DE1954065C3 - Verfahren zur Herstellung von kondensierten 1,4-Benzodiazepinderivaten - Google Patents
Verfahren zur Herstellung von kondensierten 1,4-BenzodiazepinderivatenInfo
- Publication number
- DE1954065C3 DE1954065C3 DE1954065A DE1954065A DE1954065C3 DE 1954065 C3 DE1954065 C3 DE 1954065C3 DE 1954065 A DE1954065 A DE 1954065A DE 1954065 A DE1954065 A DE 1954065A DE 1954065 C3 DE1954065 C3 DE 1954065C3
- Authority
- DE
- Germany
- Prior art keywords
- chloro
- amino
- yield
- melts
- oxo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 76
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical class N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 title claims description 17
- 238000002360 preparation method Methods 0.000 title claims description 4
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 235000009518 sodium iodide Nutrition 0.000 claims description 2
- 239000000047 product Substances 0.000 description 75
- 239000000155 melt Substances 0.000 description 67
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 49
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 30
- -1 alkyl mercapto- Chemical class 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 23
- HZAXFHJVJLSVMW-UHFFFAOYSA-N monoethanolamine hydrochloride Natural products NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 23
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- 239000000203 mixture Substances 0.000 description 20
- 239000002904 solvent Substances 0.000 description 20
- 229940049706 benzodiazepine Drugs 0.000 description 19
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 18
- 238000000354 decomposition reaction Methods 0.000 description 16
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000000126 substance Substances 0.000 description 11
- SYZRZLUNWVNNNV-UHFFFAOYSA-N 2-bromoacetyl chloride Chemical compound ClC(=O)CBr SYZRZLUNWVNNNV-UHFFFAOYSA-N 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- 235000017550 sodium carbonate Nutrition 0.000 description 9
- 238000009835 boiling Methods 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- ZUWXHHBROGLWNH-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-phenylmethanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 ZUWXHHBROGLWNH-UHFFFAOYSA-N 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 7
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 7
- BKMMTJMQCTUHRP-UHFFFAOYSA-N 2-aminopropan-1-ol Chemical compound CC(N)CO BKMMTJMQCTUHRP-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- KWZYIAJRFJVQDO-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-(2-chlorophenyl)methanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1Cl KWZYIAJRFJVQDO-UHFFFAOYSA-N 0.000 description 4
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 4
- MWGWIYHLYKSWOH-UHFFFAOYSA-N 4-chloro-2-(5-methyl-2-phenyl-1,3-oxazolidin-2-yl)aniline Chemical compound ClC=1C=CC(=C(C1)C1(OC(CN1)C)C1=CC=CC=C1)N MWGWIYHLYKSWOH-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 150000001557 benzodiazepines Chemical class 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 229940102253 isopropanolamine Drugs 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- GTLLBGFJGUJABH-UHFFFAOYSA-N (2-amino-5-bromophenyl)-(2-chlorophenyl)methanone Chemical compound NC1=CC=C(Br)C=C1C(=O)C1=CC=CC=C1Cl GTLLBGFJGUJABH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- BASRYQBPQWFPEF-UHFFFAOYSA-N [5-chloro-2-(ethylamino)phenyl]-phenylmethanone Chemical compound CCNC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 BASRYQBPQWFPEF-UHFFFAOYSA-N 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- LXJVUGANBDAASB-UHFFFAOYSA-N (2-amino-5-bromophenyl)-phenylmethanone Chemical compound NC1=CC=C(Br)C=C1C(=O)C1=CC=CC=C1 LXJVUGANBDAASB-UHFFFAOYSA-N 0.000 description 2
- PZPZDEIASIKHPY-UHFFFAOYSA-N (2-amino-5-nitrophenyl)-phenylmethanone Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(=O)C1=CC=CC=C1 PZPZDEIASIKHPY-UHFFFAOYSA-N 0.000 description 2
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 2
- FUKOTTQGWQVMQB-UHFFFAOYSA-N (2-bromoacetyl) 2-bromoacetate Chemical compound BrCC(=O)OC(=O)CBr FUKOTTQGWQVMQB-UHFFFAOYSA-N 0.000 description 2
- LRANPJDWHYRCER-UHFFFAOYSA-N 1,2-diazepine Chemical compound N1C=CC=CC=N1 LRANPJDWHYRCER-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 230000001914 calming effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- WSXPCBBBFNSXNG-UHFFFAOYSA-N (2-amino-3,5-dichlorophenyl)-phenylmethanone Chemical compound NC1=C(Cl)C=C(Cl)C=C1C(=O)C1=CC=CC=C1 WSXPCBBBFNSXNG-UHFFFAOYSA-N 0.000 description 1
- BHIQWPLMSSPGNB-UHFFFAOYSA-N (2-amino-3,5-dimethylphenyl)-phenylmethanone Chemical compound CC1=CC(C)=C(N)C(C(=O)C=2C=CC=CC=2)=C1 BHIQWPLMSSPGNB-UHFFFAOYSA-N 0.000 description 1
- FBWIBFRRBJHQTK-UHFFFAOYSA-N (2-amino-3-methylphenyl)-phenylmethanone Chemical compound CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1N FBWIBFRRBJHQTK-UHFFFAOYSA-N 0.000 description 1
- MXCCUJSCFMFTNY-UHFFFAOYSA-N (2-amino-4,5-dichlorophenyl)-phenylmethanone Chemical compound NC1=CC(Cl)=C(Cl)C=C1C(=O)C1=CC=CC=C1 MXCCUJSCFMFTNY-UHFFFAOYSA-N 0.000 description 1
- MSLAXEHHMCZZOX-UHFFFAOYSA-N (2-amino-5-chloro-3-fluorophenyl)-phenylmethanone Chemical compound NC1=C(F)C=C(Cl)C=C1C(=O)C1=CC=CC=C1 MSLAXEHHMCZZOX-UHFFFAOYSA-N 0.000 description 1
- ZVPLWDRTHNDLQO-UHFFFAOYSA-N (2-amino-5-chloro-3-methylphenyl)-phenylmethanone Chemical compound CC1=CC(Cl)=CC(C(=O)C=2C=CC=CC=2)=C1N ZVPLWDRTHNDLQO-UHFFFAOYSA-N 0.000 description 1
- VKTIPANBPNEKBN-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-(2-methylphenyl)methanone Chemical compound CC1=CC=CC=C1C(=O)C1=CC(Cl)=CC=C1N VKTIPANBPNEKBN-UHFFFAOYSA-N 0.000 description 1
- TUFWUVGXYPKWNV-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-(4-nitrophenyl)methanone Chemical compound ClC=1C=CC(=C(C(=O)C2=CC=C(C=C2)[N+](=O)[O-])C=1)N TUFWUVGXYPKWNV-UHFFFAOYSA-N 0.000 description 1
- GRDGBWVSVMLKBV-UHFFFAOYSA-N (2-amino-5-nitrophenyl)-(2-chlorophenyl)methanone Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(=O)C1=CC=CC=C1Cl GRDGBWVSVMLKBV-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- JVJXUSZFWQUMBZ-UHFFFAOYSA-N 10-bromo-11b-(2-chlorophenyl)-2-methyl-2,3,5,7-tetrahydro-[1,3]oxazolo[3,2-d][1,4]benzodiazepin-6-one Chemical compound O1C(C)CN2CC(=O)NC3=CC=C(Br)C=C3C21C1=CC=CC=C1Cl JVJXUSZFWQUMBZ-UHFFFAOYSA-N 0.000 description 1
- KJGWZWJHDVNZAW-UHFFFAOYSA-N 2,4-dimethyl-6-(5-methyl-2-phenyl-1,3-oxazolidin-2-yl)aniline Chemical compound CC=1C(=C(C=C(C1)C)C1(OC(CN1)C)C1=CC=CC=C1)N KJGWZWJHDVNZAW-UHFFFAOYSA-N 0.000 description 1
- DRQNDJOERYQGQA-UHFFFAOYSA-N 2-[[(2-amino-5-bromophenyl)-(2-chlorophenyl)methylidene]amino]ethanol Chemical compound NC1=C(C(C2=C(C=CC=C2)Cl)=NCCO)C=C(C=C1)Br DRQNDJOERYQGQA-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- SZFHAHACWVROGM-UHFFFAOYSA-N 2-phenyl-1,3-oxazolidine Chemical compound N1CCOC1C1=CC=CC=C1 SZFHAHACWVROGM-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- IHBVNSPHKMCPST-UHFFFAOYSA-N 3-bromopropanoyl chloride Chemical compound ClC(=O)CCBr IHBVNSPHKMCPST-UHFFFAOYSA-N 0.000 description 1
- IRWPZPMPDLRSIS-UHFFFAOYSA-N 4-chloro-2-(2-phenyl-1,3-oxazolidin-2-yl)aniline Chemical compound ClC=1C=CC(=C(C1)C1(OCCN1)C1=CC=CC=C1)N IRWPZPMPDLRSIS-UHFFFAOYSA-N 0.000 description 1
- REXMVLSITPHYDY-UHFFFAOYSA-N 4-chloro-2-[2-(2-chlorophenyl)-1,3-oxazolidin-2-yl]aniline Chemical compound ClC=1C=CC(=C(C1)C1(OCCN1)C1=C(C=CC=C1)Cl)N REXMVLSITPHYDY-UHFFFAOYSA-N 0.000 description 1
- JEHVULXLGBRSMT-UHFFFAOYSA-N 4-chloro-2-methyl-6-(2-phenyl-1,3-oxazolidin-2-yl)aniline Chemical compound CC=1C(=C(C=C(C1)Cl)C1(OCCN1)C1=CC=CC=C1)N JEHVULXLGBRSMT-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- NMARPFMJVCXSAV-UHFFFAOYSA-N 5-[(3,5-diethoxy-4-pyrrol-1-ylphenyl)methyl]pyrimidine-2,4-diamine Chemical compound C=1C(OCC)=C(N2C=CC=C2)C(OCC)=CC=1CC1=CN=C(N)N=C1N NMARPFMJVCXSAV-UHFFFAOYSA-N 0.000 description 1
- HBVZPVWFLGXUAU-UHFFFAOYSA-N 5-methyl-1,3-oxazolidine Chemical compound CC1CNCO1 HBVZPVWFLGXUAU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- VCCZBYPHZRWKFY-UHFFFAOYSA-N Oxazolam Chemical compound O1C(C)CN2CC(=O)NC3=CC=C(Cl)C=C3C21C1=CC=CC=C1 VCCZBYPHZRWKFY-UHFFFAOYSA-N 0.000 description 1
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000006545 Ziziphus mauritiana Nutrition 0.000 description 1
- 240000000038 Ziziphus mauritiana Species 0.000 description 1
- IBDWEQVFNZSVFU-UHFFFAOYSA-N [1,3]oxazolo[3,2-d][1,4]benzodiazepine Chemical compound C1=CN=C2C=CC=CC2=C2OC=CN21 IBDWEQVFNZSVFU-UHFFFAOYSA-N 0.000 description 1
- HPVUXGAKPJOZBW-UHFFFAOYSA-N [2-(benzylamino)-5-chlorophenyl]-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C1=CC(Cl)=CC=C1NCC1=CC=CC=C1 HPVUXGAKPJOZBW-UHFFFAOYSA-N 0.000 description 1
- FUYPDDZLQLWFBR-UHFFFAOYSA-N [3-amino-5-chloro-2-[(4-chlorophenyl)methyl]phenyl]-phenylmethanone Chemical compound ClC=1C=C(C(=C(C(=O)C2=CC=CC=C2)C=1)CC1=CC=C(C=C1)Cl)N FUYPDDZLQLWFBR-UHFFFAOYSA-N 0.000 description 1
- YKSNHLNTLVRITE-UHFFFAOYSA-N [Br].CC(Br)=O Chemical compound [Br].CC(Br)=O YKSNHLNTLVRITE-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 229940053194 antiepileptics oxazolidine derivative Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000004915 dibutylamino group Chemical group C(CCC)N(CCCC)* 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012971 dimethylpiperazine Substances 0.000 description 1
- 125000004914 dipropylamino group Chemical group C(CC)N(CCC)* 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 235000020130 leben Nutrition 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229960003151 mercaptamine Drugs 0.000 description 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N methyl alcohol Substances OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- ANUCDXCTICZJRH-UHFFFAOYSA-N mexazolam Chemical compound C=1C=C(Cl)C=C2C=1NC(=O)CN1C(C)COC21C1=CC=CC=C1Cl ANUCDXCTICZJRH-UHFFFAOYSA-N 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 150000002917 oxazolidines Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003254 radicals Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Chemical group 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- GRVPDGGTLNKOBZ-UHFFFAOYSA-M triethyl(methyl)azanium;bromide Chemical compound [Br-].CC[N+](C)(CC)CC GRVPDGGTLNKOBZ-UHFFFAOYSA-M 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Furnace Details (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP43077500A JPS4834752B1 (enExample) | 1968-10-24 | 1968-10-24 | |
| JP43077504A JPS4834756B1 (enExample) | 1968-10-24 | 1968-10-24 | |
| JP44029908A JPS4925276B1 (enExample) | 1969-04-17 | 1969-04-17 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1954065A1 DE1954065A1 (de) | 1970-08-27 |
| DE1954065B2 DE1954065B2 (de) | 1979-01-11 |
| DE1954065C3 true DE1954065C3 (de) | 1979-09-13 |
Family
ID=27286759
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1954065A Expired DE1954065C3 (de) | 1968-10-24 | 1969-10-23 | Verfahren zur Herstellung von kondensierten 1,4-Benzodiazepinderivaten |
Country Status (17)
| Country | Link |
|---|---|
| AR (1) | AR207426A1 (enExample) |
| BE (1) | BE740587A (enExample) |
| BG (2) | BG20109A3 (enExample) |
| CH (1) | CH533130A (enExample) |
| DE (1) | DE1954065C3 (enExample) |
| DK (1) | DK153152C (enExample) |
| FI (1) | FI49621C (enExample) |
| FR (1) | FR2021469B1 (enExample) |
| GB (1) | GB1276909A (enExample) |
| IE (1) | IE33825B1 (enExample) |
| IL (1) | IL33190A (enExample) |
| NL (1) | NL166262C (enExample) |
| NO (1) | NO128109B (enExample) |
| OA (1) | OA03155A (enExample) |
| PL (1) | PL82688B1 (enExample) |
| RO (2) | RO55843A (enExample) |
| SE (2) | SE384857B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH565180A5 (enExample) * | 1970-12-23 | 1975-08-15 | Hoffmann La Roche |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3914215A (en) * | 1967-11-27 | 1975-10-21 | Sankyo Co | Benzodiazepine derivatives and process for preparing the same |
| GB1222294A (en) * | 1968-09-19 | 1971-02-10 | Upjohn Co | Oxazinobenzodiazepine derivatives |
-
1969
- 1969-10-15 IL IL33190A patent/IL33190A/xx unknown
- 1969-10-21 BE BE740587D patent/BE740587A/xx not_active IP Right Cessation
- 1969-10-23 IE IE1447/69A patent/IE33825B1/xx unknown
- 1969-10-23 DK DK561869A patent/DK153152C/da not_active IP Right Cessation
- 1969-10-23 NL NL6915994.A patent/NL166262C/xx not_active IP Right Cessation
- 1969-10-23 OA OA53762A patent/OA03155A/xx unknown
- 1969-10-23 NO NO04212/69A patent/NO128109B/no unknown
- 1969-10-23 PL PL1969136465A patent/PL82688B1/pl unknown
- 1969-10-23 DE DE1954065A patent/DE1954065C3/de not_active Expired
- 1969-10-23 BG BG013231A patent/BG20109A3/xx unknown
- 1969-10-23 FR FR696936338A patent/FR2021469B1/fr not_active Expired
- 1969-10-23 BG BG020368A patent/BG19175A3/xx unknown
- 1969-10-24 FI FI693070A patent/FI49621C/fi active
- 1969-10-24 RO RO61341A patent/RO55843A/ro unknown
- 1969-10-24 CH CH1592069A patent/CH533130A/de not_active IP Right Cessation
- 1969-10-24 RO RO69346A patent/RO57031A/ro unknown
- 1969-10-24 SE SE7215303A patent/SE384857B/xx unknown
- 1969-10-24 GB GB52353/69A patent/GB1276909A/en not_active Expired
- 1969-10-24 SE SE14615/69A patent/SE366314B/xx unknown
-
1971
- 1971-01-01 AR AR236342A patent/AR207426A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| DK153152B (da) | 1988-06-20 |
| RO57031A (enExample) | 1974-12-15 |
| SE366314B (enExample) | 1974-04-22 |
| GB1276909A (en) | 1972-06-07 |
| FI49621C (fi) | 1975-08-11 |
| CH533130A (de) | 1973-01-31 |
| NL166262C (nl) | 1981-07-15 |
| FR2021469A1 (enExample) | 1970-07-24 |
| DK153152C (da) | 1988-12-05 |
| IE33825B1 (en) | 1974-11-13 |
| NO128109B (enExample) | 1973-10-01 |
| RO55843A (enExample) | 1974-02-01 |
| NL6915994A (enExample) | 1970-04-28 |
| SE384857B (sv) | 1976-05-24 |
| BG20109A3 (bg) | 1975-10-30 |
| OA03155A (fr) | 1970-12-15 |
| IE33825L (en) | 1970-04-24 |
| BG19175A3 (bg) | 1975-04-30 |
| DE1954065A1 (de) | 1970-08-27 |
| IL33190A0 (en) | 1969-12-31 |
| IL33190A (en) | 1972-11-28 |
| PL82688B1 (en) | 1975-10-31 |
| FI49621B (enExample) | 1975-04-30 |
| BE740587A (enExample) | 1970-04-21 |
| AR207426A1 (es) | 1976-10-08 |
| DE1954065B2 (de) | 1979-01-11 |
| FR2021469B1 (enExample) | 1973-04-06 |
| NL166262B (nl) | 1981-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0230942B1 (de) | Thieno-1,4-diazepine | |
| US4129656A (en) | Thiazolidine derivatives, salidiuretic compositions and methods of effecting salidiuresis employing them | |
| CH532065A (de) | Verfahren zur Herstellung von Benzodiazepinderivaten | |
| DE2651809A1 (de) | Neue benzodiazepinderivate und verfahren zu deren herstellung und verwendung | |
| DE1954065C3 (de) | Verfahren zur Herstellung von kondensierten 1,4-Benzodiazepinderivaten | |
| EP0024272B1 (de) | 1,4-Benzodiazepinderivate und ihre Salze; Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneipräparate | |
| US4052394A (en) | 2-(dicyanomethylene)-1,3-dithiolo-(4,5-b)pyrazine-5,6-dicarbonitrile | |
| DE1912941C3 (de) | 1 -Phenyl^-amino-e-methoxypyridaziniumsalze | |
| EP0003540B1 (de) | N-Azolylalkyl-aniline sowie Verfahren zu ihrer Herstellung | |
| DD157799A5 (de) | Verfahren zur herstellung substituierter triarylthiazole | |
| DE2439209A1 (de) | Neue 6-phenyl-s-triazolo eckige klammer auf 4,3-a eckige klammer zu eckige klammer auf 1,3,4 eckige klammer zu benzotriazepine | |
| DE3204074C2 (enExample) | ||
| EP0072029A2 (de) | Triazolobenzazepine, Verfahren und Zwischenprodukte zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2143646A1 (de) | 2-Amino-l,5-benzodiazocinderivate und Verfahren zu ihrer Herstellung | |
| DE2114441A1 (de) | Benzodiazepindenvate und Ver fahren zu ihrer Herstellung | |
| CH476753A (de) | Verfahren zur Herstellung von 11-basisch substituierter Dibenzo(b,f)(1,4)thiazepine | |
| DD296920A5 (de) | Benzothiazinderivate, ihre herstellung und anwendung als medikamente oder synthesezwischenprodukte fuer diese | |
| DE1967030C3 (de) | γ-Lactame der 6H,7H-cis-7- Amino-3aminomethyl-ceph-3-em-4-carbonsäuren | |
| DE2167258C2 (de) | s-Triazolyl-benzophenon-Derivate | |
| CH655105A5 (de) | Neue, acylierte 1,2,4-triazol-derivate, deren intermediaere, verfahren zu ihrer herstellung und die 1,2,4-triazol-derivate enthaltende arzneimittelpraeparate. | |
| DE2448259A1 (de) | Verfahren zur herstellung von 2-halogenmethyl-1,4-benzodiazepinen | |
| CH562814A5 (enExample) | ||
| CH529779A (de) | Verfahren zur Herstellung von Benzodiazepinderivaten | |
| CH633555A5 (de) | Verfahren zur herstellung von 1-(2-(dialkylamino)aethyl)-6-aryl-4h-s-triazolo(4,3-a)(1,4)benzodiazepinen. | |
| CH505850A (de) | Verfahren zur Herstellung von neuen Benzoxazepinonen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |