DE1944255B - - Google Patents
Info
- Publication number
- DE1944255B DE1944255B DE1944255B DE 1944255 B DE1944255 B DE 1944255B DE 1944255 B DE1944255 B DE 1944255B
- Authority
- DE
- Germany
- Prior art keywords
- day
- minutes
- exposure time
- test
- cooh
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 claims description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 230000000721 bacterilogical effect Effects 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 8
- 108090000623 proteins and genes Proteins 0.000 description 7
- 102000004169 proteins and genes Human genes 0.000 description 7
- 241000588724 Escherichia coli Species 0.000 description 6
- 241000588767 Proteus vulgaris Species 0.000 description 6
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 6
- 241000191967 Staphylococcus aureus Species 0.000 description 6
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 6
- 229940007042 proteus vulgaris Drugs 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 230000003115 biocidal effect Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000000622 irritating effect Effects 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 241000283973 Oryctolagus cuniculus Species 0.000 description 4
- 150000001413 amino acids Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- CNDHHGUSRIZDSL-UHFFFAOYSA-N 1-chlorooctane Chemical compound CCCCCCCCCl CNDHHGUSRIZDSL-UHFFFAOYSA-N 0.000 description 3
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 239000012888 bovine serum Substances 0.000 description 3
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 3
- 229960004068 hexachlorophene Drugs 0.000 description 3
- 239000013558 reference substance Substances 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 2
- OMOVVBIIQSXZSZ-UHFFFAOYSA-N [6-(4-acetyloxy-5,9a-dimethyl-2,7-dioxo-4,5a,6,9-tetrahydro-3h-pyrano[3,4-b]oxepin-5-yl)-5-formyloxy-3-(furan-3-yl)-3a-methyl-7-methylidene-1a,2,3,4,5,6-hexahydroindeno[1,7a-b]oxiren-4-yl] 2-hydroxy-3-methylpentanoate Chemical compound CC12C(OC(=O)C(O)C(C)CC)C(OC=O)C(C3(C)C(CC(=O)OC4(C)COC(=O)CC43)OC(C)=O)C(=C)C32OC3CC1C=1C=COC=1 OMOVVBIIQSXZSZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 2
- 229940106681 chloroacetic acid Drugs 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000000645 desinfectant Substances 0.000 description 2
- 230000000249 desinfective effect Effects 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 101150073877 egg-1 gene Proteins 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 230000007794 irritation Effects 0.000 description 2
- 231100000286 mucous membrane, eye irritation or corrosion testing Toxicity 0.000 description 2
- -1 octyl halide Chemical class 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- BASMANVIUSSIIM-UHFFFAOYSA-N 1-chloro-2-(chloromethyl)benzene Chemical compound ClCC1=CC=CC=C1Cl BASMANVIUSSIIM-UHFFFAOYSA-N 0.000 description 1
- 101150021183 65 gene Proteins 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 235000019687 Lamb Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000003978 alpha-halocarboxylic acids Chemical class 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 235000015278 beef Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000000199 molecular distillation Methods 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- YBUMEUMBIWOBBF-UHFFFAOYSA-N n'-[2-(octylamino)ethyl]ethane-1,2-diamine Chemical compound CCCCCCCCNCCNCCN YBUMEUMBIWOBBF-UHFFFAOYSA-N 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 239000012063 pure reaction product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000008149 soap solution Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000002602 strong irritant Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1693156B2 (de) | N-(Dichlorbenzyt>N'-(3,4dichlorphenyl)-thioharnstoffe und diese enthaltende biocide Mittel | |
| DE2606106C2 (de) | Hydroxyamine, Verfahren zur Herstellung solcher Verbindungen und deren Verwendung | |
| DE2530243C2 (de) | Verwendung von N-substituierten Aminoalkanolen als antimikrobielle Wirkstoffe | |
| DE1944255B (cg-RX-API-DMAC10.html) | ||
| DE2263596C3 (de) | Mikrobicide Mittel | |
| DE1944255A1 (de) | Biocide Zubereitungen | |
| DE2447547C2 (de) | Antibakterielles Mittel | |
| DE3147990C2 (cg-RX-API-DMAC10.html) | ||
| DE2531343A1 (de) | Antimikrobielle mittel | |
| DE3148047C2 (cg-RX-API-DMAC10.html) | ||
| DE2833135A1 (de) | Verwendung von substituierten oligocarbamidinen als mikrobistatika sowie diese enthaltende antimikrobielle mittel | |
| DE2055208C3 (de) | Mikrobicide Zubereitung auf der Basis von substituierten Phenylendiaminen | |
| DE2244778B2 (de) | 1 -n-Dodecylaminomethyl-2-aminocyclopentan, dessen Herstellung und Verwendung als mikrobicider Wirkstoff | |
| DE2744353A1 (de) | Hydantoinderivate, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2055854C (cg-RX-API-DMAC10.html) | ||
| DE2055209C3 (de) | Mikrobicide Pyridinderivate | |
| DE1909065C (de) | N-substituierte Diaminopyridine | |
| DE2247370C3 (de) | 1,3,3-Trimethyl-1 -noctylaminomethyl-5-n-octylamino-cyclohexan, Verfahren zu deren Herstellung und deren Verwendung als mikrobicider Wirkstoff | |
| DE2262333C3 (de) | Verfahren zur Herstellung eines Gemisches von Tripopylentetraminderivaten und deren Verwendung als Mikrobicid | |
| DE2247369B1 (de) | Verfahren zur Herstellung von Diaminen und deren Verwendung als Mikrobicid | |
| DE2058661A1 (de) | Biocides Adamantylaminderivat | |
| DE2948186A1 (de) | Neue sulfonamide, ihre herstellung und ihre verwendung als antimikrobielle substanzen | |
| DE2009276C (de) | Biocide | |
| DE2244814A1 (de) | Verfahren zur herstellung von mikrobicid wirksamen verbindungen oder verbindungsgemischen | |
| DE1261278B (de) | Antimikrobielle Mittel |