DE1793381C - - Google Patents
Info
- Publication number
- DE1793381C DE1793381C DE1793381C DE 1793381 C DE1793381 C DE 1793381C DE 1793381 C DE1793381 C DE 1793381C
- Authority
- DE
- Germany
- Prior art keywords
- acid
- oxo
- benzyl
- cyclohexanepropionic
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- -1 2 - Oxo -1 - benzyl - cyclohexanepropionic acid sodium salt Chemical compound 0.000 claims description 15
- QQWBGHWKTDIMCX-UHFFFAOYSA-N 3-(1-benzyl-2-oxocyclohexyl)propanoic acid Chemical class C=1C=CC=CC=1CC1(CCC(=O)O)CCCCC1=O QQWBGHWKTDIMCX-UHFFFAOYSA-N 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- 239000002253 acid Substances 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- 238000003756 stirring Methods 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 210000000941 bile Anatomy 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- OVGORFFCBUIFIA-UHFFFAOYSA-N Fenipentol Chemical compound CCCCC(O)C1=CC=CC=C1 OVGORFFCBUIFIA-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 230000001989 choleretic effect Effects 0.000 description 5
- 125000001664 diethylamino group Chemical class [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000000731 choleretic agent Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- CUYLPYBYCYQGCE-UHFFFAOYSA-N 2-benzylcyclohexan-1-one Chemical compound O=C1CCCCC1CC1=CC=CC=C1 CUYLPYBYCYQGCE-UHFFFAOYSA-N 0.000 description 2
- OHXPGWPVLFPUSM-KLRNGDHRSA-N 3,7,12-trioxo-5beta-cholanic acid Chemical compound C1CC(=O)C[C@H]2CC(=O)[C@H]3[C@@H]4CC[C@H]([C@@H](CCC(O)=O)C)[C@@]4(C)C(=O)C[C@@H]3[C@]21C OHXPGWPVLFPUSM-KLRNGDHRSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- PLPYCZHDXQANQN-UHFFFAOYSA-N COC(=O)CCC1(C(CCCC1)=O)CC1=CC=CC=C1 Chemical compound COC(=O)CCC1(C(CCCC1)=O)CC1=CC=CC=C1 PLPYCZHDXQANQN-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 210000001953 common bile duct Anatomy 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229960002997 dehydrocholic acid Drugs 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000029142 excretion Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- YDDUMTOHNYZQPO-FCXRPNKRSA-N 1,3-bis[[(e)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-4,5-dihydroxycyclohexane-1-carboxylic acid Chemical compound OC1C(O)CC(C(O)=O)(OC(=O)\C=C\C=2C=C(O)C(O)=CC=2)CC1OC(=O)\C=C\C1=CC=C(O)C(O)=C1 YDDUMTOHNYZQPO-FCXRPNKRSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- UEHKDTFMDMCQOE-UHFFFAOYSA-N 2-benzylcyclohexan-1-one propanoic acid Chemical compound C(CC)(=O)O.O=C1C(CCCC1)CC1=CC=CC=C1 UEHKDTFMDMCQOE-UHFFFAOYSA-N 0.000 description 1
- XEBOVYWLIDTDQE-UHFFFAOYSA-N 3-[1-[(2-chlorophenyl)methyl]-2-oxocyclohexyl]propanoic acid Chemical compound C=1C=CC=C(Cl)C=1CC1(CCC(=O)O)CCCCC1=O XEBOVYWLIDTDQE-UHFFFAOYSA-N 0.000 description 1
- BQRWJPVPSAFIRY-UHFFFAOYSA-N 3-[1-[(2-methoxyphenyl)methyl]-2-oxocyclohexyl]propanoic acid Chemical compound COC1=CC=CC=C1CC1(CCC(O)=O)C(=O)CCCC1 BQRWJPVPSAFIRY-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- YDDUMTOHNYZQPO-RVXRWRFUSA-N Cynarine Chemical compound O([C@@H]1C[C@@](C[C@H]([C@@H]1O)O)(OC(=O)\C=C\C=1C=C(O)C(O)=CC=1)C(O)=O)C(=O)\C=C\C1=CC=C(O)C(O)=C1 YDDUMTOHNYZQPO-RVXRWRFUSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- WJAASTDRAAMYNK-UHFFFAOYSA-N benzyl carbamimidothioate;hydron;chloride Chemical compound Cl.NC(=N)SCC1=CC=CC=C1 WJAASTDRAAMYNK-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000008845 cholagoga Substances 0.000 description 1
- 229940124571 cholagogue Drugs 0.000 description 1
- 150000001851 cinnamic acid derivatives Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- HJZLEGIHUQOJBA-UHFFFAOYSA-N cyclohexane propionic acid Chemical class OC(=O)CCC1CCCCC1 HJZLEGIHUQOJBA-UHFFFAOYSA-N 0.000 description 1
- 229950009125 cynarine Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- HPLFQKUIHGZHPH-UHFFFAOYSA-N fencibutirol Chemical compound C1CC(C(C(O)=O)CC)(O)CCC1C1=CC=CC=C1 HPLFQKUIHGZHPH-UHFFFAOYSA-N 0.000 description 1
- 229950000795 fencibutirol Drugs 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- HXXRFEYZOBSAJK-UHFFFAOYSA-N hexane;propanoic acid Chemical compound CCC(O)=O.CCCCCC HXXRFEYZOBSAJK-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- VJINJXFHNHCOOT-UHFFFAOYSA-L magnesium;4-(4-methoxynaphthalen-1-yl)-4-oxobutanoate Chemical group [Mg+2].C1=CC=C2C(OC)=CC=C(C(=O)CCC([O-])=O)C2=C1.C1=CC=C2C(OC)=CC=C(C(=O)CCC([O-])=O)C2=C1 VJINJXFHNHCOOT-UHFFFAOYSA-L 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- KQEVIFKPZOGBMZ-UHFFFAOYSA-N methyl 3-bromopropanoate Chemical compound COC(=O)CCBr KQEVIFKPZOGBMZ-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- ZIKJCAPMXXTMDD-UHFFFAOYSA-M sodium;2-(1-hydroxycyclohexyl)butanoate Chemical compound [Na+].CCC(C([O-])=O)C1(O)CCCCC1 ZIKJCAPMXXTMDD-UHFFFAOYSA-M 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH619205A5 (Direct) | ||
| CH637404A5 (de) | Verfahren zur herstellung von 17-alpha-pregnenderivaten. | |
| CH626880A5 (Direct) | ||
| DE1793381C (Direct) | ||
| DE1468201B1 (de) | phenoxy-essigsaeure-Verbindungen und Verfahren zu ihrer Herstellung | |
| DE2500808B2 (de) | 4-cyclopropylmethylenoxy-3-chlorphenylessigsaeure und ihre salze, verfahren zu deren herstellung sowie diese enthaltende arzneimittel | |
| DE2328060B2 (de) | 5-substituierte 3-Methylbenzo eckige Klammer auf b eckige Klammer zuthienyl (2)-essigsauren, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1055007B (de) | Verfahren zur Herstellung von 3-Aminothiophen-2-carbonsaeureestern und den entsprechenden freien Carbonsaeuren | |
| DE2907379A1 (de) | Benzylidenderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE2251556C3 (de) | Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE1793381B1 (de) | 2-Oxo-1-benzyl-cyclohexanpropionsaeuren und deren Salze | |
| DE1291332B (de) | Verfahren zur Herstellung von 1-Phenyl-1-cycloalkyl-ªÏ-dimethylaminoalkanen mit appetitzuegelnden Eigenschaften | |
| DE1593315C (Direct) | ||
| DE1593113C3 (de) | 4-(2-Nitro-l-aIkenyl)-phenoxyessigsäuren, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2728248A1 (de) | Nitroxolinderivate | |
| DE2025819A1 (de) | alpha-Aminopenicillinverbindungen und Verfahren zu ihrer Herstellung | |
| EP0034746B1 (de) | 5-Sulfamoyl-orthanilsäuren, Verfahren zu ihrer Herstellung, diese enthaltende Heilmittel und die Verbindungen zur Verwendung als Heilmittel | |
| DE951364C (de) | Verfahren zur Herstellung von schwefelhaltigen Abkoemmlingen der Barbitursaeure | |
| DE2430077C3 (de) | 2"- eckige Klammer auf 3' - (2-Benzofuroyl) phenyl eckige Klammer zu propionsäure, ihre optisch aktiven Isomere, ihre pharmakologisch unbedenklichen niederen Alkylester, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel | |
| DE2243305C3 (de) | Neue Derivate von Phenylessigsäure, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen, die die Derivate als Wirkstoff enthalten | |
| DE1917036C3 (de) | N-Acyl-N-(substituiertes)phenyl-4amino-buttersäuren und deren Salze, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| AT207373B (de) | Verfahren zur Herstellung von Äthyleniminderivaten | |
| DE1593069B2 (de) | Eckige Klammer auf (2,2-Diacylvinyl)phenoxy eckige Klammer zu -essigsauren, Salze und Ester dieser Säuren, Verfahren zur Herstellung dieser Verbindungen und diese Verbindungen enthaltende Arzneimittel | |
| DE1146066B (de) | Verfahren zur Herstellung von therapeutisch wirksamem N-(ª-Phenylbutyryl)-dl-methionin und N-(ª-Phenylbutyryl)-taurin | |
| DE2029991B2 (de) | 2-hydroxy-5-aminobenzamide, verfahren zu ihrer herstellung und arzneimittel, die diese verbindungen enthalten |