DE2023772C3 - Metallhalogenidentladungslampe - Google Patents
MetallhalogenidentladungslampeInfo
- Publication number
- DE2023772C3 DE2023772C3 DE2023772A DE2023772A DE2023772C3 DE 2023772 C3 DE2023772 C3 DE 2023772C3 DE 2023772 A DE2023772 A DE 2023772A DE 2023772 A DE2023772 A DE 2023772A DE 2023772 C3 DE2023772 C3 DE 2023772C3
- Authority
- DE
- Germany
- Prior art keywords
- aluminum
- lamp
- discharge lamp
- metal halide
- filling
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910001507 metal halide Inorganic materials 0.000 title claims description 6
- 150000005309 metal halides Chemical class 0.000 title claims description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 27
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 26
- 229910052782 aluminium Inorganic materials 0.000 claims description 25
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 13
- 239000002184 metal Substances 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 11
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 11
- 229910052721 tungsten Inorganic materials 0.000 claims description 11
- 239000010937 tungsten Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 8
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 8
- CECABOMBVQNBEC-UHFFFAOYSA-K aluminium iodide Chemical compound I[Al](I)I CECABOMBVQNBEC-UHFFFAOYSA-K 0.000 claims description 7
- 238000005260 corrosion Methods 0.000 claims description 6
- 230000007797 corrosion Effects 0.000 claims description 6
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 6
- 241001676573 Minium Species 0.000 claims description 5
- 229910052753 mercury Inorganic materials 0.000 claims description 5
- 150000002739 metals Chemical class 0.000 claims description 4
- 239000012535 impurity Substances 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 229910052756 noble gas Inorganic materials 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- 238000004031 devitrification Methods 0.000 claims 1
- 210000004072 lung Anatomy 0.000 claims 1
- 239000011241 protective layer Substances 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 11
- 229910052801 chlorine Inorganic materials 0.000 description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 10
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229910052758 niobium Inorganic materials 0.000 description 4
- 239000010955 niobium Substances 0.000 description 4
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 4
- 239000010453 quartz Substances 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229910001511 metal iodide Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- WRTMQOHKMFDUKX-UHFFFAOYSA-N triiodide Chemical compound I[I-]I WRTMQOHKMFDUKX-UHFFFAOYSA-N 0.000 description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- -1 aluminum chloride tungsten Chemical compound 0.000 description 2
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 2
- 239000005350 fused silica glass Substances 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 238000009877 rendering Methods 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- YCGSLTNXFOFSOQ-UHFFFAOYSA-K [Cl].[Al](Cl)(Cl)Cl Chemical compound [Cl].[Al](Cl)(Cl)Cl YCGSLTNXFOFSOQ-UHFFFAOYSA-K 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- LHJQIRIGXXHNLA-UHFFFAOYSA-N calcium peroxide Chemical compound [Ca+2].[O-][O-] LHJQIRIGXXHNLA-UHFFFAOYSA-N 0.000 description 1
- 235000019402 calcium peroxide Nutrition 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- YOUIDGQAIILFBW-UHFFFAOYSA-J tetrachlorotungsten Chemical compound Cl[W](Cl)(Cl)Cl YOUIDGQAIILFBW-UHFFFAOYSA-J 0.000 description 1
- CMJCEVKJYRZMIA-UHFFFAOYSA-M thallium(i) iodide Chemical compound [Tl]I CMJCEVKJYRZMIA-UHFFFAOYSA-M 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- RMUKCGUDVKEQPL-UHFFFAOYSA-K triiodoindigane Chemical compound I[In](I)I RMUKCGUDVKEQPL-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/125—Selection of substances for gas fillings; Specified operating pressure or temperature having an halogenide as principal component
Landscapes
- Discharge Lamp (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US82566169A | 1969-05-19 | 1969-05-19 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2023772A1 DE2023772A1 (de) | 1970-12-10 |
| DE2023772B2 DE2023772B2 (de) | 1974-01-17 |
| DE2023772C3 true DE2023772C3 (de) | 1974-08-22 |
Family
ID=25244617
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2023772A Expired DE2023772C3 (de) | 1969-05-19 | 1970-05-15 | Metallhalogenidentladungslampe |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3586898A (enExample) |
| JP (1) | JPS4915414B1 (enExample) |
| BE (1) | BE750474A (enExample) |
| DE (1) | DE2023772C3 (enExample) |
| FR (1) | FR2047427A5 (enExample) |
| GB (1) | GB1253948A (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3882343A (en) * | 1970-10-06 | 1975-05-06 | Gen Electric | Tin chloride molecular radiation lamp |
| US3898504A (en) * | 1970-12-09 | 1975-08-05 | Matsushita Electronics Corp | High pressure metal vapor discharge lamp |
| US3882345A (en) * | 1971-11-22 | 1975-05-06 | Gen Electric | Metal halide discharge lamp containing tin and sodium halides |
| JPS5345631B2 (enExample) * | 1972-04-04 | 1978-12-07 | ||
| NL7303079A (enExample) * | 1973-03-06 | 1974-09-10 | ||
| US3911308A (en) * | 1974-02-07 | 1975-10-07 | Matsushita Electronics Corp | High-pressure metal-vapor discharge lamp |
| JPS50115519U (enExample) * | 1974-03-07 | 1975-09-20 | ||
| US4480213A (en) * | 1982-07-26 | 1984-10-30 | Gte Laboratories Incorporated | Compact mercury-free fluorescent lamp |
| US4492898A (en) * | 1982-07-26 | 1985-01-08 | Gte Laboratories Incorporated | Mercury-free discharge lamp |
| US4436762A (en) | 1982-07-26 | 1984-03-13 | Gte Laboratories Incorporated | Low pressure plasma discharge formation of refractory coatings |
| US4495435A (en) * | 1982-07-26 | 1985-01-22 | Gte Laboratories Incorporated | Plasma switch |
| US4647821A (en) * | 1984-09-04 | 1987-03-03 | Gte Laboratories Incorporated | Compact mercury-free fluorescent lamp |
| US4636692A (en) * | 1984-09-04 | 1987-01-13 | Gte Laboratories Incorporated | Mercury-free discharge lamp |
| US4710679A (en) * | 1985-12-06 | 1987-12-01 | Gte Laboratories Incorporated | Fluorescent light source excited by excimer emission |
| JPH03152852A (ja) * | 1989-11-08 | 1991-06-28 | Matsushita Electric Works Ltd | 高輝度放電ランプ及び無電極放電灯装置 |
| US5256940A (en) * | 1989-11-08 | 1993-10-26 | Matsushita Electric Works, Ltd. | High intensity discharge lamp device |
| DE4327534A1 (de) * | 1993-08-16 | 1995-02-23 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Metallhalogenidentladungslampe für fotooptische Zwecke |
| DE10216092A1 (de) * | 2002-04-11 | 2003-10-30 | Schott Glas | Verbundmaterial aus einem Substratmaterial und einem Barriereschichtmaterial |
| DE10254969A1 (de) * | 2002-11-26 | 2004-06-03 | Philips Intellectual Property & Standards Gmbh | Hochdruckentladungslampe mit Quecksilberchlorid bei begrenztem Chlorgehalt |
| US7768207B2 (en) * | 2007-10-12 | 2010-08-03 | General Electric Company | Highly emissive material, structure made from highly emissive material, and method of making the same |
| US20090098389A1 (en) * | 2007-10-12 | 2009-04-16 | General Electric Company. | Highly emissive material, structure made from highly emissive material, and method of making the same |
-
1969
- 1969-05-19 US US825661A patent/US3586898A/en not_active Expired - Lifetime
-
1970
- 1970-04-13 JP JP45030869A patent/JPS4915414B1/ja active Pending
- 1970-04-13 GB GB07467/70A patent/GB1253948A/en not_active Expired
- 1970-05-06 FR FR7016655A patent/FR2047427A5/fr not_active Expired
- 1970-05-15 BE BE750474D patent/BE750474A/xx unknown
- 1970-05-15 DE DE2023772A patent/DE2023772C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2023772A1 (de) | 1970-12-10 |
| US3586898A (en) | 1971-06-22 |
| DE2023772B2 (de) | 1974-01-17 |
| JPS4915414B1 (enExample) | 1974-04-15 |
| FR2047427A5 (enExample) | 1971-03-12 |
| BE750474A (fr) | 1970-11-16 |
| GB1253948A (en) | 1971-11-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2023772C3 (de) | Metallhalogenidentladungslampe | |
| DE2512436C2 (de) | Elektrische Hochleistungs- Entladungslampe mit einem lichtdurchlässigen Kolben aus polykristallinem Aluminiumoxyd | |
| DE2624897A1 (de) | Aluminiumoxyd-ueberzuege fuer quecksilberdampf-lampen | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2524410C3 (de) | Verwendung eines glasartigen Siliziumdioxids mit einer glasartigen Sperrzone aus Aluminiumoxid für den Kolben einer Metallhalogenidlampe | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2619674A1 (de) | Halogen-metalldampfentladungslampe | |
| DE2422576C3 (de) | Quecksilberdampflampe | |
| DE1639112A1 (de) | Dampfentladungslampe fuer photochemische Zwecke | |
| EP1253625B1 (de) | Gasentladungslampe mit Down-Conversion-Leuchtstoff | |
| DE2550661A1 (de) | Metallhalogenidlampe | |
| DE3733217C2 (enExample) | ||
| DE2023770C3 (de) | Hochleistungsbogenlampe | |
| DE2456757C2 (de) | Metallhalogenid-Hochdruckgasentladungslampe | |
| EP1254943B1 (de) | Down-Conversion-Leuchtstoff, und Gasentladungslampe mit diesem Leuchtstoff | |
| DE2846816A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2402760A1 (de) | Metallhalogenid-hochdruckentladungslampe | |
| DE2149033A1 (de) | Zinnchlorid-Molekular-Strahlungslampe | |
| DE2430695A1 (de) | Lampe mit differentieller leistungsabgabe | |
| DE2605290C2 (de) | Hochdruck-Entladungslampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE2318062A1 (de) | Elektrische entladungslampe | |
| DE3024167A1 (de) | Halogengluehlampe | |
| DE2903963A1 (de) | Entladungslampe und ihre verwendung | |
| DE1938955B2 (de) | Elektrische Gluehlampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |