DE1793364A1 - Basische alpha-Nortricyclyl-(3)-benzyl-aether,ihre quartaeren Salze und N-Oxide und pharmazeutische Produkte hieraus - Google Patents
Basische alpha-Nortricyclyl-(3)-benzyl-aether,ihre quartaeren Salze und N-Oxide und pharmazeutische Produkte hierausInfo
- Publication number
- DE1793364A1 DE1793364A1 DE19681793364 DE1793364A DE1793364A1 DE 1793364 A1 DE1793364 A1 DE 1793364A1 DE 19681793364 DE19681793364 DE 19681793364 DE 1793364 A DE1793364 A DE 1793364A DE 1793364 A1 DE1793364 A1 DE 1793364A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- methyl
- carbon atoms
- hydrogen
- oxides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003839 salts Chemical group 0.000 title claims description 13
- 150000001204 N-oxides Chemical group 0.000 title claims description 8
- 239000000825 pharmaceutical preparation Chemical group 0.000 title claims description 4
- 229940127557 pharmaceutical product Drugs 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 239000000126 substance Substances 0.000 claims description 10
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 9
- -1 piperidino, morpholino Chemical group 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 2
- 239000000654 additive Substances 0.000 claims 1
- 210000003608 fece Anatomy 0.000 claims 1
- 239000010871 livestock manure Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 238000002360 preparation method Methods 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 230000002048 spasmolytic effect Effects 0.000 description 9
- 208000005392 Spasm Diseases 0.000 description 8
- 239000000203 mixture Substances 0.000 description 6
- XQYZDYMELSJDRZ-UHFFFAOYSA-N papaverine Chemical compound C1=C(OC)C(OC)=CC=C1CC1=NC=CC2=CC(OC)=C(OC)C=C12 XQYZDYMELSJDRZ-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Substances OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 4
- 229960002362 neostigmine Drugs 0.000 description 4
- LULNWZDBKTWDGK-UHFFFAOYSA-M neostigmine bromide Chemical compound [Br-].CN(C)C(=O)OC1=CC=CC([N+](C)(C)C)=C1 LULNWZDBKTWDGK-UHFFFAOYSA-M 0.000 description 4
- 230000002276 neurotropic effect Effects 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- BOCNKEKVCTZYIX-UHFFFAOYSA-M 2-[1-(5-bicyclo[2.2.1]hept-2-enyl)-1-phenylethoxy]ethyl-diethyl-methylazanium;bromide Chemical compound [Br-].C1C(C=C2)CC2C1C(C)(OCC[N+](C)(CC)CC)C1=CC=CC=C1 BOCNKEKVCTZYIX-UHFFFAOYSA-M 0.000 description 3
- RYOOHIUJEJZCFT-UHFFFAOYSA-N 2-[2-(diethylamino)ethylamino]-2-phenylacetic acid 3-methylbutyl ester Chemical compound CCN(CC)CCNC(C(=O)OCCC(C)C)C1=CC=CC=C1 RYOOHIUJEJZCFT-UHFFFAOYSA-N 0.000 description 3
- 229930008281 A03AD01 - Papaverine Natural products 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229960001789 papaverine Drugs 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 2
- 229910002012 Aerosil® Inorganic materials 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 2
- 229910001626 barium chloride Inorganic materials 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229950003212 ciclonium bromide Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- WNRWEBKEQARBKV-UHFFFAOYSA-N 1-(2-chloroethyl)piperidine Chemical compound ClCCN1CCCCC1 WNRWEBKEQARBKV-UHFFFAOYSA-N 0.000 description 1
- WRYDGMWSKBGVHS-UHFFFAOYSA-N 2-bromo-n,n-diethylethanamine Chemical compound CCN(CC)CCBr WRYDGMWSKBGVHS-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 1
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PQMWYJDJHJQZDE-UHFFFAOYSA-M Methantheline bromide Chemical compound [Br-].C1=CC=C2C(C(=O)OCC[N+](C)(CC)CC)C3=CC=CC=C3OC2=C1 PQMWYJDJHJQZDE-UHFFFAOYSA-M 0.000 description 1
- GQKZBCPTCWJTAS-UHFFFAOYSA-N Methyl benzyl ether Natural products COCC1=CC=CC=C1 GQKZBCPTCWJTAS-UHFFFAOYSA-N 0.000 description 1
- 208000007101 Muscle Cramp Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000001410 anti-tremor Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- KDQPSPMLNJTZAL-UHFFFAOYSA-L disodium hydrogenphosphate dihydrate Chemical compound O.O.[Na+].[Na+].OP([O-])([O-])=O KDQPSPMLNJTZAL-UHFFFAOYSA-L 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 230000003170 musculotropic effect Effects 0.000 description 1
- 230000000956 myotropic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- BYTCDABWEGFPLT-UHFFFAOYSA-L potassium;sodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[K+] BYTCDABWEGFPLT-UHFFFAOYSA-L 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- BBMHARZCALWXSL-UHFFFAOYSA-M sodium dihydrogenphosphate monohydrate Chemical compound O.[Na+].OP(O)([O-])=O BBMHARZCALWXSL-UHFFFAOYSA-M 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681793364 DE1793364A1 (de) | 1968-09-06 | 1968-09-06 | Basische alpha-Nortricyclyl-(3)-benzyl-aether,ihre quartaeren Salze und N-Oxide und pharmazeutische Produkte hieraus |
| AT802669A AT296249B (de) | 1968-09-06 | 1969-08-21 | Verfahren zur Herstellung neuer basischer α-Nortricyclyl-(3)-benzyl-äther, ihrer Säureadditionssalze, quartären Salze und N-Oxyde |
| US857272A US3686311A (en) | 1968-09-06 | 1969-08-21 | Basic {60 -nortricyclyl-(3)-benzyl ether, and the salts thereof |
| LU59333D LU59333A1 (enExample) | 1968-09-06 | 1969-08-21 | |
| IL32882A IL32882A0 (en) | 1968-09-06 | 1969-08-22 | Dialkylaminoalkyl ethers of alpha-(nortricyclyl-3)-benzyl alcohol and salts,quaternary ammonium salts and n-oxides thereof their preparation and pharmaceutical preparations comprising them |
| ES370977A ES370977A1 (es) | 1968-09-06 | 1969-08-29 | Procedimiento para la fabricacion de esteres basicos alfa- norticiclin-(3)-bencilico, sus sales cuaternarias y oxidos- n. |
| CH1327669A CH545767A (enExample) | 1968-09-06 | 1969-09-02 | |
| GB43518/69A GB1240943A (en) | 1968-09-06 | 1969-09-03 | BASIC alpha-NORTRICYCLYL-(3)-BENZYL ETHERS AND SALTS, QUATERNARY AMMONIUM SALTS AND N-OXIDES THEREOF, PROCESSES FOR THE PRODUCTION THEREOF, AND PHARMACEUTICAL COMPOSITIONS CONTAINING THE SAME |
| FR6930160A FR2017501A1 (enExample) | 1968-09-06 | 1969-09-04 | |
| NL6913584A NL6913584A (enExample) | 1968-09-06 | 1969-09-05 | |
| SU1360611A SU375844A1 (ru) | 1969-09-05 | СССРЗависимый от иатента № — За влено 05.IX.1969 (№ 1360611/23-4)М. Кл. С 07с 101/42УДК 547.581.2.07(088.8)Иностранцы(Федеративна Республика Германии) | |
| BR212200/69A BR6912200D0 (pt) | 1968-09-06 | 1969-09-05 | Processo para a preparacao de eteres basicos alfa notricidil 3 benzilicos |
| BE738449D BE738449A (enExample) | 1968-09-06 | 1969-09-05 | |
| OA53723A OA03379A (fr) | 1968-09-06 | 1969-09-06 | Procédés de préparation des esthers basiques. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681793364 DE1793364A1 (de) | 1968-09-06 | 1968-09-06 | Basische alpha-Nortricyclyl-(3)-benzyl-aether,ihre quartaeren Salze und N-Oxide und pharmazeutische Produkte hieraus |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1793364A1 true DE1793364A1 (de) | 1972-01-27 |
Family
ID=5707679
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681793364 Pending DE1793364A1 (de) | 1968-09-06 | 1968-09-06 | Basische alpha-Nortricyclyl-(3)-benzyl-aether,ihre quartaeren Salze und N-Oxide und pharmazeutische Produkte hieraus |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3686311A (enExample) |
| AT (1) | AT296249B (enExample) |
| BE (1) | BE738449A (enExample) |
| BR (1) | BR6912200D0 (enExample) |
| CH (1) | CH545767A (enExample) |
| DE (1) | DE1793364A1 (enExample) |
| ES (1) | ES370977A1 (enExample) |
| FR (1) | FR2017501A1 (enExample) |
| GB (1) | GB1240943A (enExample) |
| IL (1) | IL32882A0 (enExample) |
| LU (1) | LU59333A1 (enExample) |
| NL (1) | NL6913584A (enExample) |
| OA (1) | OA03379A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1637537A1 (de) * | 2004-09-17 | 2006-03-22 | Riemser Arzneimittel AG | Neue Arzneimittel |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2413814C3 (de) * | 1974-03-22 | 1979-10-04 | Asta-Werke Ag Chemische Fabrik, 4800 Bielefeld | Aminoalkyläther von Aryl-(tricycloheptyliden)-methanen und ihre Salze, Herstellungsverfahren und Arzneimittel |
| US4124716A (en) * | 1974-03-22 | 1978-11-07 | Asta-Werke Aktiengesellschaft | Process for the treatment of spasmodic conditions in humans |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2812327A (en) * | 1954-04-14 | 1957-11-05 | Thomae Gmbh Dr K | Basic ethers of carbinols substituted by endocyclic groups, and a process of making same |
| US2914561A (en) * | 1957-08-06 | 1959-11-24 | Wm S Merrell Co | Amine derivatives of triphenylethylene |
| DE1102156B (de) * | 1959-02-27 | 1961-03-16 | Bayer Ag | Verfahren zur Herstellung von basisch substituierten Estern der Hydracrylsaeure |
| US2971001A (en) * | 1959-10-21 | 1961-02-07 | Wm S Merrell Co | Quaternary salts of triphenylethanols, -ethylenes, and -ethanes |
-
1968
- 1968-09-06 DE DE19681793364 patent/DE1793364A1/de active Pending
-
1969
- 1969-08-21 LU LU59333D patent/LU59333A1/xx unknown
- 1969-08-21 AT AT802669A patent/AT296249B/de not_active IP Right Cessation
- 1969-08-21 US US857272A patent/US3686311A/en not_active Expired - Lifetime
- 1969-08-22 IL IL32882A patent/IL32882A0/xx unknown
- 1969-08-29 ES ES370977A patent/ES370977A1/es not_active Expired
- 1969-09-02 CH CH1327669A patent/CH545767A/xx not_active IP Right Cessation
- 1969-09-03 GB GB43518/69A patent/GB1240943A/en not_active Expired
- 1969-09-04 FR FR6930160A patent/FR2017501A1/fr not_active Withdrawn
- 1969-09-05 NL NL6913584A patent/NL6913584A/xx unknown
- 1969-09-05 BE BE738449D patent/BE738449A/xx unknown
- 1969-09-05 BR BR212200/69A patent/BR6912200D0/pt unknown
- 1969-09-06 OA OA53723A patent/OA03379A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1637537A1 (de) * | 2004-09-17 | 2006-03-22 | Riemser Arzneimittel AG | Neue Arzneimittel |
Also Published As
| Publication number | Publication date |
|---|---|
| BR6912200D0 (pt) | 1973-05-10 |
| SU375844A3 (enExample) | 1973-03-23 |
| LU59333A1 (enExample) | 1970-01-06 |
| GB1240943A (en) | 1971-07-28 |
| OA03379A (fr) | 1970-12-15 |
| CH545767A (enExample) | 1974-02-15 |
| ES370977A1 (es) | 1972-01-01 |
| AT296249B (de) | 1972-02-10 |
| US3686311A (en) | 1972-08-22 |
| NL6913584A (enExample) | 1970-03-10 |
| BE738449A (enExample) | 1970-02-16 |
| IL32882A0 (en) | 1970-01-29 |
| FR2017501A1 (enExample) | 1970-05-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1543715B2 (de) | Basisch substituierte Phthalan derivate und deren pharmakologisch vertragliche Saureadditionssalze so wie Verfahren zu deren Herstellung | |
| DE2525226C2 (de) | Oxanilsäure oder Oxanilsäurederivate enthaltende pharmazeutische Mittel, Oxanilsäurederivate und Verfahren zu deren Herstellung | |
| DD145104B3 (de) | Verfahren zur herstellung von polyalkoxyphenylpyrrolidone | |
| DE2231067C2 (de) | Phenoxathiinderivate, Verfahren zu deren Herstellung sowie pharmazeutische Präparate mit einem Gehalt an Phenoxathiinderivaten zur Bekämpfung von Virusinfektionen | |
| DE1793364A1 (de) | Basische alpha-Nortricyclyl-(3)-benzyl-aether,ihre quartaeren Salze und N-Oxide und pharmazeutische Produkte hieraus | |
| DE2144683A1 (de) | 4-phenyl-thiazolderivate enthaltende pharmazeutische praeparate | |
| CH629781A5 (de) | Verfahren zur herstellung von benzolsulfonylharnstoffen. | |
| DE69617001T2 (de) | (2-morpholinylmethyl)benzamid-derivate | |
| DE1770414B2 (de) | Chinuclidin-2 und Chinuclidin-3-carbonsäureanilide, Verfahren zu deren Herstellung und sie enthaltende pharmazeutische Mittel | |
| DE2425767A1 (de) | 3-alkyl-9-aminoalkyl-1,2,3,4-tetrahydrocarbazole und ihre verwendung in arzneimitteln | |
| DE2107871C3 (enExample) | ||
| DE3028064C2 (enExample) | ||
| DE2631080C2 (de) | Isocarbostyril-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE2257639A1 (de) | Neue ester und aether von ketoximen, verfahren zu deren herstellung sowie diese verbindungen enthaltende therapeutische zubereitungen | |
| DE1217396B (de) | Verfahren zur Herstellung von 1 - (Thienyl-21) - l-oxo-2-amino-propanen | |
| DE2003744C2 (de) | In 3- und 4-Stellung disubstituierte 3-Amino-2-bicyclo[2,2,2]octan-2-ole, Verfahren zu deren Herstellung und dieselben enthaltende Arzneimittel | |
| DE2923817B1 (de) | (3-Alkylamino-2-hydroxypropoxy)-furan-2-carbonsaeureanilide und deren physiologisch vertraegliche Saeureadditionssalze und Verfahren zu deren Herstellung sowie Arzneimittel mit einem Gehalt dieser Verbindungen | |
| DE2310827C3 (de) | Im phenylkern heterocyclisch substituierte Phenylalaninderivate | |
| DE2435248A1 (de) | 1,3-diamino-2-propanole, ein verfahren zu deren herstellung und ein dieselben enthaltendes mittel | |
| DE2705896A1 (de) | 2,5-disubstituierte benzamide und verfahren zu ihrer herstellung | |
| DE2528194A1 (de) | Benzhydryloxyalkylaminderivate, solche enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE2012667B2 (de) | carbonylmethyl-2-benzothiazolinone und ihre Säureadditionssalze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharamazeutische Präparate | |
| DE1618160C3 (de) | l-(2-Äthinylphenoxy)-2-hydroxy-3alkylaminopropane, ihre physiologisch verträglichen Säureadditionssalze, Verfahren zu ihrer Herstellung, sowie diese Verbindungen enthaltende Arzneimittel | |
| DE4407139A1 (de) | Aryl-1-azacycloalkane und deren Salze, diese Verbindungen enthaltende Arzneimittel und deren Verwendung sowie Verfahren zu ihrer Herstellung | |
| DE3046017C2 (de) | Indolizin-Derivate, Verfahren zu deren Herstellung und pharmazeutische Zusammensetzung |