DE2004718A1 - Verfahren zur Herstellung von 4-Alkylprolinen sowie 4-Alkylpyrroline und 4-Alkylpyrollidine - Google Patents
Verfahren zur Herstellung von 4-Alkylprolinen sowie 4-Alkylpyrroline und 4-AlkylpyrollidineInfo
- Publication number
- DE2004718A1 DE2004718A1 DE19702004718 DE2004718A DE2004718A1 DE 2004718 A1 DE2004718 A1 DE 2004718A1 DE 19702004718 DE19702004718 DE 19702004718 DE 2004718 A DE2004718 A DE 2004718A DE 2004718 A1 DE2004718 A1 DE 2004718A1
- Authority
- DE
- Germany
- Prior art keywords
- pyrroline
- decarboxylated
- hydrolyzed
- alkylprolines
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 25
- 238000004519 manufacturing process Methods 0.000 title description 13
- 239000002253 acid Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 8
- 238000006114 decarboxylation reaction Methods 0.000 claims description 8
- 230000007062 hydrolysis Effects 0.000 claims description 8
- 238000006460 hydrolysis reaction Methods 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 5
- 230000018044 dehydration Effects 0.000 claims description 4
- 238000006297 dehydration reaction Methods 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- 239000003125 aqueous solvent Substances 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- XAEWZDYWZHIUCT-UHFFFAOYSA-N desipramine hydrochloride Chemical compound [H+].[Cl-].C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 XAEWZDYWZHIUCT-UHFFFAOYSA-N 0.000 claims description 2
- -1 Foiwyl Chemical group 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 5
- VHWDHLHXGXIGTL-MTFPJWTKSA-N (2S)-4-pentylpyrrolidine-2-carboxylic acid hydrochloride Chemical compound Cl.C(CCCC)C1C[C@H](NC1)C(=O)O VHWDHLHXGXIGTL-MTFPJWTKSA-N 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000003242 anti bacterial agent Substances 0.000 description 4
- 229940088710 antibiotic agent Drugs 0.000 description 4
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- ISOLMABRZPQKOV-UHFFFAOYSA-N diethyl 2-acetamidopropanedioate Chemical compound CCOC(=O)C(NC(C)=O)C(=O)OCC ISOLMABRZPQKOV-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000005245 sintering Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- JFTHBDBUVHRREF-UHFFFAOYSA-N 2-acetamidopropanedioic acid Chemical compound CC(=O)NC(C(O)=O)C(O)=O JFTHBDBUVHRREF-UHFFFAOYSA-N 0.000 description 1
- GMLDCZYTIPCVMO-UHFFFAOYSA-N 2-methylidenebutanal Chemical compound CCC(=C)C=O GMLDCZYTIPCVMO-UHFFFAOYSA-N 0.000 description 1
- JXBPQQPESPAUPO-UHFFFAOYSA-N 2-methylidenedecanal Chemical compound CCCCCCCCC(=C)C=O JXBPQQPESPAUPO-UHFFFAOYSA-N 0.000 description 1
- LDGVIXYITWDQFB-UHFFFAOYSA-N 2-methylideneheptanal Chemical compound CCCCCC(=C)C=O LDGVIXYITWDQFB-UHFFFAOYSA-N 0.000 description 1
- RTTWLTLNKLTUJR-UHFFFAOYSA-N 2-methylidenepentanal Chemical compound CCCC(=C)C=O RTTWLTLNKLTUJR-UHFFFAOYSA-N 0.000 description 1
- AZJKMGFKDLZPAR-UHFFFAOYSA-N 3-ethyl-1-hydroxypyrrolidine Chemical compound CCC1CCN(O)C1 AZJKMGFKDLZPAR-UHFFFAOYSA-N 0.000 description 1
- JHAIKOVGZVTZJC-UHFFFAOYSA-N 3-propylpyrrolidin-2-ol Chemical compound C(CC)C1CCNC1O JHAIKOVGZVTZJC-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 241001517310 Eria Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001397173 Kali <angiosperm> Species 0.000 description 1
- OJMMVQQUTAEWLP-UHFFFAOYSA-N Lincomycin Natural products CN1CC(CCC)CC1C(=O)NC(C(C)O)C1C(O)C(O)C(O)C(SC)O1 OJMMVQQUTAEWLP-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- MDPBXPGOCXZQGU-UHFFFAOYSA-N dibutyl 2-formamidopropanedioate Chemical compound C(=O)NC(C(=O)OCCCC)C(=O)OCCCC MDPBXPGOCXZQGU-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- FDEDTSWJULBKKT-UHFFFAOYSA-N diethyl 2-(propanoylamino)propanedioate Chemical compound CCOC(=O)C(NC(=O)CC)C(=O)OCC FDEDTSWJULBKKT-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002337 glycosamines Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- OJMMVQQUTAEWLP-KIDUDLJLSA-N lincomycin Chemical compound CN1C[C@H](CCC)C[C@H]1C(=O)N[C@H]([C@@H](C)O)[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](SC)O1 OJMMVQQUTAEWLP-KIDUDLJLSA-N 0.000 description 1
- 229960005287 lincomycin Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical group CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US79655869A | 1969-02-04 | 1969-02-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2004718A1 true DE2004718A1 (de) | 1970-08-06 |
Family
ID=25168478
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702004718 Pending DE2004718A1 (de) | 1969-02-04 | 1970-02-03 | Verfahren zur Herstellung von 4-Alkylprolinen sowie 4-Alkylpyrroline und 4-Alkylpyrollidine |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3636043A (enExample) |
| JP (1) | JPS4837269B1 (enExample) |
| BE (1) | BE745450A (enExample) |
| CH (1) | CH525881A (enExample) |
| DE (1) | DE2004718A1 (enExample) |
| FR (1) | FR2033914A5 (enExample) |
| GB (1) | GB1243593A (enExample) |
| NL (1) | NL7001252A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3993049A (en) * | 1974-12-26 | 1976-11-23 | Kater John A R | Electrodes and materials therefor |
| JPS5480483U (enExample) * | 1977-11-18 | 1979-06-07 | ||
| DE3137377C2 (de) * | 1981-09-19 | 1984-03-08 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von L-Prolin |
| US4625038A (en) * | 1984-11-19 | 1986-11-25 | E. R. Squibb & Sons, Inc. | (25-trans)-4-substituted-2-pyrrolidines-methanols |
| US4588819A (en) * | 1984-11-19 | 1986-05-13 | E. R. Squibb & Sons, Inc. | Process and intermediates for preparing trans-4-substituted-s-prolines |
| JPS61132274U (enExample) * | 1985-02-08 | 1986-08-18 | ||
| JPH0240084U (enExample) * | 1988-09-13 | 1990-03-19 | ||
| US20100057118A1 (en) * | 2008-09-03 | 2010-03-04 | Dietz Timothy G | Ultrasonic surgical blade |
-
1969
- 1969-02-04 US US796558A patent/US3636043A/en not_active Expired - Lifetime
- 1969-12-30 GB GB63295/69A patent/GB1243593A/en not_active Expired
-
1970
- 1970-01-21 JP JP45005156A patent/JPS4837269B1/ja active Pending
- 1970-01-29 CH CH126870A patent/CH525881A/de not_active IP Right Cessation
- 1970-01-29 NL NL7001252A patent/NL7001252A/xx unknown
- 1970-02-03 DE DE19702004718 patent/DE2004718A1/de active Pending
- 1970-02-03 FR FR7003801A patent/FR2033914A5/fr not_active Expired
- 1970-02-04 BE BE745450D patent/BE745450A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1243593A (en) | 1971-08-18 |
| NL7001252A (enExample) | 1970-08-06 |
| CH525881A (de) | 1972-07-31 |
| FR2033914A5 (enExample) | 1970-12-04 |
| JPS4837269B1 (enExample) | 1973-11-09 |
| US3636043A (en) | 1972-01-18 |
| BE745450A (fr) | 1970-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH633264A5 (de) | N-alkylpiperidin-derivate. | |
| EP0173199A1 (de) | cis, endo-2-Azabicycloalkan-3-carbonsäure-Derivate, Verfahren zu deren Herstellung, deren Verwendung sowie Zwischenprodukte bei deren Herstellung | |
| DE2411382A1 (de) | Neue 2-tetrahydrofurfuryl-6,7-benzomorphane, deren saeureadditionssalze, ihre verwendung als arzneimittel und verfahren zu deren herstellung | |
| DE1620694C3 (de) | Verfahren zur Herstellung von 5-Methyl-7-diäthylamino-s-triazolo [1,5-a] pyrimidin und seinen Salzen mit Säuren | |
| DE1445848A1 (de) | Verfahren zur Herstellung eines neuen Isoxazolderivates | |
| DE2004718A1 (de) | Verfahren zur Herstellung von 4-Alkylprolinen sowie 4-Alkylpyrroline und 4-Alkylpyrollidine | |
| DE69109682T2 (de) | Propylaminederivate. | |
| DE2631222C3 (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| DE1620704A1 (de) | Verfahren zur Herstellung von Indolizinverbindungen | |
| DE1941536A1 (de) | 1-Alkyl-2-aminomethylpyrrolidine sowie Verfahren zur Herstellung dieser Verbindungen und deren Zwischenprodukte | |
| DE1695140A1 (de) | Verfahren zur Herstellung von Phenanthridinderivaten | |
| EP0425929B1 (de) | Verfahren zur Herstellung von Zwischenprodukten und zur Synthese von N-(2-Hydroxyethyl)-2-hydroxymethyl-3,4,5-trihydroxypiperidine | |
| DE2508947A1 (de) | Verfahren zur herstellung von 4-oxo-hexahydro-pyrazinoisochinolinderivaten | |
| CH535236A (de) | Verfahren zur Herstellung neuer reaktionsträger Lysergsäurederivate | |
| DE3135840C1 (de) | 2-Azido-3-benzyloxy-propionsaeure-benzylester und Verfahren zu dessen Herstellung | |
| DE2058237C (enExample) | ||
| AT293362B (de) | Verfahren zur Herstellung von N-substituierten β-Aminopropiophenonen | |
| DE2924334C2 (enExample) | ||
| DE1620658C (de) | l-Phenyl-4-aminopyrazolderivate und Verfahren zu ihrer Herstellung | |
| DE2345972A1 (de) | Verfahren zur herstellung von 10-aminodihydrodibenzoazepinen | |
| DE2701280A1 (de) | 3-o-hydroxyphenyl-3-phenylpropionsaeure und verfahren zu ihrer herstellung | |
| DE2160674C3 (de) | Verfahren zur Herstellung von 4(5)-Aminoimidazol-5(4)-carboxamid aus 4(5)-Aminoimidazol-5(4)-carbonitril | |
| DE2049941C (de) | Verfahren zur Herstellung von 2 De carboxamido 2 lminotetracychnen, bzw ihren Saureadditionssalzen oder Metallsalzen | |
| AT356291B (de) | Verfahren zur herstellung von in die dihydrolysergsaeure- und dihydroiso- lysergsaeure-reihe gehoerenden verbindungen | |
| DE916055C (de) | Verfahren zur Herstellung von Aminoverbindungen |