DE1543127B - - Google Patents
Info
- Publication number
- DE1543127B DE1543127B DE1543127B DE 1543127 B DE1543127 B DE 1543127B DE 1543127 B DE1543127 B DE 1543127B
- Authority
- DE
- Germany
- Prior art keywords
- bis
- propane
- peroxide
- benzene
- butylperoxycyclohexyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 25
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 18
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 10
- 239000001294 propane Substances 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 150000002978 peroxides Chemical class 0.000 claims description 7
- HAWVCXABNZBPED-UHFFFAOYSA-N 4-[2-(4-oxocyclohexyl)propan-2-yl]cyclohexan-1-one Chemical compound C1CC(=O)CCC1C(C)(C)C1CCC(=O)CC1 HAWVCXABNZBPED-UHFFFAOYSA-N 0.000 claims description 6
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 claims description 6
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 229920003052 natural elastomer Polymers 0.000 claims description 4
- 229920001194 natural rubber Polymers 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 229920003051 synthetic elastomer Polymers 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- 244000043261 Hevea brasiliensis Species 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 238000010533 azeotropic distillation Methods 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 238000001816 cooling Methods 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims description 2
- 238000004132 cross linking Methods 0.000 claims description 2
- 239000003431 cross linking reagent Substances 0.000 claims description 2
- 238000001914 filtration Methods 0.000 claims description 2
- 239000000178 monomer Substances 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229920002379 silicone rubber Polymers 0.000 claims description 2
- 239000004945 silicone rubber Substances 0.000 claims description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 2
- 239000005061 synthetic rubber Substances 0.000 claims description 2
- KRDXTHSSNCTAGY-UHFFFAOYSA-N 2-cyclohexylpyrrolidine Chemical compound C1CCNC1C1CCCCC1 KRDXTHSSNCTAGY-UHFFFAOYSA-N 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 229920003225 polyurethane elastomer Polymers 0.000 claims 1
- -1 4-ketocyclohexyl Chemical group 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0003045B1 (de) | Verwendung von Gemischen oligomerer Acrylsäuren in Klebstoffen | |
| DE1443188C (enrdf_load_html_response) | ||
| DE729342C (de) | Verfahren zur Herstellung von Acrylsaeure, Methacrylsaeure und deren Ester aus ª‰-Alkoxycarbonsaeuren | |
| DE1543127B (enrdf_load_html_response) | ||
| DE1543127C (de) | 2,2 Bis-(4,4-ditert.butylperoxycyclo hexyl)-propan und Verfahren zu dessen Herstellung | |
| DE2921503A1 (de) | Verfahren zur herstellung von resorcin | |
| DE1543127A1 (de) | 2,2-bis(4-tert.-Butylperoxycyclohexyl)-propan und Verfahren zu dessen Herstellung | |
| DE1232582B (de) | Verfahren zur Herstellung von 3, 3-Bis-(hydro-peroxy-tert.-butyl)-butan-1-carbonsaeureestern | |
| DE3216085A1 (de) | Substituierte 3-isopropyl-cyclopentanonderivate, deren herstellung und verwendung als riechstoffe sowie diese enthaltende riechstoffkompositionen | |
| US3198843A (en) | Purification of glycerine | |
| DE854797C (de) | Verfahren zur Herstellung von ungesaettigten Carbonsaeuren durch Oxydation der entsprechenden Aldehyde | |
| DE1189993B (de) | Verfahren zur Herstellung von organischen Peroxyden | |
| DE1949434C3 (de) | Verfahren zur Gewinnung von Methyl methacrylat | |
| DE749150C (de) | Verfahren zur Herstellung von ringfoermigen Acetalen des Formaldehyds | |
| DE2818244C2 (de) | Verwendung der 4,6,6- bzw. 4,4,6-Trimethyltetrahydropyran-2-one als Riechstoffe sowie diese enthaltende Riechstoffkompositionen | |
| DE2157035A1 (de) | Verfahren zur herstellung hoehermolekularer alpha-beta-ungesaettigter aldehyde | |
| DE250690C (enrdf_load_html_response) | ||
| DE2051320C3 (de) | Verfahren zur Reinigung von aliphatischen Dicarbonsäuregemischen | |
| AT206880B (de) | Verfahren zur Herstellung von Maleinsäureanhydrid | |
| EP0093852A1 (de) | Makrocyclische Dicarbonsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Riechstoffe | |
| DE817306C (de) | Verfahren zur Herstellung von 2, 7-Dimethylocten-(2)-ol-(7) | |
| DE1912869C (de) | Verfahren zur Herstellung von Pheno len und Ketonen | |
| JPS6243982B2 (enrdf_load_html_response) | ||
| DE1290142B (de) | Verfahren zur Herstellung eines Gemisches von ª‡,ª‡'-Bis-(di-tert.-butylperoxy)-1, 3-diisopropylbenzol und ª‡,ª‡'-Bis-(di-tert.-butylperoxy)-1, 4-diisopropylbenzol | |
| DE2358508C3 (de) | Verfahren zum Reinigen von Dicumylperoxid |