neuen Chinolizidin-Derivaten | |
| EP0024682A1 (de) | Verfahren zur Herstellung von n-Propyl-n-propylidenacetamid oder Di-n-propylacetamid | |
| DD145532A5 (de) | Verfahren zur herstellung von 7,8-dichlor-1,2,3,4-tetrahydroisochinolin | |
| DE2912052A1 (de) | Verfahren zur herstellung von 2eckige klammer auf 4-(thienylcarbonyl)phenyl eckige klammer zu -propionsaeure |