DE2037493A1 - Verfahren zur Massepolymerisation von Vinylchlorid bei tiefer Temperatur - Google Patents
Verfahren zur Massepolymerisation von Vinylchlorid bei tiefer TemperaturInfo
- Publication number
- DE2037493A1 DE2037493A1 DE19702037493 DE2037493A DE2037493A1 DE 2037493 A1 DE2037493 A1 DE 2037493A1 DE 19702037493 DE19702037493 DE 19702037493 DE 2037493 A DE2037493 A DE 2037493A DE 2037493 A1 DE2037493 A1 DE 2037493A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- polymerization
- salt
- vinyl chloride
- monoester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 title claims description 11
- 238000012662 bulk polymerization Methods 0.000 title claims description 7
- 238000006116 polymerization reaction Methods 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 9
- 150000003863 ammonium salts Chemical class 0.000 claims description 9
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 150000002432 hydroperoxides Chemical class 0.000 claims description 6
- 150000002830 nitrogen compounds Chemical class 0.000 claims description 6
- 230000001476 alcoholic effect Effects 0.000 claims description 5
- 239000003054 catalyst Substances 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000000835 fiber Substances 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- -1 alkyl radical Chemical class 0.000 description 15
- 229920000642 polymer Polymers 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000000178 monomer Substances 0.000 description 8
- 235000019441 ethanol Nutrition 0.000 description 6
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 4
- 150000002894 organic compounds Chemical class 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 3
- CAWUVGBQXBXBHO-UHFFFAOYSA-N azanium;methyl sulfite Chemical compound [NH4+].COS([O-])=O CAWUVGBQXBXBHO-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 229920000554 ionomer Polymers 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 2
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- AKUNSTOMHUXJOZ-UHFFFAOYSA-N 1-hydroperoxybutane Chemical compound CCCCOO AKUNSTOMHUXJOZ-UHFFFAOYSA-N 0.000 description 1
- JYLUDNGUBXOJPX-UHFFFAOYSA-N 1-hydroperoxypropylbenzene Chemical compound CCC(OO)C1=CC=CC=C1 JYLUDNGUBXOJPX-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- RLFDKNKVSQTFIE-UHFFFAOYSA-N COS(=O)[O-].C[NH+](C)C Chemical compound COS(=O)[O-].C[NH+](C)C RLFDKNKVSQTFIE-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241001189642 Theroa Species 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- YQHLDYVWEZKEOX-UHFFFAOYSA-N cumene hydroperoxide Chemical compound OOC(C)(C)C1=CC=CC=C1 YQHLDYVWEZKEOX-UHFFFAOYSA-N 0.000 description 1
- PAFZNILMFXTMIY-UHFFFAOYSA-O cyclohexylammonium Chemical compound [NH3+]C1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-O 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-O diethylammonium Chemical compound CC[NH2+]CC HPNMFZURTQLUMO-UHFFFAOYSA-O 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- BESWQAXCVAOXFV-UHFFFAOYSA-N octyl hydroperoxide Chemical class CCCCCCCCOO BESWQAXCVAOXFV-UHFFFAOYSA-N 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- PTLIIZJLRPOFJR-UHFFFAOYSA-M tert-butyl sulfite Chemical compound CC(C)(C)OS([O-])=O PTLIIZJLRPOFJR-UHFFFAOYSA-M 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F14/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen
- C08F14/02—Monomers containing chlorine
- C08F14/04—Monomers containing two carbon atoms
- C08F14/06—Vinyl chloride
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2035769 | 1969-07-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2037493A1 true DE2037493A1 (de) | 1971-03-04 |
Family
ID=11165996
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702037493 Pending DE2037493A1 (de) | 1969-07-31 | 1970-07-29 | Verfahren zur Massepolymerisation von Vinylchlorid bei tiefer Temperatur |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3637622A (enExample) |
| BE (1) | BE754167R (enExample) |
| CS (1) | CS163220B4 (enExample) |
| DE (1) | DE2037493A1 (enExample) |
| ES (1) | ES382308A2 (enExample) |
| FR (1) | FR2054659B2 (enExample) |
| GB (1) | GB1314046A (enExample) |
| HU (1) | HU164390B (enExample) |
| NL (1) | NL7011065A (enExample) |
| PL (1) | PL80750B3 (enExample) |
| RO (1) | RO62004A7 (enExample) |
| YU (1) | YU192570A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2163998A5 (enExample) * | 1971-12-09 | 1973-07-27 | Aquitaine Petrole | |
| DE102005032837A1 (de) * | 2005-07-14 | 2007-02-08 | Merck Patent Gmbh | Verfahren zur Herstellung von Onium-Alkylsulfiten |
| DE102005032836A1 (de) * | 2005-07-14 | 2007-01-18 | Merck Patent Gmbh | Verfahren zur Herstellung von Onium-Alkylsulfonaten |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL155270B (nl) * | 1967-12-19 | 1977-12-15 | Chatillon Italiana Fibre | Werkwijze voor het polymeriseren in de massa van vinylchloride, eventueel gemengd met ten minste een ander copolymeriseerbaar monomeer. |
-
0
- BE BE754167D patent/BE754167R/xx active
-
1970
- 1970-07-22 HU HUCA288A patent/HU164390B/hu unknown
- 1970-07-22 US US57305A patent/US3637622A/en not_active Expired - Lifetime
- 1970-07-27 NL NL7011065A patent/NL7011065A/xx unknown
- 1970-07-28 FR FR7027756A patent/FR2054659B2/fr not_active Expired
- 1970-07-28 PL PL1970143338A patent/PL80750B3/pl unknown
- 1970-07-28 GB GB3653670A patent/GB1314046A/en not_active Expired
- 1970-07-29 RO RO64090A patent/RO62004A7/ro unknown
- 1970-07-29 DE DE19702037493 patent/DE2037493A1/de active Pending
- 1970-07-30 YU YU01925/70A patent/YU192570A/xx unknown
- 1970-07-30 ES ES382308A patent/ES382308A2/es not_active Expired
- 1970-07-31 CS CS705392A patent/CS163220B4/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2054659B2 (enExample) | 1973-10-19 |
| US3637622A (en) | 1972-01-25 |
| GB1314046A (en) | 1973-04-18 |
| NL7011065A (enExample) | 1971-02-02 |
| CS163220B4 (en) | 1975-08-29 |
| PL80750B3 (enExample) | 1975-08-30 |
| HU164390B (enExample) | 1974-02-28 |
| RO62004A7 (enExample) | 1977-09-15 |
| YU192570A (en) | 1977-08-31 |
| ES382308A2 (es) | 1973-01-01 |
| BE754167R (fr) | 1971-02-01 |
| FR2054659A2 (enExample) | 1971-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2205908C2 (de) | Verfahren zur Flockung von in wäßrigen Medien suspendierten Feststoffen | |
| DE2757329C2 (de) | Verfahren zur Herstellung von Polymerisaten der Acrylsäure oder Methacrylsäure | |
| DE1595680A1 (de) | Sulfonsaeuregruppen enthaltende Polymerisate | |
| DE1106077B (de) | Verfahren zur Herstellung von kristallinen Polymeren der Alkyl- und Cycloalkylacrylate und -methacrylate | |
| DE3420036C2 (enExample) | ||
| WO2001096430A1 (de) | Verfahren zur herstellung vernetzbarer acrylathaftklebemassen | |
| DE102008002927A1 (de) | Gemische, enthaltend Inhibitoren der radikalischen Polymerisation und ionische Flüssigkeiten, und ihre Verwendung zur Stabilisierung von radikalisch polymerisierbaren Monomeren | |
| DE2037493A1 (de) | Verfahren zur Massepolymerisation von Vinylchlorid bei tiefer Temperatur | |
| DE2142617A1 (de) | Verfahren zur Herstellung von Copoly mensaten | |
| DE2400043A1 (de) | Verbessertes verfahren zur massenpolymerisation von acrylnitril | |
| DE2009137C3 (de) | Verfahren zur Polymerisation von Vinylchlorid | |
| DE2029316A1 (de) | Herstellung von Acrylnitrilpolymerlösungen | |
| DE1932643C3 (de) | Verfahren zur Polymerisation von Vinylchlorid | |
| DE1520969A1 (de) | Verfahren zur Herstellung harzartiger Copolymerisationsprodukte aus ungesaettigten Nitrilen | |
| DE1720233C3 (de) | Verfahren zur Polymerisation von Vinylchlorid, allein oder im Gemisch mit bis zu 50 Gew.-% von einem oder mehreren anderen mischpolymerisierbaren äthylenisch ungesättigten Monomeren, in Masse | |
| DE102012110156B4 (de) | Verfahren zur Herstellung von zwitterionischen Monomeren sowie die Verwendung dieser Monomere | |
| DE1916942A1 (de) | Verfahren zur Polymerisation von Vinylchlorid | |
| CH501676A (de) | Verfahren zur Massepolymerisation von Vinylchlorid bei tiefer Temperatur | |
| DE1124693B (de) | Verfahren zur Herstellung von Acrylnitrilpolymerisaten | |
| AT231423B (de) | Verfahren zur Herstellung von Methacrylsäure und deren Estern | |
| DE2260286A1 (de) | Verfahren zur polymerisation von aethylenkohlenwasserstoffen | |
| DE3782320T2 (de) | Nicht-waesserige polymer-dispersion und verfahren zu ihrer herstellung. | |
| DE2049060A1 (de) | Verfahren zur Herstellung von Losungen von lactonisierten Acrylpolymensaten | |
| DE1570574C3 (de) | Verfahren zur Herstellung von Phos phor enthaltenden Polymerisaten oder Mischpolymerisaten | |
| DE1595692A1 (de) | Verfahren und Herstellung von Sulfonsaeuregruppen enthaltenden Acrylnitrilmischpolymeren |