DE1568248C - - Google Patents
Info
- Publication number
- DE1568248C DE1568248C DE1568248C DE 1568248 C DE1568248 C DE 1568248C DE 1568248 C DE1568248 C DE 1568248C
- Authority
- DE
- Germany
- Prior art keywords
- weight
- hours
- cyclohexane
- parts
- phosgene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 12
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 claims description 9
- 125000005587 carbonate group Chemical group 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 150000002009 diols Chemical class 0.000 claims description 8
- 239000012442 inert solvent Substances 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000000047 product Substances 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 238000006068 polycondensation reaction Methods 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 2
- 238000000921 elemental analysis Methods 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 13
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 13
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- -1 aliphatic diols Chemical class 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000004417 polycarbonate Substances 0.000 description 5
- 229920000515 polycarbonate Polymers 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 125000004965 chloroalkyl group Chemical group 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229920002635 polyurethane Polymers 0.000 description 3
- 239000004814 polyurethane Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000012696 Interfacial polycondensation Methods 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- WSJCBMAHJRRJRX-UHFFFAOYSA-N carbonic acid;[4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OC(O)=O.OCC1CCC(CO)CC1 WSJCBMAHJRRJRX-UHFFFAOYSA-N 0.000 description 1
- 229940059864 chlorine containing product ectoparasiticides Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- VSSAZBXXNIABDN-UHFFFAOYSA-N cyclohexylmethanol Chemical compound OCC1CCCCC1 VSSAZBXXNIABDN-UHFFFAOYSA-N 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920001291 polyvinyl halide Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE1595446C3 (de) | Verfahren zur Herstellung von Carbonatreste enthaltenden Dihydroxyverbi ndungen | |
DE68927281T2 (de) | Polycarbonatdiolzusammensetzung und Polyurethankunststoff | |
DE69513159T2 (de) | Verfahren zur herstellung von polycarbonaten mit hydroxylendgruppen | |
DE1108904B (de) | Verfahren zur Herstellung von Urethangruppen aufweisenden Schaumstoffen | |
DE60112347T2 (de) | Verfahren zur Herstellung von Polycarbonatdiolen mit hohem Molekulargewicht | |
DE68925667T2 (de) | Copolyester-Diol-Polycarbonate, Verfahren zu ihrer Herstellung und deren Verwendung | |
DE1226560B (de) | Verfahren zur Herstellung von Butylenglykoldiacetaten | |
DE2238740A1 (de) | Perfluoralkylgruppenhaltige polyaether und verfahren zu deren herstellung | |
DE1618480A1 (de) | Verfahren zur Herstellung von Vinylaethern | |
DE2555805A1 (de) | Zweistufiges herstellungsverfahren fuer polycarbonate | |
DE10303881A1 (de) | Verfahren zur Herstellung von oligomeren aliphatischen Diolen, darauf basierenden Polycarbonatdiolen und deren Prepolymeren | |
WO2022268615A2 (de) | Verfahren zum chemischen recycling von polyethylenfuranoat (pef), pur/pir-hartschaum und verfahren zur herstellung von pur/pir-hartschäumen | |
EP1663941A1 (de) | Zwischenprodukt bestehend aus einer mischung von organischen carbonaten und carbamaten und ein verfahren zu seiner herstellung | |
DE1568248C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
AT391691B (de) | Verfahren zur herstellung von kohlensaeureestern, die sich von ungesaettigten alkoholen und mehrwertigen alkoholen ableiten | |
DE4113156A1 (de) | Verfahren zur herstellung von poly(o-alkylurethanen) der diphenylmethanreihe | |
DE2448649C3 (de) | Verfahren zur Herstellung von aliphatischen oder cycloaliphatischen Diol-Polycarbonaten | |
DE1266309B (de) | Verfahren zur Herstellung von Bromderivaten von Bis-(hydroxyphenyl)-dialkylmethanen | |
DE1568248B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
DE1817197A1 (de) | Cycloaliphatische Di-(aminoalkane) und Verfahren zu ihrer Herstellung | |
EP0057825B1 (de) | Verfahren zur Herstellung aliphatischer cyclischer Kohlensäureester | |
WO2005028414A1 (de) | Verfahren zur herstellung von organischen carbonaten | |
DE2555882A1 (de) | Verfahren zur herstellung von oligocarbonaten durch doppelte katalyse | |
EP0317743B1 (de) | Verfahren zur Herstellung von monoblockierten (cyclo)-aliphatischen Diisocyanaten | |
AT341225B (de) | Verfahren zur herstellung von polykarbonaten |