DE1290148B - Verfahren zur Herstellung von 4, 4'-Dinitrodiphenylaether - Google Patents
Verfahren zur Herstellung von 4, 4'-DinitrodiphenylaetherInfo
- Publication number
- DE1290148B DE1290148B DEF52407A DEF0052407A DE1290148B DE 1290148 B DE1290148 B DE 1290148B DE F52407 A DEF52407 A DE F52407A DE F0052407 A DEF0052407 A DE F0052407A DE 1290148 B DE1290148 B DE 1290148B
- Authority
- DE
- Germany
- Prior art keywords
- potassium
- carbonate
- dinitrodiphenyl
- ether
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- MWAGUKZCDDRDCS-UHFFFAOYSA-N 1-nitro-4-(4-nitrophenoxy)benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 MWAGUKZCDDRDCS-UHFFFAOYSA-N 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 17
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 15
- ACBQROXDOHKANW-UHFFFAOYSA-N bis(4-nitrophenyl) carbonate Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC(=O)OC1=CC=C([N+]([O-])=O)C=C1 ACBQROXDOHKANW-UHFFFAOYSA-N 0.000 claims description 10
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 claims description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 8
- 235000011056 potassium acetate Nutrition 0.000 claims description 5
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 claims description 5
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 claims description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- 239000000155 melt Substances 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 5
- 235000011118 potassium hydroxide Nutrition 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 2
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical class OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- -1 dinitrodiphenyl ethers Chemical class 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 229940058287 salicylic acid derivative anticestodals Drugs 0.000 description 2
- 150000003872 salicylic acid derivatives Chemical class 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- FLJXVWVEYUFFQN-UHFFFAOYSA-N 2-phenoxy-3-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1OC1=CC=CC=C1 FLJXVWVEYUFFQN-UHFFFAOYSA-N 0.000 description 1
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K potassium phosphate Substances [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- WPFGFHJALYCVMO-UHFFFAOYSA-L rubidium carbonate Chemical compound [Rb+].[Rb+].[O-]C([O-])=O WPFGFHJALYCVMO-UHFFFAOYSA-L 0.000 description 1
- 229910000026 rubidium carbonate Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF52407A DE1290148B (de) | 1967-05-13 | 1967-05-13 | Verfahren zur Herstellung von 4, 4'-Dinitrodiphenylaether |
| CH648168A CH500149A (de) | 1967-05-13 | 1968-05-01 | Verfahren zur Herstellung substituierter Diaryläther |
| GB22226/68A GB1217762A (en) | 1967-05-13 | 1968-05-10 | Process for the preparation of substituted diaryl ethers |
| US728841A US3642866A (en) | 1967-05-13 | 1968-05-13 | Process for the preparation of substituted diaryl ethers |
| AT457368A AT282587B (de) | 1967-05-13 | 1968-05-13 | Verfahren zur Herstellung von substituierten Diaryläthern |
| SE06442/68A SE349561B (enExample) | 1967-05-13 | 1968-05-13 | |
| BE715051D BE715051A (enExample) | 1967-05-13 | 1968-05-13 | |
| FR1561896D FR1561896A (enExample) | 1967-05-13 | 1968-05-13 | |
| NL6806763A NL6806763A (enExample) | 1967-05-13 | 1968-05-13 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF52407A DE1290148B (de) | 1967-05-13 | 1967-05-13 | Verfahren zur Herstellung von 4, 4'-Dinitrodiphenylaether |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1290148B true DE1290148B (de) | 1969-03-06 |
Family
ID=7105427
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF52407A Pending DE1290148B (de) | 1967-05-13 | 1967-05-13 | Verfahren zur Herstellung von 4, 4'-Dinitrodiphenylaether |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3642866A (enExample) |
| AT (1) | AT282587B (enExample) |
| BE (1) | BE715051A (enExample) |
| CH (1) | CH500149A (enExample) |
| DE (1) | DE1290148B (enExample) |
| FR (1) | FR1561896A (enExample) |
| GB (1) | GB1217762A (enExample) |
| NL (1) | NL6806763A (enExample) |
| SE (1) | SE349561B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2524879A1 (fr) * | 1982-04-09 | 1983-10-14 | Inst Francais Du Petrole | Procede de preparation d'ethers d'aryle portant des substituants differents sur les deux noyaux aromatiques |
| EP0476785A1 (en) * | 1990-09-20 | 1992-03-25 | OSi Specialties, Inc. | Processes for the preparation of aminoethers |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA956974A (en) * | 1970-06-22 | 1974-10-29 | Yasunori Abe | Compounds having the herbicidal effect and the process for the manufacture thereof |
| DE2549036C3 (de) * | 1975-11-03 | 1979-01-18 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 4,4'-Dinitro-diphenylcarbonat |
| US5221798A (en) * | 1988-12-30 | 1993-06-22 | Amoco Corporation | Changing the regiopurity of mixtures containing 4,4'-disubstituted diphenyl carbonates |
| DE19747468C1 (de) * | 1997-10-28 | 1999-04-01 | Weatherford Oil Tool | Klemmvorrichtung zum Halten von Rohren |
| US8916731B2 (en) * | 2009-07-14 | 2014-12-23 | Ceramatec, Inc. | Dialkyl and diaryl ether production from metal alcoholate |
-
1967
- 1967-05-13 DE DEF52407A patent/DE1290148B/de active Pending
-
1968
- 1968-05-01 CH CH648168A patent/CH500149A/de not_active IP Right Cessation
- 1968-05-10 GB GB22226/68A patent/GB1217762A/en not_active Expired
- 1968-05-13 SE SE06442/68A patent/SE349561B/xx unknown
- 1968-05-13 AT AT457368A patent/AT282587B/de active
- 1968-05-13 BE BE715051D patent/BE715051A/xx unknown
- 1968-05-13 US US728841A patent/US3642866A/en not_active Expired - Lifetime
- 1968-05-13 NL NL6806763A patent/NL6806763A/xx unknown
- 1968-05-13 FR FR1561896D patent/FR1561896A/fr not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2524879A1 (fr) * | 1982-04-09 | 1983-10-14 | Inst Francais Du Petrole | Procede de preparation d'ethers d'aryle portant des substituants differents sur les deux noyaux aromatiques |
| US4596680A (en) * | 1982-04-09 | 1986-06-24 | Institut Francais Du Petrole | Process for manufacturing aryl ethers having different substituents on the two aromatic rings |
| EP0476785A1 (en) * | 1990-09-20 | 1992-03-25 | OSi Specialties, Inc. | Processes for the preparation of aminoethers |
| US5214142A (en) * | 1990-09-20 | 1993-05-25 | Union Carbide Chemicals & Plastics Technology Corporation | Processes for the preparation of aminoethers |
Also Published As
| Publication number | Publication date |
|---|---|
| SE349561B (enExample) | 1972-10-02 |
| BE715051A (enExample) | 1968-09-30 |
| NL6806763A (enExample) | 1968-11-14 |
| US3642866A (en) | 1972-02-15 |
| CH500149A (de) | 1970-12-15 |
| GB1217762A (en) | 1970-12-31 |
| AT282587B (de) | 1970-07-10 |
| FR1561896A (enExample) | 1969-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1695753B2 (de) | Verfahren zur Herstellung von 6,6disubstituierten 2,2-Dimethyl-4-oxopiperidinen | |
| DE2909650C2 (enExample) | ||
| DE1290148B (de) | Verfahren zur Herstellung von 4, 4'-Dinitrodiphenylaether | |
| DE1593865C3 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemischen | |
| DE2004280B2 (de) | Verfahren zur Kristallisation von Vitamin D tief 3 | |
| EP0089417A1 (de) | Verfahren zur Herstellung von Phthalid | |
| DE1914565C3 (de) | Verfahren zur Herstellung von Alkalimetallsalzen aliphatischer Dicarbonsäuren oder der Ameisensäure | |
| DE1232944B (de) | Verfahren zur Herstellung von meso-2, 3-Dibrombernsteinsaeure | |
| EP0157225B1 (de) | Verfahren zur Herstellung von Benzimidazolyl,-Benzoxazolyl- und Benzthiazolyloxyphenoxypropionsäurederivaten | |
| DE2055494A1 (de) | Verfahren zur Herstellung von Thiobisphenolen | |
| DE2438542C3 (de) | Verfahren zur Herstellung von Diaminonaphthalinen | |
| DE862751C (de) | Verfahren zur Herstellung von Salicylsaeurederivaten | |
| EP0033762B1 (de) | Verfahren zur Herstellung von 1,2-Epoxycyclooctan | |
| DE1768890B2 (de) | Verfahren zur herstellung von 4-fluor- 3-nitroanilin | |
| DE890943C (de) | Verfahren zur Herstellung von mehrwertigen Alkoholen | |
| DE2012434C3 (de) | Verfahren zur Herstellung von mindestens 10 Ringglieder aufweisenden N-Alkyllactam | |
| DE912216C (de) | Verfahren zur Herstellung von Nicotinsaeureestern bzw. von Nicotinsaeure | |
| US1957089A (en) | Process of preparing nitro- | |
| DE2551498C2 (de) | Verfahren zur Herstellung von Dichlorophen | |
| DE1618023B1 (de) | Verfahren zur Herstellung von Dihydroxydiphenylsulfon | |
| EP0084329B1 (de) | Verfahren zur Herstellung von 1,4-Bis-(dicyanomethylen)-cyclohexan | |
| DE1935725C3 (de) | Verfahren zur Herstellung von Chlorphenylestern | |
| DE2536689C3 (de) | Verfahren zur Herstellung von Melamin aus Cyanamid und/oder Dicyandiamid | |
| DE3347526A1 (de) | Verfahren zur herstellung substituierter chinazolin-2.4(1h.3h)-dione | |
| DE1643329C3 (de) | Verfahren zur Herstellung von Nitroaminodiarylathern |