DE1811411C3 - Aromatische Polyamide - Google Patents
Aromatische PolyamideInfo
- Publication number
- DE1811411C3 DE1811411C3 DE1811411A DE1811411A DE1811411C3 DE 1811411 C3 DE1811411 C3 DE 1811411C3 DE 1811411 A DE1811411 A DE 1811411A DE 1811411 A DE1811411 A DE 1811411A DE 1811411 C3 DE1811411 C3 DE 1811411C3
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- amino
- quinazolone
- aminophenoxy
- aromatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004760 aramid Substances 0.000 title claims description 9
- 229920003235 aromatic polyamide Polymers 0.000 title claims description 9
- 239000004952 Polyamide Substances 0.000 claims description 37
- 229920002647 polyamide Polymers 0.000 claims description 37
- -1 7-amino-2- (m-aminophenyl) -3-methyl- 4 (3H) -quinazolone Chemical compound 0.000 claims description 33
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 13
- 150000004985 diamines Chemical class 0.000 claims description 12
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 claims description 7
- 238000002844 melting Methods 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 239000003495 polar organic solvent Substances 0.000 claims description 5
- 150000004984 aromatic diamines Chemical class 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- NVILBQSOVYAXDI-UHFFFAOYSA-N 7-amino-2-(3-aminophenyl)-3-phenylquinazolin-4-one Chemical compound NC1=CC=C2C(N(C(=NC2=C1)C1=CC(=CC=C1)N)C1=CC=CC=C1)=O NVILBQSOVYAXDI-UHFFFAOYSA-N 0.000 claims description 3
- QCRPGJVUDRRQOE-UHFFFAOYSA-N NC(C=C1)=CC=C1S(C1=CC=CC(C(N2C3=CC=CC=C3)=NC3=CC(N)=CC=C3C2=O)=C1)(=O)=O Chemical compound NC(C=C1)=CC=C1S(C1=CC=CC(C(N2C3=CC=CC=C3)=NC3=CC(N)=CC=C3C2=O)=C1)(=O)=O QCRPGJVUDRRQOE-UHFFFAOYSA-N 0.000 claims description 3
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 claims description 3
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 claims description 2
- LXAAZYAEMBSRIA-UHFFFAOYSA-N 7-amino-2-[4-(4-aminophenoxy)phenyl]-3-ethylquinazolin-4-one Chemical compound NC1=CC=C(OC2=CC=C(C=C2)C2=NC3=CC(=CC=C3C(N2CC)=O)N)C=C1 LXAAZYAEMBSRIA-UHFFFAOYSA-N 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 229940018564 m-phenylenediamine Drugs 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 238000006068 polycondensation reaction Methods 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 claims 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 229910001628 calcium chloride Inorganic materials 0.000 claims 1
- 239000001110 calcium chloride Substances 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 claims 1
- 229910001623 magnesium bromide Inorganic materials 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 229920000642 polymer Polymers 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N terephthalic acid group Chemical group C(C1=CC=C(C(=O)O)C=C1)(=O)O KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims 1
- 150000003852 triazoles Chemical class 0.000 claims 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 10
- 230000000052 comparative effect Effects 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- FJVAQPINJBFBLI-UHFFFAOYSA-N 3-methylquinazolin-4-one Chemical compound C1=CC=C2C(=O)N(C)C=NC2=C1 FJVAQPINJBFBLI-UHFFFAOYSA-N 0.000 description 4
- WAIHFZPSLVDBRV-UHFFFAOYSA-N 3-phenylquinazolin-4-one Chemical compound C1=NC2=CC=CC=C2C(=O)N1C1=CC=CC=C1 WAIHFZPSLVDBRV-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- VIXWGKYSYIBATJ-UHFFFAOYSA-N pyrrol-2-one Chemical compound O=C1C=CC=N1 VIXWGKYSYIBATJ-UHFFFAOYSA-N 0.000 description 4
- RUCHWTKMOWXHLU-UHFFFAOYSA-N 5-nitroanthranilic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(O)=O RUCHWTKMOWXHLU-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 2
- BMFONNKQZRYQSO-UHFFFAOYSA-N 3-ethylquinazolin-4-one Chemical compound C1=CC=C2C(=O)N(CC)C=NC2=C1 BMFONNKQZRYQSO-UHFFFAOYSA-N 0.000 description 2
- KCEVANTVMCPDQV-UHFFFAOYSA-N 4,5-dinitro-3H-quinazolin-2-one Chemical compound [N+](=O)([O-])C1=C2C(=NC(NC2=CC=C1)=O)[N+](=O)[O-] KCEVANTVMCPDQV-UHFFFAOYSA-N 0.000 description 2
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical group CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 2
- UEALKTCRMBVTFN-UHFFFAOYSA-N 4-nitroanthranilic acid Chemical compound NC1=CC([N+]([O-])=O)=CC=C1C(O)=O UEALKTCRMBVTFN-UHFFFAOYSA-N 0.000 description 2
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical class C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- ZYEDGEXYGKWJPB-UHFFFAOYSA-N 4-[2-(4-aminophenyl)propan-2-yl]aniline Chemical compound C=1C=C(N)C=CC=1C(C)(C)C1=CC=C(N)C=C1 ZYEDGEXYGKWJPB-UHFFFAOYSA-N 0.000 description 1
- JLNMBIKJQAKQBH-UHFFFAOYSA-N 4-cyclohexylaniline Chemical compound C1=CC(N)=CC=C1C1CCCCC1 JLNMBIKJQAKQBH-UHFFFAOYSA-N 0.000 description 1
- QCKNVACNSFYGQV-UHFFFAOYSA-N 6-amino-2-(3-aminophenyl)-3-methylquinazolin-4-one Chemical compound NC=1C=C(C=CC1)C1=NC2=CC=C(C=C2C(N1C)=O)N QCKNVACNSFYGQV-UHFFFAOYSA-N 0.000 description 1
- BXMWFWBQBVECBW-UHFFFAOYSA-N 6-amino-2-(3-aminophenyl)-3-phenylquinazolin-4-one Chemical compound NC1=CC=CC(C=2N(C(=O)C3=CC(N)=CC=C3N=2)C=2C=CC=CC=2)=C1 BXMWFWBQBVECBW-UHFFFAOYSA-N 0.000 description 1
- UKTDIKKCIOSCLE-UHFFFAOYSA-N 6-amino-2-[4-(4-aminophenoxy)phenyl]-3-phenylquinazolin-4-one Chemical compound NC1=CC=C(OC2=CC=C(C=C2)C2=NC3=CC=C(C=C3C(N2C2=CC=CC=C2)=O)N)C=C1 UKTDIKKCIOSCLE-UHFFFAOYSA-N 0.000 description 1
- PTXGLFNCPFRNII-UHFFFAOYSA-N 7-amino-2-(4-aminophenyl)-3-phenylquinazolin-4-one Chemical compound NC1=CC=C(C=C1)C1=NC2=CC(=CC=C2C(N1C1=CC=CC=C1)=O)N PTXGLFNCPFRNII-UHFFFAOYSA-N 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- SSTTVWQXGSUVBO-UHFFFAOYSA-N NC1=CC=C(OC2=CC=C(C=C2)C2=NC3=CC=C(C=C3C(N2CC)=O)N)C=C1 Chemical compound NC1=CC=C(OC2=CC=C(C=C2)C2=NC3=CC=C(C=C3C(N2CC)=O)N)C=C1 SSTTVWQXGSUVBO-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- OETHQSJEHLVLGH-UHFFFAOYSA-N metformin hydrochloride Chemical compound Cl.CN(C)C(=N)N=C(N)N OETHQSJEHLVLGH-UHFFFAOYSA-N 0.000 description 1
- DFFZOPXDTCDZDP-UHFFFAOYSA-N naphthalene-1,5-dicarboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1C(O)=O DFFZOPXDTCDZDP-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000008646 thermal stress Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/32—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids from aromatic diamines and aromatic dicarboxylic acids with both amino and carboxylic groups aromatically bound
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1811411A DE1811411C3 (de) | 1968-11-28 | 1968-11-28 | Aromatische Polyamide |
| GB1227509D GB1227509A (cg-RX-API-DMAC7.html) | 1968-11-28 | 1969-10-29 | |
| US878237A US3671614A (en) | 1968-11-28 | 1969-11-19 | Aromatic polyamides containing the quinazolone ring |
| NL6917742.A NL164071C (nl) | 1968-11-28 | 1969-11-25 | Werkwijze voor de bereiding van aromatische polyamiden, alsmede gevormd voortbrengsel, dat geheel of ten dele uit deze polyamiden bestaat. |
| BE742311D BE742311A (cg-RX-API-DMAC7.html) | 1968-11-28 | 1969-11-27 | |
| FR6941254A FR2024445A1 (cg-RX-API-DMAC7.html) | 1968-11-28 | 1969-11-28 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1811411A DE1811411C3 (de) | 1968-11-28 | 1968-11-28 | Aromatische Polyamide |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1811411A1 DE1811411A1 (de) | 1970-06-25 |
| DE1811411B2 DE1811411B2 (de) | 1980-01-31 |
| DE1811411C3 true DE1811411C3 (de) | 1980-11-06 |
Family
ID=5714591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1811411A Expired DE1811411C3 (de) | 1968-11-28 | 1968-11-28 | Aromatische Polyamide |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3671614A (cg-RX-API-DMAC7.html) |
| BE (1) | BE742311A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1811411C3 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2024445A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1227509A (cg-RX-API-DMAC7.html) |
| NL (1) | NL164071C (cg-RX-API-DMAC7.html) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE374121B (cg-RX-API-DMAC7.html) * | 1970-10-29 | 1975-02-24 | Montedison Spa | |
| DE2208811C2 (de) * | 1972-02-24 | 1982-05-19 | Vsesojuznyj naučno-issledovatel'skij institut iskusstvennogo volokna, Mytišči, Moskovskaja oblast' | Aromatische Polyamide |
| CH562273A5 (cg-RX-API-DMAC7.html) * | 1972-03-07 | 1975-05-30 | Ciba Geigy Ag | |
| DE2248663A1 (de) * | 1972-10-04 | 1974-04-11 | Bayer Ag | Aromatische copolyamide und daraus hergestellte faeden mit hohem elastizitaetsmodul und hoher reissfestigkeit |
| DE2248662A1 (de) * | 1972-10-04 | 1974-04-18 | Bayer Ag | Loesliche aromatische copolyamide und daraus hergestellte faeden mit hohem elastizitaetsmodul und hoher reissfestigkeit |
| DE2259123A1 (de) * | 1972-12-02 | 1974-06-06 | Bayer Ag | Chinazolindion-strukturen enthaltende copolyamide |
| US3991015A (en) * | 1973-05-18 | 1976-11-09 | Bayer Aktiengesellschaft | High molecular weight copolyamides containing quinazoline dione units |
| US3925310A (en) * | 1973-05-18 | 1975-12-09 | Bayer Ag | High molecular weight copolyamides containing hydantoin units |
| US7144119B2 (en) * | 1996-04-25 | 2006-12-05 | Bioarray Solutions Ltd. | System and method for programmable illumination pattern generation |
| US7057704B2 (en) * | 2000-09-17 | 2006-06-06 | Bioarray Solutions Ltd. | System and method for programmable illumination pattern generation |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1720754B2 (de) * | 1967-11-28 | 1980-01-24 | Bayer Ag, 5090 Leverkusen | Aromatische Polyamide |
-
1968
- 1968-11-28 DE DE1811411A patent/DE1811411C3/de not_active Expired
-
1969
- 1969-10-29 GB GB1227509D patent/GB1227509A/en not_active Expired
- 1969-11-19 US US878237A patent/US3671614A/en not_active Expired - Lifetime
- 1969-11-25 NL NL6917742.A patent/NL164071C/xx active
- 1969-11-27 BE BE742311D patent/BE742311A/xx unknown
- 1969-11-28 FR FR6941254A patent/FR2024445A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| NL164071B (nl) | 1980-06-16 |
| DE1811411B2 (de) | 1980-01-31 |
| BE742311A (cg-RX-API-DMAC7.html) | 1970-05-04 |
| NL6917742A (cg-RX-API-DMAC7.html) | 1970-06-01 |
| US3671614A (en) | 1972-06-20 |
| FR2024445A1 (cg-RX-API-DMAC7.html) | 1970-08-28 |
| NL164071C (nl) | 1980-11-17 |
| GB1227509A (cg-RX-API-DMAC7.html) | 1971-04-07 |
| DE1811411A1 (de) | 1970-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1811411C3 (de) | Aromatische Polyamide | |
| DE1420681B2 (de) | Verfahren zur herstellung aromatischer polyamide | |
| DE3718212A1 (de) | Verfahren zur herstellung von aromatischen polyamiden und polybenzoxazolen | |
| DE1745165A1 (de) | Heteroxyclisches Amidpolymerisat und Verfahren zu dessen Herstellung | |
| DE2144126C3 (de) | Hochmolekulare aromatische Polyamide und Fäden aus ihnen | |
| DE2047933C3 (de) | Verfahren zur Herstellung von aromatischen Polybenzimidazolen | |
| DE1720754B2 (de) | Aromatische Polyamide | |
| DE1765738C3 (de) | Isolierender Überzug auf einem elektrischen Leiter | |
| DE1946790A1 (de) | Hochmolekulare aromatische Polyamide mit Phenoythiin- oder Phenoxthiin-S-dioxid-Strukturen | |
| DE1720687C3 (de) | Aromatische Polyamide | |
| DE2433907C2 (de) | Polymere Imidazolone | |
| DE2009741A1 (en) | High molecular aromatic copolyamides | |
| EP0281954A1 (de) | Aromatische Polyamide auf Basis von Phenoxyterephthalsäure und Verfahren zu ihrer Herstellung | |
| DE1720728A1 (de) | Aromatische Polyamide und Verfahren zu ihrer Herstellung | |
| DE3125233C2 (de) | Verfahren zur Herstellung von Polymeren auf Basis von Polychinazolonen | |
| DE1953358B2 (de) | Aromatische Copolyamide | |
| DE1795319C3 (de) | Verfahren zur Herstellung von Polybenzimidazolen und deren Verwendung | |
| DE2346227A1 (de) | Neue carboxamid-sulfonamid-polykondensate | |
| DE1720686C3 (de) | Aromatische Polyamide | |
| DE1595677A1 (de) | Verfahren zur Herstellung von hochschmelzenden Polyamiden | |
| DE1933787A1 (de) | Hochmolekulare Polychinazolone und Verfahren zu ihrer Herstellung | |
| DE1720707A1 (de) | Verfahren zur Herstellung von hochmolekularen aromatischen Polyamiden | |
| DE2248662A1 (de) | Loesliche aromatische copolyamide und daraus hergestellte faeden mit hohem elastizitaetsmodul und hoher reissfestigkeit | |
| DE2507380A1 (de) | Neue aromatische iminpolymere und verfahren zu ihrer herstellung | |
| DE2737522A1 (de) | Polymer und praepolymer sowie verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |