DE1620286C2 - Verfahren zur Herstellung von Pyrrolderivaten - Google Patents
Verfahren zur Herstellung von PyrrolderivatenInfo
- Publication number
- DE1620286C2 DE1620286C2 DE1620286A DE1620286DA DE1620286C2 DE 1620286 C2 DE1620286 C2 DE 1620286C2 DE 1620286 A DE1620286 A DE 1620286A DE 1620286D A DE1620286D A DE 1620286DA DE 1620286 C2 DE1620286 C2 DE 1620286C2
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- pyrrole
- carboxamido
- product
- nitro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 4
- 150000003233 pyrroles Chemical class 0.000 title claims description 4
- 239000000047 product Substances 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- 239000000243 solution Substances 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- -1 amidine hydrochloride Chemical class 0.000 description 15
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- ZBXBOVMIODZOBQ-UHFFFAOYSA-N 1-methyl-4-nitropyrrole-2-carbonyl chloride Chemical compound CN1C=C([N+]([O-])=O)C=C1C(Cl)=O ZBXBOVMIODZOBQ-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- OSDZHDOKXGSWOD-UHFFFAOYSA-N nitroxyl;hydrochloride Chemical compound Cl.O=N OSDZHDOKXGSWOD-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- GEGNYFQOFWUIFG-UHFFFAOYSA-N 1-methyl-4-nitro-1h-pyrrole-2-carboxylic acid Chemical compound CN1C=C([N+]([O-])=O)C=C1C(O)=O GEGNYFQOFWUIFG-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 230000000840 anti-viral effect Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- CFHIDWOYWUOIHU-UHFFFAOYSA-N oxomethyl Chemical group O=[CH] CFHIDWOYWUOIHU-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- ZNTAXEMTUMCOTJ-UHFFFAOYSA-N 1-methyl-2-nitropyrrole Chemical compound CN1C=CC=C1[N+]([O-])=O ZNTAXEMTUMCOTJ-UHFFFAOYSA-N 0.000 description 1
- GDQSDZRZHLAVCU-UHFFFAOYSA-N 1-methylpyrrol-3-amine Chemical compound CN1C=CC(N)=C1 GDQSDZRZHLAVCU-UHFFFAOYSA-N 0.000 description 1
- NIBFJPXGNVPNHK-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-4-carbaldehyde Chemical group C1=CC(C=O)=C2OC(F)(F)OC2=C1 NIBFJPXGNVPNHK-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- XFKYKTBPRBZDFG-UHFFFAOYSA-N 2-aminoacetonitrile;hydrochloride Chemical compound Cl.NCC#N XFKYKTBPRBZDFG-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 150000000994 L-ascorbates Chemical class 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- PERWPJFJGJMXKR-UHFFFAOYSA-N N-(1-cyanoethyl)-1H-pyrrole-2-carboxamide Chemical compound N1C(=CC=C1)C(=O)NC(C#N)C PERWPJFJGJMXKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 1
- VGGRCVDNFAQIKO-UHFFFAOYSA-N formic anhydride Chemical compound O=COC=O VGGRCVDNFAQIKO-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- DFWRZHZPJJAJMX-UHFFFAOYSA-N propanimidamide;hydrochloride Chemical compound Cl.CCC(N)=N DFWRZHZPJJAJMX-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/42—Nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1539064 | 1964-07-14 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1620286B1 DE1620286B1 (de) | 1974-02-21 |
| DE1620286C2 true DE1620286C2 (de) | 1974-10-03 |
Family
ID=11147978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1620286A Expired DE1620286C2 (de) | 1964-07-14 | 1965-07-08 | Verfahren zur Herstellung von Pyrrolderivaten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3420845A (enExample) |
| BR (1) | BR6571168D0 (enExample) |
| CH (1) | CH475241A (enExample) |
| DE (1) | DE1620286C2 (enExample) |
| ES (1) | ES315304A1 (enExample) |
| NL (1) | NL130086C (enExample) |
| SE (1) | SE314983B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4803212A (en) * | 1983-04-11 | 1989-02-07 | Bristol-Myers Company | Amino disulfides |
| CN85103908A (zh) * | 1985-07-16 | 1986-11-05 | 法米塔利·卡洛·埃尔巴有限公司 | 制备4′-表多克索红菌素的新方法 |
| GB8517922D0 (en) * | 1985-07-16 | 1985-08-21 | Erba Farmitalia | Carboxamido derivatives |
| SE468642B (sv) * | 1985-07-16 | 1993-02-22 | Erba Farmitalia | Poly-4-aminopyrrol-2-karboxamidoderivat och foerfarande foer deras framstaellning och en farmaceutisk komposition |
| US5310752A (en) * | 1986-05-20 | 1994-05-10 | Farmitalia Carlo Erba Spa | Site specific alkylating agents |
| GB8612218D0 (en) * | 1986-05-20 | 1986-06-25 | Erba Farmitalia | Site specific alkylating agents |
| GB8906709D0 (en) * | 1989-03-23 | 1989-05-10 | Creighton Andrew M | Acryloyl substituted pyrrole derivatives |
| IT1230909B (it) * | 1989-06-23 | 1991-11-08 | Erba Carlo Spa | Distamicina a e derivati utili per la profilassi e il trattamento della malaria. |
| IT1247878B (it) * | 1991-02-15 | 1995-01-05 | Menarini Farma Ind | Derivati poli-4-aminopirrol-2-carbossiamidici,processi di preparazione e composizioni farmaceutiche che li contengono |
-
1965
- 1965-07-01 NL NL6508459A patent/NL130086C/xx active
- 1965-07-07 US US470258A patent/US3420845A/en not_active Expired - Lifetime
- 1965-07-08 DE DE1620286A patent/DE1620286C2/de not_active Expired
- 1965-07-12 CH CH971165A patent/CH475241A/de not_active IP Right Cessation
- 1965-07-12 BR BR171168/65A patent/BR6571168D0/pt unknown
- 1965-07-13 ES ES0315304A patent/ES315304A1/es not_active Expired
- 1965-07-13 SE SE9229/65A patent/SE314983B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH475241A (de) | 1969-07-15 |
| US3420845A (en) | 1969-01-07 |
| SE314983B (enExample) | 1969-09-22 |
| NL6508459A (enExample) | 1966-01-17 |
| BR6571168D0 (pt) | 1973-04-26 |
| NL130086C (enExample) | 1970-06-15 |
| DE1620286B1 (de) | 1974-02-21 |
| ES315304A1 (es) | 1966-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3012533C2 (enExample) | ||
| DE1720019C3 (de) | 1 -Benzyl-2-aminoacetyl-pyrrol-Derivate, deren Salze und Verfahren zu ihrer Herstellung | |
| DE1620286C2 (de) | Verfahren zur Herstellung von Pyrrolderivaten | |
| DE2141616C3 (de) | Oxazole- und Oxazine eckige Klammer auf 3,2-c eckige Klammer zu chinazolinone, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0252353B1 (de) | 4-Benzyloxy-3-pyrrolin-2-on-1-yl-acetamid, dessen Herstellung und Verwendung | |
| DE69707860T2 (de) | Verfahren zur herstellung von tetrahydroindolizinen | |
| DE69803979T2 (de) | Verfahren zur herstellung von carboxamido-4-azasteroiden | |
| CH653996A5 (de) | Tryptaminderivate und verfahren zu deren herstellung. | |
| EP0202625A2 (de) | Verfahren zur Herstellung von 2,6-Dimethyl-4-(3'-nitrophenyl)-1,4-dihydropyridin-3,5-dicarbonsäure-3 beta-(N-benzyl-N-methylamino)-ethylester-5-methylester und dessen Hydrochlorid-Salz | |
| CH645623A5 (en) | 2-Methyl-3-acetoxy-4,5-bis(halomethyl)pyridines, process for their preparation and process for the preparation of pyridoxin | |
| DE2642608C2 (de) | Verfahren zur Herstellung eines 4-Hydroxymethyl-2-pyrrolidinons | |
| DE2166270C3 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| EP0104566B1 (de) | Verfahren zur Herstellung von 5,11-Dihydro-11-((4-methyl-1-piperazinyl)-acetyl)-6H-pyrido(2,3-b)(1,4)benzodiazepin-6-on | |
| CH624107A5 (enExample) | ||
| DE1695554C3 (de) | Verfahren zur Herstellung kondensierter Piperazinonderivate | |
| DE1795701B2 (de) | Alpha- substituierte benzylpenicillinsaeureester | |
| EP0393499A1 (de) | Verfahren zur Herstellung von Carbovir und neue Zwischenprodukte dafür | |
| DE2111610C3 (de) | Verfahren zur Herstellung von Salzen von Pyrimidyl-pyridiniumderivaten | |
| CH666891A5 (de) | 4-alkoxy-2-oxo-pyrrolidin-1-yl-essigsaeure-c(1)-c(4)-alkylester, deren herstellung und verwendung. | |
| DE1240873B (de) | Verfahren zur Herstellung von 4-Halogen-5-sulfamylanthranilsaeure-hydroxamiden | |
| AT359210B (de) | Verfahren zur herstellung von desoxyvincamin- amiden | |
| EP0004535A2 (de) | Verfahren zur Herstellung von 4-Methyl-5-((2-aminoäthyl)-thiomethyl)-imidazol-dihydrochlorid | |
| AT218526B (de) | Verfahren zur Herstellung von neuen Phenthiazinderivaten | |
| AT269151B (de) | Verfahren zur Herstellung von neuen Oxazinverbindungen | |
| AT266140B (de) | Verfahren zur Herstellung von neuen Pyrazinverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EHJ | Ceased/non-payment of the annual fee |