DE1954793B2 - Verfahren zur herstellung von carbonsaeurechloriden der benzolreihe - Google Patents
Verfahren zur herstellung von carbonsaeurechloriden der benzolreiheInfo
- Publication number
- DE1954793B2 DE1954793B2 DE19691954793 DE1954793A DE1954793B2 DE 1954793 B2 DE1954793 B2 DE 1954793B2 DE 19691954793 DE19691954793 DE 19691954793 DE 1954793 A DE1954793 A DE 1954793A DE 1954793 B2 DE1954793 B2 DE 1954793B2
- Authority
- DE
- Germany
- Prior art keywords
- acids
- reaction
- hours
- sulfuric acid
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 title description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 title description 2
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 carboxylic acid chlorides Chemical class 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 9
- 150000007513 acids Chemical class 0.000 claims description 8
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 29
- 238000006243 chemical reaction Methods 0.000 description 17
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 10
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 238000009835 boiling Methods 0.000 description 8
- XEMRAKSQROQPBR-UHFFFAOYSA-N (trichloromethyl)benzene Chemical class ClC(Cl)(Cl)C1=CC=CC=C1 XEMRAKSQROQPBR-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 6
- 229940095102 methyl benzoate Drugs 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 3
- OTEKOJQFKOIXMU-UHFFFAOYSA-N 1,4-bis(trichloromethyl)benzene Chemical compound ClC(Cl)(Cl)C1=CC=C(C(Cl)(Cl)Cl)C=C1 OTEKOJQFKOIXMU-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- WEWXCIOGPKAVFO-UHFFFAOYSA-N 1,2-bis(trichloromethyl)benzene Chemical class ClC(Cl)(Cl)C1=CC=CC=C1C(Cl)(Cl)Cl WEWXCIOGPKAVFO-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- MFHPYLFZSCSNST-UHFFFAOYSA-N 1-chloro-2-(trichloromethyl)benzene Chemical class ClC1=CC=CC=C1C(Cl)(Cl)Cl MFHPYLFZSCSNST-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- SJSOFNCYXJUNBT-UHFFFAOYSA-N 3,4,5-trimethoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC(OC)=C1OC SJSOFNCYXJUNBT-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 150000001559 benzoic acids Chemical class 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 2
- GGZIUXGYCNYNNV-UHFFFAOYSA-N 1,3-bis(trichloromethyl)benzene Chemical compound ClC(Cl)(Cl)C1=CC=CC(C(Cl)(Cl)Cl)=C1 GGZIUXGYCNYNNV-UHFFFAOYSA-N 0.000 description 1
- ZVPXXRHACIEOFJ-UHFFFAOYSA-N 1-chloro-3-(trichloromethyl)benzene Chemical compound ClC1=CC=CC(C(Cl)(Cl)Cl)=C1 ZVPXXRHACIEOFJ-UHFFFAOYSA-N 0.000 description 1
- LVZPKYYPPLUECL-UHFFFAOYSA-N 1-chloro-4-(trichloromethyl)benzene Chemical compound ClC1=CC=C(C(Cl)(Cl)Cl)C=C1 LVZPKYYPPLUECL-UHFFFAOYSA-N 0.000 description 1
- ALLSOOQIDPLIER-UHFFFAOYSA-N 2,3,4-trichlorobenzoic acid Chemical class OC(=O)C1=CC=C(Cl)C(Cl)=C1Cl ALLSOOQIDPLIER-UHFFFAOYSA-N 0.000 description 1
- HDIJZFORGDBEKL-UHFFFAOYSA-N 2,3,4-trimethylbenzoic acid Chemical class CC1=CC=C(C(O)=O)C(C)=C1C HDIJZFORGDBEKL-UHFFFAOYSA-N 0.000 description 1
- QAOJBHRZQQDFHA-UHFFFAOYSA-N 2,3-dichlorobenzoic acid Chemical class OC(=O)C1=CC=CC(Cl)=C1Cl QAOJBHRZQQDFHA-UHFFFAOYSA-N 0.000 description 1
- RIZUCYSQUWMQLX-UHFFFAOYSA-N 2,3-dimethylbenzoic acid Chemical class CC1=CC=CC(C(O)=O)=C1C RIZUCYSQUWMQLX-UHFFFAOYSA-N 0.000 description 1
- YTEUDCIEJDRJTM-UHFFFAOYSA-N 2-(chloromethyl)benzoic acid Chemical class OC(=O)C1=CC=CC=C1CCl YTEUDCIEJDRJTM-UHFFFAOYSA-N 0.000 description 1
- ODZRWXLKQLEWTR-UHFFFAOYSA-N 2-(fluoromethyl)benzoic acid Chemical class OC(=O)C1=CC=CC=C1CF ODZRWXLKQLEWTR-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- XDZMPRGFOOFSBL-UHFFFAOYSA-N 2-ethoxybenzoic acid Chemical class CCOC1=CC=CC=C1C(O)=O XDZMPRGFOOFSBL-UHFFFAOYSA-N 0.000 description 1
- CGMMPMYKMDITEA-UHFFFAOYSA-N 2-ethylbenzoic acid Chemical class CCC1=CC=CC=C1C(O)=O CGMMPMYKMDITEA-UHFFFAOYSA-N 0.000 description 1
- OBYWYNKFFLAQBD-UHFFFAOYSA-N 2-octadecoxybenzoic acid Chemical class CCCCCCCCCCCCCCCCCCOC1=CC=CC=C1C(O)=O OBYWYNKFFLAQBD-UHFFFAOYSA-N 0.000 description 1
- GPWWXKMSPDGDBQ-UHFFFAOYSA-N 2-octadecylbenzoic acid Chemical class CCCCCCCCCCCCCCCCCCC1=CC=CC=C1C(O)=O GPWWXKMSPDGDBQ-UHFFFAOYSA-N 0.000 description 1
- BANZVKGLDQDFDV-UHFFFAOYSA-N 2-propan-2-ylbenzoic acid Chemical class CC(C)C1=CC=CC=C1C(O)=O BANZVKGLDQDFDV-UHFFFAOYSA-N 0.000 description 1
- SGNROMIBCNSPLN-UHFFFAOYSA-N 4-chloro-1,2-bis(trichloromethyl)benzene Chemical compound ClC1=CC=C(C(Cl)(Cl)Cl)C(C(Cl)(Cl)Cl)=C1 SGNROMIBCNSPLN-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 229910015449 FeCU Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910003902 SiCl 4 Inorganic materials 0.000 description 1
- 229910007926 ZrCl Inorganic materials 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical class OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- XOYLJNJLGBYDTH-UHFFFAOYSA-M chlorogallium Chemical compound [Ga]Cl XOYLJNJLGBYDTH-UHFFFAOYSA-M 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- DDKMFOUTRRODRE-UHFFFAOYSA-N chloromethanone Chemical compound Cl[C]=O DDKMFOUTRRODRE-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 150000005343 dimethoxybenzoic acids Chemical class 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 150000005342 methoxybenzoic acids Chemical class 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical class CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical class CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/58—Preparation of carboxylic acid halides
- C07C51/60—Preparation of carboxylic acid halides by conversion of carboxylic acids or their anhydrides or esters, lactones, salts into halides with the same carboxylic acid part
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE758209D BE758209A (fr) | 1969-10-31 | Procede de preparation de chlorures d'acides carboxyliques de la serie benzenique | |
| DE19691954793 DE1954793B2 (de) | 1969-10-31 | 1969-10-31 | Verfahren zur herstellung von carbonsaeurechloriden der benzolreihe |
| NL7015647A NL7015647A (enExample) | 1969-10-31 | 1970-10-26 | |
| CH1593670A CH574896A5 (enExample) | 1969-10-31 | 1970-10-28 | |
| GB5172470A GB1300918A (en) | 1969-10-31 | 1970-10-30 | Process for the preparation of carboxylic acid chlorides of the benzene series |
| FR7039197A FR2066768A5 (enExample) | 1969-10-31 | 1970-10-30 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691954793 DE1954793B2 (de) | 1969-10-31 | 1969-10-31 | Verfahren zur herstellung von carbonsaeurechloriden der benzolreihe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1954793A1 DE1954793A1 (de) | 1971-05-06 |
| DE1954793B2 true DE1954793B2 (de) | 1976-07-29 |
Family
ID=5749759
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691954793 Pending DE1954793B2 (de) | 1969-10-31 | 1969-10-31 | Verfahren zur herstellung von carbonsaeurechloriden der benzolreihe |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE758209A (enExample) |
| CH (1) | CH574896A5 (enExample) |
| DE (1) | DE1954793B2 (enExample) |
| FR (1) | FR2066768A5 (enExample) |
| GB (1) | GB1300918A (enExample) |
| NL (1) | NL7015647A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5220985B2 (enExample) * | 1972-03-10 | 1977-06-07 | ||
| DE2549242A1 (de) * | 1975-11-04 | 1977-05-05 | Dynamit Nobel Ag | Verfahren zur herstellung von carbonsaeurechloriden der benzolreihe |
| US4104300A (en) * | 1976-07-07 | 1978-08-01 | Dynamit Nobel Aktiengesellschaft | Method of preparing carboxylic acid chlorides of the benzene series |
| DE2714111C2 (de) * | 1977-03-30 | 1985-08-01 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Herstellung von aromatischen Säurechloriden und 3-Chlorphthalid |
| DE2841541A1 (de) * | 1978-09-23 | 1980-04-03 | Bayer Ag | Verfahren zur herstellung von gegebenenfalls substituiertem benzoylchlorid |
| DE3004693A1 (de) * | 1980-02-08 | 1981-08-13 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von aromatischen sulfonsaeurehalogeniden |
| FR2622885B1 (fr) * | 1987-11-05 | 1990-01-26 | Poudres & Explosifs Ste Nale | Nouveau procede de preparation de chlorures d'acides carboxyliques |
| US5395966A (en) * | 1989-03-06 | 1995-03-07 | Atochem | Process for the manufacture of acryloyl chloride |
| FR2686601B1 (fr) * | 1992-01-29 | 1995-05-19 | Rhone Poulenc Chimie | Reactif et procede de synthese d'halogenure d'acides utile pour sa mise en óoeuvre. |
| CN108117486B (zh) * | 2017-12-13 | 2020-10-20 | 江西科苑生物药业有限公司 | 一种联产甲基苯甲酸、甲基苯甲酰氯和苯二甲酰氯的方法 |
| CN111848392B (zh) * | 2020-07-17 | 2022-04-26 | 青岛科技大学 | 一种制备对苯二甲酰氯的工艺 |
| CN117567269B (zh) * | 2023-10-19 | 2025-11-21 | 江西森众科技有限公司 | 一种4-氯丁酰氯的合成方法 |
-
0
- BE BE758209D patent/BE758209A/xx unknown
-
1969
- 1969-10-31 DE DE19691954793 patent/DE1954793B2/de active Pending
-
1970
- 1970-10-26 NL NL7015647A patent/NL7015647A/xx unknown
- 1970-10-28 CH CH1593670A patent/CH574896A5/xx not_active IP Right Cessation
- 1970-10-30 FR FR7039197A patent/FR2066768A5/fr not_active Expired
- 1970-10-30 GB GB5172470A patent/GB1300918A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1300918A (en) | 1972-12-29 |
| BE758209A (fr) | 1971-04-29 |
| DE1954793A1 (de) | 1971-05-06 |
| CH574896A5 (enExample) | 1976-04-30 |
| FR2066768A5 (enExample) | 1971-08-06 |
| NL7015647A (enExample) | 1971-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1954793B2 (de) | Verfahren zur herstellung von carbonsaeurechloriden der benzolreihe | |
| EP0253214B1 (de) | Verfahren zur Herstellung von Chlorcarbonsäurechloriden | |
| DE2940654A1 (de) | Dimeres keten der 1,2,,-triazol-3-carbonsaeure | |
| DE1279017B (de) | Verfahren zur Herstellung von Diorganostibinmercaptiden | |
| DE2129583C3 (de) | Verfahren zur Herstellung von Phosphinsäureanhydriden | |
| DE2550261A1 (de) | Benzonitrile | |
| DE3532359A1 (de) | Verfahren zur herstellung bifunktioneller tertiaerer aromatischer phosphanoxide | |
| EP0039905B1 (de) | Verfahren zur Herstellung von 2-Chlorbenzothiazol | |
| US2814627A (en) | N-phthalidyl carbanilates | |
| EP0100956B1 (de) | Verfahren zur Herstellung von Dicyan | |
| DE2361604C3 (de) | Verfahren zur Herstellung von N1Ndisubstituierten Carbonsäureamiden | |
| DE459738C (de) | Verfahren zur Herstellung von Alkyl- oder Alkylenestern anorganischer Saeuren | |
| DE1080091B (de) | Verfahren zur Herstellung von ªŠ-Halogencapronsaeuren | |
| EP0271695B1 (de) | Verfahren zur Herstellung von Phosphin- oder Phosphonsäurechloriden | |
| DE1468167B2 (de) | Basische ester bicyclischer dicarbonsaeuren, ihre saeureadditionssalze und bisquaternaeren ammoniumverbindungen, sowie verfahren zur herstellung derselben | |
| DE1793287B2 (de) | Verfahren zur herstellung von n- substituierte n-acylcarbamidsaeurehalogeniden | |
| DE1618517C3 (de) | Verfahren zur Herstellung von 1,2,43-Tetrachlorbenzol | |
| DE1261855B (de) | Verfahren zur Herstellung von reinem 2-N,N-Dimethylcarbamyl-3-methyl-pyrazolyl-(5)-N,N-dimethylcarbamat | |
| DE2449523C3 (de) | Verfahren zur Herstellung von PhthaUmido- oder Cyclohexen-1,2-dicarboximido-Thionophosphaten | |
| CH442348A (de) | Verfahren zur Herstellung von 4-Alkyl- bzw. Halogenalkylmercaptophenolen | |
| DE1793350C3 (de) | Verfahren zur Herstellung von alkylsubstituierten Glutarsäuren | |
| DE2037612A1 (en) | Diisocyano tetrachloride - useful as plant-protection agent and intermediate | |
| DE1230026B (de) | Verfahren zur Herstellung von Carbonsaeurenitrilen | |
| DE1618517B2 (de) | Verfahren zur herstellung von 1,2,4,5-tetrachlorbenzol | |
| DE1200275B (de) | Verfahren zur Perchlorierung der Seitenketten in Methylbenzolen und deren kernsubstituierten Derivaten |