DE1290452B - Manoeverkartusche - Google Patents
ManoeverkartuscheInfo
- Publication number
- DE1290452B DE1290452B DER40579A DER0040579A DE1290452B DE 1290452 B DE1290452 B DE 1290452B DE R40579 A DER40579 A DE R40579A DE R0040579 A DER0040579 A DE R0040579A DE 1290452 B DE1290452 B DE 1290452B
- Authority
- DE
- Germany
- Prior art keywords
- cartridge
- combustion chamber
- hollow cylinder
- wall
- dam
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000002485 combustion reaction Methods 0.000 claims description 11
- 239000000843 powder Substances 0.000 claims description 8
- 230000006378 damage Effects 0.000 claims description 3
- 239000004794 expanded polystyrene Substances 0.000 claims description 3
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 2
- 239000003063 flame retardant Substances 0.000 claims description 2
- 239000004033 plastic Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229920006248 expandable polystyrene Polymers 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B8/00—Practice or training ammunition
- F42B8/02—Cartridges
- F42B8/04—Blank cartridges, i.e. primed cartridges without projectile but containing an explosive or combustible powder charge
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Accommodation For Nursing Or Treatment Tables (AREA)
- Pens And Brushes (AREA)
- Paper (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DER40579A DE1290452B (de) | 1965-05-08 | 1965-05-08 | Manoeverkartusche |
| GB18704/66A GB1137978A (en) | 1965-05-08 | 1966-04-28 | Improvements in or relating to blank cartridges |
| NL6605758A NL6605758A (OSRAM) | 1965-05-08 | 1966-04-28 | |
| FR60208A FR1478287A (fr) | 1965-05-08 | 1966-05-04 | Cartouche d'exercice |
| BE680518D BE680518A (OSRAM) | 1965-05-08 | 1966-05-04 | |
| US548277A US3398683A (en) | 1965-05-08 | 1966-05-06 | Blank cartridge |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DER40579A DE1290452B (de) | 1965-05-08 | 1965-05-08 | Manoeverkartusche |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1290452B true DE1290452B (de) | 1969-03-06 |
Family
ID=7406102
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DER40579A Pending DE1290452B (de) | 1965-05-08 | 1965-05-08 | Manoeverkartusche |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3398683A (OSRAM) |
| BE (1) | BE680518A (OSRAM) |
| DE (1) | DE1290452B (OSRAM) |
| GB (1) | GB1137978A (OSRAM) |
| NL (1) | NL6605758A (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4157684A (en) * | 1975-09-23 | 1979-06-12 | Clausser Karl C | Safety filler for underloaded firearm cartridge |
| DE4135248A1 (de) * | 1991-10-25 | 1993-04-29 | Brenneke Wilhelm Kg | Kartusche fuer eine handwaffe |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2166850B (en) * | 1984-09-28 | 1988-08-10 | Haley & Weller Ltd | Pyrotechnic device |
| GB2244547B (en) * | 1990-05-17 | 1994-02-09 | Jenkins Harvey Dev Ltd | A pyrotechnic device |
| DE4243860C2 (de) * | 1992-12-23 | 1995-02-23 | Imm Inst Mikrotech | Mikrominiaturisierte, elektrostatische Pumpe und Verfahren zu deren Herstellung |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1113395B (de) * | 1960-02-22 | 1961-08-31 | Rheinmetall Gmbh | Manoeverkartusche mit einer Ladung aus schuettfaehigem Schiesspulver |
| DE1123953B (de) * | 1960-07-01 | 1962-02-15 | Dynamit Nobel Ag | Kartusche fuer rueckstossfreie Geschuetze |
| FR1347142A (fr) * | 1962-11-13 | 1963-12-27 | Cartoucherie Francaise | Perfectionnements aux cartouches de mortiers |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3209689A (en) * | 1956-11-14 | 1965-10-05 | Mclennan Donald Elmore | Reduction of gun barrel wear |
| GB950609A (en) * | 1959-08-14 | 1964-02-26 | Military Training Device Co Ak | Improvements in or relating to ammunition cartridges |
| NL298793A (OSRAM) * | 1962-10-04 | |||
| DE1229880B (de) * | 1963-10-31 | 1966-12-01 | Rheinmetall Gmbh | Manoeverkartusche fuer Geschuetze |
| US3282215A (en) * | 1965-04-30 | 1966-11-01 | Roth Milton | Additives for reduction of gun wear |
-
1965
- 1965-05-08 DE DER40579A patent/DE1290452B/de active Pending
-
1966
- 1966-04-28 NL NL6605758A patent/NL6605758A/xx unknown
- 1966-04-28 GB GB18704/66A patent/GB1137978A/en not_active Expired
- 1966-05-04 BE BE680518D patent/BE680518A/xx unknown
- 1966-05-06 US US548277A patent/US3398683A/en not_active Expired - Lifetime
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1113395B (de) * | 1960-02-22 | 1961-08-31 | Rheinmetall Gmbh | Manoeverkartusche mit einer Ladung aus schuettfaehigem Schiesspulver |
| DE1123953B (de) * | 1960-07-01 | 1962-02-15 | Dynamit Nobel Ag | Kartusche fuer rueckstossfreie Geschuetze |
| FR1347142A (fr) * | 1962-11-13 | 1963-12-27 | Cartoucherie Francaise | Perfectionnements aux cartouches de mortiers |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4157684A (en) * | 1975-09-23 | 1979-06-12 | Clausser Karl C | Safety filler for underloaded firearm cartridge |
| DE4135248A1 (de) * | 1991-10-25 | 1993-04-29 | Brenneke Wilhelm Kg | Kartusche fuer eine handwaffe |
Also Published As
| Publication number | Publication date |
|---|---|
| BE680518A (OSRAM) | 1966-10-17 |
| NL6605758A (OSRAM) | 1966-11-10 |
| GB1137978A (en) | 1968-12-27 |
| US3398683A (en) | 1968-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69104781T2 (de) | Patronenhülsenelement mit verbrennbarer Hülse, mit einem solchen Element versehene halbverbrennbare Munition und Verfahren zum Laden dieser Munition. | |
| DE2637848B2 (de) | Zünder für einen Raketenmotor | |
| DE2143605B2 (de) | Patrone | |
| DE2447676C2 (de) | Abschußvorrichtung für Projektile | |
| DE1290452B (de) | Manoeverkartusche | |
| DE2139735B2 (de) | Einrichtung zum simulieren der schussbeanspruchung von geschuetzrohren | |
| EP0236705B1 (de) | Verbindung zwischen dem Treibspiegelmantel und dem Treibspiegelheck eines Treibspiegelgeschosses | |
| DE949726C (de) | Kraftgas erzeugende Ladung | |
| DE1428680A1 (de) | Verbesserungen an Huelsen fuer Feuerwaffenmunition | |
| DE2903286A1 (de) | Patrone mit flintenlaufgeschoss | |
| AT216389B (de) | Übungsmunition für Feuerwaffen mit einer vom Patronenkörper untrennbaren, durch Falten verschlossenen zylindrischen Projektilattrappe und Verfahren zum Verschließen von Hohlkörpern von geringer Wandstärke | |
| DE69106322T2 (de) | Gewehrgranate. | |
| DE1966993C3 (de) | Geschoß | |
| DE965804C (de) | Schiessbolzen | |
| CH535727A (de) | Feuerwerkskörper für Kanonenschuss-Darstellungsgeräte | |
| DE1578155C (de) | Zerfallgeschoß, insbesondere Manoverpatronen Zerfallgeschoß | |
| DE540683C (de) | Patronenpfropfen | |
| DE1244019B (de) | Manoeverkartusche fuer Geschuetze | |
| DE4013516A1 (de) | Seemarkierer fuer notanflugverfahren von bordflugzeugen von schiffen | |
| AT228683B (de) | Übungsgewehrgranate | |
| DE9317440U1 (de) | Übungspatrone | |
| DE1066461B (OSRAM) | ||
| AT259415B (de) | Manöverpatronen-Zerfallgeschoß | |
| AT248298B (de) | Kartusche für Artilleriemunition | |
| DE1225075B (de) | Manoeverkartusche |