DE1923624C3 - Verfahren zur Herstellung von Penicillinen - Google Patents
Verfahren zur Herstellung von PenicillinenInfo
- Publication number
- DE1923624C3 DE1923624C3 DE1923624A DE1923624A DE1923624C3 DE 1923624 C3 DE1923624 C3 DE 1923624C3 DE 1923624 A DE1923624 A DE 1923624A DE 1923624 A DE1923624 A DE 1923624A DE 1923624 C3 DE1923624 C3 DE 1923624C3
- Authority
- DE
- Germany
- Prior art keywords
- acid
- aminopenicillanic acid
- aminopenicillanic
- reaction
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 13
- 229930182555 Penicillin Natural products 0.000 title claims description 12
- 150000002960 penicillins Chemical class 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title description 3
- 238000002360 preparation method Methods 0.000 claims description 5
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 64
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 63
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 51
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 39
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- 239000000047 product Substances 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- 238000001914 filtration Methods 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 14
- 150000003839 salts Chemical class 0.000 description 14
- 239000002253 acid Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- 229940086542 triethylamine Drugs 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 10
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 229960000723 ampicillin Drugs 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- WOXWUZCRWJWTRT-UHFFFAOYSA-N 1-amino-1-cyclohexanecarboxylic acid Chemical compound OC(=O)C1(N)CCCCC1 WOXWUZCRWJWTRT-UHFFFAOYSA-N 0.000 description 7
- ZGUNAGUHMKGQNY-UHFFFAOYSA-N alpha-phenylglycine Chemical compound OC(=O)C(N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-UHFFFAOYSA-N 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000370 acceptor Substances 0.000 description 6
- 238000005917 acylation reaction Methods 0.000 description 6
- KTQYJQFGNYHXMB-UHFFFAOYSA-N dichloro(methyl)silicon Chemical compound C[Si](Cl)Cl KTQYJQFGNYHXMB-UHFFFAOYSA-N 0.000 description 6
- 239000005048 methyldichlorosilane Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- -1 organosilane derivatives of 6-aminopenicillanic acid Chemical class 0.000 description 6
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- OSXYHAQZDCICNX-UHFFFAOYSA-N dichloro(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](Cl)(Cl)C1=CC=CC=C1 OSXYHAQZDCICNX-UHFFFAOYSA-N 0.000 description 4
- GNVPGBIHGALKRR-UHFFFAOYSA-N dichloro-methyl-propylsilane Chemical compound CCC[Si](C)(Cl)Cl GNVPGBIHGALKRR-UHFFFAOYSA-N 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical group CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 3
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 3
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 3
- 238000006136 alcoholysis reaction Methods 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- GNEPOXWQWFSSOU-UHFFFAOYSA-N dichloro-methyl-phenylsilane Chemical compound C[Si](Cl)(Cl)C1=CC=CC=C1 GNEPOXWQWFSSOU-UHFFFAOYSA-N 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229940049954 penicillin Drugs 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 230000008929 regeneration Effects 0.000 description 3
- 238000011069 regeneration method Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- MNAQQHWMIALRPQ-UHFFFAOYSA-N n,n-dimethylaniline;dihydrochloride Chemical compound Cl.Cl.CN(C)C1=CC=CC=C1 MNAQQHWMIALRPQ-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000001282 organosilanes Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- GVVFCAFBYHYGEE-OGFXRTJISA-N (2r)-2-amino-2-phenylacetyl chloride;hydron;chloride Chemical compound Cl.ClC(=O)[C@H](N)C1=CC=CC=C1 GVVFCAFBYHYGEE-OGFXRTJISA-N 0.000 description 1
- HGUFODBRKLSHSI-UHFFFAOYSA-N 2,3,7,8-tetrachloro-dibenzo-p-dioxin Chemical compound O1C2=CC(Cl)=C(Cl)C=C2OC2=C1C=C(Cl)C(Cl)=C2 HGUFODBRKLSHSI-UHFFFAOYSA-N 0.000 description 1
- DVMQNHACVBLYQH-UHFFFAOYSA-N 2-anilinoacetyl chloride;hydrochloride Chemical compound Cl.ClC(=O)CNC1=CC=CC=C1 DVMQNHACVBLYQH-UHFFFAOYSA-N 0.000 description 1
- WNPVZANXRCPJPW-UHFFFAOYSA-N 5-[isocyano-(4-methylphenyl)sulfonylmethyl]-1,2,3-trimethoxybenzene Chemical compound COC1=C(OC)C(OC)=CC(C([N+]#[C-])S(=O)(=O)C=2C=CC(C)=CC=2)=C1 WNPVZANXRCPJPW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- JOOMLFKONHCLCJ-UHFFFAOYSA-N N-(trimethylsilyl)diethylamine Chemical compound CCN(CC)[Si](C)(C)C JOOMLFKONHCLCJ-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- OZRDIIAODQOSHW-UHFFFAOYSA-N benzyl-dibromo-ethylsilane Chemical compound CC[Si](Br)(Br)CC1=CC=CC=C1 OZRDIIAODQOSHW-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- HGBLNBBNRORJKI-WCABBAIRSA-N cyclacillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C1(N)CCCCC1 HGBLNBBNRORJKI-WCABBAIRSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- PJMZOZSTBHYHFW-UHFFFAOYSA-N dibenzyl(dichloro)silane Chemical compound C=1C=CC=CC=1C[Si](Cl)(Cl)CC1=CC=CC=C1 PJMZOZSTBHYHFW-UHFFFAOYSA-N 0.000 description 1
- LIQOCGKQCFXKLF-UHFFFAOYSA-N dibromo(dimethyl)silane Chemical compound C[Si](C)(Br)Br LIQOCGKQCFXKLF-UHFFFAOYSA-N 0.000 description 1
- NJKDOKBDBHYMAH-UHFFFAOYSA-N dibutyl(dichloro)silane Chemical compound CCCC[Si](Cl)(Cl)CCCC NJKDOKBDBHYMAH-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- YCOFRPYSZKIPBQ-UHFFFAOYSA-N penicillic acid Natural products COC1=CC(=O)OC1(O)C(C)=C YCOFRPYSZKIPBQ-UHFFFAOYSA-N 0.000 description 1
- VOUGEZYPVGAPBB-UHFFFAOYSA-N penicillin acid Natural products OC(=O)C=C(OC)C(=O)C(C)=C VOUGEZYPVGAPBB-UHFFFAOYSA-N 0.000 description 1
- 229920001339 phlorotannin Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical class [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 125000000026 trimethylsilyl group Chemical class [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US72768868A | 1968-05-08 | 1968-05-08 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1923624A1 DE1923624A1 (de) | 1969-11-20 |
| DE1923624B2 DE1923624B2 (de) | 1979-03-15 |
| DE1923624C3 true DE1923624C3 (de) | 1979-11-08 |
Family
ID=24923612
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1923624A Expired DE1923624C3 (de) | 1968-05-08 | 1969-05-08 | Verfahren zur Herstellung von Penicillinen |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3654266A (enExample) |
| JP (3) | JPS518954B1 (enExample) |
| BE (1) | BE732769A (enExample) |
| BR (1) | BR6908638D0 (enExample) |
| CA (1) | CA992957A (enExample) |
| CH (1) | CH515933A (enExample) |
| DE (1) | DE1923624C3 (enExample) |
| DK (3) | DK137760B (enExample) |
| FI (1) | FI56181C (enExample) |
| FR (1) | FR2008111A1 (enExample) |
| GB (1) | GB1266544A (enExample) |
| IL (2) | IL41851A (enExample) |
| MY (1) | MY7500061A (enExample) |
| NL (1) | NL173406C (enExample) |
| PH (3) | PH10525A (enExample) |
| SE (4) | SE395702B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4000129A (en) * | 1970-02-18 | 1976-12-28 | Koninklijke Nederlandsche Gist-En Spiritusfabriek N.V. | 6-aminopenicillanic acid sulfoxide silyl esters |
| US3926954A (en) * | 1970-05-27 | 1975-12-16 | Erwin Kiesewetter | Preparation of salts of carboxylic acids containing a beta-lactam groups |
| US3862933A (en) * | 1972-07-12 | 1975-01-28 | Pfizer | Process for making esters of 6-(alpha-(carboxy)aryla-cetamido)penicillanic acids |
| IT1091586B (it) * | 1978-01-04 | 1985-07-06 | Vigano Vittorio | Macchina perfezionata per il piegamento di fogli |
| JPS5576886A (en) * | 1978-12-07 | 1980-06-10 | Mitsubishi Chem Ind Ltd | Synthetic method of penicillin |
| US4278600A (en) * | 1979-03-19 | 1981-07-14 | Bristol-Myers Company | Production of penicillins |
| DE2921422C2 (de) * | 1978-12-18 | 1985-04-18 | Bristol-Myers Co., New York, N.Y. | Zwischenprodukte zur Herstellung von Penicillinen und deren Verwendung, Verfahren zur Herstellung derselben |
| US4240960A (en) * | 1979-03-19 | 1980-12-23 | Bristol-Myers Company | Trimethylsilyl substituted penicillins |
| US4310458A (en) * | 1979-03-19 | 1982-01-12 | Bristol-Myers Company | Production of penicillins |
| US4301072A (en) * | 1979-04-20 | 1981-11-17 | American Home Products Corporation | Process for preparing aminopenicillins |
| US4231954A (en) * | 1979-04-20 | 1980-11-04 | American Home Products Corporation | Dane salt and process for preparing aminopenicillins therefrom |
| US4351766A (en) * | 1979-07-12 | 1982-09-28 | Bristol-Myers Company | Production of penicillins |
| JPS60150051U (ja) * | 1984-03-16 | 1985-10-05 | 大塚 寛之 | プリンタ−用ゴムロ−ルの構造 |
| JPH02149653U (enExample) * | 1990-05-10 | 1990-12-20 | ||
| US7230097B2 (en) * | 2003-03-10 | 2007-06-12 | Lupin Ltd. | Process for preparation of 7-[α-Amino (4-hydroxyphenyl) acetamido]-3-substituted-3-cephem-4-carboxylic acid |
-
1968
- 1968-05-08 US US727688A patent/US3654266A/en not_active Expired - Lifetime
-
1969
- 1969-04-24 CA CA049,617A patent/CA992957A/en not_active Expired
- 1969-04-25 IL IL41851A patent/IL41851A/xx unknown
- 1969-04-25 IL IL32078A patent/IL32078A/xx unknown
- 1969-05-06 GB GB1266544D patent/GB1266544A/en not_active Expired
- 1969-05-06 PH PH10287A patent/PH10525A/en unknown
- 1969-05-07 DK DK249669AA patent/DK137760B/da not_active IP Right Cessation
- 1969-05-07 NL NLAANVRAGE6906997,A patent/NL173406C/xx not_active IP Right Cessation
- 1969-05-08 DE DE1923624A patent/DE1923624C3/de not_active Expired
- 1969-05-08 BE BE732769D patent/BE732769A/xx not_active IP Right Cessation
- 1969-05-08 FR FR6914872A patent/FR2008111A1/fr active Pending
- 1969-05-08 BR BR208638/69A patent/BR6908638D0/pt unknown
- 1969-05-08 FI FI1358/69A patent/FI56181C/fi active
- 1969-05-08 SE SE7211003A patent/SE395702B/xx unknown
- 1969-05-08 CH CH707669A patent/CH515933A/de not_active IP Right Cessation
- 1969-05-08 JP JP44035465A patent/JPS518954B1/ja active Pending
- 1969-05-08 SE SE6906553A patent/SE410461B/sv unknown
-
1971
- 1971-07-02 JP JP46048725A patent/JPS5111639B1/ja active Pending
- 1971-07-02 JP JP46048726A patent/JPS5114517B1/ja active Pending
-
1972
- 1972-01-06 DK DK6872A patent/DK143563C/da not_active IP Right Cessation
- 1972-01-06 DK DK7072A patent/DK147127C/da not_active IP Right Cessation
- 1972-04-17 SE SE7205606A patent/SE419088B/xx unknown
- 1972-04-27 SE SE7205607-0A patent/SE419089B/xx unknown
-
1973
- 1973-10-09 PH PH15103A patent/PH11955A/en unknown
- 1973-10-09 PH PH15102A patent/PH11783A/en unknown
-
1975
- 1975-12-30 MY MY61/75A patent/MY7500061A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL173406B (nl) | 1983-08-16 |
| GB1266544A (enExample) | 1972-03-08 |
| DK147127B (da) | 1984-04-16 |
| FI56181B (fi) | 1979-08-31 |
| PH10525A (en) | 1977-05-26 |
| DK137760B (da) | 1978-05-01 |
| JPS5111639B1 (enExample) | 1976-04-13 |
| FI56181C (fi) | 1979-12-10 |
| US3654266A (en) | 1972-04-04 |
| MY7500061A (en) | 1975-12-31 |
| SE395702B (sv) | 1977-08-22 |
| CA992957A (en) | 1976-07-13 |
| SE419088B (sv) | 1981-07-13 |
| SE410461B (sv) | 1979-10-15 |
| FR2008111A1 (enExample) | 1970-01-16 |
| IL41851A (en) | 1974-01-14 |
| PH11783A (en) | 1978-07-05 |
| DK147127C (da) | 1984-10-08 |
| CH515933A (de) | 1971-11-30 |
| SE419089B (sv) | 1981-07-13 |
| IL32078A (en) | 1974-01-14 |
| JPS5114517B1 (enExample) | 1976-05-10 |
| NL173406C (nl) | 1984-01-16 |
| JPS518954B1 (enExample) | 1976-03-22 |
| NL6906997A (enExample) | 1969-11-11 |
| DE1923624A1 (de) | 1969-11-20 |
| DK143563B (da) | 1981-09-07 |
| BE732769A (enExample) | 1969-11-10 |
| DK143563C (da) | 1982-02-08 |
| BR6908638D0 (pt) | 1973-02-08 |
| PH11955A (en) | 1978-09-20 |
| DK137760C (enExample) | 1978-10-09 |
| DE1923624B2 (de) | 1979-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1923624C3 (de) | Verfahren zur Herstellung von Penicillinen | |
| DE1800698C3 (de) | Verfahren zur Herstellung von a-Aminobenzylpenicillin | |
| DE2462383A1 (de) | Verfahren zur herstellung von antibiotischen mitteln | |
| DE2550039A1 (de) | Verfahren zur herstellung von saeurechloriden | |
| DE1960748B2 (de) | Verfahren zur Herstellung von alpha- Aminoacylpenicillansäuren | |
| DE2822876C2 (enExample) | ||
| DE1420981C3 (de) | Verfahren zur Herstellung von 6-Acylaminopenicillansäuren | |
| DD202435A5 (de) | Verbessertes verfahren zur herstellung von penicillansaeureestern | |
| DE2528730A1 (de) | Verfahren zur herstellung von penicillansaeuren und zwischenprodukte zur gewinnung von penicillansaeuren | |
| AT314081B (de) | Verfahren zur Herstellung von Penicillinen | |
| CH627472A5 (de) | Neues verfahren zur herstellung von reinem cefamandol. | |
| DE1770855A1 (de) | Verfahren zur Herstellung von 6-Acylaminopenicillansaeuren | |
| DE2408171C3 (de) | Silyl-oxazolidinon-Verbindungen und Verfahren zu ihrer Herstellung | |
| CH527846A (de) | Verfahren zur Herstellung von Penicillinderivaten | |
| EP0193066B1 (de) | Neue Ketosultame und Verfahren zu ihrer Herstellung | |
| DE2423048A1 (de) | Verfahren zur herstellung eines kristallinen solvats eines alkali- oder erdalkalimetallsalzes von 6-(d-alphaamino-p-hydroxyphenylacetamido) -penicillansaeure | |
| DE2012022B2 (de) | Pivaloyloxymethyl- a -aminophydroxybenzylpenicUlinat und Verfahren zu semer Herstellung | |
| DE1770951A1 (de) | Cyclopentanochinolonderivate und Verfahren zu deren Herstellung | |
| CH628635A5 (en) | Process for the preparation of semisynthetic penicillin antibiotics | |
| DE3018535A1 (de) | Verfahren zur herstellung von 6-d-alpha -amino-p-hydroxyphenylacetamid-penicillansaeure | |
| DE2834698A1 (de) | Verfahren zur herstellung von uracil- derivaten | |
| CH400158A (de) | Verfahren zur Herstellung von Penicillinderivaten | |
| DE1962154A1 (de) | Basisch substituierte Cumarinderivate | |
| DE1958382B2 (de) | 6-(1-aminocyclopenten-1-carboxamido)-penicillansaeuren und 6- (4-oxo-1,3-diazaspiro eckige klammer auf 4,4 eckige klammer zu -nonen-3-yl) -penicillansaeuren, verfahren zu ihrer herstellung und pharmazeutische mittel | |
| DE1445543A1 (de) | Verfahren zur Herstellung von Stoffen mit antibakteriellen Eigenschaften |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BI | Miscellaneous see part 2 | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. DR.JUR. DR.RER.NAT. MARX, L., DIPL.-PHYS. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |