DE1753096A1 - Vorrichtung zum Aufklappen eines Toilettensitzes - Google Patents
Vorrichtung zum Aufklappen eines ToilettensitzesInfo
- Publication number
- DE1753096A1 DE1753096A1 DE19681753096 DE1753096A DE1753096A1 DE 1753096 A1 DE1753096 A1 DE 1753096A1 DE 19681753096 DE19681753096 DE 19681753096 DE 1753096 A DE1753096 A DE 1753096A DE 1753096 A1 DE1753096 A1 DE 1753096A1
- Authority
- DE
- Germany
- Prior art keywords
- seat
- pressure member
- pin
- foot lever
- sleeve
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000009471 action Effects 0.000 claims description 7
- 230000006835 compression Effects 0.000 claims description 2
- 238000007906 compression Methods 0.000 claims description 2
- 230000000284 resting effect Effects 0.000 claims description 2
- 210000003462 vein Anatomy 0.000 claims 1
- 230000000694 effects Effects 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 101150006573 PAN1 gene Proteins 0.000 description 1
- RZKYEQDPDZUERB-UHFFFAOYSA-N Pindone Chemical compound C1=CC=C2C(=O)C(C(=O)C(C)(C)C)C(=O)C2=C1 RZKYEQDPDZUERB-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000002781 deodorant agent Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47K—SANITARY EQUIPMENT NOT OTHERWISE PROVIDED FOR; TOILET ACCESSORIES
- A47K13/00—Seats or covers for all kinds of closets
- A47K13/10—Devices for raising and lowering, e.g. tilting or lifting mechanisms; Collapsible or rotating seats or covers
Landscapes
- Health & Medical Sciences (AREA)
- Public Health (AREA)
- Toilet Supplies (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6701415A NL6701415A (enExample) | 1967-01-30 | 1967-01-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1753096A1 true DE1753096A1 (de) | 1971-10-07 |
Family
ID=19799167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681753096 Pending DE1753096A1 (de) | 1967-01-30 | 1968-01-26 | Vorrichtung zum Aufklappen eines Toilettensitzes |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3528075A (enExample) |
| DE (1) | DE1753096A1 (enExample) |
| FR (1) | FR1558609A (enExample) |
| GB (1) | GB1210121A (enExample) |
| NL (1) | NL6701415A (enExample) |
| SE (1) | SE318379B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2912084C2 (de) * | 1979-03-27 | 1983-01-05 | Heinz Georg Thun Baus | Wasserklosett |
| GB2146674B (en) * | 1983-09-13 | 1987-05-07 | Sani Seat Inc | Toilet seat lifting device |
| US4551866A (en) * | 1984-08-30 | 1985-11-12 | Hibbs Walter G | Automatic toilet seat lowering apparatus |
| GB2171426A (en) * | 1985-02-18 | 1986-08-28 | Robert James Fowler | Lifting apparatus for toilet seat and/or lid |
| GB2185271B (en) * | 1986-01-14 | 1989-12-20 | Hussain Ali Moontasir | Seat and lid assembly for a toilet bowl |
| USD338711S (en) | 1991-07-08 | 1993-08-24 | Harold Bishop | Lifter for a toilet seat |
| GB2295167B (en) * | 1994-11-21 | 1999-02-24 | Jeremy Sherr | Remotely operated toilet seat |
| US5884342A (en) * | 1996-07-18 | 1999-03-23 | Maake; Roger W. | Toilet seat and lid hinge |
| US5978974A (en) * | 1997-06-16 | 1999-11-09 | Mullen; Michelle D. | Apparatus for raising and automatically lowering a toilet seat |
| US5852833A (en) * | 1997-10-01 | 1998-12-29 | Gregoire; Julius | Toilet seat lifting device having his and her foot pedal |
| USD458108S1 (en) | 2000-04-27 | 2002-06-04 | Cordeal, Ltd. | Toilet seat lifting device |
| US7254846B2 (en) * | 2004-05-04 | 2007-08-14 | Young Han Joo | Toilet seat tilting device |
| CN101899859A (zh) * | 2010-08-19 | 2010-12-01 | 赵金刚 | 免冲水座便器 |
| US10709303B2 (en) * | 2018-09-18 | 2020-07-14 | Arthur Clark | Toilet seat lifting assembly |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1529656A (en) * | 1924-04-28 | 1925-03-17 | Kornhauser Louis | Adjustable spring attachment for closet seats |
| GB338736A (en) * | 1929-09-24 | 1930-11-27 | Leopold Mandler | Improvements in and relating to foot-operated hinged covers |
| US1863295A (en) * | 1931-02-12 | 1932-06-14 | Joseph J Bukovitz | Toilet seat appliance |
| DE564460C (de) * | 1931-07-11 | 1932-11-19 | Paul Craemer | Vorrichtung zum Heben und Senken von Klosettsitzen |
| CH178494A (de) * | 1934-10-15 | 1935-07-31 | Odin Marcel | Mechanismus zum Öffnen und Schliessen von klappbaren Teilen mittelst eines Pedals. |
| DE651196C (de) * | 1935-10-01 | 1937-10-09 | Johann Jochim | Vorrichtung zum Zu- und Aufklappen von Klosettsitzen |
| US2100906A (en) * | 1935-12-17 | 1937-11-30 | Lefkowitz Emil | Seat and seat cover actuating mechanism for toilets |
| US2092707A (en) * | 1936-07-27 | 1937-09-07 | Bruno P Zulkoski | Toilet seat and cover operator |
| US2410854A (en) * | 1945-04-02 | 1946-11-12 | Bruno P Zulkoski | Device for raising toilet seats |
| FR72731E (fr) * | 1957-08-27 | 1960-07-22 | Cie Ind Du Confort | Dispositif de commande non-manuelle d'abattants doubles |
| US3345650A (en) * | 1965-01-18 | 1967-10-10 | Ovington E Waters | Toilet seat sanitary lifting mechanism |
-
1967
- 1967-01-30 NL NL6701415A patent/NL6701415A/xx unknown
- 1967-06-29 SE SE9654/67*A patent/SE318379B/xx unknown
-
1968
- 1968-01-25 US US700455A patent/US3528075A/en not_active Expired - Lifetime
- 1968-01-26 DE DE19681753096 patent/DE1753096A1/de active Pending
- 1968-01-29 FR FR1558609D patent/FR1558609A/fr not_active Expired
- 1968-01-30 GB GB4763/68A patent/GB1210121A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE318379B (enExample) | 1969-12-08 |
| US3528075A (en) | 1970-09-08 |
| NL6701415A (enExample) | 1968-07-31 |
| GB1210121A (en) | 1970-10-28 |
| FR1558609A (enExample) | 1969-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE102016120455B4 (de) | Kinderwagenvorrichtung | |
| DE60034390T2 (de) | Spender zum Spenden von Toilettenpapier von Rollen | |
| DE1753096A1 (de) | Vorrichtung zum Aufklappen eines Toilettensitzes | |
| CH249833A (de) | Verstellbares Ruhemöbel. | |
| DE1775524A1 (de) | Selbsttaetig verriegelbares Gelenk | |
| DE4024656A1 (de) | Muelleimer | |
| DE69900581T2 (de) | Schnellkochtopf mit einer Sicherheitsvorrichtung für die Drehung des Deckels | |
| DD280691A5 (de) | Dampfdruckkochgefaess | |
| DE29901184U1 (de) | Zusammenklappbarer Roller | |
| DE4445649A1 (de) | Vorrichtung zum Betätigen des Auslaufverschlusses von Badewannen (Rotexa-Linear) | |
| DE2649849C3 (de) | Bodenluke mit zusammenklappbarer Leiter | |
| DE3213295A1 (de) | Zusammenklappbare buegelvorrichtung | |
| DE1429413A1 (de) | Lehnstuhl | |
| DE3222232C1 (de) | Müllsammler | |
| DE19841110B4 (de) | Spülmittel-Abgabevorrichtung für eine Geschirrspülmaschine | |
| DE2948453C2 (de) | Zusammenklappbarer Konsolenträger | |
| CH471574A (de) | Vorrichtung zum Aufklappen eines Klosettsitzes | |
| DE69422175T2 (de) | Sanitäre sprühvorrichtung für klosettschüssel | |
| DE3825277C2 (enExample) | ||
| DE9420417U1 (de) | Vorrichtung zum Betätigen des Auslaufverschlusses von Badewannen (Rotexa-Linear) | |
| DE3400153A1 (de) | Vorrichtung zur aufnahme von abfall | |
| EP1258586A2 (de) | Beschlagvorrichtung für eine Möbelklappe | |
| DE8907373U1 (de) | Rückstauvorrichtung | |
| DE29703089U1 (de) | Wasserkocher | |
| DE4026450A1 (de) | Standschirm |