DE202005021797U1 - Rasierer mit zusätzlicher Schneideklinge - Google Patents
Rasierer mit zusätzlicher Schneideklinge Download PDFInfo
- Publication number
- DE202005021797U1 DE202005021797U1 DE202005021797U DE202005021797U DE202005021797U1 DE 202005021797 U1 DE202005021797 U1 DE 202005021797U1 DE 202005021797 U DE202005021797 U DE 202005021797U DE 202005021797 U DE202005021797 U DE 202005021797U DE 202005021797 U1 DE202005021797 U1 DE 202005021797U1
- Authority
- DE
- Germany
- Prior art keywords
- primary
- razor
- housing
- cutting
- handle
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000005520 cutting process Methods 0.000 title claims abstract description 69
- 210000004209 hair Anatomy 0.000 claims description 12
- 239000013536 elastomeric material Substances 0.000 claims description 3
- 210000003811 finger Anatomy 0.000 description 8
- 210000003813 thumb Anatomy 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BUHVIAUBTBOHAG-FOYDDCNASA-N (2r,3r,4s,5r)-2-[6-[[2-(3,5-dimethoxyphenyl)-2-(2-methylphenyl)ethyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound COC1=CC(OC)=CC(C(CNC=2C=3N=CN(C=3N=CN=2)[C@H]2[C@@H]([C@H](O)[C@@H](CO)O2)O)C=2C(=CC=CC=2)C)=C1 BUHVIAUBTBOHAG-FOYDDCNASA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000008257 shaving cream Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B21/00—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor
- B26B21/40—Details or accessories
- B26B21/52—Handles, e.g. tiltable, flexible
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B21/00—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor
- B26B21/40—Details or accessories
- B26B21/52—Handles, e.g. tiltable, flexible
- B26B21/522—Ergonomic details, e.g. shape, ribs or rubber parts
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B21/00—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B21/00—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor
- B26B21/08—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor involving changeable blades
- B26B21/14—Safety razors with one or more blades arranged transversely to the handle
- B26B21/22—Safety razors with one or more blades arranged transversely to the handle involving several blades to be used simultaneously
- B26B21/222—Safety razors with one or more blades arranged transversely to the handle involving several blades to be used simultaneously with the blades moulded into, or attached to, a changeable unit
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B26—HAND CUTTING TOOLS; CUTTING; SEVERING
- B26B—HAND-HELD CUTTING TOOLS NOT OTHERWISE PROVIDED FOR
- B26B21/00—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor
- B26B21/08—Razors of the open or knife type; Safety razors or other shaving implements of the planing type; Hair-trimming devices involving a razor-blade; Equipment therefor involving changeable blades
- B26B21/14—Safety razors with one or more blades arranged transversely to the handle
- B26B21/22—Safety razors with one or more blades arranged transversely to the handle involving several blades to be used simultaneously
- B26B21/222—Safety razors with one or more blades arranged transversely to the handle involving several blades to be used simultaneously with the blades moulded into, or attached to, a changeable unit
- B26B21/225—Safety razors with one or more blades arranged transversely to the handle involving several blades to be used simultaneously with the blades moulded into, or attached to, a changeable unit the changeable unit being resiliently mounted on the handle
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Forests & Forestry (AREA)
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Dry Shavers And Clippers (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10/798,541 US20050198829A1 (en) | 2004-03-11 | 2004-03-11 | Shaving razor with trimming blade |
| US20040798541 | 2004-03-11 | ||
| PCT/US2005/007330 WO2005090025A1 (en) | 2004-03-11 | 2005-03-07 | Saving razor with additional trimming blade |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE202005021797U1 true DE202005021797U1 (de) | 2010-03-18 |
Family
ID=34920292
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE202005021797U Expired - Lifetime DE202005021797U1 (de) | 2004-03-11 | 2005-03-07 | Rasierer mit zusätzlicher Schneideklinge |
| DE602005017836T Active DE602005017836D1 (de) | 2004-03-11 | 2005-03-07 | Rasierer mit zusätzlicher Trimmklinge |
| DE602005010981T Active DE602005010981D1 (de) | 2004-03-11 | 2005-03-07 | Nassrasierer mit zusätzlicher effilierklinge |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE602005017836T Active DE602005017836D1 (de) | 2004-03-11 | 2005-03-07 | Rasierer mit zusätzlicher Trimmklinge |
| DE602005010981T Active DE602005010981D1 (de) | 2004-03-11 | 2005-03-07 | Nassrasierer mit zusätzlicher effilierklinge |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US20050198829A1 (https=) |
| EP (2) | EP1722945B1 (https=) |
| JP (2) | JP2007528269A (https=) |
| KR (1) | KR20070015143A (https=) |
| CN (1) | CN100402248C (https=) |
| AR (1) | AR048263A1 (https=) |
| AT (2) | ATE413952T1 (https=) |
| AU (1) | AU2005222582B9 (https=) |
| BR (1) | BRPI0508642A (https=) |
| CA (3) | CA2669419A1 (https=) |
| DE (3) | DE202005021797U1 (https=) |
| DK (1) | DK1722945T3 (https=) |
| ES (2) | ES2317215T3 (https=) |
| MY (1) | MY140128A (https=) |
| PL (2) | PL2008780T3 (https=) |
| PT (1) | PT1722945E (https=) |
| RU (1) | RU2353510C2 (https=) |
| SI (1) | SI1722945T1 (https=) |
| WO (1) | WO2005090025A1 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE202013003009U1 (de) | 2013-04-01 | 2013-06-26 | Axel R. Hidde | Mechanischer Komfort-Rasierer |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7617607B2 (en) | 2003-07-21 | 2009-11-17 | The Gillette Company | Shaving razors and other hair cutting assemblies |
| GB2406537B (en) * | 2003-07-21 | 2006-09-06 | Gillette Co | Safety razors |
| US20050022386A1 (en) * | 2003-07-29 | 2005-02-03 | Macove James A. | Razor having separate blade groups for shaving and trimming/sculpting |
| US20090176675A1 (en) * | 2006-01-09 | 2009-07-09 | Marjorie Mossman Peffly | Personal Care Compositions Containing Cationically Modified Starch and an Anionic Surfactant System |
| WO2008023210A1 (en) | 2006-08-25 | 2008-02-28 | Bic-Violex Sa | Shaving blade unit and shaver having such a blade unit |
| WO2008023211A1 (en) | 2006-08-25 | 2008-02-28 | Bic-Violex Sa | Shaving blade unit comprising a movable trimming blade protector and shaver having such a blade unit |
| US20080086899A1 (en) * | 2006-10-12 | 2008-04-17 | Gallagher Richard N | Razor head and method for making the same |
| EP2176041B1 (en) * | 2007-04-13 | 2018-03-07 | Edgewell Personal Care Brands, LLC | Multi-use shaving implement |
| USD588308S1 (en) | 2008-02-15 | 2009-03-10 | American Safety Razor | Shaving razor |
| USD588309S1 (en) | 2008-02-15 | 2009-03-10 | American Safety Razor | Razor cartridge |
| US8930512B2 (en) * | 2008-08-21 | 2015-01-06 | Red Hat, Inc. | Providing remote software provisioning to machines |
| RU2479418C2 (ru) * | 2009-01-05 | 2013-04-20 | Дзе Жиллетт Компани | Механизмы фиксации рукояток и картриджей бритвенных приборов |
| US8782903B2 (en) * | 2009-05-29 | 2014-07-22 | The Gillette Company | Shaving razor comb guard for a trimming blade |
| US9193080B2 (en) * | 2009-08-03 | 2015-11-24 | The Gillette Company | Shaving blade unit with self-leveling trimmer |
| USD625883S1 (en) | 2009-11-30 | 2010-10-19 | American Safety Razor | Razor cartridge |
| USD633253S1 (en) | 2010-06-23 | 2011-02-22 | American Safety Razor | Razor cartridge |
| USD648075S1 (en) | 2010-07-07 | 2011-11-01 | American Safety Razor | Razor cartridge |
| USD640415S1 (en) | 2010-07-07 | 2011-06-21 | American Safety Razor | Razor cartridge |
| USD643977S1 (en) | 2010-10-19 | 2011-08-23 | American Safety Razor | Razor cartridge |
| USD643976S1 (en) | 2010-10-19 | 2011-08-23 | American Safety Razor | Razor cartridge |
| US20140033551A1 (en) * | 2012-08-03 | 2014-02-06 | The Gillette Company | Hand held device having a metal rod forming a rotational axis |
| WO2017092836A1 (en) | 2015-12-01 | 2017-06-08 | Bic-Violex Sa | Shaving razors and shaving cartridges |
| CN105538355B (zh) * | 2015-12-22 | 2017-08-15 | 任向荣 | 具有修剪功能的剃须刀头 |
| WO2017173198A1 (en) | 2016-04-01 | 2017-10-05 | The Procter & Gamble Company | Oral care compositions containing a gel network phase |
| US11141873B2 (en) | 2017-04-18 | 2021-10-12 | The Gillette Company Llc | Shaving razor system |
| US20180297221A1 (en) * | 2017-04-18 | 2018-10-18 | The Gillette Company Llc | Shaving razor system and method of manufacture |
| USD1003515S1 (en) | 2020-10-28 | 2023-10-31 | Sportz Razors LLC | Razor handle |
| WO2025155577A1 (en) | 2024-01-19 | 2025-07-24 | The Gillette Company Llc | Shaving razor system |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5787586A (en) | 1996-04-10 | 1998-08-04 | The Gillette Company | Shaving system and method |
| US6276061B1 (en) | 1999-03-29 | 2001-08-21 | Menachem Rozenkranc | Multi-blade shaving apparatus |
Family Cites Families (101)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE109694C (https=) * | ||||
| US1290664A (en) * | 1917-03-13 | 1919-01-07 | John E Russell | Planetarium. |
| US1479690A (en) * | 1923-01-05 | 1924-01-01 | Angst Adolf | Safety razor |
| US1911996A (en) * | 1930-04-03 | 1933-05-30 | Gillette Safety Razor Co | Safety razor |
| US1853867A (en) * | 1931-12-05 | 1932-04-12 | Leroy G Love | Safety razor holder and blade |
| US1999060A (en) * | 1931-12-07 | 1935-04-23 | Gustaf W Rydner | Safety razor |
| US2118498A (en) * | 1935-02-06 | 1938-05-24 | Durham Duplex Razor Company | Safety razor |
| US2083172A (en) * | 1935-07-23 | 1937-06-08 | Roland L Smith | Razor handle |
| US2043124A (en) * | 1935-09-09 | 1936-06-02 | Gillette Safety Razor Co | Safety razor |
| US2078150A (en) * | 1935-09-23 | 1937-04-20 | Masip Joseph | Safety razor |
| US2353599A (en) * | 1940-11-04 | 1944-07-11 | Lewis H Swann | Safety razor |
| US2275517A (en) * | 1941-07-01 | 1942-03-10 | Harold C Fay | Safety razor |
| GB549466A (en) * | 1941-07-14 | 1942-11-23 | W R Swann & Company Ltd | Improvements in, and relating to, safety razors |
| US2704397A (en) * | 1953-12-28 | 1955-03-22 | Mary C Turgi | Disposable razor |
| US2837820A (en) * | 1955-10-03 | 1958-06-10 | Ostrowski Walter | Safety razor with clamped blade |
| US2934776A (en) * | 1956-02-10 | 1960-05-03 | George S Clemens | Toothbrush |
| US3137939A (en) * | 1962-06-06 | 1964-06-23 | George A Waldeck | Safety razor marker |
| US3172202A (en) * | 1963-09-19 | 1965-03-09 | Claude W Sooter | Protective cover for safety razor |
| US3259978A (en) * | 1963-10-23 | 1966-07-12 | Brunswick Corp | Safety razor with integral hinge means for a pivotal cap and locking means for said cap |
| US3383764A (en) * | 1964-10-26 | 1968-05-21 | Sachs Safety Razor Co Inc | Plastic disposable safety razor |
| NL128550C (https=) * | 1965-04-26 | |||
| US3391458A (en) * | 1967-09-11 | 1968-07-09 | Robert L. Karr | Safety razor with adjustable guards |
| US3593416A (en) * | 1968-10-10 | 1971-07-20 | Roger C Edson | Safety razor |
| JPS5027061B1 (https=) * | 1971-03-08 | 1975-09-04 | ||
| US3795955A (en) * | 1972-02-15 | 1974-03-12 | Gillette Co | Razor with plastic handle and guard |
| US3795979A (en) * | 1972-04-27 | 1974-03-12 | Gillette Co | Handle |
| US3810305A (en) * | 1972-04-27 | 1974-05-14 | Gillette Co | Blade unit |
| US3823471A (en) * | 1972-12-05 | 1974-07-16 | R Stone | Plastic safety razor |
| US3934338A (en) * | 1972-12-11 | 1976-01-27 | Philip Morris Incorporated | Multiple blade safety razor combination |
| US4017970A (en) * | 1975-10-06 | 1977-04-19 | Lawrence Peska Associates, Inc. | Tile and tub scraper |
| US4285124A (en) * | 1979-09-21 | 1981-08-25 | Diakonov Yuri G | Safety razor for trimming beards and mustaches |
| US4270268A (en) * | 1979-12-07 | 1981-06-02 | The Gillette Company | Razor blade assembly |
| US4378634A (en) * | 1979-12-07 | 1983-04-05 | The Gillette Company | Razor blade assembly |
| US4378633A (en) * | 1979-12-07 | 1983-04-05 | The Gillette Company | Razor blade assembly |
| US4442598A (en) * | 1981-01-30 | 1984-04-17 | The Gillette Company | Razor blade assembly |
| US4493025A (en) * | 1981-05-22 | 1985-01-08 | Data General Corporation | Digital data processing system using unique means for comparing operational results and locations at which such results are to be stored |
| DE3303095A1 (de) * | 1982-02-10 | 1983-08-25 | Feather Safety Razor Co., Ltd., Osaka | Sicherheitsrasierapparat |
| US4446619A (en) * | 1982-06-07 | 1984-05-08 | The Gillette Company | Razor handle |
| US4498235A (en) * | 1982-09-17 | 1985-02-12 | The Gillette Company | Razor blade assembly |
| US4492024A (en) * | 1982-09-17 | 1985-01-08 | The Gillette Company | Razor blade assembly |
| US4501066A (en) * | 1983-04-11 | 1985-02-26 | Sceberras Conrad T | Dual headed razor system |
| US4901437A (en) * | 1984-05-25 | 1990-02-20 | American Safety Razor Company | Razor head and method of manufacture |
| US4586255A (en) * | 1984-10-15 | 1986-05-06 | The Gillette Company | Razor blade assembly |
| IL79651A (en) * | 1986-08-07 | 1991-03-10 | America Israel Blades Ltd | Safety razor |
| US4809432A (en) * | 1986-11-24 | 1989-03-07 | Shaverd Corp. | Disposable razor and emollient dispensing device |
| USD306915S (en) * | 1987-06-18 | 1990-03-27 | Luzenberg Robert S | Shaver with shaving gel dispensing unit |
| USD307334S (en) * | 1987-07-24 | 1990-04-17 | Warner-Lambert Company | Disposable razor |
| US4831731A (en) * | 1988-04-07 | 1989-05-23 | Mirel Elits | Multiple blade safety razor |
| USD313672S (en) * | 1988-09-14 | 1991-01-08 | Robert Tiegs | Safety razor |
| US4993154A (en) * | 1990-03-01 | 1991-02-19 | Allan Radcliffe | Shaving apparatus |
| US5018274A (en) * | 1990-04-05 | 1991-05-28 | The Gillette Company | Safety razor blade |
| USD327550S (en) * | 1990-04-10 | 1992-06-30 | Warner-Lambert Company | Razor handle |
| USD318142S (en) * | 1990-05-29 | 1991-07-09 | Anthony Falchi | Safety razor |
| JPH0639644Y2 (ja) * | 1990-06-21 | 1994-10-19 | 石根 石田 | 安全剃刀 |
| US5029390A (en) * | 1990-07-16 | 1991-07-09 | Reeves Ronald R | Safety razor apparatus |
| US5027511A (en) * | 1990-09-28 | 1991-07-02 | The Gillette Company | Shaving system |
| US5113585A (en) * | 1990-09-28 | 1992-05-19 | The Gillette Company | Shaving system |
| CA69936S (fr) * | 1991-02-26 | 1992-01-28 | Prod S W L Inc | Ensemble de rasoir et son capuchon |
| US5199173A (en) * | 1991-10-17 | 1993-04-06 | Hegemann Research Corporation | Concave, convex safety razor |
| US5205040A (en) * | 1991-11-05 | 1993-04-27 | Werner Eric J | Apparatus for shaving |
| DE69233787D1 (de) * | 1991-11-27 | 2010-07-15 | Gillette Co | Rasierapparate |
| USD346042S (en) * | 1992-04-30 | 1994-04-12 | Steve Chu | Disposable razor |
| US5282814A (en) * | 1992-09-08 | 1994-02-01 | Rajesh Srivastava | Instrument for cleaning the top of the human tongue with antiseptic strip |
| US5307564A (en) * | 1992-12-01 | 1994-05-03 | Schoenberg Frederic D | Safety razor |
| US5343622A (en) * | 1993-02-22 | 1994-09-06 | Andrews Edward A | Bi-directional razor device |
| US6212777B1 (en) * | 1993-09-29 | 2001-04-10 | The Gillette Company | Safety razors |
| US6026577A (en) * | 1993-10-15 | 2000-02-22 | Warner-Lambert Company | Disposable razor with removable razor head |
| BR9509216A (pt) * | 1994-10-03 | 1998-01-27 | Gillette Co | Conjunto de lâmina para aparelho para barbear |
| USD369437S (en) * | 1995-02-17 | 1996-04-30 | Armbruster Joseph M | Razor |
| US6185823B1 (en) * | 1995-11-10 | 2001-02-13 | The Gillette Company | Oval frame razor |
| US5704127A (en) * | 1996-03-04 | 1998-01-06 | Cordio; Caroline | Concave, convex safety razors |
| US5711076A (en) * | 1996-03-27 | 1998-01-27 | The Gillette Company | Shaving system with improved guard structure |
| US5784790A (en) * | 1996-04-10 | 1998-07-28 | The Gillette Company | Shaving razor and method |
| US6041926A (en) * | 1996-04-10 | 2000-03-28 | The Gillette Company | Dispensing razor blade cartridges used with a handle |
| USD392417S (en) * | 1996-04-10 | 1998-03-17 | The Gillette Company | Razor handle |
| US5661907A (en) * | 1996-04-10 | 1997-09-02 | The Gillette Company | Razor blade assembly |
| USD406393S (en) * | 1996-04-10 | 1999-03-02 | The Gillette Company | Razor handle |
| US5687485A (en) * | 1996-05-15 | 1997-11-18 | The Gillette Company | Razor handle |
| JP3195243B2 (ja) * | 1996-08-06 | 2001-08-06 | フェザー安全剃刀株式会社 | 剃 刀 |
| USD422117S (en) * | 1996-09-24 | 2000-03-28 | Warner-Lambert Company | Razor handle |
| USD404527S (en) * | 1997-02-19 | 1999-01-19 | The Gillette Company | Gripping pad for a razor handle |
| USD407849S (en) * | 1997-02-19 | 1999-04-06 | The Gillette Company | Button for a razor handle |
| USD392418S (en) * | 1997-02-19 | 1998-03-17 | The Gillette Company | Razor handle |
| US6727061B2 (en) * | 1997-02-20 | 2004-04-27 | Cabtec, Inc. | Methods for identifying species or Shigella and E. coli using operon sequence analysis |
| USD391512S (en) * | 1997-06-24 | 1998-03-03 | Mick Ch | Emergency alarm |
| US6035537A (en) * | 1997-09-30 | 2000-03-14 | The Gillette Company | Razor cartridge with metal clip retaining blades |
| US6009624A (en) * | 1997-09-30 | 2000-01-04 | The Gillette Company | Razor cartridge with movable blades |
| CN1191918A (zh) * | 1998-03-06 | 1998-09-02 | 邹先春 | 城市分流循环供水系统 |
| USD407851S (en) * | 1998-04-24 | 1999-04-06 | The Gillette Company | Razor handle |
| USD408101S (en) * | 1998-04-24 | 1999-04-13 | The Gillette Company | Razor handle grip |
| USD407850S (en) * | 1998-04-24 | 1999-04-06 | The Gillette Company | Razor handle pad |
| US6308416B1 (en) * | 1998-12-31 | 2001-10-30 | The Gillette Company | Surface conforming shaving razor and handle therefor |
| CA2276882C (en) * | 1999-07-02 | 2000-05-02 | Stephen Macneil | Device for trimming and shaping a beard or moustache |
| US6216345B1 (en) * | 1999-07-27 | 2001-04-17 | Edward A. Andrews | Glide systems for manual shaving razors |
| GB2354474B8 (en) * | 1999-09-27 | 2008-01-29 | Gillette Co | Safety razors |
| USD444267S1 (en) * | 2000-02-29 | 2001-06-26 | The Gillette Company | Razor handle |
| US6675479B1 (en) * | 2000-02-29 | 2004-01-13 | The Gillette Company | Shaving razor and blade unit with improved guard |
| EP2181815B1 (en) * | 2001-04-27 | 2011-10-26 | Eveready Battery Company, Inc. | Wet razor with four blades, and cartridge therefor |
| USD458410S1 (en) * | 2001-08-29 | 2002-06-04 | American Safety Razor Company | Razor handle |
| US7210229B2 (en) * | 2002-04-24 | 2007-05-01 | Eveready Battery Company, Inc. | Razor cartridge |
| GB2406537B (en) * | 2003-07-21 | 2006-09-06 | Gillette Co | Safety razors |
-
2004
- 2004-03-11 US US10/798,541 patent/US20050198829A1/en not_active Abandoned
-
2005
- 2005-03-07 AT AT05724800T patent/ATE413952T1/de not_active IP Right Cessation
- 2005-03-07 ES ES05724800T patent/ES2317215T3/es not_active Expired - Lifetime
- 2005-03-07 DE DE202005021797U patent/DE202005021797U1/de not_active Expired - Lifetime
- 2005-03-07 DE DE602005017836T patent/DE602005017836D1/de active Active
- 2005-03-07 EP EP05724800A patent/EP1722945B1/en not_active Expired - Lifetime
- 2005-03-07 CA CA002669419A patent/CA2669419A1/en not_active Abandoned
- 2005-03-07 AU AU2005222582A patent/AU2005222582B9/en not_active Ceased
- 2005-03-07 DK DK05724800T patent/DK1722945T3/da active
- 2005-03-07 ES ES08165014T patent/ES2336974T3/es not_active Expired - Lifetime
- 2005-03-07 PL PL08165014T patent/PL2008780T3/pl unknown
- 2005-03-07 CN CNB200580007632XA patent/CN100402248C/zh not_active Expired - Lifetime
- 2005-03-07 EP EP08165014A patent/EP2008780B1/en not_active Expired - Lifetime
- 2005-03-07 WO PCT/US2005/007330 patent/WO2005090025A1/en not_active Ceased
- 2005-03-07 SI SI200530581T patent/SI1722945T1/sl unknown
- 2005-03-07 JP JP2007502897A patent/JP2007528269A/ja not_active Withdrawn
- 2005-03-07 CA CA002557922A patent/CA2557922C/en not_active Expired - Fee Related
- 2005-03-07 DE DE602005010981T patent/DE602005010981D1/de active Active
- 2005-03-07 RU RU2006131439/02A patent/RU2353510C2/ru not_active IP Right Cessation
- 2005-03-07 AT AT08165014T patent/ATE448921T1/de not_active IP Right Cessation
- 2005-03-07 BR BRPI0508642-6A patent/BRPI0508642A/pt not_active Application Discontinuation
- 2005-03-07 CA CA002669421A patent/CA2669421A1/en not_active Abandoned
- 2005-03-07 PT PT05724800T patent/PT1722945E/pt unknown
- 2005-03-07 PL PL05724800T patent/PL1722945T3/pl unknown
- 2005-03-07 KR KR1020067018430A patent/KR20070015143A/ko not_active Ceased
- 2005-03-10 MY MYPI20050993A patent/MY140128A/en unknown
- 2005-03-11 AR ARP050100939A patent/AR048263A1/es unknown
-
2007
- 2007-09-27 US US11/904,443 patent/US20080022529A1/en not_active Abandoned
-
2011
- 2011-01-26 JP JP2011014435A patent/JP5405503B2/ja not_active Expired - Fee Related
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5787586A (en) | 1996-04-10 | 1998-08-04 | The Gillette Company | Shaving system and method |
| US6276061B1 (en) | 1999-03-29 | 2001-08-21 | Menachem Rozenkranc | Multi-blade shaving apparatus |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE202013003009U1 (de) | 2013-04-01 | 2013-06-26 | Axel R. Hidde | Mechanischer Komfort-Rasierer |
| DE102013007223A1 (de) | 2013-04-01 | 2014-10-02 | Axel R. Hidde | Mechanischer Komfort-Rasierer |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE202005021797U1 (de) | Rasierer mit zusätzlicher Schneideklinge | |
| DE69233729T2 (de) | Rasierapparate | |
| DE60133591T2 (de) | Rasierer und Klingeneinheit mit verbessertem Schutz | |
| DE60220641T2 (de) | Rasierer | |
| DE602004009738T2 (de) | Rasierer | |
| DE102017115867B4 (de) | Nasenhaar- und Augenbrauentrimmer, dessen Fest- und Bewegungsmesser zur Reinigung voneinander getrennt werden können | |
| DE60214245T2 (de) | Rasierklingeneinheit mit Rasierhilfe | |
| DE69830801T2 (de) | Rasierklingeneinheit mit schmiermittelströmungswegen | |
| DE69411933T2 (de) | Wegwerfnassrasierer mit abnehmbarem rasierkopf | |
| DE69609497T3 (de) | Rasiersystem mit elastisch unterstützten klingen | |
| DE60020579T2 (de) | Sicherheitsrasierer | |
| DE602004013156T2 (de) | Sicherheitsrasierer | |
| EP1740354B1 (de) | System bestehend aus einem elektrischen rasierapparat und wenigstens einem zubehörteil | |
| EP0113359B1 (de) | Haarschneidegerät | |
| DE202007018906U1 (de) | Rasierer | |
| DE29724235U1 (de) | Rasierklingeneinheit | |
| DE102022100352A1 (de) | Verfahren zum zurückhalten einer rasiererkomponente in einer rasierklingeneinheit | |
| DE4142070A1 (de) | Oszillierender elektrorasierer | |
| DE3416177A1 (de) | Rasierapparat | |
| DE3139693A1 (de) | Rasiergeraet | |
| DE3222701A1 (de) | Rasierapparat | |
| DE2755973A1 (de) | Rasiereranordnung | |
| DE20019442U1 (de) | Vorrichtung zur abtragenden Behandlung von Hornhaut | |
| EP0008483A1 (de) | Langhaarscherteil, insbesondere für Trockenrasierapparate | |
| DE2264550A1 (de) | Rasierklingeneinheit |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| R207 | Utility model specification |
Effective date: 20100422 |
|
| R150 | Utility model maintained after payment of first maintenance fee after three years |
Effective date: 20100420 |
|
| R151 | Utility model maintained after payment of second maintenance fee after six years |
Effective date: 20110418 |
|
| R152 | Utility model maintained after payment of third maintenance fee after eight years |
Effective date: 20130418 |
|
| R071 | Expiry of right | ||
| R071 | Expiry of right |