DE2019432C3 - Verfahren zur Herstellung von endständige Aminogruppen aufweisenden organischen Verbindungen und deren Verwendung zur Herstellung von Kunststoffen - Google Patents
Verfahren zur Herstellung von endständige Aminogruppen aufweisenden organischen Verbindungen und deren Verwendung zur Herstellung von KunststoffenInfo
- Publication number
- DE2019432C3 DE2019432C3 DE2019432A DE2019432A DE2019432C3 DE 2019432 C3 DE2019432 C3 DE 2019432C3 DE 2019432 A DE2019432 A DE 2019432A DE 2019432 A DE2019432 A DE 2019432A DE 2019432 C3 DE2019432 C3 DE 2019432C3
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- weight
- general formula
- production
- groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 24
- 125000003277 amino group Chemical group 0.000 title claims description 13
- 150000002894 organic compounds Chemical class 0.000 title claims description 3
- 238000004519 manufacturing process Methods 0.000 title description 14
- 229920003023 plastic Polymers 0.000 title description 7
- 239000004033 plastic Substances 0.000 title description 7
- 229920000570 polyether Polymers 0.000 claims description 35
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 25
- VYFOAVADNIHPTR-UHFFFAOYSA-N isatoic anhydride Chemical compound NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 19
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 19
- 229920005862 polyol Polymers 0.000 claims description 16
- -1 ether polyol Chemical class 0.000 claims description 15
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 14
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 13
- 229920006295 polythiol Polymers 0.000 claims description 13
- 150000003077 polyols Chemical class 0.000 claims description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 8
- 229920001281 polyalkylene Polymers 0.000 claims description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 6
- 239000012442 inert solvent Substances 0.000 claims description 5
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 3
- 150000003568 thioethers Chemical class 0.000 claims description 3
- 229920000642 polymer Polymers 0.000 claims description 2
- 239000004698 Polyethylene Substances 0.000 claims 1
- 239000004743 Polypropylene Substances 0.000 claims 1
- 229920000573 polyethylene Polymers 0.000 claims 1
- 229920001155 polypropylene Polymers 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- 239000000203 mixture Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000006260 foam Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 8
- 229920001228 polyisocyanate Polymers 0.000 description 8
- 239000005056 polyisocyanate Substances 0.000 description 8
- 238000004448 titration Methods 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical group NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 238000005452 bending Methods 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 239000004814 polyurethane Substances 0.000 description 5
- 229920002635 polyurethane Polymers 0.000 description 5
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 229920001451 polypropylene glycol Polymers 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 239000004970 Chain extender Substances 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- XFLSMWXCZBIXLV-UHFFFAOYSA-N n,n-dimethyl-2-(4-methylpiperazin-1-yl)ethanamine Chemical compound CN(C)CCN1CCN(C)CC1 XFLSMWXCZBIXLV-UHFFFAOYSA-N 0.000 description 3
- 229920003225 polyurethane elastomer Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical compound [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229920002396 Polyurea Polymers 0.000 description 2
- 229920005830 Polyurethane Foam Polymers 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- 150000007514 bases Chemical class 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 238000007046 ethoxylation reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- 229920000909 polytetrahydrofuran Polymers 0.000 description 2
- 239000011496 polyurethane foam Substances 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- CPRMKOQKXYSDML-UHFFFAOYSA-M rubidium hydroxide Chemical compound [OH-].[Rb+] CPRMKOQKXYSDML-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 238000009864 tensile test Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- GFNKTLQTQSALEJ-UHFFFAOYSA-N 1-isocyanato-4-nitrobenzene Chemical class [O-][N+](=O)C1=CC=C(N=C=O)C=C1 GFNKTLQTQSALEJ-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- NDLNTMNRNCENRZ-UHFFFAOYSA-N 2-[2-hydroxyethyl(octadecyl)amino]ethanol Chemical compound CCCCCCCCCCCCCCCCCCN(CCO)CCO NDLNTMNRNCENRZ-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- AKNUHUCEWALCOI-UHFFFAOYSA-N N-ethyldiethanolamine Chemical compound OCCN(CC)CCO AKNUHUCEWALCOI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Inorganic materials [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- JXCHMDATRWUOAP-UHFFFAOYSA-N diisocyanatomethylbenzene Chemical class O=C=NC(N=C=O)C1=CC=CC=C1 JXCHMDATRWUOAP-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- YBXCWYOXJRWZBH-UHFFFAOYSA-N ethene;2-(2-hydroxyethylamino)ethanol Chemical compound C=C.OCCNCCO YBXCWYOXJRWZBH-UHFFFAOYSA-N 0.000 description 1
- SHZIWNPUGXLXDT-UHFFFAOYSA-N ethyl hexanoate Chemical compound CCCCCC(=O)OCC SHZIWNPUGXLXDT-UHFFFAOYSA-N 0.000 description 1
- SBPHMRSYBPXBIP-UHFFFAOYSA-N ethyl n-(4-nitrophenyl)carbamate Chemical class CCOC(=O)NC1=CC=C([N+]([O-])=O)C=C1 SBPHMRSYBPXBIP-UHFFFAOYSA-N 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- GJRQTCIYDGXPES-UHFFFAOYSA-N iso-butyl acetate Natural products CC(C)COC(C)=O GJRQTCIYDGXPES-UHFFFAOYSA-N 0.000 description 1
- FGKJLKRYENPLQH-UHFFFAOYSA-M isocaproate Chemical compound CC(C)CCC([O-])=O FGKJLKRYENPLQH-UHFFFAOYSA-M 0.000 description 1
- OQAGVSWESNCJJT-UHFFFAOYSA-N isovaleric acid methyl ester Natural products COC(=O)CC(C)C OQAGVSWESNCJJT-UHFFFAOYSA-N 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 1
- 229940113083 morpholine Drugs 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- DYFXGORUJGZJCA-UHFFFAOYSA-N phenylmethanediamine Chemical compound NC(N)C1=CC=CC=C1 DYFXGORUJGZJCA-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- UUCCCPNEFXQJEL-UHFFFAOYSA-L strontium dihydroxide Chemical compound [OH-].[OH-].[Sr+2] UUCCCPNEFXQJEL-UHFFFAOYSA-L 0.000 description 1
- 229910001866 strontium hydroxide Inorganic materials 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
- 229950006389 thiodiglycol Drugs 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/52—Polythioethers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/48—Polyethers
- C08G18/50—Polyethers having heteroatoms other than oxygen
- C08G18/5021—Polyethers having heteroatoms other than oxygen having nitrogen
- C08G18/5024—Polyethers having heteroatoms other than oxygen having nitrogen containing primary and/or secondary amino groups
- C08G18/5027—Polyethers having heteroatoms other than oxygen having nitrogen containing primary and/or secondary amino groups directly linked to carbocyclic groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/48—Polyethers
- C08G18/50—Polyethers having heteroatoms other than oxygen
- C08G18/5072—Polyethers having heteroatoms other than oxygen containing sulfur
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyurethanes Or Polyureas (AREA)
- Polyethers (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2019432A DE2019432C3 (de) | 1970-04-22 | 1970-04-22 | Verfahren zur Herstellung von endständige Aminogruppen aufweisenden organischen Verbindungen und deren Verwendung zur Herstellung von Kunststoffen |
| US00134841A US3808250A (en) | 1970-04-22 | 1971-04-16 | Polyethers containing terminal amino groups |
| CA110,768A CA969554A (en) | 1970-04-22 | 1971-04-19 | Polyethers containing terminal amino groups and their use for the production of synthetic resins |
| NL7105297A NL7105297A (enExample) | 1970-04-22 | 1971-04-20 | |
| JP46025354A JPS5221040B1 (enExample) | 1970-04-22 | 1971-04-21 | |
| GB1072471*[A GB1303787A (enExample) | 1970-04-22 | 1971-04-22 | |
| BE766139A BE766139A (fr) | 1970-04-22 | 1971-04-22 | Nouveaux polyethers presentant des groupes amines terminaux et leur utilisation pour la fabrication de matieres plastiques |
| FR7114412A FR2090581A5 (enExample) | 1970-04-22 | 1971-04-22 | |
| JP15662776A JPS52125598A (en) | 1970-04-22 | 1976-12-27 | Process for producing synthetic resin from novel polyether having amino radicals at polymer ends |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2019432A DE2019432C3 (de) | 1970-04-22 | 1970-04-22 | Verfahren zur Herstellung von endständige Aminogruppen aufweisenden organischen Verbindungen und deren Verwendung zur Herstellung von Kunststoffen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2019432A1 DE2019432A1 (de) | 1971-11-11 |
| DE2019432B2 DE2019432B2 (de) | 1978-07-27 |
| DE2019432C3 true DE2019432C3 (de) | 1982-05-06 |
Family
ID=5768845
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2019432A Expired DE2019432C3 (de) | 1970-04-22 | 1970-04-22 | Verfahren zur Herstellung von endständige Aminogruppen aufweisenden organischen Verbindungen und deren Verwendung zur Herstellung von Kunststoffen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3808250A (enExample) |
| JP (2) | JPS5221040B1 (enExample) |
| BE (1) | BE766139A (enExample) |
| CA (1) | CA969554A (enExample) |
| DE (1) | DE2019432C3 (enExample) |
| FR (1) | FR2090581A5 (enExample) |
| GB (1) | GB1303787A (enExample) |
| NL (1) | NL7105297A (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4129741A (en) * | 1975-10-27 | 1978-12-12 | Lim-Holding, S.A. | Novel polyethers having terminal amino groups, a process for their production and their application |
| DE2619840A1 (de) * | 1976-05-05 | 1977-11-24 | Bayer Ag | Amino- und hydroxyl- bzw. mercaptogruppenhaltige polymere und ihre verwendung zur herstellung von polyurethankunststoffen |
| DE2702050A1 (de) * | 1977-01-19 | 1978-07-20 | Bayer Ag | Verfahren zur herstellung von amino- und hydroxyl- bzw. mercaptogruppenhaltigen polymeren |
| US4186257A (en) * | 1977-02-15 | 1980-01-29 | Bayer Aktiengesellschaft | Process for the preparation of new segmented polyurethane resins derived from block copolymers being linked together through ester and/or urethane and/or urea groups |
| US4247677A (en) * | 1979-04-13 | 1981-01-27 | Lim-Holding S.A. | Novel polyethers having terminal amino groups and plastic materials made therefrom |
| US4229561A (en) * | 1979-04-13 | 1980-10-21 | Lim-Holding, S.A. | Polyurea polymer prepared from polyethers having heterocyclic groups and terminal amino groups |
| EP0021569A1 (en) * | 1979-05-29 | 1981-01-07 | Interox Chemicals Limited | Amino-terminated polymers, process for their preparation and their use |
| US4328322A (en) * | 1979-12-03 | 1982-05-04 | Polaroid Corporation | Synthetic polymers by polyisocyanate polyaddition process |
| WO1982001709A1 (en) * | 1980-11-10 | 1982-05-27 | Corp Polaroid | Synthetic polymers by polyisocyanate polyaddition process |
| CA1221383A (en) * | 1981-08-07 | 1987-05-05 | Werner Rasshofer | Polyamines, a process for the production of polyamines and their use in the production of polyurethanes |
| DE3144874A1 (de) * | 1981-11-12 | 1983-05-19 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyaminen aus n-monoaryl-n', n'-dialkylharnstoff-verbindungen und ihre verwendung zum aufbau von polyurethanen |
| US4723032A (en) * | 1981-11-12 | 1988-02-02 | Bayer Aktiengesellschaft | Modified polyamines and a process for their production |
| US4396729A (en) * | 1982-04-23 | 1983-08-02 | Texaco Inc. | Reaction injection molded elastomer containing an internal mold release made by a two-stream system |
| DE3223397A1 (de) * | 1982-06-23 | 1983-12-29 | Bayer Ag, 5090 Leverkusen | Einstufenverfahren zur herstellung von polyaminen aus nco-prepolymeren, polyamine und deren verwendung zur herstellung von polyurethanen |
| DE3223400A1 (de) * | 1982-06-23 | 1983-12-29 | Bayer Ag, 5090 Leverkusen | Polyamine, verfahren zur herstellung von polyaminen und deren verwendung zur herstellung von polyurethanen |
| DE3223398A1 (de) * | 1982-06-23 | 1983-12-29 | Bayer Ag, 5090 Leverkusen | Polyamine, verfahren zur herstellung von polyaminen und deren verwendung zur herstellung von polyurethanen |
| DE3227219A1 (de) * | 1982-07-21 | 1984-02-02 | Bayer Ag, 5090 Leverkusen | Einstufenverfahren zur herstellung von polyaminen aus nco-praepolymeren, polyamine und deren verwendung zur herstellung von polyurethanen |
| DE3244913A1 (de) * | 1982-12-04 | 1984-06-07 | Bayer Ag, 5090 Leverkusen | Aminogruppen enthaltende reaktionskomponenten, verfahren zu ihrer herstellung und ihre verwendung |
| US4499254A (en) * | 1984-02-13 | 1985-02-12 | Texaco Inc. | Reaction injection molded elastomers containing high molecular weight organic acids |
| NL8500476A (nl) * | 1985-02-20 | 1986-09-16 | Akzo Nv | Thixotrope bekledingssamenstelling. |
| US4609683A (en) * | 1985-06-21 | 1986-09-02 | Texaco Inc. | Quasi-prepolymers from isatoic anhydride derivatives of polyoxyalkylene polyamines and rim products made therefrom |
| US4609684A (en) * | 1985-06-21 | 1986-09-02 | Texaco Inc. | Rim products made from isatoic anhydride derivatives of polyoxyalkylene polyamines |
| DE3530476A1 (de) * | 1985-08-27 | 1987-03-05 | Bayer Ag | Polyamine, verfahren zu ihrer herstellung aus nco-prepolymeren und ihre verwendung bei der herstellung von polyurethanen |
| DE3534947A1 (de) * | 1985-10-01 | 1987-04-09 | Bayer Ag | Verfahren zur herstellung von polyaminen, polyamine und deren verwendung zur herstellung von polyurethanen |
| US5283364A (en) * | 1985-10-18 | 1994-02-01 | Bayer Aktiengesellschaft | Hydrolysis process for polyamines |
| US4847416A (en) * | 1986-10-27 | 1989-07-11 | The Dow Chemical Company | Capping of polyols with aromatic amines |
| JP2577900B2 (ja) * | 1987-02-18 | 1997-02-05 | イハラケミカル工業 株式会社 | ポリ尿素樹脂の製造方法 |
| US5079275A (en) * | 1987-04-06 | 1992-01-07 | The Dow Chemical Company | Polyurea resins from poly(aminoaromatic) compounds |
| DE3713858A1 (de) * | 1987-04-25 | 1988-11-17 | Bayer Ag | Aromatische polyamine, ein verfahren zu ihrer herstellung und ihre verwendung zur herstellung von polyurethankunststoffen |
| US4898971A (en) * | 1989-01-23 | 1990-02-06 | Mobay Corporation | Liquid isocyanate prepolymers |
| US4914174A (en) * | 1989-01-23 | 1990-04-03 | Mobay Corporation | Liquid isocyanate prepolymers |
| US4885353A (en) * | 1988-11-16 | 1989-12-05 | Mobay Corporation | Liquid isocyanate prepolymers |
| US5068306A (en) * | 1990-10-30 | 1991-11-26 | The Dow Chemical Company | Process for the preparation of o-aminophenyl derivatives of aminated poly(alkylene glycols) and backbone-modified derivatives thereof |
| US5219973A (en) * | 1990-12-07 | 1993-06-15 | Miles Inc. | Polyurea rim systems |
| JP3220873B2 (ja) * | 1992-07-02 | 2001-10-22 | イハラケミカル工業株式会社 | ポリウレタンウレアエラストマー |
| US5510535A (en) * | 1994-11-22 | 1996-04-23 | Bayer Corporation | Ether-linked amine-terminated polyethers and a process for their production |
| US6020392A (en) * | 1998-09-04 | 2000-02-01 | Air Products And Chemicals, Inc. | Polyurea elastomeric microcellular foam |
| US6582771B1 (en) | 2002-05-03 | 2003-06-24 | Bayer Corporation | Method for producing a polyurethane/geofabric composite |
| DE102007046860A1 (de) * | 2007-09-28 | 2009-04-09 | Evonik Goldschmidt Gmbh | Aminkatalysatoren geeignet zur Herstellung emissionsarmer, rekatalysestabiler Polyurethanweichschaumstoffe |
| DE102009040058A1 (de) | 2009-03-06 | 2010-09-09 | Bayer Materialscience Ag | Verfahren zur Herstellung von Aminogruppen enthaltenden Polyoxyalkylenen |
| WO2013124830A1 (en) | 2012-02-24 | 2013-08-29 | Basf Se | Novel polymer dispersants |
| CN110360467A (zh) | 2013-04-19 | 2019-10-22 | 科思创有限公司 | 模内电子印刷电路板封装及组件 |
| EP4259685A1 (de) | 2020-12-10 | 2023-10-18 | Covestro Deutschland AG | Verfahren zur herstellung eines polyisocyanats, polyisocyanat, dessen verwendung und daraus hergestellte polyadditions¬produkte |
| CN112794975A (zh) * | 2021-01-14 | 2021-05-14 | 青岛爱尔家佳新材料股份有限公司 | 一种用于海洋无毒防污的有机硅改性聚脲及其制备方法 |
-
1970
- 1970-04-22 DE DE2019432A patent/DE2019432C3/de not_active Expired
-
1971
- 1971-04-16 US US00134841A patent/US3808250A/en not_active Expired - Lifetime
- 1971-04-19 CA CA110,768A patent/CA969554A/en not_active Expired
- 1971-04-20 NL NL7105297A patent/NL7105297A/xx not_active Application Discontinuation
- 1971-04-21 JP JP46025354A patent/JPS5221040B1/ja active Pending
- 1971-04-22 GB GB1072471*[A patent/GB1303787A/en not_active Expired
- 1971-04-22 BE BE766139A patent/BE766139A/xx not_active IP Right Cessation
- 1971-04-22 FR FR7114412A patent/FR2090581A5/fr not_active Expired
-
1976
- 1976-12-27 JP JP15662776A patent/JPS52125598A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52125598A (en) | 1977-10-21 |
| DE2019432B2 (de) | 1978-07-27 |
| GB1303787A (enExample) | 1973-01-17 |
| BE766139A (fr) | 1971-09-16 |
| US3808250A (en) | 1974-04-30 |
| FR2090581A5 (enExample) | 1972-01-14 |
| DE2019432A1 (de) | 1971-11-11 |
| JPS5221040B1 (enExample) | 1977-06-08 |
| JPS5416999B2 (enExample) | 1979-06-26 |
| NL7105297A (enExample) | 1971-10-26 |
| CA969554A (en) | 1975-06-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2019432C3 (de) | Verfahren zur Herstellung von endständige Aminogruppen aufweisenden organischen Verbindungen und deren Verwendung zur Herstellung von Kunststoffen | |
| DE2040644C3 (de) | Verfahren zur herstellung von polyurethankunststoffen | |
| DE2710901A1 (de) | Polyurethan mit integrer haut und verfahren zur herstellung desselben | |
| DE1125647B (de) | Verfahren zur Herstellung von gegebenenfalls verschaeumten Polyurethanen | |
| DE1025136B (de) | Verfahren zur Herstellung von elastomeren homogenen Formkoerpern oder Schaumkoerpern | |
| DE1085671B (de) | Verfahren zur Herstellung von kautschukartigen, aushaertbaren Polyurethanen | |
| DE2648825C2 (de) | Endständige Aminogruppen aufweisende Polyäther, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0097298B1 (de) | Polyamine, Verfahren zur Herstellung von Polyaminen und deren Verwendung zur Herstellung von Polyurethanen | |
| DE1287308B (de) | Verfahren zur Herstellung von Polyurethanschaumstoffen | |
| DE1932832A1 (de) | Neue Isocyanatverbindung einschliesslich eines neuen Amins und deren Verwendung zur Herstellung von Polyurethanen | |
| DE2912664A1 (de) | Polyoxypropylenpolyamin-derivat und dieses derivat enthaltende polyurethan-komposition | |
| DE1957394B2 (de) | Verfahren zur Herstellung von gegebenenfalls verschäumten Polyurethanen | |
| EP0000724B1 (de) | Hydroxylgruppen und Urethano-aryl-sulfonsäuregruppen enthaltende Verbindungen und Verfahren zu deren Herstellung; Verwendung dieser Verbindungen als Reaktionskomponente für Polyisocyanate | |
| EP0097299A2 (de) | Polyamine, Verfahren zur Herstellung von Polyaminen und deren Verwendung zur Herstellung von Polyurethanen | |
| DE1157773B (de) | Verfahren zur Herstellung von Kunststoffen, einschliesslich Schaumstoffen, nach dem Isocyanat-Polyadditionsverfahren | |
| DE69403824T2 (de) | Polyol-Zusammensetzungen und Polyisocynate sowie ihre Verwendung zur Herstellung von Polyurethanen | |
| DE2252107A1 (de) | Verfahren zum haerten von polyurethanen | |
| DE2431032C2 (de) | Polymere Acetale, die Urethan-, Carbamid- und Amidgruppen enthalten, und Verfahren zu ihrer Herstellung | |
| EP0013923B1 (de) | Suspensionen von Isocyanatoharnstoffen in Isocyanat-Präpolymeren, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung bei der Herstellung von hochmolekularen Polyurethankunststoffen | |
| DE1022788B (de) | Verfahren zur Herstellung hochmolekularer vernetzter Kunststoffe | |
| EP0148462B1 (de) | Verfahren zur in situ-Herstellung von Harnstoffgruppen-enthaltenden Diisocyanaten in Polyolen, dem Verfahren entsprechende Dispersionen oder Lösungen sowie ihre Verwendung | |
| DE1243865B (de) | Polyisocyanatmischungen zur Herstellung von Kunststoffen | |
| DE1068461B (enExample) | ||
| DE1803723C3 (de) | Gemische auf Basis aromatischer Polyisocyanate, Verfahren zu ihrer Herstellung und Verwendung zur Herstellung von Polyurethanschaumstoffen | |
| AT340690B (de) | Verfahren zur herstellung von neuen, endstandige aminogruppen aufweisenden polyathern und ihre verwendung als reaktionspartner bei der herstellung von kunststoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |