DE1963188A1 - Neue Cyanphenyl-1,4-dihydropyridinderivate - Google Patents
Neue Cyanphenyl-1,4-dihydropyridinderivateInfo
- Publication number
- DE1963188A1 DE1963188A1 DE19691963188 DE1963188A DE1963188A1 DE 1963188 A1 DE1963188 A1 DE 1963188A1 DE 19691963188 DE19691963188 DE 19691963188 DE 1963188 A DE1963188 A DE 1963188A DE 1963188 A1 DE1963188 A1 DE 1963188A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- group
- substituted
- atoms
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- YJEMRKNORLUSHO-UHFFFAOYSA-N 1-phenyl-4h-pyridine-2-carbonitrile Chemical class N#CC1=CCC=CN1C1=CC=CC=C1 YJEMRKNORLUSHO-UHFFFAOYSA-N 0.000 title description 2
- -1 cyclic alkyl radical Chemical class 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 230000000694 effects Effects 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002560 nitrile group Chemical group 0.000 claims description 4
- 229920006395 saturated elastomer Chemical group 0.000 claims description 4
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- KRTGJZMJJVEKRX-UHFFFAOYSA-N 2-phenylethan-1-yl Chemical compound [CH2]CC1=CC=CC=C1 KRTGJZMJJVEKRX-UHFFFAOYSA-N 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 3
- 238000000034 method Methods 0.000 claims 3
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 230000008018 melting Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 3
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 3
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DIVNUTGTTIRPQA-UHFFFAOYSA-N (3,4-dimethoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1OC DIVNUTGTTIRPQA-UHFFFAOYSA-N 0.000 description 1
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 description 1
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 1
- YNXDZOKTZHHBLM-UHFFFAOYSA-N 2-chloro-5-formylbenzonitrile Chemical compound ClC1=CC=C(C=O)C=C1C#N YNXDZOKTZHHBLM-UHFFFAOYSA-N 0.000 description 1
- QVTPWONEVZJCCS-UHFFFAOYSA-N 2-formylbenzonitrile Chemical compound O=CC1=CC=CC=C1C#N QVTPWONEVZJCCS-UHFFFAOYSA-N 0.000 description 1
- PRRBQHNMYJRHFW-UHFFFAOYSA-M 3-oxoheptanoate Chemical compound CCCCC(=O)CC([O-])=O PRRBQHNMYJRHFW-UHFFFAOYSA-M 0.000 description 1
- KNKVNTDAQHBEAW-UHFFFAOYSA-N 4-formyl-3-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(C#N)=CC=C1C=O KNKVNTDAQHBEAW-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- REIYHFWZISXFKU-UHFFFAOYSA-N Butyl acetoacetate Chemical compound CCCCOC(=O)CC(C)=O REIYHFWZISXFKU-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- GKESTCSMPAVCFO-UHFFFAOYSA-N NC.ClO Chemical compound NC.ClO GKESTCSMPAVCFO-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000003440 anti-fibrillation Effects 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- GBCGEXQYERFWNO-UHFFFAOYSA-N butyl 3-oxopropanoate Chemical compound CCCCOC(=O)CC=O GBCGEXQYERFWNO-UHFFFAOYSA-N 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- GJOSRMAVDXJBCZ-UHFFFAOYSA-N cyclohexyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCCC1 GJOSRMAVDXJBCZ-UHFFFAOYSA-N 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- KQWWVLVLVYYYDT-UHFFFAOYSA-N ethyl 3-oxohexanoate Chemical compound CCCC(=O)CC(=O)OCC KQWWVLVLVYYYDT-UHFFFAOYSA-N 0.000 description 1
- SYFFHRPDTQNMQB-UHFFFAOYSA-N ethyl 3-oxopropanoate Chemical compound CCOC(=O)CC=O SYFFHRPDTQNMQB-UHFFFAOYSA-N 0.000 description 1
- XCLDSQRVMMXWMS-UHFFFAOYSA-N ethyl 4-methyl-3-oxopentanoate Chemical compound CCOC(=O)CC(=O)C(C)C XCLDSQRVMMXWMS-UHFFFAOYSA-N 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- GDOYYMOEBDFFIQ-UHFFFAOYSA-N oxolan-2-ylmethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1CCCO1 GDOYYMOEBDFFIQ-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- AXLMPTNTPOWPLT-UHFFFAOYSA-N prop-2-enyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC=C AXLMPTNTPOWPLT-UHFFFAOYSA-N 0.000 description 1
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical compound NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 1
- 125000003186 propargylic group Chemical group 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
Priority Applications (20)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691963188 DE1963188A1 (de) | 1969-12-17 | 1969-12-17 | Neue Cyanphenyl-1,4-dihydropyridinderivate |
| IE1477/70A IE34742B1 (en) | 1969-12-17 | 1970-11-17 | Cyano-phenyl-1,4-dihydropyridine derivatives |
| IL7035678A IL35678A (en) | 1969-12-17 | 1970-11-17 | Cyanophenyl-1,4-dihydropyridine derivatives and pharmaceutical compositions containing them |
| CH1711070A CH559178A5 (enExample) | 1969-12-17 | 1970-11-19 | |
| ZA707820A ZA707820B (en) | 1969-12-17 | 1970-11-19 | New cyanophenyl-1,4-dihydropyridine derivatives |
| FI703213A FI52339C (fi) | 1969-12-17 | 1970-11-30 | Menetelmä terapeuttisesti aktiivisten 1,4-dihydropyridiinijohdannaiste n valmistamiseksi. |
| DK619770AA DK127113B (da) | 1969-12-17 | 1970-12-04 | Analogifremgangsmåde til fremstilling af 1,4-dihydropyridiner. |
| NO4730/70A NO132590C (enExample) | 1969-12-17 | 1970-12-09 | |
| NLAANVRAGE7018070,A NL171052C (nl) | 1969-12-17 | 1970-12-10 | Werkwijze ter bereiding van een farmaceutisch preparaat met een hartontlastende, anti-fladderende, vaat-spasmolytische en antihypertensieve werking alsmede werkwijze ter bereiding van een 4-fenyl-2,6-dialkyl-1,4-dihydropyridine -3,5-dicarbonzuurderivaat. |
| US97338A US3691177A (en) | 1969-12-17 | 1970-12-11 | Cyanophenyl-1,4-dihydropyridine derivatives |
| AT1121570A AT301545B (de) | 1969-12-17 | 1970-12-14 | Verfahren zur Herstellung von neuen 1,4-Dihydropyridinen |
| CA100519A CA928713A (en) | 1969-12-17 | 1970-12-14 | Cyanophenyl-1,4-dihydropyridine derivatives |
| JP45111391A JPS4811102B1 (enExample) | 1969-12-17 | 1970-12-15 | |
| SE17079/70A SE364709B (enExample) | 1969-12-17 | 1970-12-16 | |
| GB6000470A GB1305794A (enExample) | 1969-12-17 | 1970-12-17 | |
| BE760483A BE760483A (fr) | 1969-12-17 | 1970-12-17 | Nouveaux derives de cyanophenyl-1,4-dyhydropyridine |
| FR7045676A FR2081373B1 (enExample) | 1969-12-17 | 1970-12-17 | |
| CS855270A CS157115B2 (enExample) | 1969-12-17 | 1970-12-17 | |
| ES386565A ES386565A1 (es) | 1969-12-17 | 1970-12-17 | Procedimiento para la obtencion de cianfenil-1,4-dihidropi-rinas. |
| US00169825A US3764683A (en) | 1969-12-17 | 1971-08-06 | Composition and method for effecting coronary dilation using cyanophenyl-1,4-dihydropyridine derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691963188 DE1963188A1 (de) | 1969-12-17 | 1969-12-17 | Neue Cyanphenyl-1,4-dihydropyridinderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1963188A1 true DE1963188A1 (de) | 1971-06-24 |
Family
ID=5754097
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691963188 Ceased DE1963188A1 (de) | 1969-12-17 | 1969-12-17 | Neue Cyanphenyl-1,4-dihydropyridinderivate |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US3691177A (enExample) |
| JP (1) | JPS4811102B1 (enExample) |
| AT (1) | AT301545B (enExample) |
| BE (1) | BE760483A (enExample) |
| CA (1) | CA928713A (enExample) |
| CH (1) | CH559178A5 (enExample) |
| CS (1) | CS157115B2 (enExample) |
| DE (1) | DE1963188A1 (enExample) |
| DK (1) | DK127113B (enExample) |
| ES (1) | ES386565A1 (enExample) |
| FI (1) | FI52339C (enExample) |
| FR (1) | FR2081373B1 (enExample) |
| GB (1) | GB1305794A (enExample) |
| IE (1) | IE34742B1 (enExample) |
| IL (1) | IL35678A (enExample) |
| NL (1) | NL171052C (enExample) |
| NO (1) | NO132590C (enExample) |
| SE (1) | SE364709B (enExample) |
| ZA (1) | ZA707820B (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2302866A1 (de) * | 1972-01-22 | 1973-08-02 | Yamanouchi Pharma Co Ltd | Neue 1-substituierte-1,4-dihydropyridinderivate |
| DE2756226A1 (de) * | 1976-12-17 | 1978-06-29 | Fujisawa Pharmaceutical Co | 1,4-dihydropyridin-verbindungen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel |
| US4338322A (en) * | 1975-07-02 | 1982-07-06 | Fujisawa Pharmaceutical Co., Ltd. | 1,4-Dihydropyridine derivatives, pharmaceutical compositions containing same and methods of effecting vasodilation using same |
| EP0330470A3 (en) * | 1988-02-24 | 1992-01-02 | Ajinomoto Co., Inc. | 1,4-dihydropyridine derivatives useful against tumour cells |
| EP0451654A3 (en) * | 1990-04-11 | 1992-07-08 | Bayer Ag | Use of n-alkylated 1,4-dihydropyridine carboxylic acid esters as drugs, new compounds and process for their preparation |
| US5216172A (en) * | 1988-02-24 | 1993-06-01 | Ajinomoto Co., Inc. | 1,4-dihydropyridine-4-aryl-2,6-dimethyl-3,5-dicarboxylates useful as agents against drug resistant tumor cells |
| US5328931A (en) * | 1991-07-31 | 1994-07-12 | Bayer Aktiengesellschaft | N-alkylated 1,4-dihydropyridinedicarboxylic acid esters |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2005116C3 (de) * | 1970-02-05 | 1980-02-14 | Bayer Ag, 5090 Leverkusen | Symmetrische 1,4-Dihydropyridin-3,5-dicarbonsäureester |
| DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| US3996234A (en) * | 1972-04-18 | 1976-12-07 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters |
| DE3339236A1 (de) * | 1983-10-28 | 1985-05-09 | Bayer Ag | Arzneimittelzubereitung |
| DE4342196A1 (de) * | 1993-12-10 | 1995-06-14 | Bayer Ag | Neue 4-Phenyl-substituierte 1,4-Dihydropyridine |
| US4652573A (en) * | 1985-03-14 | 1987-03-24 | Nelson Research & Development Co. | Calcium antagonist N-hetero ester 1,4-dihydropyridines |
| US4849436A (en) * | 1986-03-11 | 1989-07-18 | Nelson Research & Development Co. | 1,4-dihydropyridines |
| DK0657432T3 (da) * | 1993-12-10 | 2003-07-07 | Bayer Ag | Phenylsubstituerede 1,4-dihydropyridiner med cerebral aktivitet |
| EE03192B1 (et) * | 1993-12-10 | 1999-06-15 | Bayer Aktiengesellschaft | Isopropüül-(2-metoksüetüül)-4-(2-kloro-3-tsüanofenüül)-1,4-dihüdro-2,6-dimetüülpüri diin-3,5-dikarboksülaat, selle enantiomeerid ja vaheühend, meetodid nimetatud ühendite valmistamiseks ja kasutamine |
| SMT202300205T1 (it) | 2014-07-03 | 2023-09-06 | Celgene Quanticel Research Inc | Inibitori della demetilasi lisina-specifica-1 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3325505A (en) * | 1965-02-24 | 1967-06-13 | Smith Kline French Lab | 4-cycloalkyl(or cycloalkenyl)-dihydropyridines |
| US3441648A (en) * | 1967-02-07 | 1969-04-29 | Smithkline Corp | Compositions and methods for lowering blood pressure with 1,4-dihydropyridines |
| US3511847A (en) * | 1967-02-07 | 1970-05-12 | Smithkline Corp | 2,6-di-lower alkyl - 1,4-dihydro - 4-(2-trifluoromethylphenyl) - 3,5 - pyridinedicarboxylic acid esters |
| DE1670824C3 (de) * | 1967-03-20 | 1978-08-03 | Bayer Ag, 5090 Leverkusen | 1,4-Dihydropyridin-33-dicarbonsäurealkylester |
| DE1670827C3 (de) * | 1967-03-20 | 1974-10-24 | Bayer Ag, 5090 Leverkusen | 4-(2'-Nitrophenyl)-2,6-dimethyl-3,5-dicarbmethoxy-1,4-dihydropyridin |
| US3455945A (en) * | 1967-06-07 | 1969-07-15 | Smithkline Corp | 4-(carboxy (and carbo-lower alkoxy)phenyl)-1,4-dihydropyridines |
| DE1923990C3 (de) * | 1969-05-10 | 1978-11-23 | Bayer Ag | Verfahren zur Herstellung von N-substituierten M-Dihydropyridin-S.S-dicarbonsäureestern |
-
1969
- 1969-12-17 DE DE19691963188 patent/DE1963188A1/de not_active Ceased
-
1970
- 1970-11-17 IE IE1477/70A patent/IE34742B1/xx unknown
- 1970-11-17 IL IL7035678A patent/IL35678A/xx unknown
- 1970-11-19 CH CH1711070A patent/CH559178A5/xx not_active IP Right Cessation
- 1970-11-19 ZA ZA707820A patent/ZA707820B/xx unknown
- 1970-11-30 FI FI703213A patent/FI52339C/fi active
- 1970-12-04 DK DK619770AA patent/DK127113B/da unknown
- 1970-12-09 NO NO4730/70A patent/NO132590C/no unknown
- 1970-12-10 NL NLAANVRAGE7018070,A patent/NL171052C/xx not_active IP Right Cessation
- 1970-12-11 US US97338A patent/US3691177A/en not_active Expired - Lifetime
- 1970-12-14 AT AT1121570A patent/AT301545B/de not_active IP Right Cessation
- 1970-12-14 CA CA100519A patent/CA928713A/en not_active Expired
- 1970-12-15 JP JP45111391A patent/JPS4811102B1/ja active Pending
- 1970-12-16 SE SE17079/70A patent/SE364709B/xx unknown
- 1970-12-17 BE BE760483A patent/BE760483A/xx unknown
- 1970-12-17 CS CS855270A patent/CS157115B2/cs unknown
- 1970-12-17 ES ES386565A patent/ES386565A1/es not_active Expired
- 1970-12-17 GB GB6000470A patent/GB1305794A/en not_active Expired
- 1970-12-17 FR FR7045676A patent/FR2081373B1/fr not_active Expired
-
1971
- 1971-08-06 US US00169825A patent/US3764683A/en not_active Expired - Lifetime
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2302866A1 (de) * | 1972-01-22 | 1973-08-02 | Yamanouchi Pharma Co Ltd | Neue 1-substituierte-1,4-dihydropyridinderivate |
| US4338322A (en) * | 1975-07-02 | 1982-07-06 | Fujisawa Pharmaceutical Co., Ltd. | 1,4-Dihydropyridine derivatives, pharmaceutical compositions containing same and methods of effecting vasodilation using same |
| DE2756226A1 (de) * | 1976-12-17 | 1978-06-29 | Fujisawa Pharmaceutical Co | 1,4-dihydropyridin-verbindungen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische mittel |
| EP0330470A3 (en) * | 1988-02-24 | 1992-01-02 | Ajinomoto Co., Inc. | 1,4-dihydropyridine derivatives useful against tumour cells |
| US5216172A (en) * | 1988-02-24 | 1993-06-01 | Ajinomoto Co., Inc. | 1,4-dihydropyridine-4-aryl-2,6-dimethyl-3,5-dicarboxylates useful as agents against drug resistant tumor cells |
| EP0451654A3 (en) * | 1990-04-11 | 1992-07-08 | Bayer Ag | Use of n-alkylated 1,4-dihydropyridine carboxylic acid esters as drugs, new compounds and process for their preparation |
| US5234935A (en) * | 1990-04-11 | 1993-08-10 | Bayer Aktiengesellschaft | N-alkylated 1,4-dihydropyridine-dicarboxylic acid esters |
| US5328931A (en) * | 1991-07-31 | 1994-07-12 | Bayer Aktiengesellschaft | N-alkylated 1,4-dihydropyridinedicarboxylic acid esters |
Also Published As
| Publication number | Publication date |
|---|---|
| CA928713A (en) | 1973-06-19 |
| NO132590C (enExample) | 1975-12-03 |
| IL35678A (en) | 1974-07-31 |
| IE34742B1 (en) | 1975-08-06 |
| CS157115B2 (enExample) | 1974-08-23 |
| DK127113B (da) | 1973-09-24 |
| FI52339B (enExample) | 1977-05-02 |
| CH559178A5 (enExample) | 1975-02-28 |
| GB1305794A (enExample) | 1973-02-07 |
| NO132590B (enExample) | 1975-08-25 |
| NL171052C (nl) | 1983-02-01 |
| US3764683A (en) | 1973-10-09 |
| FI52339C (fi) | 1977-08-10 |
| AT301545B (de) | 1972-09-11 |
| IL35678A0 (en) | 1971-01-28 |
| ES386565A1 (es) | 1973-03-16 |
| FR2081373A1 (enExample) | 1971-12-03 |
| JPS4811102B1 (enExample) | 1973-04-10 |
| IE34742L (en) | 1971-06-17 |
| BE760483A (fr) | 1971-06-17 |
| NL7018070A (enExample) | 1971-06-21 |
| FR2081373B1 (enExample) | 1975-04-18 |
| SE364709B (enExample) | 1974-03-04 |
| NL171052B (nl) | 1982-09-01 |
| ZA707820B (en) | 1971-08-25 |
| US3691177A (en) | 1972-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1923990C3 (de) | Verfahren zur Herstellung von N-substituierten M-Dihydropyridin-S.S-dicarbonsäureestern | |
| DE2005116A1 (de) | Neue 1,4 Dihydropyridindenvate | |
| DE2013431C3 (de) | 4-Azidophenyl-l,4-dihydropyridin-3,5-dicarbonsäureester | |
| DE1963188A1 (de) | Neue Cyanphenyl-1,4-dihydropyridinderivate | |
| DE2218644C3 (de) | Basische Ester von 1,4-Dihydropyridinen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2117571C3 (de) | Unsymmetrische 1,4-Dihydropyridin-33-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2003146A1 (de) | Neue 1,4-Dihydropyridinderivate | |
| DE2117572C3 (de) | Unsymmetrische 1,4-Dihydropyridin ^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE1670824A1 (de) | Verfahren zur Herstellung von 1,4-Dihydropyridinderivaten | |
| DE2228363A1 (de) | 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2658183A1 (de) | In 2-position substituierte 1,4- dihydropyridin-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2210672C3 (de) | N-substituierte unsymmetrische 1 ^-Dihydropyridin-S^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE1670827A1 (de) | Neue Arzneimittel auf der Grundlage von 4-Aryl-1,4-dihydropyridinderivaten | |
| DE1963186C3 (de) | Schwefelhaltige 1,4-Dihydropyridin-33-dicarbonsäureester | |
| DE1813436A1 (de) | N-Alkyl-1,4-dihydropyridine | |
| DE2210633A1 (de) | Neue brueckenkopfheterocyclen, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE2117573B2 (de) | Verfahren zur herstellung von unsymmetrischen 1,4-dihydropyridin-3,5- dicarbonsaeureestern, sowie ihre verwendung als arzneimittel | |
| CH622507A5 (en) | Process for the preparation of 1,4-dihydropyridines | |
| DE2228377A1 (de) | Dihydropyridin-carbonsaeureamide, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| EP0010130A1 (de) | Sila-substituierte 1,4-Dihydropyridinderivate, Verfahren zu ihrer Herstellung, Arzneimittel und Verfahren zu deren Herstellung | |
| EP0039863A1 (de) | 1,4-Dihydropyridine mit unterschiedlichen Substituenten in 2- und 6-Position, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2239815C2 (de) | 2-Alkylamino-dihydropyridine, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| DE2406198C2 (de) | Verfahren zur Herstellung von neuen 2-Amino-6-dialkylamino-dihydropyridinen | |
| DE1963185A1 (de) | Neue Nitrophenyl-1,4-dihydropyridinderivate | |
| DE2738153A1 (de) | 2-pyridyl-1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8131 | Rejection |