DE1964995A1 - N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums - Google Patents
N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des PflanzenwachstumsInfo
- Publication number
- DE1964995A1 DE1964995A1 DE19691964995 DE1964995A DE1964995A1 DE 1964995 A1 DE1964995 A1 DE 1964995A1 DE 19691964995 DE19691964995 DE 19691964995 DE 1964995 A DE1964995 A DE 1964995A DE 1964995 A1 DE1964995 A1 DE 1964995A1
- Authority
- DE
- Germany
- Prior art keywords
- benzyltriazoles
- stands
- growth
- plant growth
- influencing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000002360 preparation method Methods 0.000 title claims description 14
- VRDSRXVCRBMZOD-UHFFFAOYSA-N 1-benzyltriazole Chemical class C1=CN=NN1CC1=CC=CC=C1 VRDSRXVCRBMZOD-UHFFFAOYSA-N 0.000 title claims description 10
- 230000008635 plant growth Effects 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 7
- 230000001105 regulatory effect Effects 0.000 title claims description 4
- 241000196324 Embryophyta Species 0.000 claims description 29
- -1 cycloalkyl radical Chemical class 0.000 claims description 22
- 230000012010 growth Effects 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 8
- 150000003852 triazoles Chemical class 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 235000013399 edible fruits Nutrition 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 239000004606 Fillers/Extenders Substances 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 125000001425 triazolyl group Chemical group 0.000 claims description 3
- KUFNEMCYFOJAGR-UHFFFAOYSA-N 4-benzyl-2h-triazole Chemical class C=1C=CC=CC=1CC1=CNN=N1 KUFNEMCYFOJAGR-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 230000002401 inhibitory effect Effects 0.000 claims 1
- 239000003495 polar organic solvent Substances 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 description 46
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 230000005764 inhibitory process Effects 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 239000003995 emulsifying agent Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 10
- 230000009036 growth inhibition Effects 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229920000151 polyglycol Polymers 0.000 description 6
- 239000010695 polyglycol Substances 0.000 description 6
- NOQGZXFMHARMLW-UHFFFAOYSA-N Daminozide Chemical compound CN(C)NC(=O)CCC(O)=O NOQGZXFMHARMLW-UHFFFAOYSA-N 0.000 description 5
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000008055 phosphate buffer solution Substances 0.000 description 5
- 241000227653 Lycopersicon Species 0.000 description 4
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 4
- BUCIWTBCUUHRHZ-UHFFFAOYSA-K potassium;disodium;dihydrogen phosphate;hydrogen phosphate Chemical compound [Na+].[Na+].[K+].OP(O)([O-])=O.OP([O-])([O-])=O BUCIWTBCUUHRHZ-UHFFFAOYSA-K 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 206010053759 Growth retardation Diseases 0.000 description 3
- BGRDGMRNKXEXQD-UHFFFAOYSA-N Maleic hydrazide Chemical compound OC1=CC=C(O)N=N1 BGRDGMRNKXEXQD-UHFFFAOYSA-N 0.000 description 3
- 244000141359 Malus pumila Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 235000004426 flaxseed Nutrition 0.000 description 3
- 230000004883 flower formation Effects 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 231100000001 growth retardation Toxicity 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 238000003306 harvesting Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- MJYQFWSXKFLTAY-OVEQLNGDSA-N (2r,3r)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]butane-1,4-diol;(2r,3r,4s,5s,6r)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O.C1=C(O)C(OC)=CC(C[C@@H](CO)[C@H](CO)CC=2C=C(OC)C(O)=CC=2)=C1 MJYQFWSXKFLTAY-OVEQLNGDSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000005983 Maleic hydrazide Substances 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000003630 growth substance Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 230000017066 negative regulation of growth Effects 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000005648 plant growth regulator Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- STNWQIGXQZPMDA-UHFFFAOYSA-N (3-methyl-1,2-oxazol-5-yl)-diphenylmethanol Chemical compound O1N=C(C)C=C1C(O)(C=1C=CC=CC=1)C1=CC=CC=C1 STNWQIGXQZPMDA-UHFFFAOYSA-N 0.000 description 1
- NLEAFPHEWZOFQV-UHFFFAOYSA-N 3-[chloro-(4-chlorophenyl)-phenylmethyl]-5-methyl-1,2-oxazole Chemical compound O1C(C)=CC(C(Cl)(C=2C=CC=CC=2)C=2C=CC(Cl)=CC=2)=N1 NLEAFPHEWZOFQV-UHFFFAOYSA-N 0.000 description 1
- UEMBXEGZDCTJKV-UHFFFAOYSA-N 3-[chloro-(4-methylsulfanylphenyl)-phenylmethyl]-5-methyl-1,2-oxazole Chemical compound C1=CC(SC)=CC=C1C(Cl)(C=1C=CC=CC=1)C1=NOC(C)=C1 UEMBXEGZDCTJKV-UHFFFAOYSA-N 0.000 description 1
- CUMCMYMKECWGHO-UHFFFAOYSA-N 3-methyl-1,2-oxazole Chemical compound CC=1C=CON=1 CUMCMYMKECWGHO-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- CCFGUMUFFGKLRD-UHFFFAOYSA-N 5-[diphenyl(1,2,4-triazol-1-yl)methyl]-3-methyl-1,2-oxazole Chemical compound O1N=C(C)C=C1C(N1N=CN=C1)(C=1C=CC=CC=1)C1=CC=CC=C1 CCFGUMUFFGKLRD-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 244000308368 Brassica oleracea var. gemmifera Species 0.000 description 1
- 235000007575 Calluna vulgaris Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 206010013883 Dwarfism Diseases 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 244000297179 Syringa vulgaris Species 0.000 description 1
- 235000004338 Syringa vulgaris Nutrition 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229960001040 ammonium chloride Drugs 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002969 artificial stone Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- JUZXDNPBRPUIOR-UHFFFAOYSA-N chlormequat Chemical compound C[N+](C)(C)CCCl JUZXDNPBRPUIOR-UHFFFAOYSA-N 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- 230000005059 dormancy Effects 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 238000004049 embossing Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000005094 fruit set Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 230000002015 leaf growth Effects 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 230000002786 root growth Effects 0.000 description 1
- 230000007226 seed germination Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 230000005068 transpiration Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (16)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691964995 DE1964995A1 (de) | 1969-12-24 | 1969-12-24 | N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums |
| IL35792A IL35792A (en) | 1969-12-24 | 1970-12-04 | N-benzyl-1,2,4-triazoles,their production and their use for the regulation of plant growth |
| ZA708275A ZA708275B (en) | 1969-12-24 | 1970-12-08 | N-benzyltriazoles,a process for their production and their use for the regulation of plant growth |
| GB5823170A GB1304558A (enExample) | 1969-12-24 | 1970-12-08 | |
| US00096574A US3801590A (en) | 1969-12-24 | 1970-12-09 | N-benzyltriazole compounds and plant growth regulant compositions |
| CA101,125A CA949561A (en) | 1969-12-24 | 1970-12-21 | N-benzyltriazoles, a process for their production and their use for the regulation of plant growth |
| NL7018593A NL7018593A (enExample) | 1969-12-24 | 1970-12-21 | |
| BG016379A BG17933A3 (bg) | 1969-12-24 | 1970-12-22 | Средство за регулиране растежа на растенията |
| AU23718/70A AU2371870A (en) | 1969-12-24 | 1970-12-23 | N-benzyltiazoles, a process for their production and their use forthe regulation of plant growth |
| AT1157270A AT302715B (de) | 1969-12-24 | 1970-12-23 | Pflanzenwachstumsregulierendes Mittel |
| HUBA002516 HU162198B (enExample) | 1969-12-24 | 1970-12-24 | |
| FR7046667A FR2074281A5 (enExample) | 1969-12-24 | 1970-12-24 | |
| JP11688070A JPS4828660B1 (enExample) | 1969-12-24 | 1970-12-24 | |
| RO6541670A RO56484A (enExample) | 1969-12-24 | 1970-12-24 | |
| BE760824A BE760824A (fr) | 1969-12-24 | 1970-12-24 | Nouveaux benzyltriazoles, leur procede de preparation et leur application a la regulation de la croissance des plantes |
| US05/405,969 US3941800A (en) | 1969-12-24 | 1973-10-12 | N-benzyltriazole compounds |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691964995 DE1964995A1 (de) | 1969-12-24 | 1969-12-24 | N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums |
| US9657470A | 1970-12-09 | 1970-12-09 | |
| US05/405,969 US3941800A (en) | 1969-12-24 | 1973-10-12 | N-benzyltriazole compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1964995A1 true DE1964995A1 (de) | 1971-07-01 |
Family
ID=27182309
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691964995 Pending DE1964995A1 (de) | 1969-12-24 | 1969-12-24 | N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US3801590A (enExample) |
| AT (1) | AT302715B (enExample) |
| BE (1) | BE760824A (enExample) |
| CA (1) | CA949561A (enExample) |
| DE (1) | DE1964995A1 (enExample) |
| FR (1) | FR2074281A5 (enExample) |
| GB (1) | GB1304558A (enExample) |
| NL (1) | NL7018593A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0166556A1 (en) * | 1984-06-18 | 1986-01-02 | Eli Lilly And Company | Diaryldiazolylmethanes |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2461406C2 (de) * | 1974-12-24 | 1984-06-14 | Bayer Ag, 5090 Leverkusen | Azolyl-(1)-methane und deren Salze, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel |
| DE2845254A1 (de) * | 1978-10-18 | 1980-05-08 | Basf Ag | Gamma -azolylverbindungen |
| ZA846525B (en) * | 1983-08-29 | 1985-04-24 | Sterling Drug Inc | (substituted)phenyl-aliphatic-isoxazoles useful as antiviral agents and preparation thereof |
| DE3413173A1 (de) * | 1984-04-07 | 1985-10-17 | Bayer Ag, 5090 Leverkusen | (1,2,4-triazol-1-yl)-methyl-carbinole |
| US4735960A (en) * | 1984-06-18 | 1988-04-05 | Eli Lilly And Company | Aromatase inhibitors |
| EP0194064A3 (en) * | 1985-03-06 | 1988-11-17 | Imperial Chemical Industries Plc | Azolyl substituted aralkyl compounds |
| US4914207A (en) * | 1989-05-09 | 1990-04-03 | Pfizer Inc. | Arylthiazolylimidazoles |
| GB9017539D0 (en) * | 1990-08-10 | 1990-09-26 | Rhone Poulenc Agriculture | New compositions of matter |
| US5747424A (en) * | 1989-09-11 | 1998-05-05 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazol |
| US5650533A (en) * | 1989-09-11 | 1997-07-22 | Rhone-Poulenc Agriculture Ltd. | Intermediates to herbicidal 4-substituted isoxazoles |
| US5656573A (en) * | 1989-09-11 | 1997-08-12 | Rhone-Poulenc Agriculture Ltd. | Herbicidal 4-substituted isoxazoles |
| US8093279B2 (en) * | 2005-12-13 | 2012-01-10 | Gillian Reed, legal representative | Compound |
| GB0525323D0 (en) * | 2005-12-13 | 2006-01-18 | Sterix Ltd | Compound |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH488713A (de) * | 1968-08-28 | 1970-04-15 | Bayer Ag | Verfahren zur Herstellung von 1-Trityl-1,2,4-triazolen |
| BR6915465D0 (pt) * | 1969-03-07 | 1973-01-04 | Bayer Ag | Processo para preparar n-benzimidazois substituidos na posicao alfa por heterociclos penta-membrados com atividade antimicotica |
| BE756662A (fr) * | 1969-09-27 | 1971-03-25 | Bayer Ag | Bistriazolyl-bisphenyl-methanes et leurs sels, leur procede de preparation et leur application comme regulateurs de croissance |
| DE2037610A1 (de) * | 1970-07-29 | 1972-02-03 | Bayer Ag | Neue alpha-substituierte Benzyl-azole, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| US3870726A (en) * | 1970-09-09 | 1975-03-11 | Bayer Ag | Derivatives of 3-azolylpropyne and processes for their preparation and use |
-
1969
- 1969-12-24 DE DE19691964995 patent/DE1964995A1/de active Pending
-
1970
- 1970-12-08 GB GB5823170A patent/GB1304558A/en not_active Expired
- 1970-12-09 US US00096574A patent/US3801590A/en not_active Expired - Lifetime
- 1970-12-21 CA CA101,125A patent/CA949561A/en not_active Expired
- 1970-12-21 NL NL7018593A patent/NL7018593A/xx unknown
- 1970-12-23 AT AT1157270A patent/AT302715B/de not_active IP Right Cessation
- 1970-12-24 BE BE760824A patent/BE760824A/xx unknown
- 1970-12-24 FR FR7046667A patent/FR2074281A5/fr not_active Expired
-
1973
- 1973-10-12 US US05/405,969 patent/US3941800A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0166556A1 (en) * | 1984-06-18 | 1986-01-02 | Eli Lilly And Company | Diaryldiazolylmethanes |
Also Published As
| Publication number | Publication date |
|---|---|
| US3941800A (en) | 1976-03-02 |
| BE760824A (fr) | 1971-06-24 |
| CA949561A (en) | 1974-06-18 |
| NL7018593A (enExample) | 1971-06-28 |
| AT302715B (de) | 1972-10-25 |
| GB1304558A (enExample) | 1973-01-24 |
| US3801590A (en) | 1974-04-02 |
| FR2074281A5 (enExample) | 1971-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0085333B1 (de) | Ether-Derivate von substituierten 1-Hydroxyalkyl-azolen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide und Pflanzenwachstumsregulatoren | |
| DE1964995A1 (de) | N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums | |
| EP0334809B1 (de) | Mittel zum Schutz von Pflanzen gegen Krankheiten | |
| DE1949013A1 (de) | Mittel zur Regulierung des Pflanzenwachstums | |
| DE3413996A1 (de) | Tetrahydrofuran-2-ylmethylamine | |
| EP0004917A1 (de) | Oximino-triazolyl-äthane, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| CH631710A5 (de) | Verfahren zur herstellung von neuen azolyl-carbonsaeure-derivaten. | |
| DE1949012A1 (de) | Bistriazolyl-bisphenyl-methane und deren Salze,Verfahren zu ihrer Herstellung und ihre Verwendung als Wachstumsregulatoren | |
| DE2600655A1 (de) | Verfahren zur regulierung des pflanzenwachstums und dabei verwendbare zusammensetzungen | |
| DE2950401A1 (de) | Phenoxybenzoesaeure-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide und pflanzenwuchsregulatoren | |
| EP0131845A2 (de) | Verwendung von substituierten Diazolyl-alkyl-carbinolen zur Bekämpfung von Pilzen im Pflanzenschutz | |
| EP0010287B1 (de) | Gamma-Azolylverbindungen, wachstumsregulierende Mittel, Verfahren zur Herstellung dieser und Verfahren zur Regulierung des Pflanzenwachstums | |
| DE3018075A1 (de) | Mittel zur regulierung des pflanzenwachstums, deren herstellung und deren verwendung | |
| DE1964996C3 (de) | 9-Azolyl-fluoren-9-carbonsäure-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Mittel zur Regulierung des Pflanzenwachstums | |
| DD156891A5 (de) | Fungizides mittel mit einem gehalt an triazolylphernacyl-pyridyl-ether-derivaten | |
| DE3830240A1 (de) | Substituierte 1-aryl-1-(thiazol-2-yl)-2-(1,2,4-triazol-1-yl)- und -(imidazol-1-yl)-ethanole, verfahren sowie substituierte 1-aryl-1-(thiazol-2-yl)-2-bromethanole als zwischenprodukte zu ihrer herstellung, und sie enthaltende fungizide und pflanzenwuchsregulierende mittel | |
| DE2842801A1 (de) | Beta-triazolyloxime | |
| DE2624529A1 (de) | Aminomethylazol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und zur regulierung des pflanzenwachstums | |
| DE3334220A1 (de) | 1-azolyl-substituierte oximether | |
| EP0005754A1 (de) | Mittel und Verfahren zur Regulierung des Pflanzenwachstums | |
| DE1935292A1 (de) | Mittel zur Beeinflussung des Pflanzenwachstums | |
| EP0021076B1 (de) | Verfahren zur Regulierung des Pflanzenwachstums | |
| DE3307216A1 (de) | Fungizide mittel | |
| DE2448060A1 (de) | Mittel zur regulierung des pflanzenwachstums | |
| DE2601376A1 (de) | Phenoxycarbonsaeure-aryloxy(thio)carbonylaminomethylester, verfahren zu ihrer herstellung sowie ihre verwendung zur regulierung des pflanzenwachstums |