DE1770784C3 - Verfahren zur Herstellung von Polyimiden - Google Patents
Verfahren zur Herstellung von PolyimidenInfo
- Publication number
- DE1770784C3 DE1770784C3 DE1770784A DE1770784A DE1770784C3 DE 1770784 C3 DE1770784 C3 DE 1770784C3 DE 1770784 A DE1770784 A DE 1770784A DE 1770784 A DE1770784 A DE 1770784A DE 1770784 C3 DE1770784 C3 DE 1770784C3
- Authority
- DE
- Germany
- Prior art keywords
- polyimides
- dianhydride
- tetracarboxylic acid
- polyimide
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004642 Polyimide Substances 0.000 title claims description 35
- 229920001721 polyimide Polymers 0.000 title claims description 35
- 238000000034 method Methods 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 11
- 238000002360 preparation method Methods 0.000 claims description 3
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 10
- -1 alkyl radical Chemical class 0.000 description 9
- 238000001556 precipitation Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000000843 powder Substances 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 229920002521 macromolecule Polymers 0.000 description 4
- 239000003495 polar organic solvent Substances 0.000 description 4
- 229920005575 poly(amic acid) Polymers 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000004570 mortar (masonry) Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- VLDPXPPHXDGHEW-UHFFFAOYSA-N 1-chloro-2-dichlorophosphoryloxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(Cl)=O VLDPXPPHXDGHEW-UHFFFAOYSA-N 0.000 description 1
- 125000004825 2,2-dimethylpropylene group Chemical group [H]C([H])([H])C(C([H])([H])[H])(C([H])([H])[*:1])C([H])([H])[*:2] 0.000 description 1
- XGKKWUNSNDTGDS-UHFFFAOYSA-N 2,5-dimethylheptane-1,7-diamine Chemical compound NCC(C)CCC(C)CCN XGKKWUNSNDTGDS-UHFFFAOYSA-N 0.000 description 1
- YXOKJIRTNWHPFS-UHFFFAOYSA-N 2,5-dimethylhexane-1,6-diamine Chemical compound NCC(C)CCC(C)CN YXOKJIRTNWHPFS-UHFFFAOYSA-N 0.000 description 1
- RLHGFJMGWQXPBW-UHFFFAOYSA-N 2-hydroxy-3-(1h-imidazol-5-ylmethyl)benzamide Chemical compound NC(=O)C1=CC=CC(CC=2NC=NC=2)=C1O RLHGFJMGWQXPBW-UHFFFAOYSA-N 0.000 description 1
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- UCFMKTNJZCYBBJ-UHFFFAOYSA-N 3-[1-(2,3-dicarboxyphenyl)ethyl]phthalic acid Chemical compound C=1C=CC(C(O)=O)=C(C(O)=O)C=1C(C)C1=CC=CC(C(O)=O)=C1C(O)=O UCFMKTNJZCYBBJ-UHFFFAOYSA-N 0.000 description 1
- POTQBGGWSWSMCX-UHFFFAOYSA-N 3-[2-(3-aminopropoxy)ethoxy]propan-1-amine Chemical compound NCCCOCCOCCCN POTQBGGWSWSMCX-UHFFFAOYSA-N 0.000 description 1
- ICNFHJVPAJKPHW-UHFFFAOYSA-N 4,4'-Thiodianiline Chemical compound C1=CC(N)=CC=C1SC1=CC=C(N)C=C1 ICNFHJVPAJKPHW-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- UITKHKNFVCYWNG-UHFFFAOYSA-N 4-(3,4-dicarboxybenzoyl)phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1C(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 UITKHKNFVCYWNG-UHFFFAOYSA-N 0.000 description 1
- IWXCYYWDGDDPAC-UHFFFAOYSA-N 4-[(3,4-dicarboxyphenyl)methyl]phthalic acid Chemical compound C1=C(C(O)=O)C(C(=O)O)=CC=C1CC1=CC=C(C(O)=O)C(C(O)=O)=C1 IWXCYYWDGDDPAC-UHFFFAOYSA-N 0.000 description 1
- GEYAGBVEAJGCFB-UHFFFAOYSA-N 4-[2-(3,4-dicarboxyphenyl)propan-2-yl]phthalic acid Chemical compound C=1C=C(C(O)=O)C(C(O)=O)=CC=1C(C)(C)C1=CC=C(C(O)=O)C(C(O)=O)=C1 GEYAGBVEAJGCFB-UHFFFAOYSA-N 0.000 description 1
- QQGYZOYWNCKGEK-UHFFFAOYSA-N 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]-2-benzofuran-1,3-dione Chemical compound C1=C2C(=O)OC(=O)C2=CC(OC=2C=C3C(=O)OC(C3=CC=2)=O)=C1 QQGYZOYWNCKGEK-UHFFFAOYSA-N 0.000 description 1
- MBRGOFWKNLPACT-UHFFFAOYSA-N 5-methylnonane-1,9-diamine Chemical compound NCCCCC(C)CCCCN MBRGOFWKNLPACT-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- 229920004142 LEXAN™ Polymers 0.000 description 1
- 239000004418 Lexan Substances 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- YQLZOAVZWJBZSY-UHFFFAOYSA-N decane-1,10-diamine Chemical compound NCCCCCCCCCCN YQLZOAVZWJBZSY-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- AIJZIRPGCQPZSL-UHFFFAOYSA-N ethylenetetracarboxylic acid Chemical compound OC(=O)C(C(O)=O)=C(C(O)=O)C(O)=O AIJZIRPGCQPZSL-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OBKARQMATMRWQZ-UHFFFAOYSA-N naphthalene-1,2,5,6-tetracarboxylic acid Chemical compound OC(=O)C1=C(C(O)=O)C=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 OBKARQMATMRWQZ-UHFFFAOYSA-N 0.000 description 1
- OLAPPGSPBNVTRF-UHFFFAOYSA-N naphthalene-1,4,5,8-tetracarboxylic acid Chemical compound C1=CC(C(O)=O)=C2C(C(=O)O)=CC=C(C(O)=O)C2=C1C(O)=O OLAPPGSPBNVTRF-UHFFFAOYSA-N 0.000 description 1
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 1
- DOBFTMLCEYUAQC-UHFFFAOYSA-N naphthalene-2,3,6,7-tetracarboxylic acid Chemical compound OC(=O)C1=C(C(O)=O)C=C2C=C(C(O)=O)C(C(=O)O)=CC2=C1 DOBFTMLCEYUAQC-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- SXJVFQLYZSNZBT-UHFFFAOYSA-N nonane-1,9-diamine Chemical compound NCCCCCCCCCN SXJVFQLYZSNZBT-UHFFFAOYSA-N 0.000 description 1
- 229940038384 octadecane Drugs 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- PZZICILSCNDOKK-UHFFFAOYSA-N propane-1,2,3-triamine Chemical compound NCC(N)CN PZZICILSCNDOKK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- YKWDNEXDHDSTCU-UHFFFAOYSA-N pyrrolidine-2,3,4,5-tetracarboxylic acid Chemical compound OC(=O)C1NC(C(O)=O)C(C(O)=O)C1C(O)=O YKWDNEXDHDSTCU-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000009420 retrofitting Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- PFNFFQXMRSDOHW-UHFFFAOYSA-N spermine Chemical compound NCCCNCCCCNCCCN PFNFFQXMRSDOHW-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- LUEGQDUCMILDOJ-UHFFFAOYSA-N thiophene-2,3,4,5-tetracarboxylic acid Chemical compound OC(=O)C=1SC(C(O)=O)=C(C(O)=O)C=1C(O)=O LUEGQDUCMILDOJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H17/00—Switches having flexible operating part adapted only for pulling, e.g. cord, chain
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/06—Polycondensates having nitrogen-containing heterocyclic rings in the main chain of the macromolecule
- C08G73/10—Polyimides; Polyester-imides; Polyamide-imides; Polyamide acids or similar polyimide precursors
- C08G73/1003—Preparatory processes
- C08G73/1007—Preparatory processes from tetracarboxylic acids or derivatives and diamines
- C08G73/101—Preparatory processes from tetracarboxylic acids or derivatives and diamines containing chain terminating or branching agents
- C08G73/1014—Preparatory processes from tetracarboxylic acids or derivatives and diamines containing chain terminating or branching agents in the form of (mono)anhydrid
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65062567A | 1967-07-03 | 1967-07-03 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1770784A1 DE1770784A1 (de) | 1971-01-21 |
| DE1770784B2 DE1770784B2 (de) | 1973-04-12 |
| DE1770784C3 true DE1770784C3 (de) | 1973-11-15 |
Family
ID=24609641
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1770784A Expired DE1770784C3 (de) | 1967-07-03 | 1968-07-03 | Verfahren zur Herstellung von Polyimiden |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3528950A (enExample) |
| CA (1) | CA966250A (enExample) |
| DE (1) | DE1770784C3 (enExample) |
| FR (1) | FR1572798A (enExample) |
| GB (1) | GB1241445A (enExample) |
| NL (2) | NL141911B (enExample) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2086401A2 (en) * | 1967-07-03 | 1971-12-31 | Trw Inc | Polyamide acid-polyimide prepolymers |
| FR96145E (fr) * | 1967-11-30 | 1972-05-19 | Trw Inc | Polyimides stables et a durcissement rapide a partir de prépolymeres, et procédé pour leur préparation. |
| US3708459A (en) * | 1970-06-24 | 1973-01-02 | Trw Inc | Molding power prepolymers |
| US3708370A (en) * | 1971-08-06 | 1973-01-02 | Trw Inc | Process for bonding surfaces with polyimide prepolymers |
| US4110294A (en) * | 1974-04-08 | 1978-08-29 | Ciba-Geigy Corporation | Processing aids for high temperature polymers |
| CH619694A5 (enExample) * | 1975-12-19 | 1980-10-15 | Ciba Geigy Ag | |
| CH619692A5 (enExample) * | 1975-12-19 | 1980-10-15 | Ciba Geigy Ag | |
| US4046748A (en) * | 1976-04-19 | 1977-09-06 | Arizona Chemical Company | Polymers of terpene-maleic anhydride adducts with aliphatic diamines |
| CH624391A5 (enExample) * | 1976-12-14 | 1981-07-31 | Ciba Geigy Ag | |
| US4302575A (en) * | 1979-12-26 | 1981-11-24 | General Electric Company | Heat curable polyimides |
| US4395514A (en) * | 1980-04-18 | 1983-07-26 | Celanese Corporation | Process for preparing a carbon fiber reinforced composite article which utilizes a polyimide matrix |
| US4338430A (en) * | 1980-04-18 | 1982-07-06 | Celanese Corporation | Preparation of polyimide compositions with cyclic peroxyketal catalyst |
| US4506100A (en) * | 1981-08-12 | 1985-03-19 | National Starch And Chemical Corporation | Aromatic diamines |
| US5693741A (en) * | 1988-03-15 | 1997-12-02 | The Boeing Company | Liquid molding compounds |
| US5344894A (en) * | 1983-09-27 | 1994-09-06 | The Boeing Company | Polyimide oligomers and blends |
| US5367083A (en) * | 1987-09-03 | 1994-11-22 | The Boeing Company | Extended acid halide capping monomers |
| US5286811A (en) * | 1983-09-27 | 1994-02-15 | The Boeing Company | Blended polyimide oligomers and method of curing polyimides |
| US5210213A (en) * | 1983-06-17 | 1993-05-11 | The Boeing Company | Dimensional, crosslinkable oligomers |
| US5705598A (en) | 1985-04-23 | 1998-01-06 | The Boeing Company | Polyester sulfone oligomers and blends |
| US5216117A (en) * | 1987-09-03 | 1993-06-01 | The Boeing Company | Amideimide blends |
| US5516876A (en) * | 1983-09-27 | 1996-05-14 | The Boeing Company | Polyimide oligomers and blends |
| US5116935A (en) * | 1987-05-04 | 1992-05-26 | The Boeing Company | Polyimide oligomers and blends and method of curing |
| US5512676A (en) * | 1987-09-03 | 1996-04-30 | The Boeing Company | Extended amideimide hub for multidimensional oligomers |
| US5969079A (en) * | 1985-09-05 | 1999-10-19 | The Boeing Company | Oligomers with multiple chemically functional end caps |
| US5175234A (en) * | 1983-09-27 | 1992-12-29 | The Boeing Company | Lightly crosslinked polyimides |
| US4604319B1 (en) * | 1984-06-01 | 1995-07-04 | American Cyanamid Co | Thermoplastic interleafed resin matrix composites with improved impact strength and toughness |
| US5618907A (en) * | 1985-04-23 | 1997-04-08 | The Boeing Company | Thallium catalyzed multidimensional ester oligomers |
| CN1004490B (zh) * | 1985-04-27 | 1989-06-14 | 旭化成工业株式会社 | 可固化组合物 |
| US4752636A (en) * | 1985-07-15 | 1988-06-21 | The Dow Chemical Company | Thermosettable polymer or prepolymer prepared from heterocyclic materials containing nitrogen atoms, carboxylic acid mono- or dianhydrides and a polymerizable material with ethylenically unsaturated groups and cured products therefrom |
| US4647616A (en) * | 1985-07-15 | 1987-03-03 | The Dow Chemical Company | Thermosettable polymer or prepolymer prepared from herterocycle material containing a nitrogen atom and carboxylic acid mono- or dianhydride |
| US4847355A (en) * | 1985-07-15 | 1989-07-11 | The Dow Chemical Company | Thermosettable prepolymer prepared from heterocyclic material having alkyl substituents, mono- or dianhydride, ethylenically unsaturated material and a hydroxide, carbonate of bicarbonate of a metal of groups I-A or II-A |
| US4654414A (en) * | 1985-07-15 | 1987-03-31 | The Dow Chemical Company | Thermosettable polymer or prepolymer prepared from heterocyclic material having alkyl substituent, mono- or dianhydride, ethylenically unsaturated material and a hydroxide, carbonate or bicarbonate of a metal of groups I-A or II-A |
| US5610317A (en) * | 1985-09-05 | 1997-03-11 | The Boeing Company | Multiple chemically functional end cap monomers |
| US5151487A (en) * | 1985-09-30 | 1992-09-29 | The Boeing Company | Method of preparing a crosslinking oligomer |
| US5606013A (en) * | 1986-12-31 | 1997-02-25 | Ciba-Geigy Corporation | Polyamic acids and polyimides |
| US5614606A (en) * | 1986-12-31 | 1997-03-25 | Ciba-Geigy Corporation | Polyamic acids and polyimides |
| FR2610938B1 (fr) * | 1987-02-13 | 1989-06-16 | Centre Etd Mat Org Tech Avance | Compositions de polybenzhydrolimides terminees par des groupements a insaturation ethylenique, les polyimides reticules obtenus par leur polymerisation thermique et l'utilisation de ces compositions |
| US5011905A (en) * | 1987-05-04 | 1991-04-30 | The Boeing Company | Polyimide oligomers and blends |
| US5109105A (en) * | 1987-06-12 | 1992-04-28 | The Boeing Company | Polyamide oligomers |
| US4946908A (en) * | 1987-07-15 | 1990-08-07 | Hercules Incorporated | Bismaleimide compositions containing high glass transition temperature and soluble reactive oligomers and composites prepared therefrom |
| US4818584A (en) * | 1987-12-03 | 1989-04-04 | General Dynamics Corp. | Arresting delamination in composite laminate |
| US5817744A (en) * | 1988-03-14 | 1998-10-06 | The Boeing Company | Phenylethynyl capped imides |
| US5041520A (en) * | 1988-07-05 | 1991-08-20 | Mitsui Toatsu Chemicals, Inc. | Process for preparing polyimide having excellent high temperature stability |
| US4954382A (en) * | 1988-11-01 | 1990-09-04 | American Cyanamid Company | Interleaf layer in fiber reinforced resin laminate composites |
| US5141804A (en) * | 1988-11-01 | 1992-08-25 | American Cyanamid Company | Interleaf layer in fiber reinforced resin laminate composites |
| DE3922876A1 (de) * | 1989-07-12 | 1991-01-24 | Bayer Ag | Mischungen aus polyarylensulfiden, glasfasern und imiden oder amidsaeuren aus bicyclischen, ungesaettigten disaeuren |
| GB8916259D0 (en) * | 1989-07-15 | 1989-08-31 | Ciba Geigy | Compounds |
| US5077382A (en) * | 1989-10-26 | 1991-12-31 | Occidental Chemical Corporation | Copolyimide odpa/bpda/4,4'-oda or p-pda |
| US5171828A (en) * | 1989-10-26 | 1992-12-15 | Occidental Chemical Corporation | Copolyimide ODPA/BPDA/4,4'-ODA or P-PDA |
| US5175241A (en) * | 1989-12-28 | 1992-12-29 | The Dexter Corporation | Polyimide with reduced anhydride content |
| US5126085A (en) * | 1990-12-07 | 1992-06-30 | Dexter Composites, Inc. | Process for preparing polyimide sheet molding compound |
| US5145943A (en) * | 1990-12-17 | 1992-09-08 | Ethyl Corporation | Production of particulate amide/imide prepolymers |
| US5248760A (en) * | 1991-01-25 | 1993-09-28 | Unc At Charlotte | Chemically cured low temperature polyimides |
| US5296559A (en) * | 1991-12-19 | 1994-03-22 | Dexter-Hysol Aerospace, Inc. | Polyimide composition |
| US5412065A (en) * | 1993-04-09 | 1995-05-02 | Ciba-Geigy Corporation | Polyimide oligomers |
| GB9310400D0 (en) * | 1993-05-20 | 1993-07-14 | Ici Composites Inc | Curable compositions |
| US5575955A (en) * | 1994-07-22 | 1996-11-19 | The United States Of America As Represented By The Administrator Of The National Aeronautics And Space Administration | Electrically conductive polyimide film containing gold (III) ions, composition, and process of making |
| US5914385A (en) * | 1996-10-03 | 1999-06-22 | Mitsubishi Jukogyo Kabushiki Kaisha | Polyimide resin composition and method for producing prepreg and paint and method for curing resin using the same |
| US6274699B1 (en) * | 2000-03-23 | 2001-08-14 | The United States Of America As Represented By The Administrator Of The National Aeronautics And Space Administration | Polyimides and process for preparing polyimides having thermal-oxidative stability |
| US20080300374A1 (en) * | 2007-05-31 | 2008-12-04 | The Boeing Company | Dinadic phenyl amine reactive endcaps |
| CN101451013B (zh) * | 2007-11-29 | 2011-05-25 | 比亚迪股份有限公司 | 一种聚酰亚胺材料及其制备方法 |
| CN103772871B (zh) * | 2013-12-20 | 2016-08-17 | 苏州市万泰真空炉研究所有限公司 | 一种复合聚酰亚胺泡沫塑料的制备方法 |
| KR101739842B1 (ko) * | 2014-10-10 | 2017-05-25 | 연세대학교 산학협력단 | 마이크로 다공성 구조의 폴리이미드 스폰지 및 이의 제조방법 |
| US10442894B2 (en) * | 2016-04-01 | 2019-10-15 | Industry-Academic Cooperation Foundation, Yonsei University | Microporous polyimide sponge and method for producing the same |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3179634A (en) * | 1962-01-26 | 1965-04-20 | Du Pont | Aromatic polyimides and the process for preparing them |
| US3422064A (en) * | 1965-01-27 | 1969-01-14 | Du Pont | Aromatic polyimide preparation |
-
0
- NL NL66822D patent/NL66822C/xx active
-
1967
- 1967-07-03 US US650625A patent/US3528950A/en not_active Expired - Lifetime
-
1968
- 1968-06-21 CA CA023194402-219A patent/CA966250A/en not_active Expired
- 1968-06-28 NL NL686809244A patent/NL141911B/xx unknown
- 1968-07-03 GB GB31725/68A patent/GB1241445A/en not_active Expired
- 1968-07-03 DE DE1770784A patent/DE1770784C3/de not_active Expired
- 1968-07-03 FR FR1572798D patent/FR1572798A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA966250A (en) | 1975-04-15 |
| DE1770784A1 (de) | 1971-01-21 |
| DE1770784B2 (de) | 1973-04-12 |
| NL141911B (nl) | 1974-04-16 |
| FR1572798A (enExample) | 1969-06-27 |
| NL6809244A (enExample) | 1969-01-07 |
| NL66822C (enExample) | |
| GB1241445A (en) | 1971-08-04 |
| US3528950A (en) | 1970-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1770784C3 (de) | Verfahren zur Herstellung von Polyimiden | |
| DE3855656T2 (de) | Schmelzformbares kristallines Polyimid | |
| DE3420929C2 (enExample) | ||
| EP3294794B1 (de) | Verfahren zur herstellung von polyimiden | |
| DE68926551T2 (de) | Verfahren zur Herstellung von Polyimid mit ausgezeichneter Temperaturstabilität | |
| DE2813425C2 (enExample) | ||
| DE2357297C3 (de) | Verfahren zur Herstellung von Polyamidcarbonsäuren | |
| AT519038B1 (de) | Herstellungsverfahren für Polyimide | |
| DE3208697C2 (de) | Verfahren zur Herstellung von Polyamidverbindungen | |
| DE1770146C3 (de) | Verfahren zur Herstellung von PoIy-(arylen-triketoimidazolidinen) | |
| DE2521305A1 (de) | Aromatische polyimide mit endstaendigen phthalsaeurenitrilgruppen und verfahren zur herstellung derselben | |
| CH463779A (de) | Stabilisierte Polyamidsäurelösung mit verbesserten Viskositätseigenschaften und Verfahren zur Herstellung derselben | |
| DE2932589B2 (de) | Polyimidharzmasse sowie Verwendung. derselben | |
| DE1745131A1 (de) | Verfahren zur Herstellung von Polyimidschaeumen | |
| DE2257996A1 (de) | Loesliche polyimide | |
| DE69821664T2 (de) | Wärmehärtbare Harzzusammensetzung | |
| CH623837A5 (enExample) | ||
| DE3883234T2 (de) | Verbesserung der Molekulargewichtsverteilung durch Lösungsmittelextraktion. | |
| DE2441020C3 (de) | Verfahren zur Herstellung von viskositätsstabilen Polyamidimid-Lösungen | |
| DE69127137T2 (de) | Leicht zu verarbeitende Polyimide und deren Herstellung | |
| DE2159935A1 (de) | Verfahren zur herstellung loeslicher polyimide | |
| DE2059079C3 (de) | Verfahren zur Herstellung von aromatischen heterocyclischen Polykondensaten | |
| EP0290910B1 (de) | Spezielle Polyimide als Thermoplaste | |
| WO2019057498A1 (de) | Verfahren zur herstellung von polybenzimidazolen | |
| DE1906253C3 (de) | Hochtemperaturbeständige Klebstoffe auf Poly imidbasis |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EHJ | Ceased/non-payment of the annual fee |