DE1542777C3 - a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivat - Google Patents
a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivatInfo
- Publication number
- DE1542777C3 DE1542777C3 DE1542777A DEF0045840A DE1542777C3 DE 1542777 C3 DE1542777 C3 DE 1542777C3 DE 1542777 A DE1542777 A DE 1542777A DE F0045840 A DEF0045840 A DE F0045840A DE 1542777 C3 DE1542777 C3 DE 1542777C3
- Authority
- DE
- Germany
- Prior art keywords
- chloro
- chlorophenyl
- methyl
- och
- propionate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004009 herbicide Substances 0.000 title claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 title description 7
- LIDRHDRWTSPELB-UHFFFAOYSA-N 2-chloro-3-phenylpropanoic acid Chemical class OC(=O)C(Cl)CC1=CC=CC=C1 LIDRHDRWTSPELB-UHFFFAOYSA-N 0.000 title 1
- 235000007320 Avena fatua Nutrition 0.000 claims description 7
- 244000075850 Avena orientalis Species 0.000 claims description 7
- 235000005373 Uvularia sessilifolia Nutrition 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 description 21
- 239000004480 active ingredient Substances 0.000 description 20
- 239000000460 chlorine Substances 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 241000196324 Embryophyta Species 0.000 description 12
- -1 alkylammonium ion Chemical class 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 239000003995 emulsifying agent Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 241000209140 Triticum Species 0.000 description 5
- 235000021307 Triticum Nutrition 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 241000209219 Hordeum Species 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- 150000001805 chlorine compounds Chemical class 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 150000008049 diazo compounds Chemical class 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241000209094 Oryza Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- MCOQHIWZJUDQIC-UHFFFAOYSA-N barban Chemical compound ClCC#CCOC(=O)NC1=CC=CC(Cl)=C1 MCOQHIWZJUDQIC-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- HCGXLLKTPOWTFZ-UHFFFAOYSA-N 2-(2,3,4-trichlorophenyl)acetic acid Chemical class OC(=O)CC1=CC=C(Cl)C(Cl)=C1Cl HCGXLLKTPOWTFZ-UHFFFAOYSA-N 0.000 description 1
- YRUBJDXEYFCYCX-UHFFFAOYSA-N 2-(3-chlorophenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=CC(Cl)=C1 YRUBJDXEYFCYCX-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- JLLYLQLDYORLBB-UHFFFAOYSA-N 5-bromo-n-methylthiophene-2-sulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(Br)S1 JLLYLQLDYORLBB-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 206010053759 Growth retardation Diseases 0.000 description 1
- 241000282858 Hyracoidea Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 241000209149 Zea Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002969 artificial stone Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical class OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 231100000001 growth retardation Toxicity 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/64—Acyl halides
- C07C57/76—Acyl halides containing halogen outside the carbonyl halide groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1542777A DE1542777C3 (de) | 1965-04-17 | 1965-04-17 | a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivat |
| GB13318/66A GB1077194A (en) | 1965-04-17 | 1966-03-25 | Selective herbicidal compositions |
| FI660895A FI41887C (fi) | 1965-04-17 | 1966-04-05 | Selektiivinen rikkaruohomyrkky |
| US540844A US3472646A (en) | 1965-04-17 | 1966-04-07 | Wild oat control with alpha-chloro-beta-(4-chlorophenyl) propionic acid esters |
| NL666605103A NL147413B (nl) | 1965-04-17 | 1966-04-15 | Werkwijze ter bereiding van preparaten met selectieve herbicide activiteit. |
| BE679576D BE679576A (https=) | 1965-04-17 | 1966-04-15 | |
| FR57881A FR1476247A (fr) | 1965-04-17 | 1966-04-15 | Herbicide sélectif |
| NO162596A NO115561B (https=) | 1965-04-17 | 1966-04-15 | |
| DK196566AA DK117116B (da) | 1965-04-17 | 1966-04-15 | Selektivt herbicid. |
| SE5151/66A SE303211B (https=) | 1965-04-17 | 1966-04-15 | |
| CH118269A CH475184A (de) | 1965-04-17 | 1966-05-20 | Verfahren zur Herstellung von Phenylcarbonsäureestern |
| CH729166A CH474954A (de) | 1965-04-17 | 1966-05-20 | Selektiv herbizides Mittel |
| US795762A US3557189A (en) | 1965-04-17 | 1968-12-06 | Alpha-chloro-beta-(4-chlorophenyl)-propionic acid methyl ester |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1542777A DE1542777C3 (de) | 1965-04-17 | 1965-04-17 | a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivat |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1542777A1 DE1542777A1 (de) | 1970-07-02 |
| DE1542777B2 DE1542777B2 (de) | 1978-04-06 |
| DE1542777C3 true DE1542777C3 (de) | 1978-12-07 |
Family
ID=7100704
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1542777A Expired DE1542777C3 (de) | 1965-04-17 | 1965-04-17 | a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivat |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3472646A (https=) |
| BE (1) | BE679576A (https=) |
| DE (1) | DE1542777C3 (https=) |
| DK (1) | DK117116B (https=) |
| FI (1) | FI41887C (https=) |
| FR (1) | FR1476247A (https=) |
| GB (1) | GB1077194A (https=) |
| NL (1) | NL147413B (https=) |
| NO (1) | NO115561B (https=) |
| SE (1) | SE303211B (https=) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1542777C3 (de) * | 1965-04-17 | 1978-12-07 | Bayer Ag, 5090 Leverkusen | a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivat |
| US3917664A (en) * | 1968-09-09 | 1975-11-04 | Velsicol Chemical Corp | 1-Halo-2-alkoxyimino-2-alkoxy ethane compounds |
| DE2031942A1 (de) * | 1970-06-27 | 1972-01-13 | Merck Patent Gmbh, 6100 Darmstadt | Herbizide Mittel |
| DE2122309C3 (de) * | 1971-05-06 | 1978-11-02 | Bayer Ag | 3-Aryl-2-halogen-thiopropionsaurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide |
| US3966801A (en) * | 1971-11-04 | 1976-06-29 | William H. Rorer, Inc. | Phenyl butyric acids and derivatives thereof |
| DE2352537A1 (de) * | 1973-10-19 | 1975-04-30 | Basf Ag | Herbizid |
| HU185876B (en) * | 1980-02-29 | 1985-04-28 | Egyt Gyogyszervegyeszeti Gyar | Composition for controlling growth of plants and process for producing the active agent |
| US5237089A (en) * | 1986-02-07 | 1993-08-17 | Basf Aktiengesellschaft | Nitro or amino substituted phenylalkyl or phenylalkenyl carboxylic acid derivatives |
| DE3724395A1 (de) * | 1987-07-23 | 1989-02-02 | Basf Ag | 3-phenylpropionsaeurederivate |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1836123A (en) * | 1927-07-09 | 1931-12-15 | Winthrop Chem Co Inc | New carboxylic acids of the fatty-aromatic series and process of making same |
| US2240275A (en) * | 1938-09-10 | 1941-04-29 | Mallinckrodt Chemical Works | Highly branched brominated organic acids and their esters |
| GB574995A (en) * | 1941-05-12 | 1946-01-30 | Wilfred Archibald Sexton | Destruction of weeds |
| US2341016A (en) * | 1941-09-09 | 1944-02-08 | Du Pont | Condensation of aldehydes with carboxylic acids and their derivatives |
| US2326471A (en) * | 1942-02-20 | 1943-08-10 | Du Pont | Composition and method |
| GB598072A (en) * | 1944-03-20 | 1948-02-10 | American Chem Paint Co | Improvements in methods and compositions for killing weeds |
| US2394916A (en) * | 1945-05-31 | 1946-02-12 | American Chem Paint Co | Methods and compositions for killing weeds |
| FR957697A (https=) * | 1947-01-02 | 1950-02-23 | ||
| US2551674A (en) * | 1949-08-22 | 1951-05-08 | Phillips Petroleum Co | Manufacture of beta-phenylpropionic acid |
| NL272056A (https=) * | 1958-03-24 | |||
| US3020146A (en) * | 1958-09-22 | 1962-02-06 | Velsicol Chemical Corp | Method of destroying undesirable plants |
| US3218146A (en) * | 1962-09-10 | 1965-11-16 | Hooker Chemical Corp | Controlling weeds with alpha-chlorinated polychlorophenylacetic acid |
| DE1542777C3 (de) * | 1965-04-17 | 1978-12-07 | Bayer Ag, 5090 Leverkusen | a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivat |
-
1965
- 1965-04-17 DE DE1542777A patent/DE1542777C3/de not_active Expired
-
1966
- 1966-03-25 GB GB13318/66A patent/GB1077194A/en not_active Expired
- 1966-04-05 FI FI660895A patent/FI41887C/fi active
- 1966-04-07 US US540844A patent/US3472646A/en not_active Expired - Lifetime
- 1966-04-15 NL NL666605103A patent/NL147413B/xx not_active IP Right Cessation
- 1966-04-15 SE SE5151/66A patent/SE303211B/xx unknown
- 1966-04-15 BE BE679576D patent/BE679576A/xx unknown
- 1966-04-15 DK DK196566AA patent/DK117116B/da unknown
- 1966-04-15 NO NO162596A patent/NO115561B/no unknown
- 1966-04-15 FR FR57881A patent/FR1476247A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI41887B (https=) | 1969-12-01 |
| NL6605103A (https=) | 1966-10-18 |
| US3472646A (en) | 1969-10-14 |
| FI41887C (fi) | 1970-03-10 |
| FR1476247A (fr) | 1967-04-07 |
| NO115561B (https=) | 1968-10-21 |
| NL147413B (nl) | 1975-10-15 |
| GB1077194A (en) | 1967-07-26 |
| DE1542777B2 (de) | 1978-04-06 |
| DK117116B (da) | 1970-03-16 |
| SE303211B (https=) | 1968-08-19 |
| DE1542777A1 (de) | 1970-07-02 |
| BE679576A (https=) | 1966-10-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0030287A1 (de) | 1-Amino-cyclopropancarbonsäure-Derivate, Verfahren zu ihrer Herstellung, ihre Verwendung als Pflanzenwachstumsregulatoren und solche Derivate enthaltende Mittel | |
| DE1542777C3 (de) | a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivat | |
| DE2500265A1 (de) | Neue mikrobizide | |
| DE2812622C2 (de) | (2,3-Dihydro-2,2-dimethyl-benzofuran-7-yl-oxy-N-methyl-carbamoyl)-(N'-alkyl-carbamoyl)-sulfide, Verfahren zu deren Herstellung und diese Verbindungen enthaltende insektizide Mittel | |
| DE1949012A1 (de) | Bistriazolyl-bisphenyl-methane und deren Salze,Verfahren zu ihrer Herstellung und ihre Verwendung als Wachstumsregulatoren | |
| DE2431073A1 (de) | Fungizides mittel | |
| DE2151766A1 (de) | Phenoxycarbonsaeureamide | |
| DE2126149A1 (en) | Halo-salicylanilide derivs - with acaricidal and fungicidal activity | |
| EP0010692A1 (de) | Neue m-Anilidurethane, sie enthaltende Herbizide und Verfahren zu deren Herstellung, sowie Verfahren zur Bekämpfung von unerwünschtem Pflanzenwuchs | |
| EP0019156A1 (de) | Substituierte Harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Pflanzenbakterizide | |
| EP0144895A2 (de) | Thiolan-2,4-dion-3-carboxamide | |
| EP0142040A2 (de) | Substituierte Pyrimidine | |
| DE2061133A1 (de) | Pestizide Verbindung,Verfahren zu ihrer Herstellung und Verwendung | |
| EP0008056A1 (de) | Neue N-substituierte Pyrazolderivate, Verfahren zu ihrer Herstellung und dabei erhaltene neue N-Hydroxyalkylpyrazole | |
| DE2601376A1 (de) | Phenoxycarbonsaeure-aryloxy(thio)carbonylaminomethylester, verfahren zu ihrer herstellung sowie ihre verwendung zur regulierung des pflanzenwachstums | |
| AT263448B (de) | Selektives herbizides Mittel | |
| EP0608739A2 (de) | Cycloalkylcarbonsäureanilide | |
| DE2546774A1 (de) | Fungizide pflanzenbiologische mittel und ein verfahren zu ihrer herstellung | |
| DE2349970A1 (de) | N-benzoyl-n-(3-chlor-4-fluorphenyl)-2amino-propionsaeureester und deren verwendung als herbizide | |
| CH474954A (de) | Selektiv herbizides Mittel | |
| DE3414881A1 (de) | Allophanat-derivate | |
| AT273960B (de) | Verfahren zur Herstellung von neuen Thiaimidazolidinderivaten | |
| AT275236B (de) | Herbizides Mittel und Verfahren zu dessen Herstellung | |
| CH638788A5 (en) | Pyridine derivatives, their preparation and use | |
| DE2203049A1 (de) | Pyridazinderivate, verfahren zu ihrer herstellung und ihre verwendung als pflanzenwachstumsregulatoren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |