DE1299296B - Verfahren zur Herstellung von substituierten 1. 3. 4-Thiodiazolen - Google Patents
Verfahren zur Herstellung von substituierten 1. 3. 4-ThiodiazolenInfo
- Publication number
- DE1299296B DE1299296B DEK47967A DEK0047967A DE1299296B DE 1299296 B DE1299296 B DE 1299296B DE K47967 A DEK47967 A DE K47967A DE K0047967 A DEK0047967 A DE K0047967A DE 1299296 B DE1299296 B DE 1299296B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- substituted
- mol
- hydrazine
- yield
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 16
- 238000002360 preparation method Methods 0.000 title claims description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 18
- -1 aromatic carbocyclic hydrocarbon Chemical class 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 9
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 229930195733 hydrocarbon Natural products 0.000 claims description 7
- VKCLPVFDVVKEKU-UHFFFAOYSA-N S=[P] Chemical class S=[P] VKCLPVFDVVKEKU-UHFFFAOYSA-N 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 4
- 150000002429 hydrazines Chemical class 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 56
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 28
- 238000006243 chemical reaction Methods 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- FUSNOPLQVRUIIM-UHFFFAOYSA-N 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-n-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide Chemical compound O=C1NC(C)(C)CN1C(N=C1N)=NC=C1C(=O)NC1=CC=CC(C(F)(F)F)=C1 FUSNOPLQVRUIIM-UHFFFAOYSA-N 0.000 description 9
- 239000012493 hydrazine sulfate Substances 0.000 description 9
- 229910000377 hydrazine sulfate Inorganic materials 0.000 description 9
- LNYTUARMNSFFBE-UHFFFAOYSA-N 4-(diethylazaniumyl)benzoate Chemical compound CCN(CC)C1=CC=C(C(O)=O)C=C1 LNYTUARMNSFFBE-UHFFFAOYSA-N 0.000 description 8
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 8
- 235000010233 benzoic acid Nutrition 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 150000001559 benzoic acids Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 150000008037 diacylhydrazines Chemical class 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- SWXFMMWYVSYQGF-UHFFFAOYSA-N 4-(ethylamino)benzoic acid Chemical compound CCNC1=CC=C(C(O)=O)C=C1 SWXFMMWYVSYQGF-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- XQNIYBBHBZAQEC-UHFFFAOYSA-N diphosphorus trisulphide Chemical compound S=PSP=S XQNIYBBHBZAQEC-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- POZIYEZBRDCICV-UHFFFAOYSA-N 4-(3-methylbutylamino)benzoic acid Chemical compound CC(C)CCNC1=CC=C(C(O)=O)C=C1 POZIYEZBRDCICV-UHFFFAOYSA-N 0.000 description 2
- YDIYEOMDOWUDTJ-UHFFFAOYSA-N 4-(dimethylamino)benzoic acid Chemical compound CN(C)C1=CC=C(C(O)=O)C=C1 YDIYEOMDOWUDTJ-UHFFFAOYSA-N 0.000 description 2
- SQLBFVMSEWIEJW-UHFFFAOYSA-N 4-(dipropylamino)benzoic acid Chemical compound CCCN(CCC)C1=CC=C(C(O)=O)C=C1 SQLBFVMSEWIEJW-UHFFFAOYSA-N 0.000 description 2
- HCFAJYNVAYBARA-UHFFFAOYSA-N 4-heptanone Chemical compound CCCC(=O)CCC HCFAJYNVAYBARA-UHFFFAOYSA-N 0.000 description 2
- REKQLYUAUXYJSZ-UHFFFAOYSA-N 4-methoxybenzohydrazide Chemical compound COC1=CC=C(C(=O)NN)C=C1 REKQLYUAUXYJSZ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- SKTSVWWOAIAIKI-UHFFFAOYSA-N furan-2-carbohydrazide Chemical compound NNC(=O)C1=CC=CO1 SKTSVWWOAIAIKI-UHFFFAOYSA-N 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 125000001477 organic nitrogen group Chemical group 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- DRTQHJPVMGBUCF-UCVXFZOQSA-N 1-[(2s,3s,4s,5s)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@H]1[C@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UCVXFZOQSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- HFZLSTDPRQSZCQ-UHFFFAOYSA-N 1-pyrrolidin-3-ylpyrrolidine Chemical compound C1CCCN1C1CNCC1 HFZLSTDPRQSZCQ-UHFFFAOYSA-N 0.000 description 1
- OIWIYLWZIIJNHU-UHFFFAOYSA-N 1-sulfanylpyrazole Chemical compound SN1C=CC=N1 OIWIYLWZIIJNHU-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- YZYDFHZMFSHWQG-UHFFFAOYSA-N 2-(3-methylbutylamino)benzoic acid Chemical compound CC(C)CCNC1=CC=CC=C1C(O)=O YZYDFHZMFSHWQG-UHFFFAOYSA-N 0.000 description 1
- SESPVZIVLFVTDB-UHFFFAOYSA-N 2-(diethylamino)benzoic acid Chemical compound CCN(CC)C1=CC=CC=C1C(O)=O SESPVZIVLFVTDB-UHFFFAOYSA-N 0.000 description 1
- NRGGMCIBEHEAIL-UHFFFAOYSA-N 2-ethylpyridine Chemical class CCC1=CC=CC=N1 NRGGMCIBEHEAIL-UHFFFAOYSA-N 0.000 description 1
- KFXLXEQCRFGDRU-UHFFFAOYSA-N 2-methylbenzohydrazide Chemical compound CC1=CC=CC=C1C(=O)NN KFXLXEQCRFGDRU-UHFFFAOYSA-N 0.000 description 1
- XUBUJTVBAXQIKG-UHFFFAOYSA-N 2-morpholin-4-ylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1N1CCOCC1 XUBUJTVBAXQIKG-UHFFFAOYSA-N 0.000 description 1
- DHMPDNLGFIBQCK-UHFFFAOYSA-N 3,4-dibromobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(Br)=C1 DHMPDNLGFIBQCK-UHFFFAOYSA-N 0.000 description 1
- FNCRWFSUYPEDSM-UHFFFAOYSA-N 3-(diethylamino)benzoic acid Chemical compound CCN(CC)C1=CC=CC(C(O)=O)=C1 FNCRWFSUYPEDSM-UHFFFAOYSA-N 0.000 description 1
- PHRDZSRVSVNQRN-UHFFFAOYSA-N 3-chlorobenzohydrazide Chemical compound NNC(=O)C1=CC=CC(Cl)=C1 PHRDZSRVSVNQRN-UHFFFAOYSA-N 0.000 description 1
- YCCRFDDXAVMSLM-UHFFFAOYSA-N 4-(butylamino)benzoic acid Chemical compound CCCCNC1=CC=C(C(O)=O)C=C1 YCCRFDDXAVMSLM-UHFFFAOYSA-N 0.000 description 1
- QADQJGKSFQRUSS-UHFFFAOYSA-N 4-(cyclohexylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC1CCCCC1 QADQJGKSFQRUSS-UHFFFAOYSA-N 0.000 description 1
- NKHOUDMZYQDBQE-UHFFFAOYSA-N 4-(cyclopentylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NC1CCCC1 NKHOUDMZYQDBQE-UHFFFAOYSA-N 0.000 description 1
- BFPWLARXKLUGHY-UHFFFAOYSA-N 4-(propylamino)benzoic acid Chemical compound CCCNC1=CC=C(C(O)=O)C=C1 BFPWLARXKLUGHY-UHFFFAOYSA-N 0.000 description 1
- UYIMBYKIIMYFPS-UHFFFAOYSA-N 4-bromobenzohydrazide Chemical compound NNC(=O)C1=CC=C(Br)C=C1 UYIMBYKIIMYFPS-UHFFFAOYSA-N 0.000 description 1
- PKBGHORNUFQAAW-UHFFFAOYSA-N 4-chlorobenzohydrazide Chemical compound NNC(=O)C1=CC=C(Cl)C=C1 PKBGHORNUFQAAW-UHFFFAOYSA-N 0.000 description 1
- GIYXSAFJMIRGNO-UHFFFAOYSA-N 4-ethyl-2-(propylamino)benzoic acid Chemical compound C(C)C1=CC(=C(C(=O)O)C=C1)NCCC GIYXSAFJMIRGNO-UHFFFAOYSA-N 0.000 description 1
- IQCIOOPQWKJECY-UHFFFAOYSA-N 4-methyl-2-propylbenzoic acid Chemical group CCCC1=CC(C)=CC=C1C(O)=O IQCIOOPQWKJECY-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- JHCKVPVXWBVGDI-UHFFFAOYSA-N hydrazine;dihydrate Chemical compound O.O.NN JHCKVPVXWBVGDI-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- VMFUMDXVTKTZQY-UHFFFAOYSA-N naphthalene-1-carbohydrazide Chemical compound C1=CC=C2C(C(=O)NN)=CC=CC2=C1 VMFUMDXVTKTZQY-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL298757D NL298757A (enrdf_load_stackoverflow) | 1962-10-13 | ||
| DEK47967A DE1299296B (de) | 1962-10-13 | 1962-10-13 | Verfahren zur Herstellung von substituierten 1. 3. 4-Thiodiazolen |
| GB40073/63A GB1016520A (en) | 1962-10-13 | 1963-10-10 | Process for the preparation of substituted 1,3,4-thiadiazoles |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK47967A DE1299296B (de) | 1962-10-13 | 1962-10-13 | Verfahren zur Herstellung von substituierten 1. 3. 4-Thiodiazolen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1299296B true DE1299296B (de) | 1969-07-17 |
Family
ID=7224765
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK47967A Pending DE1299296B (de) | 1962-10-13 | 1962-10-13 | Verfahren zur Herstellung von substituierten 1. 3. 4-Thiodiazolen |
Country Status (3)
| Country | Link |
|---|---|
| DE (1) | DE1299296B (enrdf_load_stackoverflow) |
| GB (1) | GB1016520A (enrdf_load_stackoverflow) |
| NL (1) | NL298757A (enrdf_load_stackoverflow) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2545223C3 (de) * | 1975-10-09 | 1978-03-30 | Basf Ag, 6700 Ludwigshafen | Selbstverlöschende thermoplastische Formmassen |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1134080B (de) * | 1960-03-01 | 1962-08-02 | Ciba Geigy | Verfahren zur Herstellung von 1, 3, 4-Thiadiazolen |
-
0
- NL NL298757D patent/NL298757A/xx unknown
-
1962
- 1962-10-13 DE DEK47967A patent/DE1299296B/de active Pending
-
1963
- 1963-10-10 GB GB40073/63A patent/GB1016520A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1134080B (de) * | 1960-03-01 | 1962-08-02 | Ciba Geigy | Verfahren zur Herstellung von 1, 3, 4-Thiadiazolen |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1016520A (en) | 1966-01-12 |
| NL298757A (enrdf_load_stackoverflow) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3634975A1 (de) | Verfahren zur herstellung von substituierten und disubstituierten pyridin-2,3-dicarboxylatestern | |
| DE2065236C3 (de) | Phosphonsäuresalze, ihre Herstellung und Verwendung | |
| DE2736408A1 (de) | Verfahren zur herstellung von sulfobetainen | |
| DE1133731B (de) | Verfahren zur Herstellung von 1, 3, 4-Thiadiazolen | |
| DE2532224A1 (de) | Photochromatische verbindungen und verfahren zu ihrer herstellung | |
| DE2739584A1 (de) | Derivate von schwefel- und/oder selenhaltigen heterofulvalenen und verfahren zu ihrer herstellung | |
| DE1299296B (de) | Verfahren zur Herstellung von substituierten 1. 3. 4-Thiodiazolen | |
| DE2814330A1 (de) | Verfahren zur herstellung eines 2,6-dichlorpyridin-derivats | |
| DE1770649A1 (de) | Substituierte 3-Amino-indazole | |
| DE2259239A1 (de) | Verfahren zur herstellung von 2alkoxy-5-alkylsulfonyl-benzoesaeure | |
| DE947185C (de) | Verfahren zur Herstellung von Cyaninfarbstoffen | |
| DE1904653A1 (de) | Substituierte Benzthiazol-N-oxide | |
| DE1445665C (de) | Derivate von 2 (2 Morpholinoathylmer capto) pyridin Verbindungen | |
| DE875048C (de) | Verfahren zur Herstellung von 3-Pyrazolidonen | |
| DE1960981A1 (de) | Verfahren zur Herstellung eines 3-Amino-5-mercapto-1,2,4-triazols | |
| DE3322079A1 (de) | Tetrahydropyridazinonderivate, verfahren zu ihrer herstellung und ihre verwendung | |
| AT234709B (de) | Verfahren zur Herstellung neuer Hydrazino-triazine | |
| DE2150856A1 (de) | Heterozyklische AEther | |
| DE947165C (de) | Verfahren zur Herstellung von in 3-Stellung substituierten 4-Oxycumarinen | |
| CH614944A5 (en) | Process for the preparation of novel pyrimidine derivatives | |
| DE1445916C (de) | Verfahren zur Herstellung von Verbindungen der Oxazolreihe | |
| DE3820595A1 (de) | Organische salze enthaltend zwei bis vier cyclische oder acyclische amidinreste und ihre verwendung als basenvorlaeufer, insbesondere in waermeentwickelbarem aufzeichnungsmaterial | |
| DE2224681A1 (enrdf_load_stackoverflow) | ||
| DE1645895B2 (de) | Verfahren zur Herstellung von Pyra zinylthiophosphaten | |
| AT249684B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten |