DE1443731B1 - Halogensubstituierte Benzodinitrile - Google Patents
Halogensubstituierte BenzodinitrileInfo
- Publication number
- DE1443731B1 DE1443731B1 DE19641443731 DE1443731A DE1443731B1 DE 1443731 B1 DE1443731 B1 DE 1443731B1 DE 19641443731 DE19641443731 DE 19641443731 DE 1443731 A DE1443731 A DE 1443731A DE 1443731 B1 DE1443731 B1 DE 1443731B1
- Authority
- DE
- Germany
- Prior art keywords
- substituted
- halogen
- effectiveness
- benzodinitriles
- plants
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 claims description 16
- 230000000694 effects Effects 0.000 claims description 7
- 239000002689 soil Substances 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 239000004009 herbicide Substances 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 244000052616 bacterial pathogen Species 0.000 claims 1
- 230000035784 germination Effects 0.000 claims 1
- 238000002360 preparation method Methods 0.000 description 11
- 241000196324 Embryophyta Species 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- -1 Tetrafluoroterephthalic Acid Nitrile Chemical class 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 230000000855 fungicidal effect Effects 0.000 description 5
- 230000001629 suppression Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 239000000417 fungicide Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 150000008359 benzonitriles Chemical class 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000001069 nematicidal effect Effects 0.000 description 3
- 235000003270 potassium fluoride Nutrition 0.000 description 3
- 239000011698 potassium fluoride Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 241000233622 Phytophthora infestans Species 0.000 description 2
- 206010040007 Sense of oppression Diseases 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 230000001717 pathogenic effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 2
- BKFXSOCDAQACQM-UHFFFAOYSA-N 3-chlorophthalic acid Chemical class OC(=O)C1=CC=CC(Cl)=C1C(O)=O BKFXSOCDAQACQM-UHFFFAOYSA-N 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000132092 Aster Species 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KZCBXHSWMMIEQU-UHFFFAOYSA-N Chlorthal Chemical compound OC(=O)C1=C(Cl)C(Cl)=C(C(O)=O)C(Cl)=C1Cl KZCBXHSWMMIEQU-UHFFFAOYSA-N 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- 241000588694 Erwinia amylovora Species 0.000 description 1
- 240000008620 Fagopyrum esculentum Species 0.000 description 1
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 1
- CSVKAPACZHOHKZ-UHFFFAOYSA-N Fc1cc(F)c(C#N)c(F)c1Cl Chemical compound Fc1cc(F)c(C#N)c(F)c1Cl CSVKAPACZHOHKZ-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 240000004296 Lolium perenne Species 0.000 description 1
- 241000192041 Micrococcus Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000233639 Pythium Species 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 241000221577 Uromyces appendiculatus Species 0.000 description 1
- 241000194062 Xanthomonas phaseoli Species 0.000 description 1
- ZOTMZDUYUQKJSO-UHFFFAOYSA-N [2,4,5,6-tetrachloro-5-(hydroxymethyl)cyclohexa-1,3-dien-1-yl]methanol Chemical compound OCC1=C(Cl)C=C(Cl)C(Cl)(CO)C1Cl ZOTMZDUYUQKJSO-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical class ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- QHOFOEVCRGYQNO-UHFFFAOYSA-N dimethyl 2,3,5-trichlorobenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC(Cl)=C(C(=O)OC)C(Cl)=C1Cl QHOFOEVCRGYQNO-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 150000003021 phthalic acid derivatives Chemical class 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/34—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/50—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
- C07C255/51—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings containing at least two cyano groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US269751A US3290353A (en) | 1963-04-01 | 1963-04-01 | Halogenated aromatic nitriles |
| US502537A US3331735A (en) | 1963-04-01 | 1965-10-22 | Halogenated aromatic pesticidal compositions for controlling fungi, bacteria and nematodes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1443731B1 true DE1443731B1 (de) | 1970-05-06 |
Family
ID=26953871
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641443731 Pending DE1443731B1 (de) | 1963-04-01 | 1964-03-26 | Halogensubstituierte Benzodinitrile |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US3290353A (enrdf_load_stackoverflow) |
| BE (1) | BE645904A (enrdf_load_stackoverflow) |
| BR (1) | BR6456831D0 (enrdf_load_stackoverflow) |
| CH (1) | CH427402A (enrdf_load_stackoverflow) |
| DE (1) | DE1443731B1 (enrdf_load_stackoverflow) |
| DK (1) | DK117669B (enrdf_load_stackoverflow) |
| FR (1) | FR1397521A (enrdf_load_stackoverflow) |
| GB (2) | GB1058558A (enrdf_load_stackoverflow) |
| NL (2) | NL6403411A (enrdf_load_stackoverflow) |
| SE (1) | SE308633B (enrdf_load_stackoverflow) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2130675A1 (de) * | 1971-06-21 | 1973-01-11 | Diamond Shamrock Corp | 2,4-dichlor-6-anilino-1,3,5-benzotrinitrile, verfahren zu ihrer herstellung und ihre verwendung als biozide |
Families Citing this family (83)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3375267A (en) * | 1965-01-21 | 1968-03-26 | Hooker Chemical Corp | Aminotetrafluorobenzonitrile |
| GB1147067A (en) * | 1965-09-15 | 1969-04-02 | Imp Smelting Corp Ltd | Fluorinated aromatic nitrile derivatives |
| DE1277838B (de) * | 1966-09-10 | 1968-09-19 | Basf Ag | Verfahren zur kontinuierlichen Herstellung von Tetrachlorphthalsaeuredinitril |
| US3485925A (en) * | 1967-10-16 | 1969-12-23 | Shell Oil Co | Bactericidal and fungicidal haloatroponitriles |
| US3456055A (en) * | 1968-01-15 | 1969-07-15 | Diamond Shamrock Corp | Mildew eradicant compositions |
| US3877927A (en) * | 1971-11-24 | 1975-04-15 | Du Pont | Herbicidal compositions and methods |
| US4013704A (en) * | 1971-06-15 | 1977-03-22 | E. I. Du Pont De Nemours And Company | 2,5-diisopropylterephthalonitrile |
| JPS5112082B2 (enrdf_load_stackoverflow) * | 1972-07-21 | 1976-04-16 | ||
| US3948948A (en) * | 1973-11-23 | 1976-04-06 | The Dow Chemical Company | 3,4-Dihalo-2,5-thiophenedicarbonitriles |
| US4069342A (en) * | 1973-12-12 | 1978-01-17 | Diamond Shamrock Corporation | Method for regulating rests using alkylthiotrichlorodicyanobenzenes |
| JPS516940A (enrdf_load_stackoverflow) * | 1974-07-04 | 1976-01-20 | Kogyo Gijutsuin | |
| JPS56580B2 (enrdf_load_stackoverflow) * | 1974-12-09 | 1981-01-08 | ||
| US3970443A (en) * | 1975-02-18 | 1976-07-20 | Diamond Shamrock Corporation | Cycloheximide-cyanobenzene compositions as fruit abscission |
| US3968239A (en) * | 1975-03-07 | 1976-07-06 | O. M. Scott & Sons Company | Fungicidal compositions containing a phthalonitrile |
| US4177288A (en) * | 1977-05-19 | 1979-12-04 | Cities Service Company | Composition for controlling fungi |
| IT1114941B (it) * | 1977-12-27 | 1986-02-03 | Sipcam Spa | Fumero - studio consulenza brevetti s.n.c.via s.agnese,12 milano |
| IL56234A (en) * | 1977-12-27 | 1983-11-30 | Lilly Co Eli | Synergistic fungicidal compositions comprising a triazole derivative together with other active compounds |
| DE2902877C2 (de) * | 1978-01-28 | 1983-05-05 | I.S.C. Chemicals Ltd., London | Verfahren zur Herstellung eines Fluorbenzomononitrils |
| ES477912A1 (es) * | 1978-02-22 | 1979-07-16 | Diamond Shamrock Corp | Un procedimiento para la preparacion de una dispersion de tetracloroisoftalonitrilo. |
| EP0034402B1 (en) * | 1980-02-05 | 1984-08-29 | Imperial Chemical Industries Plc | Method of preparing fluorine-substituted diphenyl ether derivatives and fluorine-substituted halogeno benzene derivatives for use therein |
| FR2490634A1 (fr) * | 1980-09-25 | 1982-03-26 | Rhone Poulenc Ind | Procede de preparation de fluorobenzonitriles |
| US4329277A (en) * | 1980-10-03 | 1982-05-11 | The B. F. Goodrich Company | Antifouling polyurethanes |
| EP0073372B1 (en) * | 1981-08-31 | 1984-08-01 | Ishihara Sangyo Kaisha, Ltd. | Process for producing 2,6-difluorobenzonitrile |
| US4556426A (en) * | 1983-06-13 | 1985-12-03 | Tile Council Of America, Inc. | Fungicidal grout composition |
| US4599192A (en) * | 1983-08-24 | 1986-07-08 | Mineral Research And Development Corp. | Wood-treating composition |
| DE3420796A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 2,4,5-trihalogen- bzw. 2,3,4,5-tetrahalogenbenzolderivate und verfahren zu ihrer herstellung |
| US4614742A (en) * | 1985-08-29 | 1986-09-30 | S.D.S. Biotech K.K. | Fluorinated isophthalonitrile compound and nonmedical fungicide containing the same |
| US4808215A (en) * | 1985-10-28 | 1989-02-28 | Calgon Corporation | Method of improving the flowability of agro-chemical slurries |
| US4791225A (en) * | 1986-01-20 | 1988-12-13 | Kyorin Pharmaceutical Co., Ltd. | Halogenobenzoic acid derivatives and their preparation |
| JPS63264504A (ja) * | 1987-04-17 | 1988-11-01 | Shinto Paint Co Ltd | 工業用防カビ組成物 |
| JPS6471844A (en) * | 1987-09-14 | 1989-03-16 | Sds Biotech Kk | 2,4,5-trifluoroisophthalonitrile and production thereof |
| US5401757A (en) * | 1988-05-20 | 1995-03-28 | Zeneca Limited | Synergistic fungicidal composition and use |
| GB8907298D0 (en) * | 1989-03-31 | 1989-05-17 | Ici Plc | Composition and use |
| US4996355A (en) * | 1989-04-14 | 1991-02-26 | Mallinckrodt, Inc. | Novel intermediates for the production of 2,4,5-trifluorobenzoyl fluoride |
| DE59101258D1 (de) * | 1990-05-26 | 1994-05-05 | Bayer Ag | Fluormethylierte Polycyanbenzole, deren Alkalicyanid-Addukte, Verfahren zu ihrer Herstellung und Verwendung der fluormethylierten Polycyanbenzole. |
| US5153350A (en) * | 1991-05-16 | 1992-10-06 | Braish Tamim F | Process for preparing 3,4,6-trifluorophithalonitrile |
| US5380484A (en) * | 1992-09-03 | 1995-01-10 | Isk Biotech Corporation | Control of marine borers by chlorothalonil |
| US5502235A (en) * | 1994-12-28 | 1996-03-26 | Dowelanco | Solventless process for making 2,6 difluorobenzonitrile |
| US6319949B1 (en) * | 1996-07-11 | 2001-11-20 | Syngenta Limited | Pesticidal sprays |
| US6409809B1 (en) | 1999-02-08 | 2002-06-25 | Cognis Corporation | Pigmented coatings exhibiting reduced fading |
| DK1239733T3 (da) | 1999-12-13 | 2003-10-27 | Bayer Cropscience Ag | Fungicide kombinationer af aktive stoffer |
| DE10019758A1 (de) | 2000-04-20 | 2001-10-25 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10103832A1 (de) * | 2000-05-11 | 2001-11-15 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| JP4876355B2 (ja) * | 2000-10-04 | 2012-02-15 | 昭和電工株式会社 | フッ素化ジシアノベンゼンの製造方法 |
| US7132561B2 (en) * | 2000-10-04 | 2006-11-07 | Showa Denko K.K. | Process for producing fluorinated dicyanobenzene |
| CN1233622C (zh) * | 2000-10-04 | 2005-12-28 | 昭和电工株式会社 | 生产氟化苯二甲腈的方法 |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE502004003642D1 (de) * | 2003-11-27 | 2007-06-06 | Basf Ag | Fungizide mischungen zur bekämpfung von reispathogenen |
| BRPI0509124A (pt) | 2004-04-30 | 2007-08-28 | Basf Ag | misturas fungicidas, agentes, processo para combater fungos nocivos, semente, e, uso de um composto |
| PE20060796A1 (es) | 2004-11-25 | 2006-09-29 | Basf Ag | Procedimiento para intensificar la eficiencia de etaboxam |
| US20080146445A1 (en) * | 2004-12-17 | 2008-06-19 | Devgen Nv | Nematicidal Compositions |
| US7494525B2 (en) * | 2005-02-22 | 2009-02-24 | Tessenderlo Kerley, Inc. | Calcium polysulfide, potassium polysulfide, calcium thiosulfate, and magnesium thiosulfate as urease inhibitors |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| WO2006131230A2 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| BRPI0614113B8 (pt) | 2005-08-05 | 2017-12-12 | Basf Se | misturas fungicidas para combater fungos nocivos fitopatogênicos, agente, processo para combater fungos nocivos fitopatogênicos, e uso de uma mistura fungicida |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| MX2009001987A (es) | 2006-09-18 | 2009-03-06 | Basf Se | Mezclas pesticidas ternarias. |
| WO2008071714A1 (en) | 2006-12-15 | 2008-06-19 | Rohm And Haas Company | Mixtures comprising 1-methylcyclopropene |
| TW200845896A (en) | 2007-02-06 | 2008-12-01 | Basf Se | Insecticides as safeners for fungicides with phytotoxic activity |
| EP2392662A3 (en) | 2007-04-23 | 2012-03-14 | Basf Se | Plant productivity enhancement by combining chemical agents with transgenic modifications |
| EP2205082B1 (en) | 2007-09-26 | 2012-04-04 | Basf Se | Ternary fungicidal compositions comprising boscalid and chlorothalonil |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| EP2410850A2 (de) | 2009-03-25 | 2012-02-01 | Bayer Cropscience AG | Synergistische wirkstoffkombinationen |
| KR20120051015A (ko) | 2009-07-16 | 2012-05-21 | 바이엘 크롭사이언스 아게 | 페닐 트리아졸을 함유하는 상승적 활성 물질 배합물 |
| WO2011026796A1 (en) | 2009-09-01 | 2011-03-10 | Basf Se | Synergistic fungicidal mixtures comprising lactylates and method for combating phytopathogenic fungi |
| KR101719854B1 (ko) * | 2009-12-22 | 2017-03-24 | 미쓰이가가쿠 아그로 가부시키가이샤 | 식물 병해 방제 조성물 및 그것을 시용하는 식물 병해의 방제 방법 |
| MX2013006737A (es) | 2010-12-20 | 2013-07-15 | Basf Se | Mezclas de activos pesticida que comprende compuestos de pirazol. |
| EP2481284A3 (en) | 2011-01-27 | 2012-10-17 | Basf Se | Pesticidal mixtures |
| EP2688405B1 (en) | 2011-03-23 | 2017-11-22 | Basf Se | Compositions containing polymeric, ionic compounds comprising imidazolium groups |
| MX2014001866A (es) | 2011-09-02 | 2015-04-16 | Basf Se | Mezclas agricolas que comprenden compuestos de arilquinazolinona. |
| JP6279563B2 (ja) | 2012-06-20 | 2018-02-14 | ビーエーエスエフ ソシエタス・ヨーロピアBasf Se | ピラゾール化合物およびピラゾール化合物を含む殺有害生物性混合物 |
| CN104814033B (zh) * | 2012-08-25 | 2017-08-25 | 郑芝红 | 一种含环己磺菌胺的农药组合物 |
| US20150257383A1 (en) | 2012-10-12 | 2015-09-17 | Basf Se | Method for combating phytopathogenic harmful microbes on cultivated plants or plant propagation material |
| MX377401B (es) | 2012-12-20 | 2025-03-07 | Basf Agro Bv | Composiciones que comprenden un compuesto de triazol. |
| US9718764B2 (en) | 2013-03-22 | 2017-08-01 | Merck Patent Gmbh | Synthetic building blocks for the production of materials for organic electroluminescence devices |
| EP2783569A1 (en) | 2013-03-28 | 2014-10-01 | Basf Se | Compositions comprising a triazole compound |
| EP2835052A1 (en) | 2013-08-07 | 2015-02-11 | Basf Se | Fungicidal mixtures comprising pyrimidine fungicides |
| WO2015036059A1 (en) | 2013-09-16 | 2015-03-19 | Basf Se | Fungicidal pyrimidine compounds |
| EP3046915A1 (en) | 2013-09-16 | 2016-07-27 | Basf Se | Fungicidal pyrimidine compounds |
| EP2979549A1 (en) | 2014-07-31 | 2016-02-03 | Basf Se | Method for improving the health of a plant |
| CN107075712A (zh) | 2014-10-24 | 2017-08-18 | 巴斯夫欧洲公司 | 改变固体颗粒的表面电荷的非两性、可季化和水溶性聚合物 |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2927126A (en) * | 1957-10-16 | 1960-03-01 | Dow Chemical Co | Preparation of n-(2-cyanoethyl) amide compounds |
| FR1265053A (fr) * | 1960-08-12 | 1961-06-23 | Diamond Alkali Co | Composés halogéno-organiques, notamment téréphtaliques, leur préparation et leurs applications |
| DE1116209B (de) * | 1959-04-28 | 1961-11-02 | Philips Nv | Verfahren zur Herstellung von Chlorbenzonitrilen |
| DE1184550B (de) * | 1961-09-25 | 1964-12-31 | Diamond Alkali Co | Fungizides und nematozides Mittel zur Pflanzen-, Boden- und Saatgutbehandlung |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2174568A (en) * | 1935-07-15 | 1939-10-03 | Ici Ltd | 4,5-dichloro-phthalonitrile and process of making it |
| US2648621A (en) * | 1948-05-11 | 1953-08-11 | Chemical Foundation Inc | Chlorinated nu-ethyl acetanilide insecticide spray composition |
| US2865803A (en) * | 1955-06-13 | 1958-12-23 | Monsanto Chemicals | Nematocidal composition and methods employing cyclohexyl isothiocyanates |
| NL222165A (enrdf_load_stackoverflow) * | 1957-11-05 | |||
| US3009942A (en) * | 1958-07-02 | 1961-11-21 | Heyden Newport Chemical Corp | Production of trichlorobenzoic acids |
| US3108130A (en) * | 1959-08-19 | 1963-10-22 | Sanko Kagaku Kogyo Kabushiki K | Process for the preparation of chlorinated phthalodinitriles by catalytic vapor-phase chlorination of phthalodinitriles |
| NL263559A (enrdf_load_stackoverflow) * | 1960-04-13 | |||
| US3094405A (en) * | 1961-02-08 | 1963-06-18 | Stauffer Chemical Co | Defoliant methods using thio esters of chloromethyl phosphonous and chloromethyl phosphonic acids |
-
0
- NL NL129620D patent/NL129620C/xx active
-
1963
- 1963-04-01 US US269751A patent/US3290353A/en not_active Expired - Lifetime
-
1964
- 1964-01-04 SE SE87/64A patent/SE308633B/xx unknown
- 1964-01-29 DK DK44564AA patent/DK117669B/da unknown
- 1964-02-14 BR BR156831/64A patent/BR6456831D0/pt unknown
- 1964-03-26 DE DE19641443731 patent/DE1443731B1/de active Pending
- 1964-03-31 GB GB4438/66A patent/GB1058558A/en not_active Expired
- 1964-03-31 FR FR969164A patent/FR1397521A/fr not_active Expired
- 1964-03-31 GB GB13171/64A patent/GB1058557A/en not_active Expired
- 1964-03-31 BE BE645904D patent/BE645904A/xx unknown
- 1964-03-31 CH CH408364A patent/CH427402A/fr unknown
- 1964-03-31 NL NL6403411A patent/NL6403411A/xx unknown
-
1965
- 1965-10-22 US US502537A patent/US3331735A/en not_active Expired - Lifetime
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2927126A (en) * | 1957-10-16 | 1960-03-01 | Dow Chemical Co | Preparation of n-(2-cyanoethyl) amide compounds |
| DE1116209B (de) * | 1959-04-28 | 1961-11-02 | Philips Nv | Verfahren zur Herstellung von Chlorbenzonitrilen |
| FR1265053A (fr) * | 1960-08-12 | 1961-06-23 | Diamond Alkali Co | Composés halogéno-organiques, notamment téréphtaliques, leur préparation et leurs applications |
| DE1184550B (de) * | 1961-09-25 | 1964-12-31 | Diamond Alkali Co | Fungizides und nematozides Mittel zur Pflanzen-, Boden- und Saatgutbehandlung |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2130675A1 (de) * | 1971-06-21 | 1973-01-11 | Diamond Shamrock Corp | 2,4-dichlor-6-anilino-1,3,5-benzotrinitrile, verfahren zu ihrer herstellung und ihre verwendung als biozide |
Also Published As
| Publication number | Publication date |
|---|---|
| US3290353A (en) | 1966-12-06 |
| CH427402A (fr) | 1966-12-31 |
| BE645904A (enrdf_load_stackoverflow) | 1964-09-30 |
| FR1397521A (fr) | 1965-04-30 |
| NL6403411A (enrdf_load_stackoverflow) | 1965-03-25 |
| SE308633B (enrdf_load_stackoverflow) | 1969-02-17 |
| GB1058558A (en) | 1967-02-15 |
| NL129620C (enrdf_load_stackoverflow) | |
| DK117669B (da) | 1970-05-19 |
| BR6456831D0 (pt) | 1973-12-04 |
| US3331735A (en) | 1967-07-18 |
| GB1058557A (en) | 1967-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1443731B1 (de) | Halogensubstituierte Benzodinitrile | |
| DE69304420T2 (de) | N-Iodopropargyl-Hydantoin-Verbindungen, Zusammensetzungen, Herstellung und Verwendung als Mikrobizide | |
| DE2513730C2 (de) | N-(1'-Methoxycarbonyl-äthyl)-N-halogenacetyl-2-halogenaniline, Verfahren zu deren Herstellung und diese Verbindungen enthaltende fungizide Mittel | |
| DE1112339B (de) | Mittel zur Verhinderung unerwuenschten Pflanzenwachstums | |
| CH638223A5 (de) | N-((phosphinyl)amino)thio-methylcarbamate bzw. n-((phosphinothioyl)amino)thio-methylcarbamate, verfahren zu ihrer herstellung sowie ihre verwendung in pestiziden. | |
| DD233293A5 (de) | Mittel zur verzoegerung der wirkung herbizider praeparate | |
| DE2643403C2 (de) | Thiocarbonsäurederivate, Verfahren zu deren Herstellung und diese enthaltende Mittel | |
| DE1443731C (de) | Halogensubstituierte Benzodinitrile | |
| DD298723A5 (de) | Biozide mittel | |
| DD157292A5 (de) | Mittel zur behandlung von pilzinfektionen | |
| DE1618968C2 (enrdf_load_stackoverflow) | ||
| DE2605586C2 (enrdf_load_stackoverflow) | ||
| DE2114094A1 (de) | Unkrautbekaempfungsmittel | |
| DE2919825C2 (enrdf_load_stackoverflow) | ||
| DE1300727B (de) | Verwendung von Dinitroanilinderivaten als selektive Vorauflaufherbizide | |
| DD210827A5 (de) | Antidotierte Herbizide Zusammensetzungen | |
| DE2104857C3 (de) | N-Benzylcarboxamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2112643A1 (de) | Neue Formamidin-Derivate | |
| DE2342073C3 (de) | Verwendung von Bis-(trialkylzinn)oxiden zur Bekämpfung von Milben auf Nutzpflanzen | |
| DE2531476A1 (de) | Fungizide mittel | |
| DD236868A5 (de) | Mittel zum protahieren der wirkungsdauer und zur erhoehung der selektivitaet von herbiziden zusammensetzungen | |
| DE2513788C3 (de) | Substituierte Furan-2-carbonsäureanilide und Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende fungizide Mittel | |
| DE1593676C3 (de) | Benzhydrylcarbamate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Schädlingsbekämpfungsmittel | |
| DE1567217C3 (de) | Tetrachlorterephthalsäurederivate, Verfahren zu deren Herstellung und ihre Verwendung als Herbicide | |
| DE2027058C3 (de) | N-acylierte Carbamate, Verfahren zur Herstellung derselben und diese Verbindungen enthaltende Schädlingsbekämpfungsmittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 |