DE1515698C - - Google Patents
Info
- Publication number
- DE1515698C DE1515698C DE1515698C DE 1515698 C DE1515698 C DE 1515698C DE 1515698 C DE1515698 C DE 1515698C
- Authority
- DE
- Germany
- Prior art keywords
- resin
- insulating layer
- parts
- coil
- varnish
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920005989 resin Polymers 0.000 claims description 35
- 239000011347 resin Substances 0.000 claims description 35
- 239000002904 solvent Substances 0.000 claims description 24
- 229920002554 vinyl polymer Polymers 0.000 claims description 20
- 239000002966 varnish Substances 0.000 claims description 18
- 239000011354 acetal resin Substances 0.000 claims description 12
- 229920002866 paraformaldehyde Polymers 0.000 claims description 12
- 239000003822 epoxy resin Substances 0.000 claims description 9
- 238000009413 insulation Methods 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 229920000647 polyepoxide Polymers 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 8
- 239000011248 coating agent Substances 0.000 claims description 7
- 238000000576 coating method Methods 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 229920000728 polyester Polymers 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 5
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims description 5
- 229920005749 polyurethane resin Polymers 0.000 claims description 5
- 229920002050 silicone resin Polymers 0.000 claims description 5
- VZGDMQKNWNREIO-UHFFFAOYSA-N Carbon tetrachloride Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 4
- 229920001568 phenolic resin Polymers 0.000 claims description 4
- 239000005011 phenolic resin Substances 0.000 claims description 4
- 239000008096 xylene Substances 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 229920000877 Melamine resin Polymers 0.000 claims description 3
- 239000004640 Melamine resin Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 125000004432 carbon atoms Chemical group C* 0.000 claims description 3
- 125000003700 epoxy group Chemical group 0.000 claims description 3
- 239000007849 furan resin Substances 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-Tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 2
- WIHMGGWNMISDNJ-UHFFFAOYSA-N 1,1-dichloropropane Chemical compound CCC(Cl)Cl WIHMGGWNMISDNJ-UHFFFAOYSA-N 0.000 claims description 2
- 239000004593 Epoxy Substances 0.000 claims description 2
- 239000004972 Polyurethane varnish Substances 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- 239000004922 lacquer Substances 0.000 claims description 2
- 229920001296 polysiloxane Polymers 0.000 claims description 2
- IJDNQMDRQITEOD-UHFFFAOYSA-N butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 claims 1
- 239000001273 butane Substances 0.000 claims 1
- 239000010410 layer Substances 0.000 description 58
- 239000002253 acid Substances 0.000 description 11
- 238000005299 abrasion Methods 0.000 description 8
- 239000004020 conductor Substances 0.000 description 8
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 8
- 238000004804 winding Methods 0.000 description 7
- 229920001225 Polyester resin Polymers 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000004645 polyester resin Substances 0.000 description 6
- 229920001187 thermosetting polymer Polymers 0.000 description 6
- 238000010304 firing Methods 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 3
- 238000007654 immersion Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 239000011528 polyamide (building material) Substances 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 239000002356 single layer Substances 0.000 description 3
- 238000007711 solidification Methods 0.000 description 3
- 229920005992 thermoplastic resin Polymers 0.000 description 3
- 210000004905 Finger nails Anatomy 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000011068 load Methods 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 230000002522 swelling Effects 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N triclene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- ABSHBZODGOHLFR-UHFFFAOYSA-N 1,1,1-trichlorobutane Chemical compound CCCC(Cl)(Cl)Cl ABSHBZODGOHLFR-UHFFFAOYSA-N 0.000 description 1
- CVKGSDYWCFQOKU-UHFFFAOYSA-N 2-N-butyl-1,3,5-triazine-2,4,6-triamine Chemical compound CCCCNC1=NC(N)=NC(N)=N1 CVKGSDYWCFQOKU-UHFFFAOYSA-N 0.000 description 1
- ZRYCRPNCXLQHPN-UHFFFAOYSA-N 3-hydroxy-2-methylbenzaldehyde Chemical compound CC1=C(O)C=CC=C1C=O ZRYCRPNCXLQHPN-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- -1 anhydrides Acids Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001809 detectable Effects 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000011146 organic particle Substances 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- KGMXPXPXPAAUMD-UHFFFAOYSA-L propane;dichloride Chemical compound [Cl-].[Cl-].CCC KGMXPXPXPAAUMD-UHFFFAOYSA-L 0.000 description 1
- 230000001681 protective Effects 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 229920003987 resole Polymers 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE974705C (de) | Glimmerpapierisolation fuer elektrische Leiter | |
| DE1515698B1 (de) | Elektrisch isolierter Draht zur Spulenherstellung | |
| DE3237022A1 (de) | Mit einem gleitmittel versehener, maschinell verarbeitbarer magnetwicklungsdraht | |
| EP1514338A1 (fr) | Dispositif anti-effluves | |
| DE2641406A1 (de) | Halbleitender bindestreifen | |
| DE2811028A1 (de) | Energiekabel, insbesondere isolierueberzug fuer ein energiekabel | |
| DE3011047C2 (de) | Wärmebeständiger, isolierter elektrischer Leitungsdraht und Verfahren zu dessen Herstellung | |
| DE2261686A1 (de) | Bandagierband fuer elektrische leiter | |
| EP3363029B1 (fr) | Transformateur sec compact doté d'un enroulement électrique et procédé de réalisation d'un enroulement électrique | |
| DE2443252C2 (de) | Wärmehärtbarer, im B-Zustand thermoplastischer Klebelack zum Überziehen elektrisch isolierter Drähte | |
| DE1495174C2 (de) | Verfahren zur Herstellung von hitzehärtbaren Polyesterharzen, die neben Estergruppen und fünfgliedrigen Imidringen innerhalb der Ketten noch Amidgruppen enthalten | |
| DE1033291B (de) | Isolierte elektrische Leitung | |
| WO2000024007A1 (fr) | Procede de production de rubans isolants contenant du mica, et utilisation de ces rubans | |
| DE3232967C2 (de) | Mit einem Gleitmittel versehener, maschinell verarbeitbarer Magnetwicklungsdraht | |
| DE1515698C (fr) | ||
| DE3403556A1 (de) | Isolierter elektrischer leiter und ein verfahren fuer seine vorbereitung | |
| DE815499C (de) | Verfahren zur Herstellung von Isolierungen auf polimerisationshindernden Metallen, z. B. Kupfer | |
| DE2342070C3 (de) | Verfarhen zur Herstellung einer für dauernde Temperaturbeanspruchung über 250 C geeigneten Wicklungsisolation für eine elektrische Maschine | |
| DE3012745C2 (de) | Draht für elektromagnetische Anwendungen | |
| EP0768680A2 (fr) | Fil et son procédé de fabrication | |
| DE19951709A1 (de) | Elektrischer Leiter mit rechteckigem oder quadradischem Querschnitt | |
| DE2460206C2 (de) | Harzmischung auf Polyester- und Polyhydantoinbasis und ihre Verwendung | |
| EP0768679A2 (fr) | Fil et son procédé de fabrication | |
| DE715147C (de) | Lackdraht | |
| DE1816234C3 (de) | Imprägnierte elektrische Wicklung |