DE1466432A1 - Drahtgitter-Linsenantenne - Google Patents
Drahtgitter-LinsenantenneInfo
- Publication number
- DE1466432A1 DE1466432A1 DE19631466432 DE1466432A DE1466432A1 DE 1466432 A1 DE1466432 A1 DE 1466432A1 DE 19631466432 DE19631466432 DE 19631466432 DE 1466432 A DE1466432 A DE 1466432A DE 1466432 A1 DE1466432 A1 DE 1466432A1
- Authority
- DE
- Germany
- Prior art keywords
- wire
- mesh
- antenna
- antenna according
- distance
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000001965 increasing effect Effects 0.000 claims description 26
- 239000002131 composite material Substances 0.000 claims description 18
- 230000005540 biological transmission Effects 0.000 claims description 13
- 230000005855 radiation Effects 0.000 claims description 13
- 239000004020 conductor Substances 0.000 claims description 6
- 230000002093 peripheral effect Effects 0.000 claims description 5
- 230000007423 decrease Effects 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 239000003990 capacitor Substances 0.000 claims 1
- 230000008859 change Effects 0.000 description 17
- 230000001939 inductive effect Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 229910003460 diamond Inorganic materials 0.000 description 4
- 239000010432 diamond Substances 0.000 description 4
- 230000008901 benefit Effects 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000001902 propagating effect Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000004146 energy storage Methods 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- QNRATNLHPGXHMA-XZHTYLCXSA-N (r)-(6-ethoxyquinolin-4-yl)-[(2s,4s,5r)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride Chemical compound Cl.C([C@H]([C@H](C1)CC)C2)CN1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OCC)C=C21 QNRATNLHPGXHMA-XZHTYLCXSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 238000003491 array Methods 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000003989 dielectric material Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 230000010363 phase shift Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01Q—ANTENNAS, i.e. RADIO AERIALS
- H01Q15/00—Devices for reflection, refraction, diffraction or polarisation of waves radiated from an antenna, e.g. quasi-optical devices
- H01Q15/02—Refracting or diffracting devices, e.g. lens, prism
- H01Q15/04—Refracting or diffracting devices, e.g. lens, prism comprising wave-guiding channel or channels bounded by effective conductive surfaces substantially perpendicular to the electric vector of the wave, e.g. parallel-plate waveguide lens
Landscapes
- Aerials With Secondary Devices (AREA)
- Waveguide Aerials (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US175369A US3234556A (en) | 1962-02-23 | 1962-02-23 | Broadband biconical wire-grid lens antenna comprising a central beam shaping portion |
| US175370A US3234557A (en) | 1962-02-23 | 1962-02-23 | Non-uniform wire-grid lens antenna |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1466432A1 true DE1466432A1 (de) | 1968-12-19 |
Family
ID=26871142
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19631466432 Pending DE1466432A1 (de) | 1962-02-23 | 1963-01-24 | Drahtgitter-Linsenantenne |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US3234556A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1466432A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1025182A (cg-RX-API-DMAC10.html) |
| NL (1) | NL288228A (cg-RX-API-DMAC10.html) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3273154A (en) * | 1964-05-27 | 1966-09-13 | Control Data Corp | Lens feed system |
| US3363251A (en) * | 1965-01-25 | 1968-01-09 | Sperry Rand Corp | Wire grid antenna exhibiting luneberg lens properties |
| US3465343A (en) * | 1965-10-11 | 1969-09-02 | Control Data Corp | Multi-hop ramp feed for wire-grid lens antenna |
| US3541565A (en) * | 1967-09-06 | 1970-11-17 | Csf | Electronic-scanning antennas |
| US3982248A (en) * | 1974-07-01 | 1976-09-21 | Trw Inc. | Compliant mesh structure for collapsible reflector |
| US5115249A (en) * | 1990-08-28 | 1992-05-19 | Grumman Aerospace Corporation | Arrangement for window shade-deployed radar |
| US5686930A (en) * | 1994-01-31 | 1997-11-11 | Brydon; Louis B. | Ultra lightweight thin membrane antenna reflector |
| CN108075236A (zh) * | 2017-12-27 | 2018-05-25 | 西安电子科技大学 | 一种基于周期性半高销钉的超宽带透镜天线 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT100539B (de) * | 1924-09-29 | 1925-07-25 | Anton Kaderabek | Antenne. |
| GB402834A (en) * | 1931-07-29 | 1933-12-14 | Fed Telegraph Co | Improvements in or relating to directional radio beam systems |
| US2511916A (en) * | 1944-07-06 | 1950-06-20 | Wave guide for high-frequency electric currents | |
| US2884629A (en) * | 1945-11-29 | 1959-04-28 | Samuel J Mason | Metal-plate lens microwave antenna |
| US2485138A (en) * | 1946-10-03 | 1949-10-18 | Rca Corp | High-gain antenna system |
| US2576181A (en) * | 1947-10-28 | 1951-11-27 | Rca Corp | Focusing device for centimeter waves |
| NL81638C (cg-RX-API-DMAC10.html) * | 1948-10-01 | |||
| US2720588A (en) * | 1949-07-22 | 1955-10-11 | Nat Res Dev | Radio antennae |
| US2576182A (en) * | 1950-01-21 | 1951-11-27 | Rca Corp | Scanning antenna system |
| US2756424A (en) * | 1952-04-30 | 1956-07-24 | Edward A Lewis | Wire grid fabry-perot type interferometer |
| US3047860A (en) * | 1957-11-27 | 1962-07-31 | Austin B Swallow | Two ply electromagnetic energy reflecting fabric |
| US3116485A (en) * | 1960-06-27 | 1963-12-31 | Ite Circuit Breaker Ltd | Omnidirectional horn radiator for beacon antenna |
-
0
- NL NL288228D patent/NL288228A/xx unknown
-
1962
- 1962-02-23 US US175369A patent/US3234556A/en not_active Expired - Lifetime
- 1962-02-23 US US175370A patent/US3234557A/en not_active Expired - Lifetime
-
1963
- 1963-01-24 DE DE19631466432 patent/DE1466432A1/de active Pending
- 1963-01-30 GB GB3785/63A patent/GB1025182A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1025182A (en) | 1966-04-06 |
| NL288228A (cg-RX-API-DMAC10.html) | |
| US3234557A (en) | 1966-02-08 |
| US3234556A (en) | 1966-02-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE894575C (de) | Kurzwellenantenne fuer breite Frequenzbaender | |
| DE60034042T2 (de) | Rahmenantenne mit vier resonanzfrequenzen | |
| DE2656729C3 (de) | Breitbanddipolantenne | |
| DE102007047741A1 (de) | Speisenetzwerk für eine Gruppenantenne | |
| DE2918055A1 (de) | Breitband-empfangsantennensystem | |
| DE69731034T2 (de) | Mobile Funkantenne | |
| DE1009678B (de) | Einrichtung zur Speisung einer Rohrschlitzantenne | |
| DE1466432A1 (de) | Drahtgitter-Linsenantenne | |
| DE1960773A1 (de) | Logarithmisch periodisches Antennensystem | |
| DE2337997C3 (de) | Kurzwellen-Vorhangantenne | |
| EP0124559B1 (de) | Breitband-richtantenne | |
| DE1766285A1 (de) | Breitbandantenne | |
| DE2434630A1 (de) | Breitbandantenne | |
| DE588587C (de) | Richtantenne fuer kurze Wellen | |
| DE2265101B2 (de) | Geschlitzte Koaxialkabelantenne | |
| DE957857C (de) | Schlitzantenne | |
| EP1202387B1 (de) | Planarantenne mit verbesserter Richtcharakteristik | |
| DE2026984B2 (de) | Antenne mit mehreren Strahlern an einem im wesentlichen senkrecht ausgerichteten Trageteil | |
| DE869505C (de) | Antenne, insbesondere Rundfunkantenne | |
| AT119205B (de) | Gerichtet ausstrahlendes Senderantennensystem und Betriebsverfahren hiefür. | |
| DE2509695C2 (de) | VHF- oder UHF-Rundstrahl-Sendeantenne | |
| DE2026451A1 (de) | Mehrebenen-Sendeantenne | |
| DE2521978C3 (de) | Kurzwellen-Steilstrahlantenne | |
| DE855732C (de) | Insbesondere fuer Sendezwecke geeignete Antennenanordnung | |
| DE69016446T2 (de) | Breitbandige Funkantenne mit kleinem Stehwellenverhältnis. |