CA992957A - Penicillin preparation - Google Patents
Penicillin preparationInfo
- Publication number
- CA992957A CA992957A CA049,617A CA49617A CA992957A CA 992957 A CA992957 A CA 992957A CA 49617 A CA49617 A CA 49617A CA 992957 A CA992957 A CA 992957A
- Authority
- CA
- Canada
- Prior art keywords
- penicillin preparation
- penicillin
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US72768868A | 1968-05-08 | 1968-05-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA992957A true CA992957A (en) | 1976-07-13 |
Family
ID=24923612
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA049,617A Expired CA992957A (en) | 1968-05-08 | 1969-04-24 | Penicillin preparation |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3654266A (enExample) |
| JP (3) | JPS518954B1 (enExample) |
| BE (1) | BE732769A (enExample) |
| BR (1) | BR6908638D0 (enExample) |
| CA (1) | CA992957A (enExample) |
| CH (1) | CH515933A (enExample) |
| DE (1) | DE1923624C3 (enExample) |
| DK (3) | DK137760B (enExample) |
| FI (1) | FI56181C (enExample) |
| FR (1) | FR2008111A1 (enExample) |
| GB (1) | GB1266544A (enExample) |
| IL (2) | IL32078A (enExample) |
| MY (1) | MY7500061A (enExample) |
| NL (1) | NL173406C (enExample) |
| PH (3) | PH10525A (enExample) |
| SE (4) | SE395702B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4000129A (en) * | 1970-02-18 | 1976-12-28 | Koninklijke Nederlandsche Gist-En Spiritusfabriek N.V. | 6-aminopenicillanic acid sulfoxide silyl esters |
| US3926954A (en) * | 1970-05-27 | 1975-12-16 | Erwin Kiesewetter | Preparation of salts of carboxylic acids containing a beta-lactam groups |
| US3862933A (en) * | 1972-07-12 | 1975-01-28 | Pfizer | Process for making esters of 6-(alpha-(carboxy)aryla-cetamido)penicillanic acids |
| IT1091586B (it) * | 1978-01-04 | 1985-07-06 | Vigano Vittorio | Macchina perfezionata per il piegamento di fogli |
| JPS5576886A (en) * | 1978-12-07 | 1980-06-10 | Mitsubishi Chem Ind Ltd | Synthetic method of penicillin |
| DE2921422C2 (de) * | 1978-12-18 | 1985-04-18 | Bristol-Myers Co., New York, N.Y. | Zwischenprodukte zur Herstellung von Penicillinen und deren Verwendung, Verfahren zur Herstellung derselben |
| US4278600A (en) * | 1979-03-19 | 1981-07-14 | Bristol-Myers Company | Production of penicillins |
| US4240960A (en) * | 1979-03-19 | 1980-12-23 | Bristol-Myers Company | Trimethylsilyl substituted penicillins |
| US4310458A (en) * | 1979-03-19 | 1982-01-12 | Bristol-Myers Company | Production of penicillins |
| US4301072A (en) * | 1979-04-20 | 1981-11-17 | American Home Products Corporation | Process for preparing aminopenicillins |
| US4231954A (en) * | 1979-04-20 | 1980-11-04 | American Home Products Corporation | Dane salt and process for preparing aminopenicillins therefrom |
| US4351766A (en) * | 1979-07-12 | 1982-09-28 | Bristol-Myers Company | Production of penicillins |
| JPS60150051U (ja) * | 1984-03-16 | 1985-10-05 | 大塚 寛之 | プリンタ−用ゴムロ−ルの構造 |
| JPH02149653U (enExample) * | 1990-05-10 | 1990-12-20 | ||
| US7230097B2 (en) * | 2003-03-10 | 2007-06-12 | Lupin Ltd. | Process for preparation of 7-[α-Amino (4-hydroxyphenyl) acetamido]-3-substituted-3-cephem-4-carboxylic acid |
-
1968
- 1968-05-08 US US727688A patent/US3654266A/en not_active Expired - Lifetime
-
1969
- 1969-04-24 CA CA049,617A patent/CA992957A/en not_active Expired
- 1969-04-25 IL IL32078A patent/IL32078A/xx unknown
- 1969-04-25 IL IL41851A patent/IL41851A/xx unknown
- 1969-05-06 PH PH10287A patent/PH10525A/en unknown
- 1969-05-06 GB GB1266544D patent/GB1266544A/en not_active Expired
- 1969-05-07 NL NLAANVRAGE6906997,A patent/NL173406C/xx not_active IP Right Cessation
- 1969-05-07 DK DK249669AA patent/DK137760B/da not_active IP Right Cessation
- 1969-05-08 SE SE7211003A patent/SE395702B/xx unknown
- 1969-05-08 FI FI1358/69A patent/FI56181C/fi active
- 1969-05-08 BE BE732769D patent/BE732769A/xx not_active IP Right Cessation
- 1969-05-08 CH CH707669A patent/CH515933A/de not_active IP Right Cessation
- 1969-05-08 DE DE1923624A patent/DE1923624C3/de not_active Expired
- 1969-05-08 FR FR6914872A patent/FR2008111A1/fr active Pending
- 1969-05-08 SE SE6906553A patent/SE410461B/sv unknown
- 1969-05-08 JP JP44035465A patent/JPS518954B1/ja active Pending
- 1969-05-08 BR BR208638/69A patent/BR6908638D0/pt unknown
-
1971
- 1971-07-02 JP JP46048726A patent/JPS5114517B1/ja active Pending
- 1971-07-02 JP JP46048725A patent/JPS5111639B1/ja active Pending
-
1972
- 1972-01-06 DK DK6872A patent/DK143563C/da not_active IP Right Cessation
- 1972-01-06 DK DK7072A patent/DK147127C/da not_active IP Right Cessation
- 1972-04-17 SE SE7205606A patent/SE419088B/xx unknown
- 1972-04-27 SE SE7205607-0A patent/SE419089B/xx unknown
-
1973
- 1973-10-09 PH PH15103A patent/PH11955A/en unknown
- 1973-10-09 PH PH15102A patent/PH11783A/en unknown
-
1975
- 1975-12-30 MY MY61/75A patent/MY7500061A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PH11955A (en) | 1978-09-20 |
| US3654266A (en) | 1972-04-04 |
| FI56181B (fi) | 1979-08-31 |
| BR6908638D0 (pt) | 1973-02-08 |
| SE419089B (sv) | 1981-07-13 |
| NL173406B (nl) | 1983-08-16 |
| DK147127B (da) | 1984-04-16 |
| CH515933A (de) | 1971-11-30 |
| PH11783A (en) | 1978-07-05 |
| FI56181C (fi) | 1979-12-10 |
| IL41851A (en) | 1974-01-14 |
| DK143563C (da) | 1982-02-08 |
| NL173406C (nl) | 1984-01-16 |
| NL6906997A (enExample) | 1969-11-11 |
| FR2008111A1 (enExample) | 1970-01-16 |
| DK147127C (da) | 1984-10-08 |
| SE410461B (sv) | 1979-10-15 |
| JPS5114517B1 (enExample) | 1976-05-10 |
| SE395702B (sv) | 1977-08-22 |
| BE732769A (enExample) | 1969-11-10 |
| IL32078A (en) | 1974-01-14 |
| MY7500061A (en) | 1975-12-31 |
| DK143563B (da) | 1981-09-07 |
| DE1923624A1 (de) | 1969-11-20 |
| JPS518954B1 (enExample) | 1976-03-22 |
| DK137760B (da) | 1978-05-01 |
| GB1266544A (enExample) | 1972-03-08 |
| DE1923624C3 (de) | 1979-11-08 |
| DE1923624B2 (de) | 1979-03-15 |
| SE419088B (sv) | 1981-07-13 |
| DK137760C (enExample) | 1978-10-09 |
| PH10525A (en) | 1977-05-26 |
| JPS5111639B1 (enExample) | 1976-04-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA992957A (en) | Penicillin preparation | |
| CA960658A (en) | Penicillins | |
| CA1024982A (en) | Penicillins | |
| AU2270267A (en) | Croplifter | |
| AU437380B2 (en) | Penicillin preparation | |
| AU5414769A (en) | Penicillin preparation | |
| AU430970B2 (en) | Penicillin derivatives | |
| AU444096B2 (en) | Penicillin derivatives | |
| CA931091A (en) | Antibiotique et sa preparation | |
| CA784689A (en) | Antibiotique et sa preparation | |
| AU444889B2 (en) | Penicillins | |
| CA801733A (en) | Penicillins | |
| CA781463A (en) | Penicillins | |
| AU426894B2 (en) | Penicillins | |
| CA781461A (en) | Penicillins | |
| CA787896A (en) | Penicillins | |
| CA960216A (en) | Novel pyrido-pyrimidinones | |
| AU6340969A (en) | Penicillin derivatives | |
| CA778399A (en) | Vinyllead compounds | |
| CA802906A (en) | 1-cyclopropylmethyl-4-phenylpiperidine compounds | |
| CA802240A (en) | Polycycloalkene compounds | |
| CA797850A (en) | N-allyl-4-phenyl-piperidine compounds | |
| CA789551A (en) | Quinolylbenzothiazole compounds | |
| CA776707A (en) | Phosphato-phosphorus compounds | |
| CA971966A (en) | N-arylaminoethyl-4-pyridine compounds |