DE1667699A1 - Verfahren zum Herstellen von hochreinem Arsentrichlorid - Google Patents
Verfahren zum Herstellen von hochreinem ArsentrichloridInfo
- Publication number
- DE1667699A1 DE1667699A1 DE19671667699 DE1667699A DE1667699A1 DE 1667699 A1 DE1667699 A1 DE 1667699A1 DE 19671667699 DE19671667699 DE 19671667699 DE 1667699 A DE1667699 A DE 1667699A DE 1667699 A1 DE1667699 A1 DE 1667699A1
- Authority
- DE
- Germany
- Prior art keywords
- arsenic
- reaction
- arsenic trichloride
- gas
- trichloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- OEYOHULQRFXULB-UHFFFAOYSA-N arsenic trichloride Chemical compound Cl[As](Cl)Cl OEYOHULQRFXULB-UHFFFAOYSA-N 0.000 title claims description 31
- 238000000034 method Methods 0.000 title claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 25
- 229910052785 arsenic Inorganic materials 0.000 claims description 21
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 20
- 239000007789 gas Substances 0.000 claims description 18
- 239000012535 impurity Substances 0.000 claims description 14
- 238000005660 chlorination reaction Methods 0.000 claims description 11
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 11
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- 239000004065 semiconductor Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 238000004821 distillation Methods 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 4
- 238000010992 reflux Methods 0.000 claims description 4
- 239000002689 soil Substances 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 238000004140 cleaning Methods 0.000 claims description 3
- 238000004508 fractional distillation Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- JBRZTFJDHDCESZ-UHFFFAOYSA-N AsGa Chemical compound [As]#[Ga] JBRZTFJDHDCESZ-UHFFFAOYSA-N 0.000 claims description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 2
- 229910001218 Gallium arsenide Inorganic materials 0.000 claims description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- 239000004063 acid-resistant material Substances 0.000 claims description 2
- 235000011089 carbon dioxide Nutrition 0.000 claims description 2
- 239000012495 reaction gas Substances 0.000 claims description 2
- 229910052710 silicon Inorganic materials 0.000 claims description 2
- 239000010703 silicon Substances 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- 239000010936 titanium Substances 0.000 claims description 2
- 244000007853 Sarothamnus scoparius Species 0.000 claims 1
- 241000033695 Sige Species 0.000 claims 1
- 229910052782 aluminium Inorganic materials 0.000 claims 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims 1
- 238000011109 contamination Methods 0.000 claims 1
- 150000004677 hydrates Chemical class 0.000 claims 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 2
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910052733 gallium Inorganic materials 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical class S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 2
- 229910052815 sulfur oxide Inorganic materials 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- IUGDILGOLSSKNE-UHFFFAOYSA-N 1,1,1-trichloro-2,2-bis(4-hydroxyphenyl)ethane Chemical compound C1=CC(O)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(O)C=C1 IUGDILGOLSSKNE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 239000012494 Quartz wool Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01G—COMPOUNDS CONTAINING METALS NOT COVERED BY SUBCLASSES C01D OR C01F
- C01G28/00—Compounds of arsenic
- C01G28/007—Halides
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01G—COMPOUNDS CONTAINING METALS NOT COVERED BY SUBCLASSES C01D OR C01F
- C01G15/00—Compounds of gallium, indium or thallium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Vaporization, Distillation, Condensation, Sublimation, And Cold Traps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DES0108554 | 1967-02-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1667699A1 true DE1667699A1 (de) | 1971-07-22 |
Family
ID=7528884
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671667699 Pending DE1667699A1 (de) | 1967-02-28 | 1967-02-28 | Verfahren zum Herstellen von hochreinem Arsentrichlorid |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3505011A (https=) |
| DE (1) | DE1667699A1 (https=) |
| FR (1) | FR1562281A (https=) |
| GB (1) | GB1173888A (https=) |
| NL (1) | NL6716186A (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3944653A (en) * | 1972-08-30 | 1976-03-16 | Occidental Petroleum Corporation | Process for preparing high purity antimony trichloride and antimony oxide from stibnite ores |
| CN114772638A (zh) * | 2022-04-25 | 2022-07-22 | 广东先导微电子科技有限公司 | 一种氯化物的除水及纯化方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1512733A (en) * | 1924-10-21 | Ments | ||
| US1525480A (en) * | 1920-11-09 | 1925-02-10 | Metallurg Dev Corp | Manufacture of arsenic acid |
| US1512734A (en) * | 1921-03-30 | 1924-10-21 | Metallurgical Dev Co | Process of purifying arsenious chloride |
| US1936078A (en) * | 1926-12-09 | 1933-11-21 | Gen Chemical Corp | Process of purifying hydrochloric acid gas |
| US1852183A (en) * | 1928-09-25 | 1932-04-05 | George E Miller | Process for preparing arsenic trichloride |
| US2383105A (en) * | 1942-12-14 | 1945-08-21 | Monsanto Chemicals | Process for making arsenic chloride |
| US2860047A (en) * | 1955-04-20 | 1958-11-11 | Electro Chimie Metal | Process of removing arsenic from hydrochloric acid suspensions of arsenide and sulpharsenide ores utilizing gaseous chloride |
| US2970887A (en) * | 1957-04-05 | 1961-02-07 | Texas Gulf Sulphur Co | Chlorination of metal oxides |
| US3240557A (en) * | 1962-03-22 | 1966-03-15 | Dominion Gulf Company | Selective chlorination with elemental chlorine of ores containing high melting metals |
| BE641736A (https=) * | 1962-12-24 | |||
| US3194631A (en) * | 1963-03-14 | 1965-07-13 | Dow Chemical Co | Process of producing high purity arsenic trichloride from a slurry of as2o3 |
-
1967
- 1967-02-28 DE DE19671667699 patent/DE1667699A1/de active Pending
- 1967-11-28 NL NL6716186A patent/NL6716186A/xx unknown
-
1968
- 1968-02-19 US US706258A patent/US3505011A/en not_active Expired - Lifetime
- 1968-02-26 FR FR1562281D patent/FR1562281A/fr not_active Expired
- 1968-02-27 GB GB9353/68A patent/GB1173888A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3505011A (en) | 1970-04-07 |
| FR1562281A (https=) | 1969-04-04 |
| GB1173888A (en) | 1969-12-10 |
| NL6716186A (https=) | 1968-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795601A1 (de) | Fluessige,lineare,unverzweigte,saure Polyoxyperfluormethylene | |
| EP0216292B1 (de) | Verfahren zur Aufarbeitung von chlorwasserstoffhaltigen Abgasen | |
| DE3203743C2 (https=) | ||
| DE69310782T2 (de) | Verfahren zur Rückgewinnung und Reinigung von einer sehr angereichertes Uran enthaltenden Metallegierung | |
| DE1667699A1 (de) | Verfahren zum Herstellen von hochreinem Arsentrichlorid | |
| DE1190919B (de) | Verfahren zur Herstellung von Chlor und Stickstoffdioxyd | |
| DE2132427C3 (de) | Verfahren zur Herstellung von Siliciumtetrafluorid | |
| DE910536C (de) | Verfahren zur Gewinnung von reinem Schwefeltrioxyd | |
| DE1925291A1 (de) | Verfahren zur Gewinnung von Vanadin aus rohem Titanchlorid | |
| DE1667700A1 (de) | Verfahren zur Herstellung von hochreinem Arsentrichlorid | |
| DE2804742A1 (de) | Verfahren zur reinigung von metallchloridhaltigen abgasen | |
| DE1082240B (de) | Verfahren zur Herstellung von reinem Zirkontetrachlorid durch Sublimation | |
| DE1028543B (de) | Verfahren zum Reinigen von mit Wasser Gel bildenden Halogeniden, insbesondere des Germaniums oder Siliciums, vorzugsweise fuer die Herstellung von Halbleiterstoffen | |
| DE1181919B (de) | Verfahren zur Herstellung von hochreinem Arsen | |
| DE1187377B (de) | Verfahren und Vorrichtung zur kontinuierlichen Herstellung von sehr reinem Gallium | |
| DE1022569B (de) | Verfahren zur Herstellung von Siliciumtetrafluorid | |
| EP0335147B1 (de) | Verfahren und Vorrichtung zur Gewinnung von Galliumchlorid aus galliumhaltigen Verbindungen | |
| DE10342827A1 (de) | Reinigung feinverteilter, pyrogen hergestellter Metalloxidpartikel | |
| DE723223C (de) | Entfaerben von Titan (4) chlorid | |
| DE2446844C3 (de) | Verfahren zur Herstellung von Fluorwasserstoff, Phosphorsäureanhydrid, Calziumpolyphosphaten und Salpetersaure | |
| DE553818C (de) | Werkstoff zur Herstellung von gegen Salpetersaeure bzw. Salpetersaeure-Stickoxyd-Gemische bestaendigen Apparaten | |
| DE1113312B (de) | Verfahren zum Reinigen von Arsen | |
| AT347402B (de) | Verfahren zur herstellung von reinem magnesiumoxid | |
| DE1253253B (de) | Verfahren zur Herstellung konzentrierter, waesseriger, magnesiumchloridhaltiger Loesungen | |
| DE1592254A1 (de) | Verfahren zur Herstellung von hochreinem Molybdaenchlorid,bevorzugte Molybdaenpentachlorid |