DE1765528A1 - Beheizter Lockenwickler - Google Patents
Beheizter LockenwicklerInfo
- Publication number
- DE1765528A1 DE1765528A1 DE19681765528 DE1765528A DE1765528A1 DE 1765528 A1 DE1765528 A1 DE 1765528A1 DE 19681765528 DE19681765528 DE 19681765528 DE 1765528 A DE1765528 A DE 1765528A DE 1765528 A1 DE1765528 A1 DE 1765528A1
- Authority
- DE
- Germany
- Prior art keywords
- tubular body
- hair
- hair curling
- electrical
- heating element
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000010438 heat treatment Methods 0.000 claims description 32
- 239000004033 plastic Substances 0.000 claims description 16
- 229920003023 plastic Polymers 0.000 claims description 16
- 238000004804 winding Methods 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 4
- 230000011664 signaling Effects 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 230000002093 peripheral effect Effects 0.000 claims 1
- 239000004020 conductor Substances 0.000 description 26
- 239000000919 ceramic Substances 0.000 description 19
- 229910010293 ceramic material Inorganic materials 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 230000000994 depressogenic effect Effects 0.000 description 2
- 239000003779 heat-resistant material Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- -1 polypropylene Polymers 0.000 description 2
- 238000005096 rolling process Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- AZBAQHIVVLQMFX-UHFFFAOYSA-N 4-(2,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine Chemical compound S1C(N)=NC(C=2C(=CC(C)=CC=2)C)=C1C AZBAQHIVVLQMFX-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 101100129922 Caenorhabditis elegans pig-1 gene Proteins 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 101100520057 Drosophila melanogaster Pig1 gene Proteins 0.000 description 1
- 235000015429 Mirabilis expansa Nutrition 0.000 description 1
- 244000294411 Mirabilis expansa Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 235000013536 miso Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45D—HAIRDRESSING OR SHAVING EQUIPMENT; EQUIPMENT FOR COSMETICS OR COSMETIC TREATMENTS, e.g. FOR MANICURING OR PEDICURING
- A45D4/00—Separate devices designed for heating hair curlers or hair-wavers
- A45D4/16—Independent devices characterised by heating the hair-curling or hair-waving means before use
Landscapes
- Hair Curling (AREA)
- Graft Or Block Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65616367A | 1967-07-26 | 1967-07-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1765528A1 true DE1765528A1 (de) | 1971-07-29 |
Family
ID=24631911
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681765528 Pending DE1765528A1 (de) | 1967-07-26 | 1968-06-01 | Beheizter Lockenwickler |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3519792A (enrdf_load_stackoverflow) |
| DE (1) | DE1765528A1 (enrdf_load_stackoverflow) |
| DK (1) | DK126229B (enrdf_load_stackoverflow) |
| FR (1) | FR1569406A (enrdf_load_stackoverflow) |
| GB (1) | GB1190502A (enrdf_load_stackoverflow) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0175232A3 (en) * | 1984-09-17 | 1986-12-30 | Braun Aktiengesellschaft | Hair treatment device |
| EP0446643A1 (de) * | 1990-03-13 | 1991-09-18 | Goldwell Aktiengesellschaft | Einrichtung zur Verformung von menschlichem Haar |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3673382A (en) * | 1969-12-09 | 1972-06-27 | Philips Corp | Electrically heated hair curler |
| US3632971A (en) * | 1970-01-27 | 1972-01-04 | Texas Instruments Inc | Self-limiting electric hair curler heater |
| US3617694A (en) * | 1970-01-27 | 1971-11-02 | Texas Instruments Inc | Electrical contact means for hair curler having elongated annular heater |
| US3689736A (en) * | 1971-01-25 | 1972-09-05 | Texas Instruments Inc | Electrically heated device employing conductive-crystalline polymers |
| BE784729A (fr) * | 1972-06-12 | 1972-10-02 | S P R L Capilustro | Outil pour coiffeurs. |
| JPS5814206B2 (ja) * | 1977-08-27 | 1983-03-17 | 松下電工株式会社 | ヘア−カ−ラ |
| US4647755A (en) * | 1985-04-15 | 1987-03-03 | Clairol Incorporated | Heating device for rapidly heating a single hair roller |
| USD313284S (en) | 1988-12-20 | 1990-12-25 | Helen Of Troy | Base heating plate for a travel hairsetter |
| US5664701A (en) * | 1995-01-25 | 1997-09-09 | Uniplast, Inc. | Glue gun system with removable cartridges |
| US5808275A (en) * | 1995-02-01 | 1998-09-15 | Dalal Kana Fani Hibri | Hair shaping apparatus with electrically heated rollers |
| US5881924A (en) * | 1997-01-17 | 1999-03-16 | Uniplast, Inc. | Feeder handler for a hot glue gun |
| US5881912A (en) * | 1997-01-17 | 1999-03-16 | Uniplast, Inc. | Glue gun with removable barrel |
| SE0401476L (sv) * | 2004-06-08 | 2005-12-09 | Caspar Teglbjaerg | Uppvärmningsanordning |
| US20070089760A1 (en) * | 2005-10-21 | 2007-04-26 | Evanyk Walter R | Hair curler/hair brush |
| GB0913703D0 (en) * | 2009-08-05 | 2009-09-16 | Next Row Ltd | Induction heated hair rollers |
| US20230320469A1 (en) * | 2022-04-11 | 2023-10-12 | Steven Coutoumanos | Hot curlers on a rope |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1588193A (en) * | 1925-07-28 | 1926-06-08 | Schmitz Charles Fred | Hair-waving device |
| US1941439A (en) * | 1928-09-25 | 1933-12-26 | Nestle Le Mur Company | Hair curling device |
| US1901892A (en) * | 1929-12-07 | 1933-03-21 | Bjorkman George Edward | Hair curler |
| US2140311A (en) * | 1932-07-23 | 1938-12-13 | Automatic Devices Corp | Cigar lighter |
| US2060102A (en) * | 1935-11-29 | 1936-11-10 | Tomlinson I Moseley | Hair curler |
| US2558441A (en) * | 1950-03-14 | 1951-06-26 | Aeromar Inc | Electrical cigar or cigarette lighter |
| US2932716A (en) * | 1956-04-26 | 1960-04-12 | Lawrence E Fenn | Cigar lighter |
| NL135169C (enrdf_load_stackoverflow) * | 1963-02-12 | |||
| US3283122A (en) * | 1963-11-12 | 1966-11-01 | Songrand Corp | Apparatus for use in curling hair |
| US3250895A (en) * | 1964-08-21 | 1966-05-10 | Songrand Corp | Heating unit for hair curling |
-
1967
- 1967-07-26 US US656163A patent/US3519792A/en not_active Expired - Lifetime
-
1968
- 1968-04-24 GB GB09370/68A patent/GB1190502A/en not_active Expired
- 1968-06-01 DE DE19681765528 patent/DE1765528A1/de active Pending
- 1968-06-20 FR FR1569406D patent/FR1569406A/fr not_active Expired
- 1968-07-04 DK DK327868AA patent/DK126229B/da unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0175232A3 (en) * | 1984-09-17 | 1986-12-30 | Braun Aktiengesellschaft | Hair treatment device |
| EP0446643A1 (de) * | 1990-03-13 | 1991-09-18 | Goldwell Aktiengesellschaft | Einrichtung zur Verformung von menschlichem Haar |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1190502A (en) | 1970-05-06 |
| DK126229B (da) | 1973-06-25 |
| US3519792A (en) | 1970-07-07 |
| FR1569406A (enrdf_load_stackoverflow) | 1969-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1765528A1 (de) | Beheizter Lockenwickler | |
| EP0021136B1 (de) | Haarpflegegerät zum Formen des Kopfhaares | |
| DE1457443A1 (de) | Haarwickel und Vorrichtung zum Erwaermen des Haarwickels vor seiner Verwendung | |
| DE69431674T2 (de) | Enthaarungswachsapplikator mit einziehbarer Rolle | |
| DE3300667C2 (de) | Lockenstab oder Curler | |
| DE2839176A1 (de) | Frisiergeraet zum locken der haare | |
| DE2409018A1 (de) | Dampffrisierstab | |
| DE2837210A1 (de) | Lockenwickler | |
| DE3243292C2 (enrdf_load_stackoverflow) | ||
| DE2813859A1 (de) | Lockenwickler-halter | |
| DE2130704A1 (de) | Lockenwickler | |
| DE3234071A1 (de) | Elektrischer lockenwickler mit elektrischer auf- und abwicklung | |
| DE3717798A1 (de) | Frisiereinrichtung | |
| DE2039937A1 (de) | Lockenwickler mit Vorrichtung zu ihrer Aufheizung | |
| EP0379670B1 (de) | Lockenstab mit einziehbaren Borsten oder Zinken | |
| EP0175232B1 (de) | Haarbehandlungseinrichtung | |
| DE9411937U1 (de) | Einrichtung zur wirkstoff-freien Behandlung parasitenbefallener Hautoberflächen (und Haaren) | |
| DE3000459C2 (de) | Lockenformer | |
| DE2827547B2 (de) | Elektrisch beheizter Frisierstab | |
| DE2526637A1 (de) | Haarbuerste | |
| DE3032983A1 (de) | Haarpflege- und frisiersatz | |
| DE1557261A1 (de) | Elektrischer Lockenwickler | |
| AT134470B (de) | Haarwellvorrichtung. | |
| DE1457386A1 (de) | Vorrichtung zum Wellen der Haare und fuer aehnliche Anwendungen | |
| EP0367258B1 (de) | Lockenstabgerät |