DE2003250B - Selbstschließender Schirm - Google Patents
Selbstschließender SchirmInfo
- Publication number
- DE2003250B DE2003250B DE19702003250D DE2003250DA DE2003250B DE 2003250 B DE2003250 B DE 2003250B DE 19702003250 D DE19702003250 D DE 19702003250D DE 2003250D A DE2003250D A DE 2003250DA DE 2003250 B DE2003250 B DE 2003250B
- Authority
- DE
- Germany
- Prior art keywords
- umbrella
- spring
- handle
- tube
- slider
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000945 filler Substances 0.000 claims description 13
- 230000009471 action Effects 0.000 claims description 5
- 238000003860 storage Methods 0.000 claims description 5
- 230000000694 effects Effects 0.000 claims description 4
- 238000004146 energy storage Methods 0.000 description 11
- 230000008901 benefit Effects 0.000 description 6
- 230000006835 compression Effects 0.000 description 4
- 238000007906 compression Methods 0.000 description 4
- 230000002349 favourable effect Effects 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 2
- 238000004904 shortening Methods 0.000 description 2
- 238000005452 bending Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45B—WALKING STICKS; UMBRELLAS; LADIES' OR LIKE FANS
- A45B25/00—Details of umbrellas
- A45B25/006—Automatic closing devices
Landscapes
- Walking Sticks, Umbrellas, And Fans (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2003250 | 1970-01-24 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2003250B true DE2003250B (de) | 1971-09-30 |
| DE2003250C2 DE2003250C2 (en:Method) | 1973-10-11 |
Family
ID=5760469
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702003250D Granted DE2003250B (de) | 1970-01-24 | 1970-01-24 | Selbstschließender Schirm |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3729012A (en:Method) |
| CA (1) | CA940002A (en:Method) |
| DE (1) | DE2003250B (en:Method) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4045926A (en) * | 1974-08-26 | 1977-09-06 | Gibbs Louis L | Easily erected roof structure for modular buildings |
| US5309933A (en) * | 1992-03-30 | 1994-05-10 | Hisao Nagai | One-hand openable and closable umbrella |
| US5232004A (en) * | 1992-09-21 | 1993-08-03 | Wu Woh Wen | Automatic umbrella having wind-resistant buffer effect |
| US5318067A (en) * | 1993-08-11 | 1994-06-07 | Day Sheng Tong | Simplified fully automatic umbrella |
| US5626161A (en) * | 1996-04-29 | 1997-05-06 | Fu Tai Umbrella Works, Ltd. | Multiple-fold automatic umbrella with simplified reliable control means |
| EP1136053B1 (en) * | 2000-03-20 | 2004-12-01 | Yuji Sumida | Extendable stick |
| USD744742S1 (en) * | 2013-11-05 | 2015-12-08 | Ching-Chuan You | Umbrella stick |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2221288A (en) * | 1940-04-10 | 1940-11-12 | American Folding Umbrella Corp | Folding umbrella |
| BE447472A (en:Method) * | 1941-08-25 | |||
| US2816560A (en) * | 1956-05-23 | 1957-12-17 | Wuster Heinrich | Self-closing umbrella frame |
| DE1109328B (de) * | 1956-07-11 | 1961-06-22 | Bremshey & Co | Selbsttaetig sich schliessender Schirm |
| US2917060A (en) * | 1958-02-17 | 1959-12-15 | Finkel Umbrella Frame Company | One-hand opening and closing umbrellas |
-
1970
- 1970-01-24 DE DE19702003250D patent/DE2003250B/de active Granted
-
1971
- 1971-01-25 CA CA103,617A patent/CA940002A/en not_active Expired
- 1971-01-25 US US00109307A patent/US3729012A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3729012A (en) | 1973-04-24 |
| DE2003250C2 (en:Method) | 1973-10-11 |
| CA940002A (en) | 1974-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2727490B1 (de) | Mehrfach gefalteter schirm mit vollautomatischer öffnung und schliessung | |
| DE20306698U1 (de) | Schlagstock | |
| DE2031492A1 (de) | Zusammenklappbarer Schirm | |
| DD249406A5 (de) | Verkuerzbarer schirm mit einem teleskopierbaren stock | |
| DE2259875C3 (de) | Verkürzbarer Schirm | |
| DE2149932C3 (de) | Selbstöffnender Schirm | |
| DE2003250B (de) | Selbstschließender Schirm | |
| DE1248246B (de) | Verkuerzbarer Schirm | |
| DE2114595B2 (de) | Selbsttaetig sich oeffnender und schliessender schirm | |
| DE2615731C3 (de) | Verkürzbarer Schirm | |
| DE1962209B2 (de) | Selbstöffnender Schirm | |
| DE879457C (de) | Verkuerzbarer Schirm | |
| DE202018100035U1 (de) | In Richtung weg vom Körper automatisch schließbarer, jedoch mit der Hand geöffneten Taschenschirm | |
| DE1678266C3 (de) | Skistock | |
| AT522832A1 (de) | Schirmständer mit einem stiel zur verankerung im boden | |
| DE2502520C3 (de) | Stativ | |
| AT253715B (de) | Verkürzbarer Schirm | |
| DE861908C (de) | Verkuerzbarer Schirm mit Betaetigungsfeder | |
| DE852744C (de) | Verkuerzbarer Schirm | |
| DE2038667C (de) | Selbsttätig sich öffnender und schließender Schirm | |
| DE2154263C3 (de) | Schirm | |
| DE539894C (de) | Schirmschieberverriegelung | |
| DE1741285U (de) | Schirmgestell mit beim aufspannen ineinanderschiebbaren stockteilen. | |
| DE1160576B (de) | Selbstoeffnender Schirm | |
| DE2036356C (de) | Verkürzbarer, sich selbsttätig öffnender Schirm |