DE2035902A1 - - Google Patents
Info
- Publication number
- DE2035902A1 DE2035902A1 DE19702035902 DE2035902A DE2035902A1 DE 2035902 A1 DE2035902 A1 DE 2035902A1 DE 19702035902 DE19702035902 DE 19702035902 DE 2035902 A DE2035902 A DE 2035902A DE 2035902 A1 DE2035902 A1 DE 2035902A1
- Authority
- DE
- Germany
- Prior art keywords
- benzyl chloride
- phenylacetic acid
- water
- cobalt
- sulfurized
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 24
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 claims description 24
- 229960003424 phenylacetic acid Drugs 0.000 claims description 12
- 239000003279 phenylacetic acid Substances 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 10
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 claims description 9
- 229940073608 benzyl chloride Drugs 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 8
- 150000001868 cobalt Chemical class 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- 230000006315 carbonylation Effects 0.000 claims description 5
- 238000005810 carbonylation reaction Methods 0.000 claims description 5
- 229910000640 Fe alloy Inorganic materials 0.000 claims description 4
- 229910000914 Mn alloy Inorganic materials 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 3
- 239000000292 calcium oxide Substances 0.000 claims description 3
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 3
- 159000000007 calcium salts Chemical class 0.000 claims description 3
- 229910002090 carbon oxide Inorganic materials 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 claims description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 claims 1
- 230000003472 neutralizing effect Effects 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000011572 manganese Substances 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 230000036632 reaction speed Effects 0.000 description 2
- 229910052979 sodium sulfide Inorganic materials 0.000 description 2
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 229910000861 Mg alloy Inorganic materials 0.000 description 1
- ZOZIRNMDEZKZHM-UHFFFAOYSA-N Phenethyl phenylacetate Chemical compound C=1C=CC=CC=1CCOC(=O)CC1=CC=CC=C1 ZOZIRNMDEZKZHM-UHFFFAOYSA-N 0.000 description 1
- MIYFJEKZLFWKLZ-UHFFFAOYSA-N Phenylmethyl benzeneacetate Chemical compound C=1C=CC=CC=1COC(=O)CC1=CC=CC=C1 MIYFJEKZLFWKLZ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- -1 allyl halides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/10—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction with carbon monoxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1999669 | 1969-07-23 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2035902A1 true DE2035902A1 (enExample) | 1971-02-04 |
| DE2035902B2 DE2035902B2 (de) | 1979-03-22 |
| DE2035902C3 DE2035902C3 (de) | 1979-11-22 |
Family
ID=11162941
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2035902A Expired DE2035902C3 (de) | 1969-07-23 | 1970-07-20 | Verfahren zur Herstellung von Phenylessigsäure |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3708529A (enExample) |
| BE (1) | BE753756A (enExample) |
| CH (1) | CH542807A (enExample) |
| DE (1) | DE2035902C3 (enExample) |
| ES (1) | ES382048A1 (enExample) |
| FR (1) | FR2055331A5 (enExample) |
| GB (1) | GB1261474A (enExample) |
| NL (1) | NL170622C (enExample) |
| YU (1) | YU183870A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2196319A1 (enExample) * | 1972-08-17 | 1974-03-15 | Dynamit Nobel Ag |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2259072C3 (de) * | 1972-12-02 | 1978-10-05 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von Arylessigsäuren |
| IT1014957B (it) * | 1974-06-11 | 1977-04-30 | Montedison Spa | Processo per la preparazione di acidi carbossilici da alogenuri organici |
| US4350825A (en) * | 1976-05-10 | 1982-09-21 | Exxon Research & Engineering Co. | Process for the manufacture of styrene |
