DE1572008C3 - Überzugsmischung für einen Schutzüberzug auf einem nach einem Silbersalz-Diffusionsübertragungsverfahren hergestellten Bild - Google Patents
Überzugsmischung für einen Schutzüberzug auf einem nach einem Silbersalz-Diffusionsübertragungsverfahren hergestellten BildInfo
- Publication number
- DE1572008C3 DE1572008C3 DE1572008A DEJ0031771A DE1572008C3 DE 1572008 C3 DE1572008 C3 DE 1572008C3 DE 1572008 A DE1572008 A DE 1572008A DE J0031771 A DEJ0031771 A DE J0031771A DE 1572008 C3 DE1572008 C3 DE 1572008C3
- Authority
- DE
- Germany
- Prior art keywords
- coating
- solution
- silver
- mixture
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 37
- 238000000576 coating method Methods 0.000 title claims description 27
- 239000011248 coating agent Substances 0.000 title claims description 25
- 239000011253 protective coating Substances 0.000 title claims description 7
- 238000000034 method Methods 0.000 title claims description 6
- 238000009792 diffusion process Methods 0.000 title claims description 3
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 title claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 26
- 229920000642 polymer Polymers 0.000 claims description 18
- 230000002378 acidificating effect Effects 0.000 claims description 14
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 13
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 12
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 12
- 229910021529 ammonia Inorganic materials 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 5
- ZWLUXSQADUDCSB-UHFFFAOYSA-N phthalaldehyde Chemical group O=CC1=CC=CC=C1C=O ZWLUXSQADUDCSB-UHFFFAOYSA-N 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 27
- 229910052709 silver Inorganic materials 0.000 description 26
- 239000004332 silver Substances 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 20
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 15
- 239000000126 substance Substances 0.000 description 14
- 235000011114 ammonium hydroxide Nutrition 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 10
- 239000008273 gelatin Substances 0.000 description 10
- 229920000159 gelatin Polymers 0.000 description 10
- -1 silver ions Chemical class 0.000 description 10
- 108010010803 Gelatin Proteins 0.000 description 9
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 9
- 229920001577 copolymer Polymers 0.000 description 9
- 235000019322 gelatine Nutrition 0.000 description 9
- 235000011852 gelatine desserts Nutrition 0.000 description 9
- 239000004246 zinc acetate Substances 0.000 description 9
- 229920002678 cellulose Polymers 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 239000001913 cellulose Substances 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000011787 zinc oxide Substances 0.000 description 5
- GAMPNQJDUFQVQO-UHFFFAOYSA-N acetic acid;phthalic acid Chemical compound CC(O)=O.OC(=O)C1=CC=CC=C1C(O)=O GAMPNQJDUFQVQO-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 150000004763 sulfides Chemical class 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- ZFSGODDPMKJGJV-UHFFFAOYSA-N 5,5-dimethylimidazolidine-2,4-dione;formaldehyde Chemical compound O=C.CC1(C)NC(=O)NC1=O ZFSGODDPMKJGJV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000001241 acetals Chemical class 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 229920002301 cellulose acetate Polymers 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 239000002250 absorbent Substances 0.000 description 2
- 230000002745 absorbent Effects 0.000 description 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical class NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- UGZADUVQMDAIAO-UHFFFAOYSA-L zinc hydroxide Chemical compound [OH-].[OH-].[Zn+2] UGZADUVQMDAIAO-UHFFFAOYSA-L 0.000 description 2
- 229940007718 zinc hydroxide Drugs 0.000 description 2
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 2
- HHEHWCIYDICHCG-ODZAUARKSA-N (z)-but-2-enedioic acid;methoxyethene Chemical compound COC=C.OC(=O)\C=C/C(O)=O HHEHWCIYDICHCG-ODZAUARKSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NSEQHAPSDIEVCD-UHFFFAOYSA-N N.[Zn+2] Chemical compound N.[Zn+2] NSEQHAPSDIEVCD-UHFFFAOYSA-N 0.000 description 1
- 108090000526 Papain Proteins 0.000 description 1
- 102000057297 Pepsin A Human genes 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- SNDJGKIVHKOEHY-UHFFFAOYSA-M S(=S)(=O)(O)O.S[Na] Chemical compound S(=S)(=O)(O)O.S[Na] SNDJGKIVHKOEHY-UHFFFAOYSA-M 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical group 0.000 description 1
- 229940071162 caseinate Drugs 0.000 description 1
- 229960001927 cetylpyridinium chloride Drugs 0.000 description 1
- YMKDRGPMQRFJGP-UHFFFAOYSA-M cetylpyridinium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 YMKDRGPMQRFJGP-UHFFFAOYSA-M 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- TYNDBNTXKWNGDS-UHFFFAOYSA-N formaldehyde;imidazolidine-2,4-dione Chemical compound O=C.O=C1CNC(=O)N1 TYNDBNTXKWNGDS-UHFFFAOYSA-N 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- 229940055729 papain Drugs 0.000 description 1
- 235000019834 papain Nutrition 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-M phthalate(1-) Chemical compound OC(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-M 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000018102 proteins Nutrition 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 229960001322 trypsin Drugs 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C11/00—Auxiliary processes in photography
- G03C11/08—Varnishing, e.g. application of protective layers on finished photographic prints
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US48759665A | 1965-09-15 | 1965-09-15 | |
| US48757865A | 1965-09-15 | 1965-09-15 | |
| US48759765A | 1965-09-15 | 1965-09-15 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1572008A1 DE1572008A1 (de) | 1970-02-19 |
| DE1572008B2 DE1572008B2 (de) | 1978-12-14 |
| DE1572008C3 true DE1572008C3 (de) | 1979-08-23 |
Family
ID=27413766
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1572008A Expired DE1572008C3 (de) | 1965-09-15 | 1966-09-15 | Überzugsmischung für einen Schutzüberzug auf einem nach einem Silbersalz-Diffusionsübertragungsverfahren hergestellten Bild |
Country Status (5)
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE794397A (fr) * | 1972-01-24 | 1973-07-23 | Du Pont | Bains d'activation photographiques |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB496049A (en) * | 1937-04-19 | 1938-11-21 | Ig Farbenindustrie Ag | Improved manufacture of light-sensitive photographic preparations |
| US2759825A (en) * | 1948-02-12 | 1956-08-21 | Polaroid Corp | Photographic image transfer process |
| NL188748B (nl) * | 1953-07-01 | Oxirane Corp | Werkwijze ter bereiding van isobuteen. | |
| US2794740A (en) * | 1954-02-24 | 1957-06-04 | Polaroid Corp | Methods for washing and protecting photographic silver images |
| US2855298A (en) * | 1954-02-24 | 1958-10-07 | Polaroid Corp | Methods for washing and protecting photographic silver images |
| NL92657C (US20080293856A1-20081127-C00150.png) * | 1954-02-26 | |||
| US2830900A (en) * | 1956-10-04 | 1958-04-15 | Polaroid Corp | Process of washing and protecting photographic silver images, and photographic products thereof |
| US2956877A (en) * | 1956-10-04 | 1960-10-18 | Polaroid Corp | Process of washing and protecting photographic silver images, and photographic products thereof |
| US2979477A (en) * | 1958-05-08 | 1961-04-11 | Polaroid Corp | Composition comprising a vinylpyridine polymer and a hydantoin formaldehyde condensation polymer |
| BE595324A (US20080293856A1-20081127-C00150.png) * | 1959-09-24 | |||
| US3325283A (en) * | 1964-01-16 | 1967-06-13 | Polaroid Corp | Photographic diffusion transfer products and processes employing image receiving elements containing a layer of polyvinyl pyrrolidone and polyvinyl hydrogen phthalate |
-
1965
- 1965-09-15 US US487578A patent/US3533789A/en not_active Expired - Lifetime
- 1965-09-15 US US487596A patent/US3533790A/en not_active Expired - Lifetime
- 1965-09-15 US US487597A patent/US3529962A/en not_active Expired - Lifetime
-
1966
- 1966-09-13 GB GB40898/66A patent/GB1164641A/en not_active Expired
- 1966-09-13 GB GB05582/69A patent/GB1164642A/en not_active Expired
- 1966-09-13 BE BE686815D patent/BE686815A/xx not_active IP Right Cessation
- 1966-09-14 NL NL6612967A patent/NL6612967A/xx unknown
- 1966-09-15 DE DE1572008A patent/DE1572008C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE686815A (US20080293856A1-20081127-C00150.png) | 1967-03-13 |
| DE1572008B2 (de) | 1978-12-14 |
| GB1164641A (en) | 1969-09-17 |
| US3529962A (en) | 1970-09-22 |
| US3533790A (en) | 1970-10-13 |
| GB1164642A (en) | 1969-09-17 |
| NL6612967A (US20080293856A1-20081127-C00150.png) | 1967-03-16 |
| DE1572008A1 (de) | 1970-02-19 |
| US3533789A (en) | 1970-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE874704C (de) | Lichtempfindliche Schicht fuer Zeichenleinwand | |
| DE1772172A1 (de) | Vorsensibilisierte lichtempfindliche,positiv-wirkende lithographische Metalldruckplatte | |
| DE2302462B2 (de) | Thermophotographisches Aufzeichnungsmaterial | |
| DE1100464B (de) | Kopierschichten zur Herstellung von Bildern durch Einwirkung von Waerme | |
| DE1572008C3 (de) | Überzugsmischung für einen Schutzüberzug auf einem nach einem Silbersalz-Diffusionsübertragungsverfahren hergestellten Bild | |
| DE1027984B (de) | Verfahren zum Waschen und Schuetzen eines photographischen Silberbildes | |
| DE950041C (de) | Photographisches Silberbild mit Schutzschicht und Verfahren zum Auftragen der Schutzschicht | |
| DE2214924A1 (de) | Diffusionsübertragungsbildempfangsmaterialien | |
| DE1102555B (de) | Verfahren zur Herstellung einer photographischen lichtempfindlichen Silberhalogenidemulsion | |
| DE1073306B (de) | Bildempfangsmaterial zur Verwendung im photographischen Silbersalzdiffusions-Ubertragungsverfahren und Verfahren zu dessen Herstellung | |
| DE2357408A1 (de) | Lichtempfindliches, photographisches silberhalogenid-aufzeichnungsmaterial | |
| DE1153249B (de) | Ein- oder beidseitig aussen aufgebrachte Schutzschichten mit Polymerisaten als Bindemittel fuer photographische Materialien oder Gelatinefolien, die photographische Anwendung finden | |
| DE2139450A1 (de) | Verfahren zum vernetzen hydrophiler kolloide | |
| DE876951C (de) | Lichtempfindliches Material zur Herstellung von Druckformen | |
| DE1547902A1 (de) | Lichtempfindliche photographische Zubereitung | |
| DE1254346B (de) | Verfahren zur Herstellung von wasserunloeslichen Gelatineschichten | |
| DE69108049T2 (de) | Beschichtungszusammensetzung und diese enthaltende verbundträger und elemente. | |
| DE1289426B (de) | Verfahren zum Fixieren von Bildern in einer Schicht aus photochromen stickstoffhaltigen Spiropyranverbindungen | |
| DE3000407A1 (de) | Verfahren zur haertung photographischer gelatine | |
| DE1941887C3 (de) | Photographisches Schichtenmaterial | |
| DE957620C (de) | Verfahren zum Waschen und Schützen von photographischen Silberbildern | |
| DE1547861A1 (de) | Photographische,lichtempfindliche Gelatine-Halogensilber-Materialien | |
| DE896294C (de) | Verfahren zur Herstellung photographischer Registrierungen und lichtempfindliches Material zur Ausfuehrung des Verfahrens | |
| DE2324524A1 (de) | Bildempfangsmaterialien fuer ein silbersalzdiffusionsuebertragungsverfahren und verfahren zu deren herstellung | |
| DE1024357B (de) | Photographisches UEbertragungsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |