DE2024243A1 - - Google Patents
Info
- Publication number
- DE2024243A1 DE2024243A1 DE19702024243 DE2024243A DE2024243A1 DE 2024243 A1 DE2024243 A1 DE 2024243A1 DE 19702024243 DE19702024243 DE 19702024243 DE 2024243 A DE2024243 A DE 2024243A DE 2024243 A1 DE2024243 A1 DE 2024243A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- diazo
- atoms
- group
- condensation product
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000007859 condensation product Substances 0.000 claims description 31
- 239000000463 material Substances 0.000 claims description 25
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 23
- -1 aromatic diazonium compounds Chemical class 0.000 claims description 22
- 239000012954 diazonium Substances 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 17
- 238000004519 manufacturing process Methods 0.000 claims description 16
- 150000001989 diazonium salts Chemical class 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 230000002378 acidificating effect Effects 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- 125000001752 diazonium salt group Chemical group 0.000 claims description 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims 1
- 239000004305 biphenyl Substances 0.000 claims 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 52
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 46
- 239000002253 acid Substances 0.000 description 33
- 235000011007 phosphoric acid Nutrition 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 25
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 23
- 229920005989 resin Polymers 0.000 description 23
- 239000011347 resin Substances 0.000 description 23
- 239000000203 mixture Substances 0.000 description 21
- 150000003839 salts Chemical class 0.000 description 21
- 229910052782 aluminium Inorganic materials 0.000 description 17
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 17
- 238000000576 coating method Methods 0.000 description 17
- 238000007639 printing Methods 0.000 description 17
- 239000011248 coating agent Substances 0.000 description 16
- 238000009833 condensation Methods 0.000 description 16
- 230000005494 condensation Effects 0.000 description 16
- 150000007513 acids Chemical class 0.000 description 14
- 229910052751 metal Inorganic materials 0.000 description 14
- 239000002184 metal Substances 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- XLLIQLLCWZCATF-UHFFFAOYSA-N ethylene glycol monomethyl ether acetate Natural products COCCOC(C)=O XLLIQLLCWZCATF-UHFFFAOYSA-N 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- 239000003960 organic solvent Substances 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- 229920002554 vinyl polymer Polymers 0.000 description 9
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 8
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 8
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000000975 dye Substances 0.000 description 7
- 239000011888 foil Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 229910019142 PO4 Inorganic materials 0.000 description 6
- 229920002301 cellulose acetate Polymers 0.000 description 6
- 150000008049 diazo compounds Chemical class 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- 150000001728 carbonyl compounds Chemical class 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 150000001805 chlorine compounds Chemical class 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 4
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- 239000010452 phosphate Substances 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 229920003176 water-insoluble polymer Polymers 0.000 description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- BUSBFZWLPXDYIC-UHFFFAOYSA-N arsonic acid Chemical class O[AsH](O)=O BUSBFZWLPXDYIC-UHFFFAOYSA-N 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 3
- 238000007645 offset printing Methods 0.000 description 3
- 239000003973 paint Substances 0.000 description 3
- 229920001568 phenolic resin Polymers 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- PNGLEYLFMHGIQO-UHFFFAOYSA-M sodium;3-(n-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate;dihydrate Chemical compound O.O.[Na+].[O-]S(=O)(=O)CC(O)CN(CC)C1=CC=CC(OC)=C1 PNGLEYLFMHGIQO-UHFFFAOYSA-M 0.000 description 3
- 150000003460 sulfonic acids Chemical class 0.000 description 3
- 229920003169 water-soluble polymer Polymers 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- YDGFWBUHUUSSRS-UHFFFAOYSA-N 1-(methoxymethyl)-4-phenoxybenzene Chemical compound C1=CC(COC)=CC=C1OC1=CC=CC=C1 YDGFWBUHUUSSRS-UHFFFAOYSA-N 0.000 description 2
- LXFQSRIDYRFTJW-UHFFFAOYSA-N 2,4,6-trimethylbenzenesulfonic acid Chemical compound CC1=CC(C)=C(S(O)(=O)=O)C(C)=C1 LXFQSRIDYRFTJW-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000276489 Merlangius merlangus Species 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000007812 deficiency Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000007598 dipping method Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 229910001507 metal halide Inorganic materials 0.000 description 2
- 150000005309 metal halides Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 239000005445 natural material Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000005011 phenolic resin Substances 0.000 description 2
- 150000003009 phosphonic acids Chemical class 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 230000036211 photosensitivity Effects 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LFXZSGVZSSMCMB-UHFFFAOYSA-N 2,5-dichlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(Cl)=CC=C1Cl LFXZSGVZSSMCMB-UHFFFAOYSA-N 0.000 description 1
- GCZFLYDNPNANCP-UHFFFAOYSA-N 2,6-ditert-butyl-1h-naphthalene-1,2-disulfonic acid Chemical compound OS(=O)(=O)C1C(S(O)(=O)=O)(C(C)(C)C)C=CC2=CC(C(C)(C)C)=CC=C21 GCZFLYDNPNANCP-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- CJGMVHVKJXBIDT-UHFFFAOYSA-N 2-nitroindene-1,3-dione Chemical compound C1=CC=C2C(=O)C([N+](=O)[O-])C(=O)C2=C1 CJGMVHVKJXBIDT-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical group C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- VVXLFFIFNVKFBD-UHFFFAOYSA-N 4,4,4-trifluoro-1-phenylbutane-1,3-dione Chemical compound FC(F)(F)C(=O)CC(=O)C1=CC=CC=C1 VVXLFFIFNVKFBD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-N Arsenic acid Chemical compound O[As](O)(O)=O DJHGAFSJWGLOIV-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical group OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N N-phenyl aniline Natural products C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- 241000033695 Sige Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical group CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- 229940000488 arsenic acid Drugs 0.000 description 1
- IWLBIFVMPLUHLK-UHFFFAOYSA-N azane;formaldehyde Chemical compound N.O=C IWLBIFVMPLUHLK-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N cinnamic acid group Chemical group C(C=CC1=CC=CC=C1)(=O)O WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- WBEBQCINXJDZCX-UHFFFAOYSA-N dibunic acid Chemical compound OS(=O)(=O)C1=C(C(C)(C)C)C=CC2=CC(C(C)(C)C)=CC=C21 WBEBQCINXJDZCX-UHFFFAOYSA-N 0.000 description 1
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000002032 methanolic fraction Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002921 oxetanes Chemical class 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- DHRLEVQXOMLTIM-UHFFFAOYSA-N phosphoric acid;trioxomolybdenum Chemical compound O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.OP(O)(O)=O DHRLEVQXOMLTIM-UHFFFAOYSA-N 0.000 description 1
- IYDGMDWEHDFVQI-UHFFFAOYSA-N phosphoric acid;trioxotungsten Chemical compound O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.OP(O)(O)=O IYDGMDWEHDFVQI-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-M phthalate(1-) Chemical compound OC(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-M 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 235000013824 polyphenols Nutrition 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000002577 pseudohalo group Chemical group 0.000 description 1
- 150000003254 radicals Chemical group 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- QYHFIVBSNOWOCQ-UHFFFAOYSA-N selenic acid Chemical compound O[Se](O)(=O)=O QYHFIVBSNOWOCQ-UHFFFAOYSA-N 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical class O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- DQFBYFPFKXHELB-VAWYXSNFSA-N trans-chalcone Chemical group C=1C=CC=CC=1C(=O)\C=C\C1=CC=CC=C1 DQFBYFPFKXHELB-VAWYXSNFSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/016—Diazonium salts or compounds
- G03F7/021—Macromolecular diazonium compounds; Macromolecular additives, e.g. binders
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G61/00—Macromolecular compounds obtained by reactions forming a carbon-to-carbon link in the main chain of the macromolecule
- C08G61/12—Macromolecular compounds containing atoms other than carbon in the main chain of the macromolecule
Landscapes
- Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Medicinal Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Physics & Mathematics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Materials For Photolithography (AREA)
- Other Resins Obtained By Reactions Not Involving Carbon-To-Carbon Unsaturated Bonds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US82628969A | 1969-05-20 | 1969-05-20 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2024243A1 true DE2024243A1 (enExample) | 1970-12-03 |
| DE2024243B2 DE2024243B2 (de) | 1978-06-22 |
| DE2024243C3 DE2024243C3 (de) | 1979-03-01 |
Family
ID=25246155
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE702024243A Expired DE2024243C3 (de) | 1969-05-20 | 1970-05-19 | Verfahren zur Herstellung Diazoniumgruppen enthaltender, lichtempfindlicher Kondensationsprodukte und diese Kondensationsprodukte enthaltendes lichtempfindliches Kopiermaterial |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3679419A (enExample) |
| JP (1) | JPS4945322B1 (enExample) |
| AT (1) | AT305024B (enExample) |
| BE (1) | BE750694A (enExample) |
| CH (1) | CH569994A5 (enExample) |
| DE (1) | DE2024243C3 (enExample) |
| ES (1) | ES379774A1 (enExample) |
| FI (1) | FI53898C (enExample) |
| FR (1) | FR2048536A5 (enExample) |
| GB (1) | GB1302717A (enExample) |
| NL (1) | NL7006702A (enExample) |
| SE (1) | SE385876B (enExample) |
| ZA (1) | ZA703393B (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005778A1 (de) * | 1978-05-26 | 1979-12-12 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von Reliefaufzeichnungen |
| EP0096326A1 (de) * | 1982-06-03 | 1983-12-21 | American Hoechst Corporation | Mit Wasser entwickelbares lichtempfindliches Gemisch und daraus hergestelltes lichtempfindliches Kopiermaterial |
| EP0130488A3 (en) * | 1983-06-21 | 1987-01-07 | Fuji Photo Film Co., Ltd. | Presensitized lithographic printing plate precursor |
| EP0136903A3 (en) * | 1983-09-30 | 1987-01-14 | Minnesota Mining And Manufacturing Company | Storage-stable photosensitive composition and article |
| EP0127893A3 (en) * | 1983-06-01 | 1987-01-28 | Fuji Photo Film Co., Ltd. | Light-sensitive composition for use with lithographic printing plates |
| EP0619519A1 (en) * | 1993-04-06 | 1994-10-12 | Lastra S.P.A. | Photosensitive polycondensation compound for negative lithographic plates |
| EP0679635A1 (de) * | 1994-04-28 | 1995-11-02 | Hoechst Aktiengesellschaft | Aromatische Diazoniumsalze und deren Verwendung in strahlungsempfindlichen Gemischen |
Families Citing this family (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4021243A (en) * | 1970-08-20 | 1977-05-03 | Hoechst Aktiengesellschaft | Diazo light-sensitive copying composition and process of using in the manufacture of screen printing stencils |
| US3890153A (en) * | 1971-03-13 | 1975-06-17 | Philips Corp | Positive-acting napthoquinone diazide photosensitive composition |
| US3790382A (en) * | 1971-04-16 | 1974-02-05 | Minnesota Mining & Mfg | Fluorinated polyamide-diazo resin coating composition |
| GB1347759A (en) * | 1971-06-17 | 1974-02-27 | Howson Algraphy Ltd | Light sensitive materials |
| US3847614A (en) * | 1971-09-13 | 1974-11-12 | Scott Paper Co | Diazo photopolymer composition and article comprising carboxylated resin |
| BE789196A (fr) * | 1971-09-25 | 1973-03-22 | Kalle Ag | Matiere a copier photosensible |
| US4131466A (en) * | 1972-03-05 | 1978-12-26 | Somar Manufacturing Co., Ltd. | Photographic method of making relief member with negative dye image |
| US3891438A (en) * | 1972-11-02 | 1975-06-24 | Polychrome Corp | Aqueous developing composition for lithographic diazo printing plates |
| US3891439A (en) * | 1972-11-02 | 1975-06-24 | Polychrome Corp | Aqueous developing composition for lithographic diazo printing plates |
| US4147545A (en) * | 1972-11-02 | 1979-04-03 | Polychrome Corporation | Photolithographic developing composition with organic lithium compound |
| GB1427932A (en) * | 1972-11-03 | 1976-03-10 | Ici Ltd | Diazotype materials |
| IT997623B (it) * | 1972-11-25 | 1975-12-30 | Licentia Gmbh | Procedimento e massa di copiatura per produrre uno schermo fluorescente per tubi a raggi catodici |
| US4164421A (en) * | 1972-12-09 | 1979-08-14 | Fuji Photo Film Co., Ltd. | Photocurable composition containing an o-quinonodiazide for printing plate |
| US3890149A (en) * | 1973-05-02 | 1975-06-17 | American Can Co | Waterless diazo planographic printing plates with epoxy-silane in undercoat and/or overcoat layers |
| US4113497A (en) * | 1973-06-11 | 1978-09-12 | American Can Company | Compositions with organohalogen compound and diazonium salts as photoinitiators of epoxy compounds in photo-polymerization |
| US3923522A (en) * | 1973-07-18 | 1975-12-02 | Oji Paper Co | Photosensitive composition |
| JPS527364B2 (enExample) * | 1973-07-23 | 1977-03-02 | ||
| US4093465A (en) * | 1973-08-14 | 1978-06-06 | Polychrome Corporation | Photosensitive diazo condensate compositions |
| US4019907A (en) * | 1973-10-24 | 1977-04-26 | Hodogaya Chemical Co., Ltd. | Photosensitive azido color-forming element |
| JPS5740501B2 (enExample) * | 1973-10-24 | 1982-08-27 | ||
| US4099973A (en) * | 1973-10-24 | 1978-07-11 | Hitachi, Ltd. | Photo-sensitive bis-azide containing composition |
| GB1488005A (en) * | 1974-01-25 | 1977-10-05 | Ici Ltd | Diazotype materials |
| US3951769A (en) * | 1974-03-01 | 1976-04-20 | American Can Company | Epoxide photopolymerizable compositions containing cyclic amides as gelation inhibitor and methods of polymerizing |
| US3997349A (en) * | 1974-06-17 | 1976-12-14 | Minnesota Mining And Manufacturing Company | Light-sensitive development-free driographic printing plate |
| US3958994A (en) * | 1974-08-26 | 1976-05-25 | American Hoechst Corporation | Photosensitive diazo steel lithoplate structure |
| JPS5236697B2 (enExample) * | 1974-09-09 | 1977-09-17 | ||
| GB1523762A (en) * | 1975-02-25 | 1978-09-06 | Oce Van Der Grinten Nv | Photocopying materials |
| US4486529A (en) * | 1976-06-10 | 1984-12-04 | American Hoechst Corporation | Dialo printing plate made from laser |
| JPS533216A (en) * | 1976-06-28 | 1978-01-12 | Fuji Photo Film Co Ltd | Diazo photosensitive composition |
| DE2652304C2 (de) * | 1976-11-17 | 1987-04-23 | Hoechst Ag, 6230 Frankfurt | Negativ arbeitendes lichtempfindliches Gemisch und damit hergestellte lichtempfindliche Flachdruckplatte |
| US4171974A (en) * | 1978-02-15 | 1979-10-23 | Polychrome Corporation | Aqueous alkali developable negative working lithographic printing plates |
| JPS5567214U (enExample) * | 1978-10-30 | 1980-05-09 | ||
| US4248959A (en) * | 1978-12-07 | 1981-02-03 | American Hoechst Corporation | Preparation of diazo printing plates using laser exposure |
| US4414315A (en) * | 1979-08-06 | 1983-11-08 | Howard A. Fromson | Process for making lithographic printing plate |
| US4408532A (en) * | 1980-04-30 | 1983-10-11 | Minnesota Mining And Manufacturing Company | Lithographic printing plate with oleophilic area of radiation exposed adduct of diazo resin and sulfonated polymer |
| US4401743A (en) * | 1980-04-30 | 1983-08-30 | Minnesota Mining And Manufacturing Company | Aqueous developable photosensitive composition and printing plate |
| CA1153611A (en) * | 1980-04-30 | 1983-09-13 | Minnesota Mining And Manufacturing Company | Aqueous developable photosensitive composition and printing plate |
| US4482489A (en) * | 1980-11-18 | 1984-11-13 | James River Graphics, Inc. | Light-sensitive diazonium trifluoromethane sulfonates |
| US4403028A (en) * | 1981-01-26 | 1983-09-06 | Andrews Paper & Chemical Co., Inc. | Light sensitive diazonium salts and diazotype materials |
| EP0061150B1 (de) * | 1981-03-20 | 1986-10-15 | American Hoechst Corporation | Lichtempfindliches Polykondensationsprodukt, Verfahren zu seiner Herstellung und dieses enthaltendes lichtempfindliches Aufzeichnungsmaterial |
| US4436804A (en) | 1981-03-20 | 1984-03-13 | American Hoechst Corporation | Light-sensitive polymeric diazonium condensates and reproduction compositions and materials therewith |
| DE3135804A1 (de) * | 1981-09-10 | 1983-03-24 | Hoechst Ag, 6000 Frankfurt | Lichtempfindliches, diazoniumgruppen enthaltendes polykondensationsprodukt und damit hergestelltes lichtempfindliches aufzeichnungsmaterial |
| US4491629A (en) * | 1982-02-22 | 1985-01-01 | Tokyo Shibaura Denki Kabushiki Kaisha | Water soluble photoresist composition with bisazide, diazo, polymer and silane |
| US4533619A (en) * | 1982-03-18 | 1985-08-06 | American Hoechst Corporation | Acid stabilizers for diazonium compound condensation products |
| US4729935A (en) * | 1982-03-18 | 1988-03-08 | Hoechst Celanese Corporation | Process for the production of photographic images utilizing a negative working diazo contact film |
| US4446218A (en) * | 1982-03-18 | 1984-05-01 | American Hoechst Corporation | Sulfur and/or amide-containing exposure accelerators for light-sensitive coatings with diazonium compounds |
| US4469772A (en) * | 1982-06-03 | 1984-09-04 | American Hoechst Corporation | Water developable dye coating on substrate with two diazo polycondensation products and water soluble polymeric binder |
| US4436807A (en) | 1982-07-15 | 1984-03-13 | American Hoechst Corporation | Developer composition with sodium, lithium and/or potassium salts for developing negative working imaged photographic material |
| US4526854A (en) * | 1982-09-01 | 1985-07-02 | Tokyo Shibaura Denki Kabushiki Kaisha | Photoresist composition with water soluble bisazide and diazo compound |
| US4501806A (en) * | 1982-09-01 | 1985-02-26 | Tokyo Shibaura Denki Kabushiki Kaisha | Method for forming pattern and photoresist used therein |
| US4937170A (en) * | 1982-11-19 | 1990-06-26 | Hoechst Celanese Corporation | Coupling agents for photographic elements |
| JPS59101644A (ja) * | 1982-12-01 | 1984-06-12 | Fuji Photo Film Co Ltd | 感光性組成物 |
| DE3311435A1 (de) * | 1983-03-29 | 1984-10-04 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches, diazoniumgruppen enthaltendes polykondensationsprodukt, verfahren zu seiner herstellung und lichtempfindliches aufzeichnungsmaterial, das dieses polykondensationsprodukt enthaelt |
| JPS6061288A (ja) * | 1983-09-13 | 1985-04-09 | Fuji Photo Film Co Ltd | 感熱記録材料 |
| EP0151191A1 (de) * | 1984-01-25 | 1985-08-14 | American Hoechst Corporation | Lichtempfindliches Material zur Herstellung von Kopiervorlagen |
| DE3417645A1 (de) * | 1984-05-12 | 1985-11-14 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches aufzeichnungsmaterial fuer die herstellung von flachdruckplatten |
| DE3418111A1 (de) * | 1984-05-16 | 1985-11-21 | Hoechst Ag, 6230 Frankfurt | Verfahren zur nachbehandlung von aluminiumoxidschichten mit phosphoroxo-anionen enthaltenden waessrigen loesungen und deren verwendung bei der herstellung von offsetdruckplattentraegern |
| DE3425328A1 (de) * | 1984-07-10 | 1986-01-16 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches gemisch und damit hergestelltes lichtempfindliches aufzeichnungsmaterial |
| US4785062A (en) * | 1984-07-31 | 1988-11-15 | W. R. Grace & Co.-Conn. | Reaction product of O-epoxyalkylated tetrakis(hydroxyphenyl)ethane resin and phenol with product having no remaining epoxy groups |
| JPH0782236B2 (ja) * | 1984-10-12 | 1995-09-06 | 三菱化学株式会社 | 感光性組成物 |
| US4618562A (en) * | 1984-12-27 | 1986-10-21 | American Hoechst Corporation | Aqueous developable lithographic printing plates containing an admixture of diazonium salts and polymers and composition therefor |
| DE3504658A1 (de) * | 1985-02-12 | 1986-08-14 | Hoechst Ag, 6230 Frankfurt | Lichtempfindliches gemisch und damit hergestelltes aufzeichnungsmaterial |
| US4946373A (en) * | 1985-02-28 | 1990-08-07 | Hoechst Celanese Corporation | Radiation-polymerizable composition |
| US4851319A (en) * | 1985-02-28 | 1989-07-25 | Hoechst Celanese Corporation | Radiation polymerizable composition, photographic element, and method of making element with diazonium salt, and monofunctional and polyfunctional acrylic monomers |
| US4634652A (en) * | 1985-07-25 | 1987-01-06 | American Hoechst Corporation | Overlay light-sensitive proofing film with transparent aluminum oxide and transparent magnesium fluoride layers therein |
| US4652604A (en) * | 1985-08-02 | 1987-03-24 | American Hoechst Corporation | Radiation-polymerizable composition and element containing a photopolymer composition |
| US4780392A (en) * | 1985-08-02 | 1988-10-25 | Hoechst Celanese Corporation | Radiation-polymerizable composition and element containing a photopolymerizable acrylic monomer |
| US5120772A (en) * | 1985-08-02 | 1992-06-09 | Walls John E | Radiation-polymerizable composition and element containing a photopolymerizable mixture |
| US4707437A (en) * | 1985-08-02 | 1987-11-17 | Hoechst Celanese Corporation | Radiation-polymerizable composition and element containing a photopolymer composition |
| US4822720A (en) * | 1985-08-02 | 1989-04-18 | Hoechst Celanese Corporation | Water developable screen printing composition |
| US4692397A (en) * | 1985-11-27 | 1987-09-08 | American Hoechst Corporation | Process for developing an aqueous alkaline development diazo photographic element |
| US5290666A (en) * | 1988-08-01 | 1994-03-01 | Hitachi, Ltd. | Method of forming a positive photoresist pattern utilizing contrast enhancement overlayer containing trifluoromethanesulfonic, methanesulfonic or trifluoromethaneacetic aromatic diazonium salt |
| US5200291A (en) * | 1989-11-13 | 1993-04-06 | Hoechst Celanese Corporation | Photosensitive diazonium resin, element made therefrom, method of preparing the resin and method for producing negative lithographic image utilizing the resin |
| US5206349A (en) * | 1990-08-10 | 1993-04-27 | Toyo Gosei Kogy Co., Ltd. | Aromatic diazo compounds and photosensitive compositions using the same |
| JP2944296B2 (ja) | 1992-04-06 | 1999-08-30 | 富士写真フイルム株式会社 | 感光性平版印刷版の製造方法 |
| US5275907A (en) | 1992-07-23 | 1994-01-04 | Eastman Kodak Company | Photosensitive compositions and lithographic printing plates containing acid-substituted ternary acetal polymer and copolyester with reduced propensity to blinding |
| CA2191055A1 (en) | 1995-12-04 | 1997-06-05 | Major S. Dhillon | Aqueous developable negative acting photosensitive composition having improved image contrast |
| EP0778292A3 (en) | 1995-12-04 | 1998-11-04 | Bayer Corporation | Method for the production of anhydride modified polyvinyl acetals useful for photosensitive compositions |
| US6458503B1 (en) | 2001-03-08 | 2002-10-01 | Kodak Polychrome Graphics Llc | Fluorinated aromatic acetal polymers and photosensitive compositions containing such polymers |
| CN101813888B (zh) * | 2010-04-14 | 2012-02-01 | 东莞长联新材料科技有限公司 | 一种重氮感光胶热稳定性和光化学活性的调控方法 |
-
1969
- 1969-05-20 US US826289A patent/US3679419A/en not_active Expired - Lifetime
-
1970
- 1970-05-08 NL NL7006702A patent/NL7006702A/xx not_active Application Discontinuation
- 1970-05-15 SE SE7006694A patent/SE385876B/xx unknown
- 1970-05-18 ES ES379774A patent/ES379774A1/es not_active Expired
- 1970-05-19 AT AT446670A patent/AT305024B/de not_active IP Right Cessation
- 1970-05-19 FI FI1399/70A patent/FI53898C/fi active
- 1970-05-19 CH CH738870A patent/CH569994A5/xx not_active IP Right Cessation
- 1970-05-19 ZA ZA703393A patent/ZA703393B/xx unknown
- 1970-05-19 GB GB2421870A patent/GB1302717A/en not_active Expired
- 1970-05-19 DE DE702024243A patent/DE2024243C3/de not_active Expired
- 1970-05-20 FR FR7018226A patent/FR2048536A5/fr not_active Expired
- 1970-05-20 BE BE750694D patent/BE750694A/xx not_active IP Right Cessation
- 1970-05-20 JP JP45042824A patent/JPS4945322B1/ja active Pending
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005778A1 (de) * | 1978-05-26 | 1979-12-12 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von Reliefaufzeichnungen |
| EP0096326A1 (de) * | 1982-06-03 | 1983-12-21 | American Hoechst Corporation | Mit Wasser entwickelbares lichtempfindliches Gemisch und daraus hergestelltes lichtempfindliches Kopiermaterial |
| EP0127893A3 (en) * | 1983-06-01 | 1987-01-28 | Fuji Photo Film Co., Ltd. | Light-sensitive composition for use with lithographic printing plates |
| EP0130488A3 (en) * | 1983-06-21 | 1987-01-07 | Fuji Photo Film Co., Ltd. | Presensitized lithographic printing plate precursor |
| EP0136903A3 (en) * | 1983-09-30 | 1987-01-14 | Minnesota Mining And Manufacturing Company | Storage-stable photosensitive composition and article |
| EP0619519A1 (en) * | 1993-04-06 | 1994-10-12 | Lastra S.P.A. | Photosensitive polycondensation compound for negative lithographic plates |
| EP0679635A1 (de) * | 1994-04-28 | 1995-11-02 | Hoechst Aktiengesellschaft | Aromatische Diazoniumsalze und deren Verwendung in strahlungsempfindlichen Gemischen |
Also Published As
| Publication number | Publication date |
|---|---|
| BE750694A (fr) | 1970-11-20 |
| ZA703393B (en) | 1971-01-27 |
| AT305024B (de) | 1973-02-12 |
| JPS4945322B1 (enExample) | 1974-12-03 |
| NL7006702A (enExample) | 1970-11-24 |
| ES379774A1 (es) | 1973-02-01 |
| DE2024243B2 (de) | 1978-06-22 |
| CH569994A5 (enExample) | 1975-11-28 |
| FI53898B (fi) | 1978-05-02 |
| DE2024243C3 (de) | 1979-03-01 |
| SE385876B (sv) | 1976-07-26 |
| US3679419A (en) | 1972-07-25 |
| FR2048536A5 (enExample) | 1971-03-19 |
| FI53898C (fi) | 1978-08-10 |
| GB1302717A (enExample) | 1973-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2024243A1 (enExample) | ||
| EP0274075B1 (de) | Polyvinylacetal, dieses enthaltendes lichtempfindliches Gemisch und daraus hergestelltes Aufzeichnungsmaterial | |
| EP0048876B1 (de) | Lichthärtbares Gemisch und damit hergestelltes lichtempfindliches Kopiermaterial | |
| DE1622301C2 (de) | Mit Alkali entwickelbare Kopierschicht | |
| EP0126875B1 (de) | Lichtempfindliches, Diazoniumgruppen enthaltendes Polykondensationsprodukt, Verfahren zu seiner Herstellung und lichtempfindliches Aufzeichnungsmaterial, das dieses Polykondensationsprodukt enthält | |
| EP0071881B1 (de) | Verfahren zur Herstellung von Flachdruckformen aus einem lichtempfindlichen Material auf Basis von Diazoniumsalz-Polykondensationsprodukten | |
| DE3009873A1 (de) | Photoempfindliche masse | |
| DE1254466B (de) | Kopiermaterial fuer die photomechanische Herstellung von Druckformen und Verfahren zur Herstellung von Druckformen | |
| DE2065732C2 (de) | Lichtempfindliches Aufzeichnungsmaterial | |
| DE1214086B (de) | Kopierschichten fuer den Flach- und Offsetdruck | |
| DE1597614A1 (de) | Lichtempfindliche Kopierschicht | |
| DE2124047A1 (de) | Photosensitive Polymere, Verfahren zur Herstellung derselben und diese Polymeren enthaltende Zusammensetzungen | |
| DE2507548A1 (de) | Lichtempfindliche lithographische druckplatte | |
| DE2065733C2 (de) | Lichtempfindliches Aufzeichnungsmaterial | |
| DE1224147B (de) | Verfahren zur Umkehrentwicklung von Diazo-verbindungen enthaltenden Kopierschichten | |
| DE2019426C3 (de) | Lichtempfindliches Gemisch und lichtempfindliches Kopiermaterial | |
| DE1572070C3 (de) | Lichtempfindliches Kopiermaterial | |
| EP0429955B1 (de) | Verfahren zur Herstellung einer negativ arbeitenden lichtempfindlichen Druckform | |
| EP0005778B1 (de) | Verfahren zur Herstellung von Reliefaufzeichnungen | |
| DE1572067C3 (de) | Lichtempfindliches Kopiermaterial | |
| EP0074580B1 (de) | Lichtempfindliches, Diazoniumgruppen enthaltendes Polykondensationsprodukt und damit hergestelltes lichtempfindliches Aufzeichnungsmaterial | |
| EP0224162B1 (de) | Lichtempfindliches, Diazoniumgruppen enthaltendes Polykondensationsprodukt, Verfahren zu seiner Herstellung und lichtempfindliches Aufzeichnungsmaterial, das dieses Polykondensationsprodukt enthält | |
| DE2932377A1 (de) | Lagerstabile lithographische druckplatten | |
| DE1572066C3 (de) | Lichtempfindliche Schicht zur Herstellung von Druckformen | |
| DE1597614C3 (de) | Lichtempfindliche Kopiermasse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| EGA | New person/name/address of the applicant | ||
| 8339 | Ceased/non-payment of the annual fee |