| IT1076234B (it) * | 1977-01-18 | 1985-04-27 | Montedison Spa | Processo per la preparazione di acido fenilacetico |
| IT1198337B (it) | 1980-07-01 | 1988-12-21 | Montedison Spa | Processo per la preparazione di composti organici carbossilati |
| IT1139455B (it) * | 1981-09-21 | 1986-09-24 | Montedison Spa | Processo per la preparazione di acidi alfa-arilpropionici e loro sali alcalini |
| US4492798A (en) * | 1982-03-01 | 1985-01-08 | Ethyl Corporation | Process for preparing arylalkylpyruvic acids |
| CN102875361B (zh) * | 2012-10-30 | 2016-01-20 | 中蓝连海设计研究院 | 由含杂质的苯乙酸盐溶液免析晶制取苯乙酸的工艺 |
| CN106496013A (zh) * | 2016-09-08 | 2017-03-15 | 上海引盛生物科技有限公司 | 一种苯乙酸类化合物的制备方法 |
| CN113354528A (zh) * | 2021-06-07 | 2021-09-07 | 李乾华 | 一种苯乙酸生产方法 |
-
1970
- 1970-07-17 NL NLAANVRAGE7010636,A patent/NL170622C/xx not_active IP Right Cessation
- 1970-07-20 FR FR7026593A patent/FR2055331A5/fr not_active Expired
- 1970-07-20 DE DE2035902A patent/DE2035902C3/de not_active Expired
- 1970-07-20 YU YU01838/70A patent/YU183870A/xx unknown
- 1970-07-20 GB GB35204/70A patent/GB1261474A/en not_active Expired
- 1970-07-21 CH CH1106570A patent/CH542807A/de not_active IP Right Cessation
- 1970-07-22 ES ES382048A patent/ES382048A1/es not_active Expired
- 1970-07-22 BE BE753756D patent/BE753756A/xx not_active IP Right Cessation
- 1970-07-22 US US00057356A patent/US3708529A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2196319A1 (enExample) * | 1972-08-17 | 1974-03-15 | Dynamit Nobel Ag |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2055331A5 (enExample) | 1971-05-07 |
| ES382048A1 (es) | 1972-10-16 |
| NL170622C (nl) | 1982-12-01 |
| DE2035902C3 (de) | 1979-11-22 |
| GB1261474A (en) | 1972-01-26 |
| NL170622B (nl) | 1982-07-01 |
| US3708529A (en) | 1973-01-02 |
| YU183870A (en) | 1979-09-10 |
| NL7010636A (enExample) | 1971-01-26 |
| CH542807A (de) | 1973-10-15 |
| BE753756A (fr) | 1971-01-22 |
| DE2035902B2 (de) | 1979-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2600541C3 (de) | Verfahren zur Herstellung von Phenylbrenztraubensäure oder Arylbrenztraubensäuren | |
| DE2259072A1 (de) | Verfahren zur herstellung von arylessigsaeuren | |
| DE2035902A1 (enExample) | ||
| DE4313793A1 (de) | Herstellung von Carbonsäurehalogeniden und Carboxylat-Salzen | |
| DE2418499C2 (de) | Verfahren zur Herstellung von α-6-Desoxytetracyclin | |
| DE2823660A1 (de) | Verfahren zur herstellung eines alkenylesters von carbonsaeuren | |
| DE2838030C2 (de) | Verfahren zur herstellung von alkylenglykolen | |
| DE1943404A1 (de) | Adamantanylalkylamin-Derivate und Verfahren zu ihrer Herstellung | |
| DE2235992A1 (de) | Verfahren zur herstellung gesaettigter aliphatischer amine | |
| DE2166270C3 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| CH495944A (de) | Verfahren zur Herstellung von a-Methyl-polycyclomethylaminen | |
| DE19636078A1 (de) | Verfahren zur heterogen katalysierten Herstellung von N-Alkyl-substituierten Aminoalkinen | |
| CH665638A5 (de) | Verfahren zur herstellung von 2,3-dihydro-7-aminobenzofuranen. | |
| DE2503926A1 (de) | Verfahren zur herstellung von vinylestern von carbonsaeuren | |
| DE2831555C2 (enExample) | ||
| DE2034682A1 (de) | Herstellung von eis 1 Propenylphos phonsaure | |
| DE3042396A1 (de) | Verfahren zur herstellung von apovincaminsaeureester-derivaten | |
| CH632244A5 (de) | Verfahren zur gewinnung von reinem l-cystin. | |
| EP0811602B1 (de) | Verfahren zur Herstellung von Aminomalonester-Salzen | |
| DE966201C (de) | Verfahren zur Herstellung von Cyclohexanonoxim durch katalytische Hydrierung von Nitrocyclohexansalzen | |
| DE892893C (de) | Verfahren zur Herstellung von Carbonsaeureestern | |
| DE895597C (de) | Verfahren zur Herstellung von Vinylestern | |
| DE2120248A1 (enExample) | ||
| DE2439742C3 (de) | Verfahren zur Herstellung von Cyclopentenonderivaten | |
| AT217041B (de) | Verfahren zur direkten Herstellung von Cyanurchlorid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |