DE2038320C3 - Nichtwäßrige Wasserstoffperpxid-Lösungen - Google Patents
Nichtwäßrige Wasserstoffperpxid-LösungenInfo
- Publication number
- DE2038320C3 DE2038320C3 DE2038320A DE2038320A DE2038320C3 DE 2038320 C3 DE2038320 C3 DE 2038320C3 DE 2038320 A DE2038320 A DE 2038320A DE 2038320 A DE2038320 A DE 2038320A DE 2038320 C3 DE2038320 C3 DE 2038320C3
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen peroxide
- solutions
- water
- aqueous hydrogen
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims description 65
- 150000001875 compounds Chemical class 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 150000003951 lactams Chemical class 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 239000000243 solution Substances 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 238000000034 method Methods 0.000 description 17
- 239000000203 mixture Substances 0.000 description 12
- -1 heterocyclic compounds Lactams Chemical class 0.000 description 10
- 150000002391 heterocyclic compounds Chemical class 0.000 description 8
- 238000004821 distillation Methods 0.000 description 4
- 150000002367 halogens Chemical group 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- KDISMIMTGUMORD-UHFFFAOYSA-N 1-acetylpiperidine Chemical compound CC(=O)N1CCCCC1 KDISMIMTGUMORD-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- YOIKDDULMGPCFL-UHFFFAOYSA-N 1-(2-chloroethyl)azetidin-2-one Chemical compound ClCCN1CCC1=O YOIKDDULMGPCFL-UHFFFAOYSA-N 0.000 description 1
- SLFOEEOQPLJIPX-UHFFFAOYSA-N 1-(2-hydroxyethyl)azetidin-2-one Chemical compound OCCN1CCC1=O SLFOEEOQPLJIPX-UHFFFAOYSA-N 0.000 description 1
- LMVCQONNFMKDRF-UHFFFAOYSA-N 1-(2-hydroxyethyl)piperidin-2-one Chemical compound OCCN1CCCCC1=O LMVCQONNFMKDRF-UHFFFAOYSA-N 0.000 description 1
- NKDWSBWYKNHGHC-UHFFFAOYSA-N 1-(2-methoxyethyl)azetidin-2-one Chemical compound COCCN1CCC1=O NKDWSBWYKNHGHC-UHFFFAOYSA-N 0.000 description 1
- DFTGNUNUHTUDLB-UHFFFAOYSA-N 1-(2-methoxyethyl)piperidin-2-one Chemical compound COCCN1CCCCC1=O DFTGNUNUHTUDLB-UHFFFAOYSA-N 0.000 description 1
- RROQKRXVLAMAKZ-UHFFFAOYSA-N 1-(3-hydroxypropyl)azetidin-2-one Chemical compound OCCCN1CCC1=O RROQKRXVLAMAKZ-UHFFFAOYSA-N 0.000 description 1
- CSXDLVLNYQAYDR-UHFFFAOYSA-N 1-(3-hydroxypropyl)piperidin-2-one Chemical compound OCCCN1CCCCC1=O CSXDLVLNYQAYDR-UHFFFAOYSA-N 0.000 description 1
- DLDWKQVABUJWBD-UHFFFAOYSA-N 1-(azetidin-1-yl)-2-chloroethanone Chemical compound ClCC(=O)N1CCC1 DLDWKQVABUJWBD-UHFFFAOYSA-N 0.000 description 1
- CUBIWYRZDPJKMX-UHFFFAOYSA-N 1-(azetidin-1-yl)-2-hydroxyethanone Chemical compound OCC(=O)N1CCC1 CUBIWYRZDPJKMX-UHFFFAOYSA-N 0.000 description 1
- DPVXICFKZSPGLX-UHFFFAOYSA-N 1-(azetidin-1-yl)-2-methoxyethanone Chemical compound COCC(=O)N1CCC1 DPVXICFKZSPGLX-UHFFFAOYSA-N 0.000 description 1
- KTGFLVDKXVWJDH-UHFFFAOYSA-N 1-(azetidin-1-yl)ethanone Chemical compound CC(=O)N1CCC1 KTGFLVDKXVWJDH-UHFFFAOYSA-N 0.000 description 1
- PRLNKBJVTMKIGO-UHFFFAOYSA-N 1-(azetidin-1-yl)propan-1-one Chemical compound CCC(=O)N1CCC1 PRLNKBJVTMKIGO-UHFFFAOYSA-N 0.000 description 1
- YMEXAAFKFVBTPW-UHFFFAOYSA-N 1-(chloromethyl)azetidin-2-one Chemical compound ClCN1CCC1=O YMEXAAFKFVBTPW-UHFFFAOYSA-N 0.000 description 1
- WAFMOUFRJOGUMW-UHFFFAOYSA-N 1-(chloromethyl)piperidin-2-one Chemical compound ClCN1CCCCC1=O WAFMOUFRJOGUMW-UHFFFAOYSA-N 0.000 description 1
- FFGFDFCBRZLOIZ-UHFFFAOYSA-N 1-butylazetidin-2-one Chemical compound CCCCN1CCC1=O FFGFDFCBRZLOIZ-UHFFFAOYSA-N 0.000 description 1
- WKWPESWRTFRCRU-UHFFFAOYSA-N 1-butylpiperidin-2-one Chemical compound CCCCN1CCCCC1=O WKWPESWRTFRCRU-UHFFFAOYSA-N 0.000 description 1
- AKTBZVFDHWKQAO-UHFFFAOYSA-N 1-ethylazetidin-2-one Chemical compound CCN1CCC1=O AKTBZVFDHWKQAO-UHFFFAOYSA-N 0.000 description 1
- VUQMOERHEHTWPE-UHFFFAOYSA-N 1-ethylpiperidin-2-one Chemical compound CCN1CCCCC1=O VUQMOERHEHTWPE-UHFFFAOYSA-N 0.000 description 1
- QOEUNLQGZBSTBB-UHFFFAOYSA-N 1-methylazetidin-2-one Chemical compound CN1CCC1=O QOEUNLQGZBSTBB-UHFFFAOYSA-N 0.000 description 1
- GGYVTHJIUNGKFZ-UHFFFAOYSA-N 1-methylpiperidin-2-one Chemical compound CN1CCCCC1=O GGYVTHJIUNGKFZ-UHFFFAOYSA-N 0.000 description 1
- MTJVUMGKHCIMJL-UHFFFAOYSA-N 1-piperidin-1-ylpropan-1-one Chemical compound CCC(=O)N1CCCCC1 MTJVUMGKHCIMJL-UHFFFAOYSA-N 0.000 description 1
- FDHVSPXJIAPARN-UHFFFAOYSA-N 1-propan-2-ylazetidin-2-one Chemical compound CC(C)N1CCC1=O FDHVSPXJIAPARN-UHFFFAOYSA-N 0.000 description 1
- GVDQKJQFVPXADH-UHFFFAOYSA-N 1-propan-2-ylpiperidin-2-one Chemical compound CC(C)N1CCCCC1=O GVDQKJQFVPXADH-UHFFFAOYSA-N 0.000 description 1
- NSWLMOHUXYULKL-UHFFFAOYSA-N 2-chloro-1-piperidin-1-ylethanone Chemical compound ClCC(=O)N1CCCCC1 NSWLMOHUXYULKL-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- ZEGFTEOLGHYWAY-UHFFFAOYSA-N 2-hydroxy-1-piperidin-1-ylethanone Chemical compound OCC(=O)N1CCCCC1 ZEGFTEOLGHYWAY-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- DTZGIEPOXONIFT-UHFFFAOYSA-N 2-methoxy-1-piperidin-1-ylethanone Chemical compound COCC(=O)N1CCCCC1 DTZGIEPOXONIFT-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 125000004122 cyclic group Chemical class 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/013—Separation; Purification; Concentration
- C01B15/017—Anhydrous hydrogen peroxide; Anhydrous solutions or gaseous mixtures containing hydrogen peroxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
- Cephalosporin Compounds (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2038320A DE2038320C3 (de) | 1970-08-01 | 1970-08-01 | Nichtwäßrige Wasserstoffperpxid-Lösungen |
| RO67821A RO62194A (enExample) | 1970-08-01 | 1971-07-27 | |
| GB3573171A GB1357790A (en) | 1970-08-01 | 1971-07-29 | Non-aqueous hydrogen peroxide solutions |
| US00167530A US3755185A (en) | 1970-08-01 | 1971-07-29 | Anhydrous hydrogen peroxide solutions |
| CA119,377A CA966296A (en) | 1970-08-01 | 1971-07-29 | Non-aqueous hydrogen peroxide solutions |
| AT667671A AT325009B (de) | 1970-08-01 | 1971-07-30 | Nichtwasserige wasserstoffperoxid-lösungen |
| ZA715094A ZA715094B (en) | 1970-08-01 | 1971-07-30 | Non-aqueous hydrogen peroxide solutions |
| FR7128176A FR2101176B1 (enExample) | 1970-08-01 | 1971-07-30 | |
| JP46056850A JPS5134398B1 (enExample) | 1970-08-01 | 1971-07-30 | |
| NL7110585A NL7110585A (enExample) | 1970-08-01 | 1971-07-30 | |
| SU1688971A SU457207A3 (ru) | 1970-08-01 | 1971-07-30 | Способ получени безводного раствора перекиси водорода |
| BE770779A BE770779A (fr) | 1970-08-01 | 1971-07-30 | Solutions non aqueuses de peroxyde d'hydrogene et leur preparation |
| ES393840A ES393840A1 (es) | 1970-08-01 | 1971-07-31 | Procedimiento para la obtencion de soluciones anhidras de peroxido de hidrogeno. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2038320A DE2038320C3 (de) | 1970-08-01 | 1970-08-01 | Nichtwäßrige Wasserstoffperpxid-Lösungen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2038320A1 DE2038320A1 (de) | 1972-02-17 |
| DE2038320B2 DE2038320B2 (de) | 1980-07-17 |
| DE2038320C3 true DE2038320C3 (de) | 1981-05-07 |
Family
ID=5778616
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2038320A Expired DE2038320C3 (de) | 1970-08-01 | 1970-08-01 | Nichtwäßrige Wasserstoffperpxid-Lösungen |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3755185A (enExample) |
| JP (1) | JPS5134398B1 (enExample) |
| AT (1) | AT325009B (enExample) |
| BE (1) | BE770779A (enExample) |
| CA (1) | CA966296A (enExample) |
| DE (1) | DE2038320C3 (enExample) |
| ES (1) | ES393840A1 (enExample) |
| FR (1) | FR2101176B1 (enExample) |
| GB (1) | GB1357790A (enExample) |
| NL (1) | NL7110585A (enExample) |
| RO (1) | RO62194A (enExample) |
| SU (1) | SU457207A3 (enExample) |
| ZA (1) | ZA715094B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3308740A1 (de) * | 1983-03-11 | 1984-09-13 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen |
| EP0139194A1 (de) * | 1983-09-27 | 1985-05-02 | Degussa Aktiengesellschaft | Verfahren zur Kernhydroxylierung von Phenol oder Phenolderivaten |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4963671A (enExample) * | 1972-10-20 | 1974-06-20 | ||
| FR2309528A1 (fr) * | 1975-04-30 | 1976-11-26 | Bayer Ag | Procede de preparation de solutions organiques d'acides percarboxyliques |
| DE2519295C3 (de) * | 1975-04-30 | 1979-02-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur kontinuierlichen Herstellung von organischen Lösungen von 1 bis 4 Kohlenstoffatome enthaltenden Percarbonsäuren |
| US4182743A (en) * | 1975-11-10 | 1980-01-08 | Philip Morris Incorporated | Filter material for selective removal of aldehydes for cigarette smoke |
| US4564514A (en) * | 1982-07-07 | 1986-01-14 | Degussa Aktiengesellschaft | Process for the production of water-free organic hydrogen peroxide solution |
| DE3225307A1 (de) * | 1982-07-07 | 1984-01-12 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung wasserfreier, organischer wasserstoffperoxidloesungen |
| DE3348020C2 (en) * | 1983-03-11 | 1987-11-12 | Degussa Ag, 6000 Frankfurt, De | Process for preparing nonaqueous solutions of hydrogen peroxide |
| US4786431A (en) * | 1984-12-31 | 1988-11-22 | Colgate-Palmolive Company | Liquid laundry detergent-bleach composition and method of use |
| SE459919C (sv) * | 1987-03-27 | 1991-03-25 | Eka Nobel Ab | Foerfarande foer framstaellning av vaeteperoxid genom reduktion och oxidation av en antrakinon |
| US5066488A (en) * | 1988-12-01 | 1991-11-19 | Isp Investments Inc. | Semi-anhydrous, suspension process for preparing uniform, free-flowing, fine, white powders of substantially anhydrous complexes of PVP and H2 O2 containing about 18 to about 22% H2 O2 |
| JP2893537B2 (ja) * | 1989-07-20 | 1999-05-24 | 東海電化工業株式会社 | ヒスチジン―過酸化水素付加物およびその製造法 |
| US5008093A (en) * | 1989-11-08 | 1991-04-16 | Gaf Chemicals Corporation | Anhydrous complexes of PVP and hydrogen peroxide |
| US7871512B2 (en) * | 2001-05-10 | 2011-01-18 | Petrosonics, Llc | Treatment of crude oil fractions, fossil fuels, and products thereof |
| US8778386B2 (en) * | 2005-12-13 | 2014-07-15 | Kimberly-Clark Worldwide, Inc. | Anti-microbial substrates with peroxide treatment |
| FR3119643B1 (fr) | 2021-02-08 | 2022-12-23 | Psa Automobiles Sa | Procede de regulation du fonctionnement d'un catalyseur de gaz d'echappement produits par le moteur thermique d'un vehicule automobile |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA719199A (en) * | 1965-10-05 | E. Meeker Robert | Hydrogen peroxide stabilization | |
| CA699784A (en) * | 1964-12-15 | E. Meeker Robert | Stabilization of hydrogen peroxide | |
| US2386484A (en) * | 1944-10-25 | 1945-10-09 | Buffalo Electro Chem Co | Anhydrous hydrogen peroxide and method of making same |
| US3480557A (en) * | 1967-01-30 | 1969-11-25 | Gaf Corp | Solid stabilized hydrogen peroxide compositions |
| US3376110A (en) * | 1967-01-30 | 1968-04-02 | Gen Aniline & Film Corp | Solid stabilized hydrogen peroxide compositions |
| AT284786B (de) * | 1968-09-16 | 1970-09-25 | Degussa | Verfahren zur Gewinnung nichtwässeriger Wasserstoffperoxydlösungen |
-
1970
- 1970-08-01 DE DE2038320A patent/DE2038320C3/de not_active Expired
-
1971
- 1971-07-27 RO RO67821A patent/RO62194A/ro unknown
- 1971-07-29 US US00167530A patent/US3755185A/en not_active Expired - Lifetime
- 1971-07-29 GB GB3573171A patent/GB1357790A/en not_active Expired
- 1971-07-29 CA CA119,377A patent/CA966296A/en not_active Expired
- 1971-07-30 SU SU1688971A patent/SU457207A3/ru active
- 1971-07-30 NL NL7110585A patent/NL7110585A/xx not_active Application Discontinuation
- 1971-07-30 FR FR7128176A patent/FR2101176B1/fr not_active Expired
- 1971-07-30 ZA ZA715094A patent/ZA715094B/xx unknown
- 1971-07-30 BE BE770779A patent/BE770779A/xx unknown
- 1971-07-30 AT AT667671A patent/AT325009B/de not_active IP Right Cessation
- 1971-07-30 JP JP46056850A patent/JPS5134398B1/ja active Pending
- 1971-07-31 ES ES393840A patent/ES393840A1/es not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3308740A1 (de) * | 1983-03-11 | 1984-09-13 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen |
| EP0121660A1 (de) * | 1983-03-11 | 1984-10-17 | Degussa Aktiengesellschaft | Verfahren zur Herstellung nichtwässriger Wasserstoffperoxidlösungen |
| EP0139194A1 (de) * | 1983-09-27 | 1985-05-02 | Degussa Aktiengesellschaft | Verfahren zur Kernhydroxylierung von Phenol oder Phenolderivaten |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7110585A (enExample) | 1972-02-03 |
| DE2038320A1 (de) | 1972-02-17 |
| BE770779A (fr) | 1972-01-31 |
| ES393840A1 (es) | 1974-10-01 |
| US3755185A (en) | 1973-08-28 |
| DE2038320B2 (de) | 1980-07-17 |
| FR2101176A1 (enExample) | 1972-03-31 |
| CA966296A (en) | 1975-04-22 |
| ZA715094B (en) | 1972-04-26 |
| AT325009B (de) | 1975-09-25 |
| SU457207A3 (ru) | 1975-01-15 |
| FR2101176B1 (enExample) | 1975-02-07 |
| RO62194A (enExample) | 1977-08-15 |
| JPS5134398B1 (enExample) | 1976-09-25 |
| GB1357790A (en) | 1974-06-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2038320C3 (de) | Nichtwäßrige Wasserstoffperpxid-Lösungen | |
| DE2642270C2 (de) | Verfahren zur Herstellung von Äthylvanadat | |
| DE1770579A1 (de) | Verfahren zur Herstellung von Rifamycin | |
| DE2642271A1 (de) | Verfahren zur herstellung von organischen vanadaten | |
| DE69913021T2 (de) | Verfahren zur Herstellung von 1,2-Epoxy-5,9-Cyclododekadien | |
| DE2152367C2 (de) | Verfahren zur Herstellung von 4- Methyl-oxazolen | |
| DE1618207B2 (de) | Verfahren zur herstellung von alphachloracetessigsaeure-monoalkylamiden | |
| DE1918253A1 (de) | Verbessertes Verfahren zur Herstellung von 3-Hydroxyisoxazolverbindungen | |
| DE2813755A1 (de) | Verfahren zur reinigung der orthophosphorsaeure | |
| CH620222A5 (enExample) | ||
| DE1131226B (de) | Verfahren zur Herstellung der Carbaminsaeureester von 4-Oxymethyl-1,3-dioxolanen | |
| EP0121660B1 (de) | Verfahren zur Herstellung nichtwässriger Wasserstoffperoxidlösungen | |
| DE2645692C2 (de) | Thiazolidin-4-carbonitrile | |
| DE2349313A1 (de) | Verfahren zur herstellung von tetraalkylthiuramidsulfiden | |
| DE228664C (enExample) | ||
| DE953078C (de) | Verfahren zum Stabilisieren von Triaethyleniminophosphinoxyd | |
| DE2923697A1 (de) | Neue 1-pyrrol- und pyrrolidin-carbonsaeure-derivate und verfahren zu deren herstellung | |
| AT228804B (de) | Verfahren zur Herstellung von Thionothiolphosphorsäureestern | |
| AT304576B (de) | Verfahren zur herstellung von neuen organoborverbindungen | |
| AT224239B (de) | Verfahren zur Herstellung neuer Pigmente bzw. neuer Küpenfarbstoffe | |
| DE1795350C3 (de) | Pyrimldlnylthiophosphorsäureester, Verfahren zu ihrer Herstellung und diese enthaltende Mittel | |
| CH460028A (de) | Verfahren zur Herstellung von Benzimidazolonderivaten | |
| DE962796C (de) | Verfahren zur Herstellung quartaerer Ammoniumverbindungen | |
| AT299244B (de) | Verfahren zur Herstellung von neuen Organozinnverbindungen | |
| DE4231529C2 (de) | Verfahren zur Herstellung heteroalicyclischer N-Nitroverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |